+{% endblock %}
diff --git a/FLASK PROJECTS/E-commerce/templates/checkout.html b/FLASK PROJECTS/E-commerce/templates/checkout.html
new file mode 100644
index 00000000..b7f3d350
--- /dev/null
+++ b/FLASK PROJECTS/E-commerce/templates/checkout.html
@@ -0,0 +1,57 @@
+{% extends "layout.html" %}
+
+{% block title %}
+ Check Out
+{% endblock %}
+
+{% block main %}
+
+
+{% endblock %}
diff --git a/FLASK PROJECTS/E-commerce/templates/index.html b/FLASK PROJECTS/E-commerce/templates/index.html
new file mode 100644
index 00000000..3a517b55
--- /dev/null
+++ b/FLASK PROJECTS/E-commerce/templates/index.html
@@ -0,0 +1,51 @@
+{% extends "layout.html" %}
+
+{% block title %}
+ Index
+{% endblock %}
+
+{% block main %}
+
+
+{% endblock %}
diff --git a/FLASK PROJECTS/E-commerce/templates/layout.html b/FLASK PROJECTS/E-commerce/templates/layout.html
new file mode 100644
index 00000000..51aac114
--- /dev/null
+++ b/FLASK PROJECTS/E-commerce/templates/layout.html
@@ -0,0 +1,96 @@
+
+
+
+
+
+
+
+
+ {% if get_flashed_messages() %}
+
+
+ {% endif %}
+
+
+
+
+
+
+
+ {% endif %}
+
+
+
{% block main %}{% endblock %}
+
+
+
+
+
diff --git a/FLASK PROJECTS/E-commerce/templates/login.html b/FLASK PROJECTS/E-commerce/templates/login.html
new file mode 100644
index 00000000..0828b901
--- /dev/null
+++ b/FLASK PROJECTS/E-commerce/templates/login.html
@@ -0,0 +1,44 @@
+{% extends "layout.html" %}
+
+{% block title %}
+ Log In
+{% endblock %}
+
+{% block main %}
+
+
+
+
+
+{% endblock %}
+
diff --git a/FLASK PROJECTS/E-commerce/templates/payment.html b/FLASK PROJECTS/E-commerce/templates/payment.html
new file mode 100644
index 00000000..66172d1f
--- /dev/null
+++ b/FLASK PROJECTS/E-commerce/templates/payment.html
@@ -0,0 +1,38 @@
+{% extends "layout.html" %}
+
+{% block title %}
+ Payment
+{% endblock %}
+
+{% block main %}
+
+
+
+
+
+{% endblock %}
diff --git a/FLASK PROJECTS/E-commerce/templates/productdetails.html b/FLASK PROJECTS/E-commerce/templates/productdetails.html
new file mode 100644
index 00000000..0e9863e8
--- /dev/null
+++ b/FLASK PROJECTS/E-commerce/templates/productdetails.html
@@ -0,0 +1,74 @@
+{% extends "layout.html" %}
+
+{% block title %}
+ productdetails
+{% endblock %}
+
+{% block main %}
+
+
+
+
+
+
+
+
+ {% for detail in details %}
+
+
+
{{ detail.name }}
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Details:
+
{{ detail.description }}
+
Price: {{ detail.price|usd }}
+ {% if session["user_id"] %}
+
+
+
+
+
+
+
+
+
+
+
+
+{% endblock %}
diff --git a/FLASK PROJECTS/E-commerce/templates/profile.html b/FLASK PROJECTS/E-commerce/templates/profile.html
new file mode 100644
index 00000000..c8ac8428
--- /dev/null
+++ b/FLASK PROJECTS/E-commerce/templates/profile.html
@@ -0,0 +1,89 @@
+{% extends "layout.html" %}
+
+{% block title %}
+ Profile
+{% endblock %}
+
+{% block main %}
+
+
+
+
+
+
+
+
+
Personal Information
+
+
Username: {{ user_data["username"] }}
+
+
+
+
+
+ address
+ city
+ postal code
+ phone number
+
+
+
+
+ {% if not orders %}
+
+ No information available.
+
+ {% else %}
+
+ {% for order in orders %}
+
+ {{ order.address }}
+ {{ order.city }}
+ {{ order.postal_code }}
+ {{ order.phone_number }}
+
+ {% endfor %}
+ {% endif %}
+
+
+
+
+
+
Your Order History
+
+
+
+
+ Order Number
+ Order Date
+ Total Amount
+
+
+
+
+ {% if not orders %}
+
+ No order history available.
+
+ {% else %}
+
+ {% for order in orders %}
+
+ {{ order.id }}
+ {{ order.history }}
+ {% endfor %}
+
+ {{ total_amount|usd }}
+
+ {% endif %}
+
+
+
+
Remove Account
+
Check cart
+
+
+
+
+
+{% endblock %}
diff --git a/FLASK PROJECTS/E-commerce/templates/register.html b/FLASK PROJECTS/E-commerce/templates/register.html
new file mode 100644
index 00000000..43251030
--- /dev/null
+++ b/FLASK PROJECTS/E-commerce/templates/register.html
@@ -0,0 +1,43 @@
+{% extends "layout.html" %}
+
+{% block title %}
+ register
+{% endblock %}
+
+{% block main %}
+
+
+
+
+
+{% endblock %}
diff --git a/FLASK PROJECTS/Excel to Firebase/main.py b/FLASK PROJECTS/Excel to Firebase/main.py
index e168a1ce..eb2ccda0 100644
--- a/FLASK PROJECTS/Excel to Firebase/main.py
+++ b/FLASK PROJECTS/Excel to Firebase/main.py
@@ -11,19 +11,19 @@
from firebase import Firebase
import os
-firebaseConfig = {
- "apiKey": "your apikey",
- "authDomain": "",
- "databaseURL": "database url",
- "projectId": "your project id",
- "storageBucket": "your storage bucket id",
- "messagingSenderId": "your sender id",
- "appId": "your appId",
- "measurementId": "your measurement id"
-};
-firebase = Firebase(firebaseConfig)
+firebase_config = {
+ "apiKey": "your apiKey",
+ "authDomain": "",
+ "databaseURL": "database url",
+ "projectId": "your project id",
+ "storageBucket": "your storage bucket id",
+ "messagingSenderId": "your sender id",
+ "appId": "your appId",
+ "measurementId": "your measurement id"
+}
+firebase = Firebase(firebase_config)
db = firebase.database()
-list_of_keys=[]
+
app = Flask(__name__)
diff --git a/GAMES/sudoku_solver/readme.md b/GAMES/sudoku_solver/readme.md
new file mode 100644
index 00000000..c4730c4f
--- /dev/null
+++ b/GAMES/sudoku_solver/readme.md
@@ -0,0 +1,28 @@
+## Sudoku Solver GUI
+
+# Overview
+This is a simple Sudoku Solver implemented in Python with a graphical user interface (GUI) using the Tkinter library. The Sudoku Solver allows you to input a Sudoku puzzle and then solves it using a backtracking algorithm. You can visualize the solution step by step on the GUI.
+
+# Features
+Interactive GUI: The Sudoku Solver features a user-friendly interface built with Tkinter, allowing you to input Sudoku puzzles and visualize the solution.
+Backtracking Algorithm: The Sudoku Solver uses a backtracking algorithm to find the solution to the input puzzle.
+Step-by-Step Solution: You can click the "Solve" button to start solving the Sudoku puzzle step by step, and observe how the solver fills in the cells.
+
+# How to Run
+Make sure you have Python installed on your system.
+Clone this repository or download the sudoku_solver.py file.
+Open a terminal or command prompt and navigate to the directory containing sudoku_solver.py.
+Run the command python sudoku_solver.py.
+The Sudoku Solver GUI window will open, allowing you to input Sudoku puzzles and visualize the solution.
+
+# How to Use
+When the Sudoku Solver GUI window opens, you'll see a 9x9 grid representing the Sudoku puzzle.
+enter value row by row in terminal ,empty space is denote by '0'.
+After entering the puzzle, click the "Solve" button to start solving the Sudoku puzzle.
+You can observe how the solver fills in the cells step by step. Once the puzzle is solved, you'll see the complete solution on the GUI.
+Additional Notes
+The Sudoku Solver uses a backtracking algorithm to find the solution to the puzzle. It tries different numbers in each cell and backtracks if it reaches a dead-end.
+You can input any valid Sudoku puzzle into the solver, and it will find the solution if one exists.
+If there are multiple solutions to the puzzle, the solver will find one of them.
+The GUI provides visual feedback on the solution process, making it easy to understand how the solver works.
+Enjoy using the Sudoku Solver GUI!
\ No newline at end of file
diff --git a/GAMES/sudoku_solver/sudoku_solver.py b/GAMES/sudoku_solver/sudoku_solver.py
new file mode 100644
index 00000000..1047dc5c
--- /dev/null
+++ b/GAMES/sudoku_solver/sudoku_solver.py
@@ -0,0 +1,88 @@
+import tkinter as tk
+
+class SudokuSolverGUI:
+ def __init__(self, master):
+ self.master = master
+ self.master.title("Sudoku Solver")
+ self.board = [[0 for _ in range(9)] for _ in range(9)]
+ self.input_sudoku()
+ self.create_widgets()
+
+ def input_sudoku(self):
+ print("Enter the Sudoku puzzle values row by row:")
+ for i in range(9):
+ row_input = input().split()
+ for j in range(9):
+ self.board[i][j] = int(row_input[j])
+
+ def create_widgets(self):
+ self.canvas = tk.Canvas(self.master, width=450, height=450, bg="white")
+ self.canvas.pack()
+
+ for i in range(10):
+ line_width = 2 if i % 3 == 0 else 1
+ self.canvas.create_line(50 * i, 0, 50 * i, 450, width=line_width)
+ self.canvas.create_line(0, 50 * i, 450, 50 * i, width=line_width)
+
+ for i in range(9):
+ for j in range(9):
+ value = self.board[i][j]
+ if value != 0:
+ x, y = j * 50 + 25, i * 50 + 25
+ self.canvas.create_text(x, y, text=str(value), font=("Arial", 14, "bold"))
+
+ self.solve_button = tk.Button(self.master, text="Solve", command=self.solve_sudoku)
+ self.solve_button.pack()
+
+ def solve_sudoku(self):
+ self.solve_button.config(state="disabled")
+ self.solve()
+
+ def solve(self):
+ empty_cell = self.find_empty_cell()
+ if not empty_cell:
+ self.solve_button.config(state="normal")
+ return True
+
+ row, col = empty_cell
+ for num in range(1, 10):
+ if self.is_valid_move(num, row, col):
+ self.board[row][col] = num
+ self.update_cell(row, col, num)
+ if self.solve():
+ return True
+ self.board[row][col] = 0
+ self.update_cell(row, col, 0)
+ return False
+
+ def find_empty_cell(self):
+ for i in range(9):
+ for j in range(9):
+ if self.board[i][j] == 0:
+ return i, j
+ return None
+
+ def is_valid_move(self, num, row, col):
+ for i in range(9):
+ if self.board[row][i] == num or self.board[i][col] == num:
+ return False
+ start_row, start_col = 3 * (row // 3), 3 * (col // 3)
+ for i in range(start_row, start_row + 3):
+ for j in range(start_col, start_col + 3):
+ if self.board[i][j] == num:
+ return False
+ return True
+
+ def update_cell(self, row, col, num):
+ x, y = col * 50 + 25, row * 50 + 25
+ self.canvas.delete(f"number_{row}_{col}")
+ if num != 0:
+ self.canvas.create_text(x, y, text=str(num), font=("Arial", 14, "bold"), tags=f"number_{row}_{col}")
+
+def main():
+ root = tk.Tk()
+ app = SudokuSolverGUI(root)
+ root.mainloop()
+
+if __name__ == "__main__":
+ main()
diff --git a/INVESTMENT_RULES/README.md b/INVESTMENT_RULES/README.md
new file mode 100644
index 00000000..99198579
--- /dev/null
+++ b/INVESTMENT_RULES/README.md
@@ -0,0 +1,28 @@
+# List of python scripts that auomates calculation of really handful of Investment Rules.
+
+## 1. What Is the Rule of 72?
+ The Rule of 72 is a simple way to determine how long an investment will take to double given a fixed annual rate of interest. Dividing 72 by the annual rate of return gives investors a rough estimate of how many years it will take for the initial investment to duplicate itself.
+
+### Key takeaways
+ The Rule of 72 is not precise, but is a quick way to get a useful ballpark figure.
+ For investments without a fixed rate of return, you can instead divide 72 by the number of years you hope it will take to double your money. This will give you an estimate of the annual rate of return you’ll need to achieve that goal.
+ The calculation is most accurate for rates of return of about 5% to 10%.
+ For more precise outcomes, divide 69.3 by the rate of return. While not as easy to do in one’s head, it is more accurate.
+
+### How the Rule of 72 Works
+ For example, the Rule of 72 states that $1 invested at an annual fixed interest rate of 10% would take 7.2 years ((72 ÷ 10) = 7.2) to grow to $2.
+
+For more details refer https://www.investopedia.com/ask/answers/what-is-the-rule-72/
+
+## 2. Real Rate of Return adjusted to Inflation
+ You know that investments have to do more than keep pace with inflation for you to build wealth. As Golden says,
+ “A dollar today is not worth a dollar in the future.” But how do you determine what your investment return is after inflation?
+ This equation helps you compute your real return, or your return adjusted for inflation.
+
+ For example, if an investment returns 8 percent, and inflation is 3 percent, this is how you’d set up the problem:
+ [ ( 1.08 ÷ 1.03 ) - 1 ] x 100 = 4.85 percent real return
+
+ “You’re losing to inflation every year,” says Charles Sachs, a wealth manager at Kaufman Rossin Wealth in Miami.
+ “Long term, inflation runs about 3 percent. So your money buys half as much in 20 years.”
+
+ Learn more here--> https://finance.yahoo.com/news/6-investment-formulas-financial-success-172744221.html
\ No newline at end of file
diff --git a/INVESTMENT_RULES/inflation_adjusted_return.py b/INVESTMENT_RULES/inflation_adjusted_return.py
new file mode 100644
index 00000000..6a59cd2f
--- /dev/null
+++ b/INVESTMENT_RULES/inflation_adjusted_return.py
@@ -0,0 +1,18 @@
+Inflation_Adjsted_Return_Summary = """
+Learn More about this investment rule in README.md located in INVESTMENT_RULES folder**
+ """
+
+print(Inflation_Adjsted_Return_Summary)
+
+# Get the Avg Investment Rate of Return and Avg Inflation Rate
+invest_rate_return = float(input("What is expected average Rate of Return (don't use % sign): "))/100
+avg_inflration_rate = float(input("What is your avg inflation rate?: "))/100
+
+
+def inflation_adjusted_return(invest_rate_return, avg_inflration_rate):
+ # Simple formula is : ((1 + Investment return percentage) / (1 + Inflation rate percentage) - 1) x 100
+ inflration_adjusted_return_val = (((1 +invest_rate_return )/(1 +avg_inflration_rate)) - 1) * 100
+ return inflration_adjusted_return_val
+
+real_return = round(inflation_adjusted_return(invest_rate_return, avg_inflration_rate),2)
+print(f"Your Actual Rate of Return adjusted to the inflation is {real_return}%. Not {invest_rate_return*100}% ")
\ No newline at end of file
diff --git a/INVESTMENT_RULES/rule_of_72.py b/INVESTMENT_RULES/rule_of_72.py
new file mode 100644
index 00000000..f1b4f1f3
--- /dev/null
+++ b/INVESTMENT_RULES/rule_of_72.py
@@ -0,0 +1,11 @@
+# Get Aannual fixed interest rate
+fixed_interest_rate = input("Please enter the Annual Fixed interest rate (don't use % sign): ")
+
+
+def calculate_time_taken_to_double(fixed_interest_rate):
+ # A simple formula calulate the time it takes to double an investment.
+ time_taken = 72/float(fixed_interest_rate)
+ return time_taken
+
+time_taken_to_double = round(calculate_time_taken_to_double(fixed_interest_rate),2)
+print(f"Your investment will take {time_taken_to_double} year(s) to double!")
\ No newline at end of file
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/README.md b/MachineLearning Projects/Driver-Drowsiness-Detection/README.md
new file mode 100644
index 00000000..1c381cbb
--- /dev/null
+++ b/MachineLearning Projects/Driver-Drowsiness-Detection/README.md
@@ -0,0 +1,107 @@
+
+# Driver Drowsiness Detection
+
+A system that alarms the driver as soon as it detects that the driver is becoming drowsy to prevent any accidents.
+
+
+
+## Quick Start 🚀
+
+### Clone the Repository
+
+```sh
+git clone https://github.com/adityajai25/driver-drowsiness-detection.git
+```
+Then
+
+```sh
+cd driver-drowsiness-detection
+```
+
+
+## Dataset
+
+We used a dataset downloaded from Kaggle.
+## Creating Virtual Environment
+
+Using a virtual environment isolates dependencies, manages library versions, keeps the global Python environment clean, and ensures consistent setups.
+
+### On Windows
+
+#### Creating a virtual environment:
+
+Open Command Prompt and navigate to the project directory
+
+```sh
+cd project/directory/
+
+```
+Create a Virtual Environment:
+```sh
+python -m venv env
+```
+To Activate the Virtual Environment:
+
+```sh
+.\env\Scripts\activate
+```
+
+### On mac/Linux
+
+#### Creating a virtual environment:
+Open terminal and navigate to the project directory
+
+```sh
+cd project/directory/
+
+```
+Create a Virtual Environment:
+```sh
+python -m venv env
+```
+To Activate the Virtual Environment:
+
+```sh
+source env/bin/activate
+```
+
+
+## Installing Required Packages
+
+Once the virtual environment is activated, install the required packages using the following commands:
+
+#### 1. Install pygame
+
+```sh
+pip install pygame==2.4.0
+```
+#### 2. Install openCV-Python
+
+```sh
+pip install opencv-python==4.6.0.66
+```
+#### 3. Install numpy
+
+```sh
+pip install numpy==1.23.0
+```
+#### 4. Install keras
+
+```sh
+pip install keras==2.12.0
+```
+#### 5. Install tensorflow
+
+```sh
+pip install tensorflow==2.13.0
+```
+
+
+## Execution
+After installing the packages required, the project can be executed using the following command.
+
+```sh
+python main.py
+```
+
+This will initiate the application, and it may take a few moments to activate the webcam and begin detection.
\ No newline at end of file
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/alarm.wav b/MachineLearning Projects/Driver-Drowsiness-Detection/alarm.wav
new file mode 100644
index 00000000..f7bf38c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/alarm.wav differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_107.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_107.jpg
new file mode 100644
index 00000000..95534c11
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_107.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_115.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_115.jpg
new file mode 100644
index 00000000..fbab9c09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_115.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_116.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_116.jpg
new file mode 100644
index 00000000..0aea1438
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_116.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_120.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_120.jpg
new file mode 100644
index 00000000..d9b18d8a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_120.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_129.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_129.jpg
new file mode 100644
index 00000000..62d2cf1d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_129.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_130.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_130.jpg
new file mode 100644
index 00000000..3553cf51
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_130.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_132.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_132.jpg
new file mode 100644
index 00000000..3cd4fd1a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_132.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_137.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_137.jpg
new file mode 100644
index 00000000..dfa7fb14
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_137.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_14.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_14.jpg
new file mode 100644
index 00000000..f8da3ebc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_14.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_148.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_148.jpg
new file mode 100644
index 00000000..2c7038c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_148.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_152.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_152.jpg
new file mode 100644
index 00000000..817ef970
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_152.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_159.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_159.jpg
new file mode 100644
index 00000000..f93c9f62
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_159.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_161.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_161.jpg
new file mode 100644
index 00000000..9b1eba08
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_161.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_163.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_163.jpg
new file mode 100644
index 00000000..7edc426b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_163.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_164.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_164.jpg
new file mode 100644
index 00000000..a5f7ce38
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_164.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_167.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_167.jpg
new file mode 100644
index 00000000..e9bfdddc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_167.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_168.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_168.jpg
new file mode 100644
index 00000000..f43f7bc5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_168.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_169.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_169.jpg
new file mode 100644
index 00000000..00390902
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_169.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_172.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_172.jpg
new file mode 100644
index 00000000..824cd597
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_172.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_181.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_181.jpg
new file mode 100644
index 00000000..a891185e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_181.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_195.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_195.jpg
new file mode 100644
index 00000000..a4997c03
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_195.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_197.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_197.jpg
new file mode 100644
index 00000000..d8dab71c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_197.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_20.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_20.jpg
new file mode 100644
index 00000000..cbc57f00
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_20.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_211.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_211.jpg
new file mode 100644
index 00000000..abcc429a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_211.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_214.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_214.jpg
new file mode 100644
index 00000000..86bb11ee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_214.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_216.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_216.jpg
new file mode 100644
index 00000000..31396026
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_216.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_219.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_219.jpg
new file mode 100644
index 00000000..853fabc8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_219.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_221.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_221.jpg
new file mode 100644
index 00000000..3c6308b7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_221.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_226.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_226.jpg
new file mode 100644
index 00000000..b896ba54
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_226.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_231.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_231.jpg
new file mode 100644
index 00000000..eb76e8cc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_231.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_240.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_240.jpg
new file mode 100644
index 00000000..6141bda7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_240.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_242.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_242.jpg
new file mode 100644
index 00000000..ce32350d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_242.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_243.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_243.jpg
new file mode 100644
index 00000000..5d4372ac
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_243.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_253.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_253.jpg
new file mode 100644
index 00000000..ff424869
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_253.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_257.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_257.jpg
new file mode 100644
index 00000000..20c2bf07
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_257.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_26.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_26.jpg
new file mode 100644
index 00000000..49bd59e7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_26.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_260.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_260.jpg
new file mode 100644
index 00000000..c59d75f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_260.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_279.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_279.jpg
new file mode 100644
index 00000000..ab38a752
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_279.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_28.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_28.jpg
new file mode 100644
index 00000000..7ca5bc81
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_28.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_284.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_284.jpg
new file mode 100644
index 00000000..b6dc7724
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_284.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_287.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_287.jpg
new file mode 100644
index 00000000..16ece593
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_287.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_298.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_298.jpg
new file mode 100644
index 00000000..d50195dd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_298.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_3.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_3.jpg
new file mode 100644
index 00000000..05444719
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_3.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_302.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_302.jpg
new file mode 100644
index 00000000..9654bd95
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_302.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_31.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_31.jpg
new file mode 100644
index 00000000..c6fce67d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_31.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_32.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_32.jpg
new file mode 100644
index 00000000..d545309f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_32.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_326.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_326.jpg
new file mode 100644
index 00000000..2d767bd0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_326.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_330.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_330.jpg
new file mode 100644
index 00000000..a5a5eb15
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_330.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_332.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_332.jpg
new file mode 100644
index 00000000..95761d25
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_332.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_340.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_340.jpg
new file mode 100644
index 00000000..0d32b7c6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_340.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_347.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_347.jpg
new file mode 100644
index 00000000..a526f279
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_347.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_348.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_348.jpg
new file mode 100644
index 00000000..56015be0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_348.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_359.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_359.jpg
new file mode 100644
index 00000000..db83f56f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_359.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_363.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_363.jpg
new file mode 100644
index 00000000..a76fb274
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_363.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_373.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_373.jpg
new file mode 100644
index 00000000..b6a81eaa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_373.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_383.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_383.jpg
new file mode 100644
index 00000000..e6868e75
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_383.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_413.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_413.jpg
new file mode 100644
index 00000000..7a8aa1ef
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_413.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_416.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_416.jpg
new file mode 100644
index 00000000..fe651aa7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_416.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_434.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_434.jpg
new file mode 100644
index 00000000..32f6992d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_434.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_439.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_439.jpg
new file mode 100644
index 00000000..bb0bf5a8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_439.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_441.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_441.jpg
new file mode 100644
index 00000000..c0337c89
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_441.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_442.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_442.jpg
new file mode 100644
index 00000000..8b375de6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_442.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_447.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_447.jpg
new file mode 100644
index 00000000..c5518a1f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_447.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_45.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_45.jpg
new file mode 100644
index 00000000..a034c2e5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_45.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_451.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_451.jpg
new file mode 100644
index 00000000..754202d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_451.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_46.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_46.jpg
new file mode 100644
index 00000000..1b16ddb2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_46.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_495.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_495.jpg
new file mode 100644
index 00000000..7fe98619
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_495.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_497.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_497.jpg
new file mode 100644
index 00000000..000fc5e3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_497.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_498.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_498.jpg
new file mode 100644
index 00000000..474588cc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_498.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_506.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_506.jpg
new file mode 100644
index 00000000..a70f8284
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_506.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_514.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_514.jpg
new file mode 100644
index 00000000..6dbe9a2c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_514.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_515.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_515.jpg
new file mode 100644
index 00000000..3a08e036
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_515.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_529.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_529.jpg
new file mode 100644
index 00000000..a7212007
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_529.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_534.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_534.jpg
new file mode 100644
index 00000000..d762dfce
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_534.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_538.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_538.jpg
new file mode 100644
index 00000000..9a7b93b5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_538.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_541.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_541.jpg
new file mode 100644
index 00000000..3aaa6400
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_541.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_542.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_542.jpg
new file mode 100644
index 00000000..9d060b52
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_542.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_559.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_559.jpg
new file mode 100644
index 00000000..9df14853
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_559.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_568.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_568.jpg
new file mode 100644
index 00000000..c5a48db3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_568.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_58.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_58.jpg
new file mode 100644
index 00000000..8a6baafc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_58.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_584.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_584.jpg
new file mode 100644
index 00000000..59f26988
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_584.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_585.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_585.jpg
new file mode 100644
index 00000000..8eb010c5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_585.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_586.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_586.jpg
new file mode 100644
index 00000000..f06463f7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_586.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_59.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_59.jpg
new file mode 100644
index 00000000..b7fe32c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_59.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_597.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_597.jpg
new file mode 100644
index 00000000..4625a47f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_597.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_605.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_605.jpg
new file mode 100644
index 00000000..0474273b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_605.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_608.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_608.jpg
new file mode 100644
index 00000000..2da1081c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_608.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_609.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_609.jpg
new file mode 100644
index 00000000..68c06826
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_609.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_61.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_61.jpg
new file mode 100644
index 00000000..ddd7d89b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_61.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_618.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_618.jpg
new file mode 100644
index 00000000..4639e40d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_618.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_624.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_624.jpg
new file mode 100644
index 00000000..5bef33a9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_624.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_634.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_634.jpg
new file mode 100644
index 00000000..a4c3d10f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_634.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_639.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_639.jpg
new file mode 100644
index 00000000..b3427698
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_639.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_64.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_64.jpg
new file mode 100644
index 00000000..f292ddf0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_64.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_650.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_650.jpg
new file mode 100644
index 00000000..ead175d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_650.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_656.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_656.jpg
new file mode 100644
index 00000000..b4ce9bec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_656.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_666.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_666.jpg
new file mode 100644
index 00000000..08d811ec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_666.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_667.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_667.jpg
new file mode 100644
index 00000000..19bc7322
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_667.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_679.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_679.jpg
new file mode 100644
index 00000000..87cfca28
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_679.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_687.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_687.jpg
new file mode 100644
index 00000000..a410e224
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_687.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_7.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_7.jpg
new file mode 100644
index 00000000..f0c743ba
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_7.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_710.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_710.jpg
new file mode 100644
index 00000000..7e1c53a5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_710.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_718.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_718.jpg
new file mode 100644
index 00000000..fe75d327
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_718.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_719.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_719.jpg
new file mode 100644
index 00000000..5998f5b1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_719.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_72.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_72.jpg
new file mode 100644
index 00000000..6959fdb3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_72.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_76.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_76.jpg
new file mode 100644
index 00000000..7341f78b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_76.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_77.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_77.jpg
new file mode 100644
index 00000000..4b206357
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_77.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_95.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_95.jpg
new file mode 100644
index 00000000..c7a64f5a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_95.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_96.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_96.jpg
new file mode 100644
index 00000000..cf786bc5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Closed/_96.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_107.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_107.jpg
new file mode 100644
index 00000000..b9441400
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_107.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_115.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_115.jpg
new file mode 100644
index 00000000..8ce7d581
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_115.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_116.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_116.jpg
new file mode 100644
index 00000000..7a988e84
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_116.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_120.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_120.jpg
new file mode 100644
index 00000000..e095fad1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_120.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_129.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_129.jpg
new file mode 100644
index 00000000..5b744395
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_129.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_130.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_130.jpg
new file mode 100644
index 00000000..2f811d14
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_130.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_132.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_132.jpg
new file mode 100644
index 00000000..b144d5f1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_132.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_137.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_137.jpg
new file mode 100644
index 00000000..230239cf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_137.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_14.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_14.jpg
new file mode 100644
index 00000000..9890a1da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_14.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_148.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_148.jpg
new file mode 100644
index 00000000..bf3ca310
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_148.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_152.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_152.jpg
new file mode 100644
index 00000000..75fcd163
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_152.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_159.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_159.jpg
new file mode 100644
index 00000000..0bec031f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_159.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_161.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_161.jpg
new file mode 100644
index 00000000..5ec57657
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_161.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_163.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_163.jpg
new file mode 100644
index 00000000..42da2c4a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_163.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_164.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_164.jpg
new file mode 100644
index 00000000..3f9d20fa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_164.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_167.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_167.jpg
new file mode 100644
index 00000000..2e9f32b6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_167.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_168.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_168.jpg
new file mode 100644
index 00000000..17afe72a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_168.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_169.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_169.jpg
new file mode 100644
index 00000000..3c488176
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_169.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_172.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_172.jpg
new file mode 100644
index 00000000..de2064d0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_172.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_181.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_181.jpg
new file mode 100644
index 00000000..7badc668
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_181.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_195.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_195.jpg
new file mode 100644
index 00000000..65ce150f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_195.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_197.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_197.jpg
new file mode 100644
index 00000000..93eaaf8f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_197.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_20.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_20.jpg
new file mode 100644
index 00000000..542f8293
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_20.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_211.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_211.jpg
new file mode 100644
index 00000000..307bf2f1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_211.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_214.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_214.jpg
new file mode 100644
index 00000000..46ad923d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_214.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_216.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_216.jpg
new file mode 100644
index 00000000..7d4659c3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_216.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_219.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_219.jpg
new file mode 100644
index 00000000..ba5f684e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_219.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_221.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_221.jpg
new file mode 100644
index 00000000..bccd959a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_221.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_226.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_226.jpg
new file mode 100644
index 00000000..249a6d93
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_226.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_231.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_231.jpg
new file mode 100644
index 00000000..18abee51
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_231.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_240.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_240.jpg
new file mode 100644
index 00000000..702e0b99
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_240.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_242.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_242.jpg
new file mode 100644
index 00000000..706cfe54
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_242.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_243.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_243.jpg
new file mode 100644
index 00000000..932bd3bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_243.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_253.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_253.jpg
new file mode 100644
index 00000000..eecff9ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_253.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_257.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_257.jpg
new file mode 100644
index 00000000..b2c39d54
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_257.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_26.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_26.jpg
new file mode 100644
index 00000000..390751fe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_26.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_260.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_260.jpg
new file mode 100644
index 00000000..3d10e4f8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_260.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_279.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_279.jpg
new file mode 100644
index 00000000..41b40fa5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_279.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_28.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_28.jpg
new file mode 100644
index 00000000..35f56a57
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_28.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_284.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_284.jpg
new file mode 100644
index 00000000..4f57085b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_284.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_287.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_287.jpg
new file mode 100644
index 00000000..fe98c5f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_287.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_298.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_298.jpg
new file mode 100644
index 00000000..933c3c43
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_298.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_3.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_3.jpg
new file mode 100644
index 00000000..de80ec48
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_3.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_302.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_302.jpg
new file mode 100644
index 00000000..8998c411
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_302.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_31.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_31.jpg
new file mode 100644
index 00000000..5f06a071
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_31.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_32.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_32.jpg
new file mode 100644
index 00000000..73075749
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_32.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_326.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_326.jpg
new file mode 100644
index 00000000..60796042
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_326.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_330.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_330.jpg
new file mode 100644
index 00000000..e510be3e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_330.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_332.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_332.jpg
new file mode 100644
index 00000000..18883d0e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_332.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_340.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_340.jpg
new file mode 100644
index 00000000..c543f7e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_340.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_347.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_347.jpg
new file mode 100644
index 00000000..14c25550
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_347.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_348.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_348.jpg
new file mode 100644
index 00000000..2c83adc4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_348.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_359.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_359.jpg
new file mode 100644
index 00000000..d80e28e0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_359.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_363.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_363.jpg
new file mode 100644
index 00000000..8545a735
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_363.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_373.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_373.jpg
new file mode 100644
index 00000000..32da8279
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_373.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_383.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_383.jpg
new file mode 100644
index 00000000..9bc8bf2b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_383.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_413.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_413.jpg
new file mode 100644
index 00000000..69b302c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_413.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_416.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_416.jpg
new file mode 100644
index 00000000..430a1d83
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_416.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_434.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_434.jpg
new file mode 100644
index 00000000..ce73e390
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_434.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_439.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_439.jpg
new file mode 100644
index 00000000..8029a6b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_439.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_441.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_441.jpg
new file mode 100644
index 00000000..90503e02
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_441.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_442.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_442.jpg
new file mode 100644
index 00000000..2589dac0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_442.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_447.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_447.jpg
new file mode 100644
index 00000000..04673fa9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_447.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_45.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_45.jpg
new file mode 100644
index 00000000..45b8b687
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_45.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_451.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_451.jpg
new file mode 100644
index 00000000..886fa0de
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_451.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_46.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_46.jpg
new file mode 100644
index 00000000..28d65a3b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_46.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_495.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_495.jpg
new file mode 100644
index 00000000..8b866e12
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_495.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_497.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_497.jpg
new file mode 100644
index 00000000..a803a66a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_497.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_498.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_498.jpg
new file mode 100644
index 00000000..82f9a0bb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_498.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_506.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_506.jpg
new file mode 100644
index 00000000..233e44f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_506.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_514.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_514.jpg
new file mode 100644
index 00000000..57f425ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_514.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_515.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_515.jpg
new file mode 100644
index 00000000..6715e5f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_515.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_529.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_529.jpg
new file mode 100644
index 00000000..ef40195a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_529.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_534.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_534.jpg
new file mode 100644
index 00000000..3085efb8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_534.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_538.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_538.jpg
new file mode 100644
index 00000000..0313663e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_538.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_541.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_541.jpg
new file mode 100644
index 00000000..c1a19b42
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_541.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_542.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_542.jpg
new file mode 100644
index 00000000..57a39c5b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_542.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_559.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_559.jpg
new file mode 100644
index 00000000..3c219462
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_559.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_568.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_568.jpg
new file mode 100644
index 00000000..e8cf6e21
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_568.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_58.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_58.jpg
new file mode 100644
index 00000000..61889b7e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_58.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_584.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_584.jpg
new file mode 100644
index 00000000..1d6f61cb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_584.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_585.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_585.jpg
new file mode 100644
index 00000000..a9310140
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_585.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_586.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_586.jpg
new file mode 100644
index 00000000..0d02ee58
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_586.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_59.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_59.jpg
new file mode 100644
index 00000000..17f9040c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_59.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_597.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_597.jpg
new file mode 100644
index 00000000..dc54aaa9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_597.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_605.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_605.jpg
new file mode 100644
index 00000000..c9354b42
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_605.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_608.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_608.jpg
new file mode 100644
index 00000000..1246828b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_608.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_609.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_609.jpg
new file mode 100644
index 00000000..bd005978
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_609.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_61.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_61.jpg
new file mode 100644
index 00000000..fcc11f37
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_61.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_618.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_618.jpg
new file mode 100644
index 00000000..c9ae1f28
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_618.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_624.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_624.jpg
new file mode 100644
index 00000000..26f5d8cb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_624.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_634.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_634.jpg
new file mode 100644
index 00000000..b37cbded
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_634.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_639.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_639.jpg
new file mode 100644
index 00000000..b9ca172c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_639.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_64.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_64.jpg
new file mode 100644
index 00000000..8e71ef8e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_64.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_650.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_650.jpg
new file mode 100644
index 00000000..768e8f80
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_650.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_656.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_656.jpg
new file mode 100644
index 00000000..fad821c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_656.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_666.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_666.jpg
new file mode 100644
index 00000000..ecdf1024
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_666.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_667.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_667.jpg
new file mode 100644
index 00000000..cf8b5d20
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_667.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_679.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_679.jpg
new file mode 100644
index 00000000..bc453ea8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_679.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_687.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_687.jpg
new file mode 100644
index 00000000..a950b957
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_687.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_7.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_7.jpg
new file mode 100644
index 00000000..f98cd214
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_7.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_710.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_710.jpg
new file mode 100644
index 00000000..c0898b1d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_710.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_718.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_718.jpg
new file mode 100644
index 00000000..29f09192
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_718.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_719.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_719.jpg
new file mode 100644
index 00000000..3c754d77
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_719.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_72.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_72.jpg
new file mode 100644
index 00000000..16d3731c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_72.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_76.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_76.jpg
new file mode 100644
index 00000000..f3d7b596
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_76.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_77.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_77.jpg
new file mode 100644
index 00000000..83210e93
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_77.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_95.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_95.jpg
new file mode 100644
index 00000000..2802d582
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_95.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_96.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_96.jpg
new file mode 100644
index 00000000..fdecf4b8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/Open/_96.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1004.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1004.jpg
new file mode 100644
index 00000000..be0aa8af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1004.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1007.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1007.jpg
new file mode 100644
index 00000000..b87ff3d8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1007.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1010.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1010.jpg
new file mode 100644
index 00000000..1c56ff75
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1010.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1033.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1033.jpg
new file mode 100644
index 00000000..7b1485af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1033.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1044.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1044.jpg
new file mode 100644
index 00000000..1ccd7519
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1044.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1050.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1050.jpg
new file mode 100644
index 00000000..759566f2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1050.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1063.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1063.jpg
new file mode 100644
index 00000000..3647b4c3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1063.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1067.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1067.jpg
new file mode 100644
index 00000000..ea0c85b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1067.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1096.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1096.jpg
new file mode 100644
index 00000000..06bcb24c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1096.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1114.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1114.jpg
new file mode 100644
index 00000000..3689194b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1114.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1118.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1118.jpg
new file mode 100644
index 00000000..7c410f32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1118.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1129.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1129.jpg
new file mode 100644
index 00000000..7d8f79f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1129.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/113.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/113.jpg
new file mode 100644
index 00000000..9423e7e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/113.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1134.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1134.jpg
new file mode 100644
index 00000000..2f443bbb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1134.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/115.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/115.jpg
new file mode 100644
index 00000000..6007b010
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/115.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1213.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1213.jpg
new file mode 100644
index 00000000..efb477bb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1213.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1267.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1267.jpg
new file mode 100644
index 00000000..e6037297
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1267.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1268.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1268.jpg
new file mode 100644
index 00000000..344652a8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1268.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1323.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1323.jpg
new file mode 100644
index 00000000..3a0e6524
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1323.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1367.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1367.jpg
new file mode 100644
index 00000000..2bf8bb09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1367.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1368.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1368.jpg
new file mode 100644
index 00000000..ec8be2d9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1368.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1452.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1452.jpg
new file mode 100644
index 00000000..80bc95ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1452.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1459.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1459.jpg
new file mode 100644
index 00000000..4c79d41f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1459.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1486.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1486.jpg
new file mode 100644
index 00000000..66845322
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1486.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1536.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1536.jpg
new file mode 100644
index 00000000..be440d34
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1536.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1543.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1543.jpg
new file mode 100644
index 00000000..c78015f4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1543.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1544.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1544.jpg
new file mode 100644
index 00000000..4b5a71ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1544.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1558.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1558.jpg
new file mode 100644
index 00000000..5977ad45
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1558.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1566.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1566.jpg
new file mode 100644
index 00000000..384f72ec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1566.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1570.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1570.jpg
new file mode 100644
index 00000000..f7e596cc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1570.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1594.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1594.jpg
new file mode 100644
index 00000000..a1eb8e2a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1594.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1596.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1596.jpg
new file mode 100644
index 00000000..96f3db87
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1596.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1641.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1641.jpg
new file mode 100644
index 00000000..17f3e9be
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1641.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1643.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1643.jpg
new file mode 100644
index 00000000..ff0050a6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1643.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1771.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1771.jpg
new file mode 100644
index 00000000..87e94cca
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1771.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1862.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1862.jpg
new file mode 100644
index 00000000..975a26ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1862.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1863.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1863.jpg
new file mode 100644
index 00000000..34df674c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1863.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1897.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1897.jpg
new file mode 100644
index 00000000..659d1ea1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1897.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1898.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1898.jpg
new file mode 100644
index 00000000..8411c18d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1898.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1913.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1913.jpg
new file mode 100644
index 00000000..d74fa8e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1913.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1942.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1942.jpg
new file mode 100644
index 00000000..651a2bb5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1942.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1946.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1946.jpg
new file mode 100644
index 00000000..11a32488
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1946.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1947.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1947.jpg
new file mode 100644
index 00000000..0fff31ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1947.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1950.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1950.jpg
new file mode 100644
index 00000000..231c4556
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/1950.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2004.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2004.jpg
new file mode 100644
index 00000000..eb77af0a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2004.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2016.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2016.jpg
new file mode 100644
index 00000000..e22b99af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2016.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/205.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/205.jpg
new file mode 100644
index 00000000..42d5e04d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/205.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2059.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2059.jpg
new file mode 100644
index 00000000..edad0117
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2059.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2090.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2090.jpg
new file mode 100644
index 00000000..76db4b93
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2090.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2093.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2093.jpg
new file mode 100644
index 00000000..ce2af290
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2093.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2107.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2107.jpg
new file mode 100644
index 00000000..41af7426
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2107.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/211.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/211.jpg
new file mode 100644
index 00000000..69a3e1ee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/211.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2110.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2110.jpg
new file mode 100644
index 00000000..a70a4a52
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2110.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2197.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2197.jpg
new file mode 100644
index 00000000..db2c6fcb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2197.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2289.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2289.jpg
new file mode 100644
index 00000000..955f95ef
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2289.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2311.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2311.jpg
new file mode 100644
index 00000000..d5b8d83e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2311.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/233.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/233.jpg
new file mode 100644
index 00000000..9606ee70
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/233.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2346.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2346.jpg
new file mode 100644
index 00000000..fcd0d216
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2346.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2351.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2351.jpg
new file mode 100644
index 00000000..3626aeb4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2351.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2354.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2354.jpg
new file mode 100644
index 00000000..1220e390
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2354.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/237.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/237.jpg
new file mode 100644
index 00000000..a3050db1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/237.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/24.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/24.jpg
new file mode 100644
index 00000000..a900c9b9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/24.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2406.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2406.jpg
new file mode 100644
index 00000000..45b988a9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2406.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2408.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2408.jpg
new file mode 100644
index 00000000..cc1bf615
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2408.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2431.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2431.jpg
new file mode 100644
index 00000000..c14b13dd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2431.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2482.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2482.jpg
new file mode 100644
index 00000000..05b76810
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2482.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2511.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2511.jpg
new file mode 100644
index 00000000..24118bf5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2511.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2514.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2514.jpg
new file mode 100644
index 00000000..9ebe2815
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2514.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2541.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2541.jpg
new file mode 100644
index 00000000..6cdc063b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2541.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2542.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2542.jpg
new file mode 100644
index 00000000..ddb05067
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2542.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2548.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2548.jpg
new file mode 100644
index 00000000..b8a2ddf6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2548.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2577.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2577.jpg
new file mode 100644
index 00000000..aa4ad115
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2577.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2590.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2590.jpg
new file mode 100644
index 00000000..8eca0c66
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2590.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/26.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/26.jpg
new file mode 100644
index 00000000..610e9940
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/26.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2607.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2607.jpg
new file mode 100644
index 00000000..2ce3ee3b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2607.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2621.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2621.jpg
new file mode 100644
index 00000000..1d85228e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/2621.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/276.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/276.jpg
new file mode 100644
index 00000000..c75c722b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/276.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/29.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/29.jpg
new file mode 100644
index 00000000..a1b230b6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/29.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/291.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/291.jpg
new file mode 100644
index 00000000..10ce4989
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/291.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/461.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/461.jpg
new file mode 100644
index 00000000..d9bc110c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/461.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/470.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/470.jpg
new file mode 100644
index 00000000..508ce6bd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/470.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/487.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/487.jpg
new file mode 100644
index 00000000..ecbbd8a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/487.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/510.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/510.jpg
new file mode 100644
index 00000000..43826883
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/510.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/526.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/526.jpg
new file mode 100644
index 00000000..afa97613
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/526.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/548.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/548.jpg
new file mode 100644
index 00000000..5939e3f7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/548.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/551.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/551.jpg
new file mode 100644
index 00000000..b6d84a60
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/551.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/555.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/555.jpg
new file mode 100644
index 00000000..132e9e0a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/555.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/603.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/603.jpg
new file mode 100644
index 00000000..b226247d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/603.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/610.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/610.jpg
new file mode 100644
index 00000000..38b1fbcc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/610.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/616.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/616.jpg
new file mode 100644
index 00000000..a61a58c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/616.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/646.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/646.jpg
new file mode 100644
index 00000000..2e11fdf4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/646.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/702.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/702.jpg
new file mode 100644
index 00000000..c443573e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/702.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/71.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/71.jpg
new file mode 100644
index 00000000..8478f75a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/71.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/728.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/728.jpg
new file mode 100644
index 00000000..1fb7a3f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/728.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/755.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/755.jpg
new file mode 100644
index 00000000..55caf8b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/755.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/756.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/756.jpg
new file mode 100644
index 00000000..9f2f3fa3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/756.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/771.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/771.jpg
new file mode 100644
index 00000000..6d25309a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/771.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/779.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/779.jpg
new file mode 100644
index 00000000..e45239fe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/779.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/830.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/830.jpg
new file mode 100644
index 00000000..29cad2ac
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/830.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/840.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/840.jpg
new file mode 100644
index 00000000..c31ff308
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/840.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/866.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/866.jpg
new file mode 100644
index 00000000..acd9823a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/866.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/896.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/896.jpg
new file mode 100644
index 00000000..5c7b4922
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/896.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/898.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/898.jpg
new file mode 100644
index 00000000..9256e549
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/898.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/900.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/900.jpg
new file mode 100644
index 00000000..d59f922f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/900.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/91.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/91.jpg
new file mode 100644
index 00000000..5d0e9d32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/91.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/958.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/958.jpg
new file mode 100644
index 00000000..36e25dd8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/958.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/959.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/959.jpg
new file mode 100644
index 00000000..70f0d6c7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/959.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/963.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/963.jpg
new file mode 100644
index 00000000..572266a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/963.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/976.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/976.jpg
new file mode 100644
index 00000000..e0f58ef1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/no_yawn/976.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/100.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/100.jpg
new file mode 100644
index 00000000..d0f6598d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/100.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/102.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/102.jpg
new file mode 100644
index 00000000..8d6c2ca7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/102.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/105.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/105.jpg
new file mode 100644
index 00000000..4b89ce3f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/105.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/111.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/111.jpg
new file mode 100644
index 00000000..12950d98
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/111.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/116.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/116.jpg
new file mode 100644
index 00000000..58417a3b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/116.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/119.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/119.jpg
new file mode 100644
index 00000000..fbcaeac8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/119.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/121.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/121.jpg
new file mode 100644
index 00000000..6e6d474b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/121.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/122.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/122.jpg
new file mode 100644
index 00000000..2788ff06
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/122.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/127.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/127.jpg
new file mode 100644
index 00000000..03f41b6c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/127.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/131.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/131.jpg
new file mode 100644
index 00000000..1e241de2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/131.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/134.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/134.jpg
new file mode 100644
index 00000000..1112fc18
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/134.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/14.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/14.jpg
new file mode 100644
index 00000000..43720aa8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/14.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/140.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/140.jpg
new file mode 100644
index 00000000..7d95ae91
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/140.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/145.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/145.jpg
new file mode 100644
index 00000000..37a785fc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/145.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/148.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/148.jpg
new file mode 100644
index 00000000..135a1568
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/148.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/160.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/160.jpg
new file mode 100644
index 00000000..091fa54c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/160.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/168.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/168.jpg
new file mode 100644
index 00000000..77d9acf9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/168.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/169.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/169.jpg
new file mode 100644
index 00000000..1000341e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/169.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/177.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/177.jpg
new file mode 100644
index 00000000..f8139b9d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/177.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/188.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/188.jpg
new file mode 100644
index 00000000..769fdf19
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/188.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/189.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/189.jpg
new file mode 100644
index 00000000..0303b700
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/189.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/205.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/205.jpg
new file mode 100644
index 00000000..d96a50d6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/205.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/206.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/206.jpg
new file mode 100644
index 00000000..b94b8312
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/206.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/214.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/214.jpg
new file mode 100644
index 00000000..41c4fbf2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/214.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/229.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/229.jpg
new file mode 100644
index 00000000..9f03989d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/229.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/233.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/233.jpg
new file mode 100644
index 00000000..248c452b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/233.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/234.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/234.jpg
new file mode 100644
index 00000000..8f5b6ea0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/234.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/235.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/235.jpg
new file mode 100644
index 00000000..a304af8e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/235.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/239.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/239.jpg
new file mode 100644
index 00000000..24936cc3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/239.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/240.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/240.jpg
new file mode 100644
index 00000000..e629d6a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/240.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/248.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/248.jpg
new file mode 100644
index 00000000..6ae78a4a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/248.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/249.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/249.jpg
new file mode 100644
index 00000000..ce498d98
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/249.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/257.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/257.jpg
new file mode 100644
index 00000000..f2acd0f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/257.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/259.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/259.jpg
new file mode 100644
index 00000000..47f1eee7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/259.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/286.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/286.jpg
new file mode 100644
index 00000000..67174c66
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/286.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/305.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/305.jpg
new file mode 100644
index 00000000..fc8d17e8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/305.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/306.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/306.jpg
new file mode 100644
index 00000000..78cdcea6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/306.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/318.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/318.jpg
new file mode 100644
index 00000000..69cd1641
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/318.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/319.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/319.jpg
new file mode 100644
index 00000000..24668b26
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/319.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/322.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/322.jpg
new file mode 100644
index 00000000..7bc876ad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/322.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/331.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/331.jpg
new file mode 100644
index 00000000..9f2678ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/331.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/332.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/332.jpg
new file mode 100644
index 00000000..f9a6c719
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/332.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/333.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/333.jpg
new file mode 100644
index 00000000..bc14074c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/333.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/336.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/336.jpg
new file mode 100644
index 00000000..2b842ed0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/336.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/349.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/349.jpg
new file mode 100644
index 00000000..4aebdf1f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/349.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/357.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/357.jpg
new file mode 100644
index 00000000..e9e0e602
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/357.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/362.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/362.jpg
new file mode 100644
index 00000000..6e5e235f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/362.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/366.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/366.jpg
new file mode 100644
index 00000000..2ba68962
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/366.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/379.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/379.jpg
new file mode 100644
index 00000000..4d26be0a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/379.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/381.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/381.jpg
new file mode 100644
index 00000000..95006bac
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/381.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/382.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/382.jpg
new file mode 100644
index 00000000..c42e2014
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/382.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/385.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/385.jpg
new file mode 100644
index 00000000..0c9916ef
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/385.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/386.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/386.jpg
new file mode 100644
index 00000000..f3a1531b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/386.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/409.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/409.jpg
new file mode 100644
index 00000000..6aacb3ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/409.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/443.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/443.jpg
new file mode 100644
index 00000000..677fceb3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/443.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/451.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/451.jpg
new file mode 100644
index 00000000..c572b0be
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/451.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/455.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/455.jpg
new file mode 100644
index 00000000..ca5aa84f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/455.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/461.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/461.jpg
new file mode 100644
index 00000000..bc7d9847
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/461.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/465.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/465.jpg
new file mode 100644
index 00000000..07aaf393
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/465.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/466.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/466.jpg
new file mode 100644
index 00000000..5f26a7df
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/466.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/47.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/47.jpg
new file mode 100644
index 00000000..76ec2f85
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/47.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/477.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/477.jpg
new file mode 100644
index 00000000..bcf80949
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/477.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/480.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/480.jpg
new file mode 100644
index 00000000..6dc3414e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/480.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/482.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/482.jpg
new file mode 100644
index 00000000..ad99b1c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/482.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/49.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/49.jpg
new file mode 100644
index 00000000..d3528419
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/49.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/505.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/505.jpg
new file mode 100644
index 00000000..fe05fcd9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/505.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/511.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/511.jpg
new file mode 100644
index 00000000..9dbf20a9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/511.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/513.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/513.jpg
new file mode 100644
index 00000000..9f5522bb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/513.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/526.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/526.jpg
new file mode 100644
index 00000000..4bd9cfd7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/526.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/527.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/527.jpg
new file mode 100644
index 00000000..f545cc6f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/527.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/529.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/529.jpg
new file mode 100644
index 00000000..eba3600c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/529.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/538.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/538.jpg
new file mode 100644
index 00000000..220247ba
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/538.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/547.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/547.jpg
new file mode 100644
index 00000000..fd358b15
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/547.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/548.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/548.jpg
new file mode 100644
index 00000000..6c7645ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/548.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/551.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/551.jpg
new file mode 100644
index 00000000..9dcaf840
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/551.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/554.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/554.jpg
new file mode 100644
index 00000000..b392c2ee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/554.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/559.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/559.jpg
new file mode 100644
index 00000000..e1be965b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/559.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/563.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/563.jpg
new file mode 100644
index 00000000..6bc06d84
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/563.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/564.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/564.jpg
new file mode 100644
index 00000000..d34f2c9b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/564.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/602.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/602.jpg
new file mode 100644
index 00000000..a234a02d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/602.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/606.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/606.jpg
new file mode 100644
index 00000000..8602e77f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/606.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/61.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/61.jpg
new file mode 100644
index 00000000..aa0dc459
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/61.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/619.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/619.jpg
new file mode 100644
index 00000000..e651e14c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/619.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/622.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/622.jpg
new file mode 100644
index 00000000..971a9484
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/622.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/63.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/63.jpg
new file mode 100644
index 00000000..a5e9fd25
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/63.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/630.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/630.jpg
new file mode 100644
index 00000000..2e0bbd75
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/630.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/632.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/632.jpg
new file mode 100644
index 00000000..d3b103f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/632.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/649.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/649.jpg
new file mode 100644
index 00000000..ea5c843c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/649.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/652.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/652.jpg
new file mode 100644
index 00000000..15566e4e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/652.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/662.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/662.jpg
new file mode 100644
index 00000000..89027b14
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/662.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/676.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/676.jpg
new file mode 100644
index 00000000..82de7b79
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/676.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/678.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/678.jpg
new file mode 100644
index 00000000..206bd7da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/678.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/681.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/681.jpg
new file mode 100644
index 00000000..6dcbc4d5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/681.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/686.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/686.jpg
new file mode 100644
index 00000000..1417fcb8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/686.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/707.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/707.jpg
new file mode 100644
index 00000000..d91d1da5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/707.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/709.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/709.jpg
new file mode 100644
index 00000000..a5cce8f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/709.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/711.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/711.jpg
new file mode 100644
index 00000000..3a49ede1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/711.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/715.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/715.jpg
new file mode 100644
index 00000000..493c32ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/715.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/719.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/719.jpg
new file mode 100644
index 00000000..b4d513c0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/719.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/720.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/720.jpg
new file mode 100644
index 00000000..92ba67e4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/720.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/721.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/721.jpg
new file mode 100644
index 00000000..e7761974
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/721.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/725.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/725.jpg
new file mode 100644
index 00000000..b7ae7b81
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/725.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/81.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/81.jpg
new file mode 100644
index 00000000..e9eaefcb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/81.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/84.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/84.jpg
new file mode 100644
index 00000000..fc40aa2a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/84.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/86.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/86.jpg
new file mode 100644
index 00000000..a1896910
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/86.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/95.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/95.jpg
new file mode 100644
index 00000000..306934d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/test/yawn/95.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_0.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_0.jpg
new file mode 100644
index 00000000..0c8bfebf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_0.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_1.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_1.jpg
new file mode 100644
index 00000000..af8e943c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_1.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_10.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_10.jpg
new file mode 100644
index 00000000..f871cfff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_10.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_100.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_100.jpg
new file mode 100644
index 00000000..16cf7d7a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_100.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_101.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_101.jpg
new file mode 100644
index 00000000..b3bef0d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_101.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_102.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_102.jpg
new file mode 100644
index 00000000..7062cf9b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_102.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_103.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_103.jpg
new file mode 100644
index 00000000..eef51f37
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_103.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_104.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_104.jpg
new file mode 100644
index 00000000..e5107d86
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_104.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_105.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_105.jpg
new file mode 100644
index 00000000..6ae96e7b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_105.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_106.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_106.jpg
new file mode 100644
index 00000000..721241c5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_106.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_108.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_108.jpg
new file mode 100644
index 00000000..239d45f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_108.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_109.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_109.jpg
new file mode 100644
index 00000000..675ac03e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_109.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_11.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_11.jpg
new file mode 100644
index 00000000..77f79bb3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_11.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_110.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_110.jpg
new file mode 100644
index 00000000..bbc0579e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_110.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_111.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_111.jpg
new file mode 100644
index 00000000..2baa1a9b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_111.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_112.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_112.jpg
new file mode 100644
index 00000000..3f6f9063
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_112.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_113.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_113.jpg
new file mode 100644
index 00000000..988a06c3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_113.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_114.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_114.jpg
new file mode 100644
index 00000000..e43b1352
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_114.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_117.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_117.jpg
new file mode 100644
index 00000000..dd739109
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_117.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_118.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_118.jpg
new file mode 100644
index 00000000..ca6ee31f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_118.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_119.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_119.jpg
new file mode 100644
index 00000000..307fcd29
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_119.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_12.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_12.jpg
new file mode 100644
index 00000000..5fb27e8d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_12.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_121.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_121.jpg
new file mode 100644
index 00000000..6d0a2f57
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_121.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_122.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_122.jpg
new file mode 100644
index 00000000..328749e0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_122.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_123.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_123.jpg
new file mode 100644
index 00000000..bd1a0564
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_123.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_124.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_124.jpg
new file mode 100644
index 00000000..0c58fa6c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_124.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_125.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_125.jpg
new file mode 100644
index 00000000..111277a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_125.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_126.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_126.jpg
new file mode 100644
index 00000000..9380554b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_126.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_127.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_127.jpg
new file mode 100644
index 00000000..1959307f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_127.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_128.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_128.jpg
new file mode 100644
index 00000000..2392b0b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_128.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_13.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_13.jpg
new file mode 100644
index 00000000..58d9484f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_13.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_131.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_131.jpg
new file mode 100644
index 00000000..f7ac5e74
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_131.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_133.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_133.jpg
new file mode 100644
index 00000000..9da7cee7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_133.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_134.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_134.jpg
new file mode 100644
index 00000000..f549253f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_134.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_135.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_135.jpg
new file mode 100644
index 00000000..b307682a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_135.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_136.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_136.jpg
new file mode 100644
index 00000000..a9190e6f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_136.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_138.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_138.jpg
new file mode 100644
index 00000000..6940a750
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_138.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_139.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_139.jpg
new file mode 100644
index 00000000..e7f53e90
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_139.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_140.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_140.jpg
new file mode 100644
index 00000000..71ea3c89
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_140.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_141.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_141.jpg
new file mode 100644
index 00000000..9a4e3ed6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_141.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_142.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_142.jpg
new file mode 100644
index 00000000..6322b107
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_142.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_143.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_143.jpg
new file mode 100644
index 00000000..01ebea24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_143.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_144.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_144.jpg
new file mode 100644
index 00000000..60b1f11d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_144.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_145.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_145.jpg
new file mode 100644
index 00000000..e84bf378
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_145.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_146.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_146.jpg
new file mode 100644
index 00000000..cbd7f97f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_146.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_147.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_147.jpg
new file mode 100644
index 00000000..88d969f4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_147.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_149.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_149.jpg
new file mode 100644
index 00000000..4f269d87
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_149.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_15.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_15.jpg
new file mode 100644
index 00000000..9fd84f49
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_15.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_150.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_150.jpg
new file mode 100644
index 00000000..d9ba661f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_150.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_151.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_151.jpg
new file mode 100644
index 00000000..69c2f0ed
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_151.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_153.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_153.jpg
new file mode 100644
index 00000000..36fdfce0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_153.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_154.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_154.jpg
new file mode 100644
index 00000000..b2bfbbfa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_154.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_155.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_155.jpg
new file mode 100644
index 00000000..af1f0ebc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_155.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_156.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_156.jpg
new file mode 100644
index 00000000..4245ca8c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_156.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_157.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_157.jpg
new file mode 100644
index 00000000..b637fc30
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_157.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_158.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_158.jpg
new file mode 100644
index 00000000..6fd08542
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_158.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_16.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_16.jpg
new file mode 100644
index 00000000..89f2d559
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_16.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_160.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_160.jpg
new file mode 100644
index 00000000..66141b3c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_160.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_162.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_162.jpg
new file mode 100644
index 00000000..bdee0f22
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_162.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_165.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_165.jpg
new file mode 100644
index 00000000..57ca55fb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_165.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_166.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_166.jpg
new file mode 100644
index 00000000..3883e3f5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_166.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_17.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_17.jpg
new file mode 100644
index 00000000..6dacc486
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_17.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_170.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_170.jpg
new file mode 100644
index 00000000..b0cdcc46
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_170.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_171.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_171.jpg
new file mode 100644
index 00000000..40b38ee2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_171.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_173.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_173.jpg
new file mode 100644
index 00000000..67862f20
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_173.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_174.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_174.jpg
new file mode 100644
index 00000000..2b7bd021
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_174.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_175.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_175.jpg
new file mode 100644
index 00000000..8e5f6aa5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_175.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_176.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_176.jpg
new file mode 100644
index 00000000..0956e4da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_176.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_177.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_177.jpg
new file mode 100644
index 00000000..dc3b707c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_177.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_178.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_178.jpg
new file mode 100644
index 00000000..00b9cadd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_178.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_179.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_179.jpg
new file mode 100644
index 00000000..c6ec7eb4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_179.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_18.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_18.jpg
new file mode 100644
index 00000000..963426d0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_18.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_180.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_180.jpg
new file mode 100644
index 00000000..64c070b5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_180.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_182.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_182.jpg
new file mode 100644
index 00000000..9d294c5f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_182.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_183.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_183.jpg
new file mode 100644
index 00000000..eaf9e49d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_183.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_184.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_184.jpg
new file mode 100644
index 00000000..adc11e12
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_184.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_185.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_185.jpg
new file mode 100644
index 00000000..e388c399
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_185.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_186.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_186.jpg
new file mode 100644
index 00000000..879135d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_186.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_187.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_187.jpg
new file mode 100644
index 00000000..421d7673
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_187.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_188.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_188.jpg
new file mode 100644
index 00000000..3cc502ce
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_188.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_189.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_189.jpg
new file mode 100644
index 00000000..f0a74c95
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_189.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_19.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_19.jpg
new file mode 100644
index 00000000..0fba1013
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_19.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_190.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_190.jpg
new file mode 100644
index 00000000..571ec1d8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_190.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_191.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_191.jpg
new file mode 100644
index 00000000..dc2a3dd7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_191.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_192.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_192.jpg
new file mode 100644
index 00000000..3804aefa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_192.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_193.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_193.jpg
new file mode 100644
index 00000000..7fe9c66e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_193.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_194.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_194.jpg
new file mode 100644
index 00000000..21621af5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_194.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_196.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_196.jpg
new file mode 100644
index 00000000..a4bad9d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_196.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_198.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_198.jpg
new file mode 100644
index 00000000..de926084
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_198.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_199.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_199.jpg
new file mode 100644
index 00000000..50e13783
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_199.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_2.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_2.jpg
new file mode 100644
index 00000000..e5b2bdb2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_2.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_200.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_200.jpg
new file mode 100644
index 00000000..37b74e6d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_200.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_201.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_201.jpg
new file mode 100644
index 00000000..ad4e52b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_201.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_202.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_202.jpg
new file mode 100644
index 00000000..a592dc40
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_202.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_203.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_203.jpg
new file mode 100644
index 00000000..f9efcb56
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_203.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_204.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_204.jpg
new file mode 100644
index 00000000..89ab0192
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_204.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_205.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_205.jpg
new file mode 100644
index 00000000..e72df35a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_205.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_206.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_206.jpg
new file mode 100644
index 00000000..432178e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_206.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_207.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_207.jpg
new file mode 100644
index 00000000..03cac898
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_207.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_208.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_208.jpg
new file mode 100644
index 00000000..bd1fb9f4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_208.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_209.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_209.jpg
new file mode 100644
index 00000000..4f2df77f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_209.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_21.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_21.jpg
new file mode 100644
index 00000000..41d486c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_21.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_210.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_210.jpg
new file mode 100644
index 00000000..5de96e5e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_210.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_212.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_212.jpg
new file mode 100644
index 00000000..d108acd1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_212.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_213.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_213.jpg
new file mode 100644
index 00000000..d4218afe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_213.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_215.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_215.jpg
new file mode 100644
index 00000000..ac6f1614
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_215.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_217.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_217.jpg
new file mode 100644
index 00000000..d4f3fb73
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_217.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_218.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_218.jpg
new file mode 100644
index 00000000..93a94f3a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_218.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_22.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_22.jpg
new file mode 100644
index 00000000..795457a6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_22.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_220.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_220.jpg
new file mode 100644
index 00000000..3e0fbf5c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_220.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_222.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_222.jpg
new file mode 100644
index 00000000..76efbe4d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_222.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_223.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_223.jpg
new file mode 100644
index 00000000..e6a6fb2e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_223.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_224.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_224.jpg
new file mode 100644
index 00000000..c6e4e0cb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_224.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_225.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_225.jpg
new file mode 100644
index 00000000..2114349d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_225.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_227.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_227.jpg
new file mode 100644
index 00000000..740c3a60
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_227.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_228.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_228.jpg
new file mode 100644
index 00000000..6596856c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_228.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_229.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_229.jpg
new file mode 100644
index 00000000..604916fc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_229.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_23.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_23.jpg
new file mode 100644
index 00000000..7743de46
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_23.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_230.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_230.jpg
new file mode 100644
index 00000000..367d5ef3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_230.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_232.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_232.jpg
new file mode 100644
index 00000000..e8919363
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_232.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_233.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_233.jpg
new file mode 100644
index 00000000..025fb65a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_233.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_234.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_234.jpg
new file mode 100644
index 00000000..dffe45e7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_234.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_235.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_235.jpg
new file mode 100644
index 00000000..a01cc212
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_235.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_236.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_236.jpg
new file mode 100644
index 00000000..6e2d698f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_236.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_237.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_237.jpg
new file mode 100644
index 00000000..6d513543
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_237.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_238.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_238.jpg
new file mode 100644
index 00000000..f27671f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_238.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_239.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_239.jpg
new file mode 100644
index 00000000..cfabf890
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_239.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_24.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_24.jpg
new file mode 100644
index 00000000..4a22686e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_24.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_241.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_241.jpg
new file mode 100644
index 00000000..f7e49d0f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_241.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_244.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_244.jpg
new file mode 100644
index 00000000..79765355
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_244.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_245.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_245.jpg
new file mode 100644
index 00000000..ee8e8264
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_245.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_246.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_246.jpg
new file mode 100644
index 00000000..588690fd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_246.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_247.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_247.jpg
new file mode 100644
index 00000000..c5c971a3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_247.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_248.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_248.jpg
new file mode 100644
index 00000000..c59f8717
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_248.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_249.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_249.jpg
new file mode 100644
index 00000000..42cc6070
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_249.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_25.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_25.jpg
new file mode 100644
index 00000000..10055b61
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_25.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_250.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_250.jpg
new file mode 100644
index 00000000..6f5aed32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_250.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_251.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_251.jpg
new file mode 100644
index 00000000..075c0ffc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_251.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_252.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_252.jpg
new file mode 100644
index 00000000..3e135fad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_252.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_254.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_254.jpg
new file mode 100644
index 00000000..6e66a46b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_254.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_255.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_255.jpg
new file mode 100644
index 00000000..edc71d93
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_255.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_256.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_256.jpg
new file mode 100644
index 00000000..7507ff42
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_256.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_258.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_258.jpg
new file mode 100644
index 00000000..771a42a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_258.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_259.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_259.jpg
new file mode 100644
index 00000000..ef8d7ddd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_259.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_261.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_261.jpg
new file mode 100644
index 00000000..9052019e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_261.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_262.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_262.jpg
new file mode 100644
index 00000000..1fd1ce14
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_262.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_263.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_263.jpg
new file mode 100644
index 00000000..5d109820
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_263.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_264.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_264.jpg
new file mode 100644
index 00000000..09839588
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_264.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_265.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_265.jpg
new file mode 100644
index 00000000..5d8efc11
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_265.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_266.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_266.jpg
new file mode 100644
index 00000000..9f8fb791
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_266.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_267.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_267.jpg
new file mode 100644
index 00000000..4f139dfb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_267.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_268.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_268.jpg
new file mode 100644
index 00000000..37df68c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_268.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_269.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_269.jpg
new file mode 100644
index 00000000..3cf18b9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_269.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_27.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_27.jpg
new file mode 100644
index 00000000..ee60948a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_27.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_270.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_270.jpg
new file mode 100644
index 00000000..5096a6cb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_270.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_271.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_271.jpg
new file mode 100644
index 00000000..ecee5512
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_271.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_272.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_272.jpg
new file mode 100644
index 00000000..e4661773
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_272.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_273.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_273.jpg
new file mode 100644
index 00000000..b22d43f8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_273.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_274.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_274.jpg
new file mode 100644
index 00000000..45ca6d19
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_274.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_275.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_275.jpg
new file mode 100644
index 00000000..6161990b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_275.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_276.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_276.jpg
new file mode 100644
index 00000000..9fe6b7f5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_276.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_277.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_277.jpg
new file mode 100644
index 00000000..4fcc4d82
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_277.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_278.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_278.jpg
new file mode 100644
index 00000000..4346f5d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_278.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_280.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_280.jpg
new file mode 100644
index 00000000..65586c32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_280.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_281.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_281.jpg
new file mode 100644
index 00000000..0b2407e6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_281.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_282.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_282.jpg
new file mode 100644
index 00000000..46fa7e2c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_282.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_283.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_283.jpg
new file mode 100644
index 00000000..069f2c04
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_283.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_285.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_285.jpg
new file mode 100644
index 00000000..203c121e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_285.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_286.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_286.jpg
new file mode 100644
index 00000000..b14ececc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_286.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_288.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_288.jpg
new file mode 100644
index 00000000..e2b8df5d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_288.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_289.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_289.jpg
new file mode 100644
index 00000000..503d2952
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_289.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_29.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_29.jpg
new file mode 100644
index 00000000..95711bce
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_29.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_290.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_290.jpg
new file mode 100644
index 00000000..acae12b0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_290.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_291.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_291.jpg
new file mode 100644
index 00000000..91ba61f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_291.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_292.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_292.jpg
new file mode 100644
index 00000000..85585437
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_292.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_293.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_293.jpg
new file mode 100644
index 00000000..fd2cc623
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_293.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_294.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_294.jpg
new file mode 100644
index 00000000..10346c31
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_294.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_295.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_295.jpg
new file mode 100644
index 00000000..9b45a10d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_295.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_296.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_296.jpg
new file mode 100644
index 00000000..a0a82815
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_296.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_297.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_297.jpg
new file mode 100644
index 00000000..9c920c7d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_297.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_299.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_299.jpg
new file mode 100644
index 00000000..0df31358
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_299.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_30.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_30.jpg
new file mode 100644
index 00000000..f1dd9cda
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_30.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_300.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_300.jpg
new file mode 100644
index 00000000..a2d27e98
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_300.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_301.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_301.jpg
new file mode 100644
index 00000000..4ab6b694
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_301.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_303.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_303.jpg
new file mode 100644
index 00000000..f5d12f4d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_303.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_304.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_304.jpg
new file mode 100644
index 00000000..54118b67
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_304.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_305.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_305.jpg
new file mode 100644
index 00000000..a5a54caa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_305.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_306.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_306.jpg
new file mode 100644
index 00000000..74015896
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_306.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_307.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_307.jpg
new file mode 100644
index 00000000..45299083
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_307.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_308.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_308.jpg
new file mode 100644
index 00000000..370a7aa7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_308.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_309.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_309.jpg
new file mode 100644
index 00000000..848e355d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_309.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_310.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_310.jpg
new file mode 100644
index 00000000..279eb7de
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_310.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_311.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_311.jpg
new file mode 100644
index 00000000..3dd2e150
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_311.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_312.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_312.jpg
new file mode 100644
index 00000000..0c855e65
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_312.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_313.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_313.jpg
new file mode 100644
index 00000000..836a9047
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_313.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_314.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_314.jpg
new file mode 100644
index 00000000..be313822
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_314.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_315.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_315.jpg
new file mode 100644
index 00000000..d846fd9c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_315.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_316.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_316.jpg
new file mode 100644
index 00000000..60d558bb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_316.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_317.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_317.jpg
new file mode 100644
index 00000000..c8c25be5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_317.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_318.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_318.jpg
new file mode 100644
index 00000000..e6e28528
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_318.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_319.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_319.jpg
new file mode 100644
index 00000000..b1b2637f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_319.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_320.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_320.jpg
new file mode 100644
index 00000000..d9c75ed6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_320.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_321.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_321.jpg
new file mode 100644
index 00000000..b22e7216
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_321.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_322.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_322.jpg
new file mode 100644
index 00000000..fc2d4919
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_322.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_323.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_323.jpg
new file mode 100644
index 00000000..7c5d6ed8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_323.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_324.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_324.jpg
new file mode 100644
index 00000000..fe3432c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_324.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_325.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_325.jpg
new file mode 100644
index 00000000..2475a49b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_325.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_327.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_327.jpg
new file mode 100644
index 00000000..c29ed1b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_327.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_328.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_328.jpg
new file mode 100644
index 00000000..5979ea8e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_328.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_329.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_329.jpg
new file mode 100644
index 00000000..dfb157df
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_329.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_33.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_33.jpg
new file mode 100644
index 00000000..8d209ef3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_33.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_331.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_331.jpg
new file mode 100644
index 00000000..01b202bd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_331.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_333.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_333.jpg
new file mode 100644
index 00000000..1e507a5a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_333.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_334.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_334.jpg
new file mode 100644
index 00000000..a949f0f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_334.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_335.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_335.jpg
new file mode 100644
index 00000000..f3e0579b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_335.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_336.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_336.jpg
new file mode 100644
index 00000000..9205df24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_336.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_337.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_337.jpg
new file mode 100644
index 00000000..f0e89305
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_337.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_338.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_338.jpg
new file mode 100644
index 00000000..13fb9517
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_338.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_339.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_339.jpg
new file mode 100644
index 00000000..7efd4f1e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_339.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_34.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_34.jpg
new file mode 100644
index 00000000..b1b43c56
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_34.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_341.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_341.jpg
new file mode 100644
index 00000000..5f514506
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_341.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_342.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_342.jpg
new file mode 100644
index 00000000..97787989
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_342.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_343.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_343.jpg
new file mode 100644
index 00000000..43ea1141
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_343.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_344.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_344.jpg
new file mode 100644
index 00000000..8d61a90c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_344.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_345.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_345.jpg
new file mode 100644
index 00000000..93a41472
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_345.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_346.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_346.jpg
new file mode 100644
index 00000000..2628fccb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_346.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_349.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_349.jpg
new file mode 100644
index 00000000..1c870478
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_349.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_35.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_35.jpg
new file mode 100644
index 00000000..539f007b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_35.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_350.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_350.jpg
new file mode 100644
index 00000000..b0a0f39d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_350.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_351.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_351.jpg
new file mode 100644
index 00000000..5793377d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_351.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_352.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_352.jpg
new file mode 100644
index 00000000..afa0eab0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_352.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_353.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_353.jpg
new file mode 100644
index 00000000..11c6d6ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_353.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_354.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_354.jpg
new file mode 100644
index 00000000..cef5f684
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_354.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_355.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_355.jpg
new file mode 100644
index 00000000..99580a3a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_355.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_356.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_356.jpg
new file mode 100644
index 00000000..6ef3f853
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_356.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_357.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_357.jpg
new file mode 100644
index 00000000..73ab5a61
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_357.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_358.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_358.jpg
new file mode 100644
index 00000000..607a5b20
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_358.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_36.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_36.jpg
new file mode 100644
index 00000000..f61aa02a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_36.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_360.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_360.jpg
new file mode 100644
index 00000000..a5ee39b5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_360.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_361.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_361.jpg
new file mode 100644
index 00000000..14d7383d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_361.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_362.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_362.jpg
new file mode 100644
index 00000000..b4bc2037
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_362.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_364.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_364.jpg
new file mode 100644
index 00000000..be08a5e5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_364.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_365.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_365.jpg
new file mode 100644
index 00000000..23bc2439
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_365.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_366.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_366.jpg
new file mode 100644
index 00000000..71da05fa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_366.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_367.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_367.jpg
new file mode 100644
index 00000000..cba38973
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_367.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_368.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_368.jpg
new file mode 100644
index 00000000..88ccafa8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_368.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_369.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_369.jpg
new file mode 100644
index 00000000..05866dcd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_369.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_37.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_37.jpg
new file mode 100644
index 00000000..0e126ef2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_37.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_370.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_370.jpg
new file mode 100644
index 00000000..857c25f4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_370.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_371.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_371.jpg
new file mode 100644
index 00000000..3085e271
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_371.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_372.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_372.jpg
new file mode 100644
index 00000000..0a19f861
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_372.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_374.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_374.jpg
new file mode 100644
index 00000000..c6fd9e00
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_374.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_375.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_375.jpg
new file mode 100644
index 00000000..835759a5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_375.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_376.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_376.jpg
new file mode 100644
index 00000000..11cde2fe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_376.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_377.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_377.jpg
new file mode 100644
index 00000000..156b2871
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_377.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_378.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_378.jpg
new file mode 100644
index 00000000..801968a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_378.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_379.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_379.jpg
new file mode 100644
index 00000000..bff36669
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_379.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_38.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_38.jpg
new file mode 100644
index 00000000..4651de84
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_38.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_380.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_380.jpg
new file mode 100644
index 00000000..8c53d770
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_380.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_381.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_381.jpg
new file mode 100644
index 00000000..732d388b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_381.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_382.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_382.jpg
new file mode 100644
index 00000000..daaa6dec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_382.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_384.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_384.jpg
new file mode 100644
index 00000000..28b68217
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_384.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_385.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_385.jpg
new file mode 100644
index 00000000..e40d23f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_385.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_386.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_386.jpg
new file mode 100644
index 00000000..312035d4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_386.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_387.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_387.jpg
new file mode 100644
index 00000000..dcfebdd7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_387.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_388.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_388.jpg
new file mode 100644
index 00000000..e6f23cd3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_388.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_389.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_389.jpg
new file mode 100644
index 00000000..827ab5f2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_389.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_39.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_39.jpg
new file mode 100644
index 00000000..b28208ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_39.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_390.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_390.jpg
new file mode 100644
index 00000000..b9d07a45
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_390.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_391.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_391.jpg
new file mode 100644
index 00000000..dcca1eca
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_391.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_392.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_392.jpg
new file mode 100644
index 00000000..5db868c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_392.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_393.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_393.jpg
new file mode 100644
index 00000000..c654319d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_393.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_394.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_394.jpg
new file mode 100644
index 00000000..38f09db9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_394.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_395.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_395.jpg
new file mode 100644
index 00000000..a6ba0370
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_395.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_396.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_396.jpg
new file mode 100644
index 00000000..4398c5e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_396.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_397.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_397.jpg
new file mode 100644
index 00000000..9920a898
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_397.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_398.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_398.jpg
new file mode 100644
index 00000000..00ce4746
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_398.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_399.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_399.jpg
new file mode 100644
index 00000000..32c05d2e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_399.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_4.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_4.jpg
new file mode 100644
index 00000000..9e75320e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_4.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_40.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_40.jpg
new file mode 100644
index 00000000..7f6c3a40
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_40.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_400.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_400.jpg
new file mode 100644
index 00000000..0e2ebf0d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_400.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_401.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_401.jpg
new file mode 100644
index 00000000..b1c59d08
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_401.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_402.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_402.jpg
new file mode 100644
index 00000000..62237f32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_402.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_403.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_403.jpg
new file mode 100644
index 00000000..c505e5ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_403.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_404.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_404.jpg
new file mode 100644
index 00000000..0d94874c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_404.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_405.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_405.jpg
new file mode 100644
index 00000000..ec791e6f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_405.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_406.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_406.jpg
new file mode 100644
index 00000000..0eeec098
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_406.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_407.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_407.jpg
new file mode 100644
index 00000000..c87c3a33
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_407.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_408.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_408.jpg
new file mode 100644
index 00000000..980eef6e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_408.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_409.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_409.jpg
new file mode 100644
index 00000000..3257721d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_409.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_41.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_41.jpg
new file mode 100644
index 00000000..7ee77c03
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_41.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_410.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_410.jpg
new file mode 100644
index 00000000..c2cbeb11
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_410.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_411.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_411.jpg
new file mode 100644
index 00000000..4a65face
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_411.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_412.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_412.jpg
new file mode 100644
index 00000000..0c66e141
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_412.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_414.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_414.jpg
new file mode 100644
index 00000000..7189d522
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_414.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_415.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_415.jpg
new file mode 100644
index 00000000..1cb1eab8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_415.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_417.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_417.jpg
new file mode 100644
index 00000000..bd632aee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_417.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_418.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_418.jpg
new file mode 100644
index 00000000..f56982c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_418.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_419.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_419.jpg
new file mode 100644
index 00000000..70f773ef
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_419.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_42.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_42.jpg
new file mode 100644
index 00000000..647da747
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_42.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_420.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_420.jpg
new file mode 100644
index 00000000..8709c477
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_420.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_421.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_421.jpg
new file mode 100644
index 00000000..03276a9f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_421.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_422.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_422.jpg
new file mode 100644
index 00000000..ba2fb2ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_422.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_423.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_423.jpg
new file mode 100644
index 00000000..b140c4b7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_423.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_424.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_424.jpg
new file mode 100644
index 00000000..865a6491
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_424.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_425.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_425.jpg
new file mode 100644
index 00000000..7a3befd3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_425.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_426.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_426.jpg
new file mode 100644
index 00000000..5bff4b7c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_426.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_427.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_427.jpg
new file mode 100644
index 00000000..3584780d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_427.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_428.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_428.jpg
new file mode 100644
index 00000000..226fb089
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_428.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_429.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_429.jpg
new file mode 100644
index 00000000..ed93a06e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_429.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_43.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_43.jpg
new file mode 100644
index 00000000..72f353e8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_43.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_430.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_430.jpg
new file mode 100644
index 00000000..81636ff9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_430.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_431.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_431.jpg
new file mode 100644
index 00000000..4e5e829d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_431.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_432.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_432.jpg
new file mode 100644
index 00000000..4718fad1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_432.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_433.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_433.jpg
new file mode 100644
index 00000000..05ef2f21
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_433.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_435.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_435.jpg
new file mode 100644
index 00000000..074f039e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_435.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_436.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_436.jpg
new file mode 100644
index 00000000..912de671
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_436.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_437.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_437.jpg
new file mode 100644
index 00000000..09c52ad8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_437.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_438.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_438.jpg
new file mode 100644
index 00000000..3e2c0ed5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_438.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_44.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_44.jpg
new file mode 100644
index 00000000..348eb04e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_44.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_440.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_440.jpg
new file mode 100644
index 00000000..de1e47b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_440.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_443.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_443.jpg
new file mode 100644
index 00000000..7f2485dc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_443.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_444.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_444.jpg
new file mode 100644
index 00000000..e0b4eae9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_444.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_445.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_445.jpg
new file mode 100644
index 00000000..798df4f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_445.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_446.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_446.jpg
new file mode 100644
index 00000000..fec5018e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_446.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_448.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_448.jpg
new file mode 100644
index 00000000..2baa21a7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_448.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_449.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_449.jpg
new file mode 100644
index 00000000..fe335998
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_449.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_450.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_450.jpg
new file mode 100644
index 00000000..9feaa8f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_450.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_452.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_452.jpg
new file mode 100644
index 00000000..628c1696
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_452.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_453.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_453.jpg
new file mode 100644
index 00000000..05a220cf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_453.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_454.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_454.jpg
new file mode 100644
index 00000000..ba1fdead
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_454.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_455.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_455.jpg
new file mode 100644
index 00000000..22145816
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_455.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_456.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_456.jpg
new file mode 100644
index 00000000..6834ad10
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_456.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_457.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_457.jpg
new file mode 100644
index 00000000..e892b333
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_457.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_458.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_458.jpg
new file mode 100644
index 00000000..8530b9bd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_458.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_459.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_459.jpg
new file mode 100644
index 00000000..aa604e61
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_459.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_460.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_460.jpg
new file mode 100644
index 00000000..42c51850
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_460.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_461.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_461.jpg
new file mode 100644
index 00000000..89dc0266
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_461.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_462.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_462.jpg
new file mode 100644
index 00000000..55cd2798
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_462.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_463.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_463.jpg
new file mode 100644
index 00000000..691f75d5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_463.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_464.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_464.jpg
new file mode 100644
index 00000000..0e1c5436
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_464.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_465.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_465.jpg
new file mode 100644
index 00000000..4ed890a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_465.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_466.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_466.jpg
new file mode 100644
index 00000000..9d96d9dd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_466.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_467.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_467.jpg
new file mode 100644
index 00000000..37056884
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_467.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_468.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_468.jpg
new file mode 100644
index 00000000..94f047dd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_468.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_469.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_469.jpg
new file mode 100644
index 00000000..285621dd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_469.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_47.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_47.jpg
new file mode 100644
index 00000000..1087a337
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_47.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_470.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_470.jpg
new file mode 100644
index 00000000..87a18df5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_470.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_471.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_471.jpg
new file mode 100644
index 00000000..c0ab4c6a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_471.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_472.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_472.jpg
new file mode 100644
index 00000000..848ef1b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_472.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_473.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_473.jpg
new file mode 100644
index 00000000..c7eac7af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_473.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_474.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_474.jpg
new file mode 100644
index 00000000..d701ef6d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_474.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_475.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_475.jpg
new file mode 100644
index 00000000..bbb1ea02
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_475.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_476.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_476.jpg
new file mode 100644
index 00000000..01c06d29
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_476.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_477.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_477.jpg
new file mode 100644
index 00000000..34f72a21
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_477.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_478.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_478.jpg
new file mode 100644
index 00000000..bb0c00ec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_478.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_479.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_479.jpg
new file mode 100644
index 00000000..8620164a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_479.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_48.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_48.jpg
new file mode 100644
index 00000000..fa6ef6f5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_48.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_480.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_480.jpg
new file mode 100644
index 00000000..af9bac54
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_480.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_481.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_481.jpg
new file mode 100644
index 00000000..1a46d1cb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_481.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_482.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_482.jpg
new file mode 100644
index 00000000..b625fb1e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_482.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_483.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_483.jpg
new file mode 100644
index 00000000..9cd6679c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_483.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_484.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_484.jpg
new file mode 100644
index 00000000..7adbc2f1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_484.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_485.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_485.jpg
new file mode 100644
index 00000000..9ccf15c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_485.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_486.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_486.jpg
new file mode 100644
index 00000000..674c8245
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_486.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_487.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_487.jpg
new file mode 100644
index 00000000..417ce765
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_487.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_488.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_488.jpg
new file mode 100644
index 00000000..f3f78436
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_488.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_489.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_489.jpg
new file mode 100644
index 00000000..4d4dd3e8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_489.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_49.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_49.jpg
new file mode 100644
index 00000000..149fcba6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_49.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_490.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_490.jpg
new file mode 100644
index 00000000..bc2ff9f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_490.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_491.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_491.jpg
new file mode 100644
index 00000000..db16c0e7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_491.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_492.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_492.jpg
new file mode 100644
index 00000000..710771e6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_492.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_493.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_493.jpg
new file mode 100644
index 00000000..266fbe9c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_493.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_494.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_494.jpg
new file mode 100644
index 00000000..06d1a8a8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_494.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_496.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_496.jpg
new file mode 100644
index 00000000..4ab9f4ca
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_496.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_499.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_499.jpg
new file mode 100644
index 00000000..e3b2e77a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_499.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_5.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_5.jpg
new file mode 100644
index 00000000..ef909679
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_5.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_50.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_50.jpg
new file mode 100644
index 00000000..de4073c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_50.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_500.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_500.jpg
new file mode 100644
index 00000000..080d65c6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_500.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_501.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_501.jpg
new file mode 100644
index 00000000..038f932b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_501.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_502.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_502.jpg
new file mode 100644
index 00000000..b6c25ce3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_502.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_503.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_503.jpg
new file mode 100644
index 00000000..8f0c4b84
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_503.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_504.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_504.jpg
new file mode 100644
index 00000000..2157be8b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_504.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_505.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_505.jpg
new file mode 100644
index 00000000..b0b68e91
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_505.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_507.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_507.jpg
new file mode 100644
index 00000000..82a7aae6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_507.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_508.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_508.jpg
new file mode 100644
index 00000000..3dbe9976
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_508.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_509.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_509.jpg
new file mode 100644
index 00000000..92d9d3ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_509.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_51.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_51.jpg
new file mode 100644
index 00000000..4a7c6276
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_51.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_510.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_510.jpg
new file mode 100644
index 00000000..9a9b852b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_510.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_511.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_511.jpg
new file mode 100644
index 00000000..e539cb23
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_511.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_512.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_512.jpg
new file mode 100644
index 00000000..6c7035ce
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_512.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_513.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_513.jpg
new file mode 100644
index 00000000..04d235e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_513.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_516.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_516.jpg
new file mode 100644
index 00000000..18254b55
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_516.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_517.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_517.jpg
new file mode 100644
index 00000000..bd8a822a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_517.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_518.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_518.jpg
new file mode 100644
index 00000000..bf1e1eb9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_518.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_519.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_519.jpg
new file mode 100644
index 00000000..8a8064bb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_519.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_52.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_52.jpg
new file mode 100644
index 00000000..c56ddbb2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_52.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_520.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_520.jpg
new file mode 100644
index 00000000..52bbfcad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_520.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_521.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_521.jpg
new file mode 100644
index 00000000..08363e7f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_521.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_522.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_522.jpg
new file mode 100644
index 00000000..c233ee8b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_522.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_523.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_523.jpg
new file mode 100644
index 00000000..c513f455
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_523.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_524.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_524.jpg
new file mode 100644
index 00000000..51a51f5e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_524.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_525.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_525.jpg
new file mode 100644
index 00000000..54cb84c7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_525.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_526.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_526.jpg
new file mode 100644
index 00000000..7a368c9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_526.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_527.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_527.jpg
new file mode 100644
index 00000000..876f99bc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_527.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_528.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_528.jpg
new file mode 100644
index 00000000..33c04676
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_528.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_53.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_53.jpg
new file mode 100644
index 00000000..85b06eae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_53.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_530.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_530.jpg
new file mode 100644
index 00000000..2e633fb4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_530.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_531.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_531.jpg
new file mode 100644
index 00000000..25be223e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_531.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_532.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_532.jpg
new file mode 100644
index 00000000..48637633
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_532.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_533.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_533.jpg
new file mode 100644
index 00000000..333f4f1c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_533.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_535.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_535.jpg
new file mode 100644
index 00000000..7cb4b7b9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_535.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_536.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_536.jpg
new file mode 100644
index 00000000..a00d9f2a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_536.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_537.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_537.jpg
new file mode 100644
index 00000000..2ae89e10
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_537.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_539.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_539.jpg
new file mode 100644
index 00000000..87b76f37
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_539.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_54.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_54.jpg
new file mode 100644
index 00000000..73dc0340
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_54.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_540.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_540.jpg
new file mode 100644
index 00000000..240a63d5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_540.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_543.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_543.jpg
new file mode 100644
index 00000000..468aa36b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_543.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_544.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_544.jpg
new file mode 100644
index 00000000..2e78bfe5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_544.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_545.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_545.jpg
new file mode 100644
index 00000000..ebe1ba5b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_545.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_546.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_546.jpg
new file mode 100644
index 00000000..fc9effaf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_546.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_547.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_547.jpg
new file mode 100644
index 00000000..34005e77
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_547.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_548.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_548.jpg
new file mode 100644
index 00000000..a53e557e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_548.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_549.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_549.jpg
new file mode 100644
index 00000000..ce5e80ba
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_549.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_55.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_55.jpg
new file mode 100644
index 00000000..f95566e0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_55.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_550.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_550.jpg
new file mode 100644
index 00000000..558c5668
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_550.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_551.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_551.jpg
new file mode 100644
index 00000000..6ae2b855
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_551.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_552.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_552.jpg
new file mode 100644
index 00000000..143bb127
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_552.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_553.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_553.jpg
new file mode 100644
index 00000000..b2c7986d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_553.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_554.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_554.jpg
new file mode 100644
index 00000000..b47a0c62
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_554.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_555.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_555.jpg
new file mode 100644
index 00000000..ac08e097
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_555.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_556.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_556.jpg
new file mode 100644
index 00000000..fc8638a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_556.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_557.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_557.jpg
new file mode 100644
index 00000000..bf706097
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_557.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_558.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_558.jpg
new file mode 100644
index 00000000..37b4eaa4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_558.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_56.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_56.jpg
new file mode 100644
index 00000000..fd65863a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_56.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_560.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_560.jpg
new file mode 100644
index 00000000..649ab0dc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_560.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_561.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_561.jpg
new file mode 100644
index 00000000..72d2724b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_561.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_562.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_562.jpg
new file mode 100644
index 00000000..d8309307
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_562.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_563.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_563.jpg
new file mode 100644
index 00000000..627ac62e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_563.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_564.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_564.jpg
new file mode 100644
index 00000000..e732b9c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_564.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_565.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_565.jpg
new file mode 100644
index 00000000..7c041878
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_565.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_566.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_566.jpg
new file mode 100644
index 00000000..f54101d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_566.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_567.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_567.jpg
new file mode 100644
index 00000000..ccfbde88
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_567.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_569.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_569.jpg
new file mode 100644
index 00000000..648ffa6e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_569.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_57.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_57.jpg
new file mode 100644
index 00000000..8b749bf4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_57.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_570.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_570.jpg
new file mode 100644
index 00000000..c52e8d60
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_570.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_571.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_571.jpg
new file mode 100644
index 00000000..7f832b5f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_571.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_572.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_572.jpg
new file mode 100644
index 00000000..a8299f2b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_572.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_573.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_573.jpg
new file mode 100644
index 00000000..e6df4fc3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_573.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_574.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_574.jpg
new file mode 100644
index 00000000..1c315c3d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_574.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_575.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_575.jpg
new file mode 100644
index 00000000..ad1110ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_575.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_576.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_576.jpg
new file mode 100644
index 00000000..1912b40e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_576.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_577.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_577.jpg
new file mode 100644
index 00000000..045a81b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_577.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_578.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_578.jpg
new file mode 100644
index 00000000..9f396940
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_578.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_579.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_579.jpg
new file mode 100644
index 00000000..59008cab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_579.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_580.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_580.jpg
new file mode 100644
index 00000000..2e56a19f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_580.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_581.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_581.jpg
new file mode 100644
index 00000000..4ed6176a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_581.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_582.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_582.jpg
new file mode 100644
index 00000000..329ac885
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_582.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_583.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_583.jpg
new file mode 100644
index 00000000..3b892a59
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_583.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_587.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_587.jpg
new file mode 100644
index 00000000..71f946fb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_587.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_588.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_588.jpg
new file mode 100644
index 00000000..a915b4af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_588.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_589.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_589.jpg
new file mode 100644
index 00000000..a5437b0d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_589.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_590.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_590.jpg
new file mode 100644
index 00000000..ef1667e3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_590.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_591.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_591.jpg
new file mode 100644
index 00000000..546c1381
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_591.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_592.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_592.jpg
new file mode 100644
index 00000000..7fc0bf77
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_592.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_593.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_593.jpg
new file mode 100644
index 00000000..37e68d0e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_593.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_594.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_594.jpg
new file mode 100644
index 00000000..1e900e15
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_594.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_595.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_595.jpg
new file mode 100644
index 00000000..fb793d8a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_595.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_596.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_596.jpg
new file mode 100644
index 00000000..6cf6c906
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_596.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_598.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_598.jpg
new file mode 100644
index 00000000..37fc1431
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_598.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_599.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_599.jpg
new file mode 100644
index 00000000..5e523228
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_599.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_6.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_6.jpg
new file mode 100644
index 00000000..d905ffa9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_6.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_60.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_60.jpg
new file mode 100644
index 00000000..816d69c4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_60.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_600.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_600.jpg
new file mode 100644
index 00000000..338d207a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_600.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_601.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_601.jpg
new file mode 100644
index 00000000..761f52ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_601.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_602.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_602.jpg
new file mode 100644
index 00000000..f37b22a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_602.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_603.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_603.jpg
new file mode 100644
index 00000000..c8a71ed9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_603.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_604.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_604.jpg
new file mode 100644
index 00000000..43adf90e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_604.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_606.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_606.jpg
new file mode 100644
index 00000000..ad25dc9d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_606.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_607.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_607.jpg
new file mode 100644
index 00000000..3166daf2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_607.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_610.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_610.jpg
new file mode 100644
index 00000000..22c5df10
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_610.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_611.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_611.jpg
new file mode 100644
index 00000000..74016490
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_611.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_612.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_612.jpg
new file mode 100644
index 00000000..de7f4bec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_612.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_613.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_613.jpg
new file mode 100644
index 00000000..d3b30fb0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_613.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_614.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_614.jpg
new file mode 100644
index 00000000..741630c6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_614.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_615.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_615.jpg
new file mode 100644
index 00000000..37d56500
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_615.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_616.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_616.jpg
new file mode 100644
index 00000000..b5c5c352
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_616.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_617.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_617.jpg
new file mode 100644
index 00000000..ab7e6f0c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_617.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_619.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_619.jpg
new file mode 100644
index 00000000..b9cf356a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_619.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_62.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_62.jpg
new file mode 100644
index 00000000..63e84403
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_62.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_620.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_620.jpg
new file mode 100644
index 00000000..5a09dc13
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_620.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_621.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_621.jpg
new file mode 100644
index 00000000..5843869d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_621.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_622.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_622.jpg
new file mode 100644
index 00000000..40eca831
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_622.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_623.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_623.jpg
new file mode 100644
index 00000000..92371ed6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_623.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_625.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_625.jpg
new file mode 100644
index 00000000..07ebd501
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_625.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_626.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_626.jpg
new file mode 100644
index 00000000..17a36653
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_626.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_627.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_627.jpg
new file mode 100644
index 00000000..76eb382a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_627.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_628.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_628.jpg
new file mode 100644
index 00000000..e8d01dfc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_628.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_629.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_629.jpg
new file mode 100644
index 00000000..0ac3bd2f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_629.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_63.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_63.jpg
new file mode 100644
index 00000000..239a4ff7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_63.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_630.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_630.jpg
new file mode 100644
index 00000000..27e86515
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_630.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_631.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_631.jpg
new file mode 100644
index 00000000..1692f0ce
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_631.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_632.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_632.jpg
new file mode 100644
index 00000000..0e018cd8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_632.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_633.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_633.jpg
new file mode 100644
index 00000000..18520b8f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_633.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_635.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_635.jpg
new file mode 100644
index 00000000..3141de26
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_635.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_636.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_636.jpg
new file mode 100644
index 00000000..cd392dda
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_636.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_637.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_637.jpg
new file mode 100644
index 00000000..2b1d17ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_637.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_638.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_638.jpg
new file mode 100644
index 00000000..ab985c0d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_638.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_640.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_640.jpg
new file mode 100644
index 00000000..cbc62fde
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_640.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_641.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_641.jpg
new file mode 100644
index 00000000..98487b7b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_641.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_642.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_642.jpg
new file mode 100644
index 00000000..494ada19
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_642.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_643.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_643.jpg
new file mode 100644
index 00000000..dbfd4b54
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_643.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_644.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_644.jpg
new file mode 100644
index 00000000..6b4f9a9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_644.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_645.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_645.jpg
new file mode 100644
index 00000000..b6c8453c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_645.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_646.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_646.jpg
new file mode 100644
index 00000000..879837d4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_646.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_647.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_647.jpg
new file mode 100644
index 00000000..173c5895
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_647.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_648.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_648.jpg
new file mode 100644
index 00000000..9177f0cf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_648.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_649.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_649.jpg
new file mode 100644
index 00000000..3e6f0c9c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_649.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_65.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_65.jpg
new file mode 100644
index 00000000..6b512c63
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_65.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_651.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_651.jpg
new file mode 100644
index 00000000..cded7de9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_651.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_652.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_652.jpg
new file mode 100644
index 00000000..435334eb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_652.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_653.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_653.jpg
new file mode 100644
index 00000000..a8a8bbdf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_653.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_654.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_654.jpg
new file mode 100644
index 00000000..a0663de0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_654.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_655.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_655.jpg
new file mode 100644
index 00000000..1a12349e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_655.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_657.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_657.jpg
new file mode 100644
index 00000000..48e1347f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_657.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_658.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_658.jpg
new file mode 100644
index 00000000..445347e7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_658.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_659.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_659.jpg
new file mode 100644
index 00000000..57b17e90
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_659.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_66.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_66.jpg
new file mode 100644
index 00000000..81681b56
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_66.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_660.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_660.jpg
new file mode 100644
index 00000000..cd7bf968
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_660.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_661.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_661.jpg
new file mode 100644
index 00000000..afe6cd27
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_661.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_662.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_662.jpg
new file mode 100644
index 00000000..f03e5a7d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_662.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_663.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_663.jpg
new file mode 100644
index 00000000..39ebfd7a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_663.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_664.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_664.jpg
new file mode 100644
index 00000000..45ecac1a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_664.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_665.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_665.jpg
new file mode 100644
index 00000000..388937a3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_665.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_668.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_668.jpg
new file mode 100644
index 00000000..5dae1826
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_668.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_669.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_669.jpg
new file mode 100644
index 00000000..cd5bb758
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_669.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_67.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_67.jpg
new file mode 100644
index 00000000..807cf04a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_67.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_670.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_670.jpg
new file mode 100644
index 00000000..2052ff05
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_670.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_671.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_671.jpg
new file mode 100644
index 00000000..c2192541
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_671.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_672.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_672.jpg
new file mode 100644
index 00000000..c280bfaa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_672.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_673.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_673.jpg
new file mode 100644
index 00000000..5359d2c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_673.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_674.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_674.jpg
new file mode 100644
index 00000000..a9a3aa1f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_674.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_675.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_675.jpg
new file mode 100644
index 00000000..353c8635
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_675.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_676.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_676.jpg
new file mode 100644
index 00000000..714e2486
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_676.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_677.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_677.jpg
new file mode 100644
index 00000000..f88ca203
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_677.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_678.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_678.jpg
new file mode 100644
index 00000000..98d2d554
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_678.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_68.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_68.jpg
new file mode 100644
index 00000000..d5831706
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_68.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_680.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_680.jpg
new file mode 100644
index 00000000..e637fa7b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_680.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_681.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_681.jpg
new file mode 100644
index 00000000..23d78f4c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_681.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_682.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_682.jpg
new file mode 100644
index 00000000..958e50cb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_682.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_683.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_683.jpg
new file mode 100644
index 00000000..f853e00f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_683.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_684.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_684.jpg
new file mode 100644
index 00000000..9a6acd59
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_684.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_685.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_685.jpg
new file mode 100644
index 00000000..cfc4a9a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_685.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_686.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_686.jpg
new file mode 100644
index 00000000..647e665d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_686.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_688.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_688.jpg
new file mode 100644
index 00000000..3e4b87ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_688.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_689.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_689.jpg
new file mode 100644
index 00000000..d91dc834
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_689.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_69.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_69.jpg
new file mode 100644
index 00000000..37f5704a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_69.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_690.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_690.jpg
new file mode 100644
index 00000000..88cbf7e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_690.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_691.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_691.jpg
new file mode 100644
index 00000000..839a9ab7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_691.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_692.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_692.jpg
new file mode 100644
index 00000000..c6e3e515
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_692.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_693.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_693.jpg
new file mode 100644
index 00000000..8a574223
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_693.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_694.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_694.jpg
new file mode 100644
index 00000000..40740013
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_694.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_695.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_695.jpg
new file mode 100644
index 00000000..3604d4bc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_695.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_696.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_696.jpg
new file mode 100644
index 00000000..c60ed441
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_696.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_697.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_697.jpg
new file mode 100644
index 00000000..8af1ecc3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_697.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_698.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_698.jpg
new file mode 100644
index 00000000..3f4d8f9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_698.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_699.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_699.jpg
new file mode 100644
index 00000000..3fc0a1c0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_699.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_70.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_70.jpg
new file mode 100644
index 00000000..a1a7681d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_70.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_700.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_700.jpg
new file mode 100644
index 00000000..f117b853
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_700.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_701.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_701.jpg
new file mode 100644
index 00000000..4cba7bba
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_701.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_702.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_702.jpg
new file mode 100644
index 00000000..78fd9925
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_702.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_703.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_703.jpg
new file mode 100644
index 00000000..8d96edd3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_703.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_704.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_704.jpg
new file mode 100644
index 00000000..f8b79324
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_704.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_705.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_705.jpg
new file mode 100644
index 00000000..123c2423
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_705.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_706.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_706.jpg
new file mode 100644
index 00000000..9f075108
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_706.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_707.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_707.jpg
new file mode 100644
index 00000000..fef7dae1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_707.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_708.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_708.jpg
new file mode 100644
index 00000000..828ad77e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_708.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_709.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_709.jpg
new file mode 100644
index 00000000..faacdbf7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_709.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_71.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_71.jpg
new file mode 100644
index 00000000..db1b4d57
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_71.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_711.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_711.jpg
new file mode 100644
index 00000000..5da9b008
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_711.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_712.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_712.jpg
new file mode 100644
index 00000000..3b941e8a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_712.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_713.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_713.jpg
new file mode 100644
index 00000000..6c70e756
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_713.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_714.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_714.jpg
new file mode 100644
index 00000000..fb93f53e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_714.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_715.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_715.jpg
new file mode 100644
index 00000000..dba08f7f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_715.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_716.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_716.jpg
new file mode 100644
index 00000000..4cad94a5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_716.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_717.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_717.jpg
new file mode 100644
index 00000000..1c26cada
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_717.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_720.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_720.jpg
new file mode 100644
index 00000000..0dd397df
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_720.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_721.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_721.jpg
new file mode 100644
index 00000000..8cbb767f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_721.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_722.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_722.jpg
new file mode 100644
index 00000000..eecf979a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_722.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_723.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_723.jpg
new file mode 100644
index 00000000..d33dfca3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_723.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_724.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_724.jpg
new file mode 100644
index 00000000..65c4c506
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_724.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_725.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_725.jpg
new file mode 100644
index 00000000..15d50601
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_725.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_73.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_73.jpg
new file mode 100644
index 00000000..dd2c5cf3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_73.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_74.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_74.jpg
new file mode 100644
index 00000000..d7bf261a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_74.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_75.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_75.jpg
new file mode 100644
index 00000000..1ae17130
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_75.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_78.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_78.jpg
new file mode 100644
index 00000000..61846a36
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_78.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_79.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_79.jpg
new file mode 100644
index 00000000..2d5d559b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_79.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_8.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_8.jpg
new file mode 100644
index 00000000..28c1634f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_8.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_80.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_80.jpg
new file mode 100644
index 00000000..c31e1cf9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_80.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_81.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_81.jpg
new file mode 100644
index 00000000..157fe8d5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_81.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_82.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_82.jpg
new file mode 100644
index 00000000..f9d96116
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_82.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_83.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_83.jpg
new file mode 100644
index 00000000..642ff966
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_83.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_84.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_84.jpg
new file mode 100644
index 00000000..a93dd156
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_84.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_85.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_85.jpg
new file mode 100644
index 00000000..a291727b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_85.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_86.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_86.jpg
new file mode 100644
index 00000000..c1128f1b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_86.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_87.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_87.jpg
new file mode 100644
index 00000000..5a59fe95
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_87.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_88.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_88.jpg
new file mode 100644
index 00000000..a57ab672
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_88.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_89.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_89.jpg
new file mode 100644
index 00000000..f7a148cd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_89.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_9.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_9.jpg
new file mode 100644
index 00000000..1a292357
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_9.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_90.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_90.jpg
new file mode 100644
index 00000000..22103cef
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_90.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_91.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_91.jpg
new file mode 100644
index 00000000..79d7d542
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_91.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_92.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_92.jpg
new file mode 100644
index 00000000..5739f9dd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_92.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_93.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_93.jpg
new file mode 100644
index 00000000..826a2b89
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_93.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_94.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_94.jpg
new file mode 100644
index 00000000..edde2355
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_94.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_97.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_97.jpg
new file mode 100644
index 00000000..7e30595e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_97.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_98.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_98.jpg
new file mode 100644
index 00000000..d6155869
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_98.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_99.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_99.jpg
new file mode 100644
index 00000000..b0e7f713
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Closed/_99.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_0.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_0.jpg
new file mode 100644
index 00000000..205eabae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_0.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_1.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_1.jpg
new file mode 100644
index 00000000..a6954d61
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_1.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_10.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_10.jpg
new file mode 100644
index 00000000..ba572227
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_10.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_100.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_100.jpg
new file mode 100644
index 00000000..b221b78e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_100.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_101.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_101.jpg
new file mode 100644
index 00000000..22f14c32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_101.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_102.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_102.jpg
new file mode 100644
index 00000000..bac7c90c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_102.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_103.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_103.jpg
new file mode 100644
index 00000000..21a06950
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_103.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_104.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_104.jpg
new file mode 100644
index 00000000..64e44a49
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_104.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_105.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_105.jpg
new file mode 100644
index 00000000..dc03fd50
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_105.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_106.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_106.jpg
new file mode 100644
index 00000000..4f5182e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_106.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_108.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_108.jpg
new file mode 100644
index 00000000..e00d0f18
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_108.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_109.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_109.jpg
new file mode 100644
index 00000000..2ca72b02
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_109.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_11.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_11.jpg
new file mode 100644
index 00000000..29120cfd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_11.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_110.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_110.jpg
new file mode 100644
index 00000000..b35b53d8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_110.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_111.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_111.jpg
new file mode 100644
index 00000000..ab6be175
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_111.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_112.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_112.jpg
new file mode 100644
index 00000000..34697c06
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_112.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_113.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_113.jpg
new file mode 100644
index 00000000..40aa3b9d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_113.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_114.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_114.jpg
new file mode 100644
index 00000000..780806f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_114.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_117.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_117.jpg
new file mode 100644
index 00000000..92773ce4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_117.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_118.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_118.jpg
new file mode 100644
index 00000000..17012e6b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_118.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_119.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_119.jpg
new file mode 100644
index 00000000..196379bc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_119.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_12.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_12.jpg
new file mode 100644
index 00000000..37297dad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_12.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_121.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_121.jpg
new file mode 100644
index 00000000..35604591
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_121.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_122.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_122.jpg
new file mode 100644
index 00000000..ac76642d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_122.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_123.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_123.jpg
new file mode 100644
index 00000000..7de87087
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_123.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_124.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_124.jpg
new file mode 100644
index 00000000..d87ad0a5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_124.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_125.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_125.jpg
new file mode 100644
index 00000000..cf9e2b89
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_125.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_126.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_126.jpg
new file mode 100644
index 00000000..cc991869
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_126.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_127.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_127.jpg
new file mode 100644
index 00000000..da107cb3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_127.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_128.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_128.jpg
new file mode 100644
index 00000000..0bb9bdaf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_128.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_13.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_13.jpg
new file mode 100644
index 00000000..afdd26a8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_13.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_131.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_131.jpg
new file mode 100644
index 00000000..c2a1d87f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_131.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_133.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_133.jpg
new file mode 100644
index 00000000..43f1ceed
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_133.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_134.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_134.jpg
new file mode 100644
index 00000000..afe37bf8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_134.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_135.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_135.jpg
new file mode 100644
index 00000000..8025d0ed
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_135.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_136.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_136.jpg
new file mode 100644
index 00000000..c29ce0cc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_136.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_138.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_138.jpg
new file mode 100644
index 00000000..1d6f24d2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_138.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_139.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_139.jpg
new file mode 100644
index 00000000..afae04cc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_139.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_140.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_140.jpg
new file mode 100644
index 00000000..61423f07
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_140.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_141.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_141.jpg
new file mode 100644
index 00000000..c1e828c3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_141.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_142.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_142.jpg
new file mode 100644
index 00000000..749c5d56
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_142.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_143.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_143.jpg
new file mode 100644
index 00000000..181dba49
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_143.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_144.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_144.jpg
new file mode 100644
index 00000000..fcd41600
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_144.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_145.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_145.jpg
new file mode 100644
index 00000000..96b24212
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_145.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_146.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_146.jpg
new file mode 100644
index 00000000..8dbb3fea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_146.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_147.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_147.jpg
new file mode 100644
index 00000000..db5e55f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_147.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_149.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_149.jpg
new file mode 100644
index 00000000..289ffb95
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_149.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_15.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_15.jpg
new file mode 100644
index 00000000..1a864324
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_15.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_150.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_150.jpg
new file mode 100644
index 00000000..8764d2a7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_150.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_151.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_151.jpg
new file mode 100644
index 00000000..dfaf23c7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_151.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_153.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_153.jpg
new file mode 100644
index 00000000..ec2bb80d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_153.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_154.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_154.jpg
new file mode 100644
index 00000000..d4e38e3a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_154.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_155.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_155.jpg
new file mode 100644
index 00000000..97e6eb08
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_155.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_156.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_156.jpg
new file mode 100644
index 00000000..63161303
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_156.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_157.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_157.jpg
new file mode 100644
index 00000000..0886af2d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_157.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_158.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_158.jpg
new file mode 100644
index 00000000..5234b9ac
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_158.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_16.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_16.jpg
new file mode 100644
index 00000000..c4b4dc0c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_16.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_160.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_160.jpg
new file mode 100644
index 00000000..20fe377b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_160.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_162.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_162.jpg
new file mode 100644
index 00000000..af66ad1c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_162.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_165.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_165.jpg
new file mode 100644
index 00000000..1a395e24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_165.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_166.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_166.jpg
new file mode 100644
index 00000000..17221917
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_166.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_17.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_17.jpg
new file mode 100644
index 00000000..17faf2c5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_17.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_170.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_170.jpg
new file mode 100644
index 00000000..20189d4a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_170.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_171.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_171.jpg
new file mode 100644
index 00000000..9369994d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_171.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_173.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_173.jpg
new file mode 100644
index 00000000..462f7b08
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_173.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_174.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_174.jpg
new file mode 100644
index 00000000..644292b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_174.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_175.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_175.jpg
new file mode 100644
index 00000000..942bf0f1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_175.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_176.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_176.jpg
new file mode 100644
index 00000000..ce6ced1b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_176.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_177.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_177.jpg
new file mode 100644
index 00000000..c66dacc4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_177.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_178.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_178.jpg
new file mode 100644
index 00000000..9a18de06
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_178.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_179.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_179.jpg
new file mode 100644
index 00000000..4b6acb08
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_179.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_18.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_18.jpg
new file mode 100644
index 00000000..ca054214
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_18.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_180.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_180.jpg
new file mode 100644
index 00000000..3c59511a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_180.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_182.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_182.jpg
new file mode 100644
index 00000000..feb4dcd7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_182.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_183.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_183.jpg
new file mode 100644
index 00000000..44af2453
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_183.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_184.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_184.jpg
new file mode 100644
index 00000000..0cf64c09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_184.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_185.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_185.jpg
new file mode 100644
index 00000000..d6d766a7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_185.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_186.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_186.jpg
new file mode 100644
index 00000000..70e300bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_186.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_187.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_187.jpg
new file mode 100644
index 00000000..f3116244
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_187.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_188.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_188.jpg
new file mode 100644
index 00000000..e59f2086
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_188.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_189.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_189.jpg
new file mode 100644
index 00000000..d0ab1cd3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_189.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_19.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_19.jpg
new file mode 100644
index 00000000..bb38ed59
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_19.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_190.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_190.jpg
new file mode 100644
index 00000000..2af48f6d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_190.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_191.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_191.jpg
new file mode 100644
index 00000000..189dedfd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_191.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_192.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_192.jpg
new file mode 100644
index 00000000..3150676c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_192.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_193.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_193.jpg
new file mode 100644
index 00000000..35c77ddd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_193.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_194.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_194.jpg
new file mode 100644
index 00000000..1d9d7211
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_194.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_196.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_196.jpg
new file mode 100644
index 00000000..88464976
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_196.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_198.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_198.jpg
new file mode 100644
index 00000000..64359fcb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_198.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_199.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_199.jpg
new file mode 100644
index 00000000..e37798ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_199.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_2.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_2.jpg
new file mode 100644
index 00000000..77616a7b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_2.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_200.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_200.jpg
new file mode 100644
index 00000000..eee1791b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_200.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_201.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_201.jpg
new file mode 100644
index 00000000..c72a218d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_201.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_202.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_202.jpg
new file mode 100644
index 00000000..faa4b5f7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_202.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_203.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_203.jpg
new file mode 100644
index 00000000..d849ffe9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_203.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_204.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_204.jpg
new file mode 100644
index 00000000..3bc35f31
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_204.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_205.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_205.jpg
new file mode 100644
index 00000000..0366c00b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_205.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_206.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_206.jpg
new file mode 100644
index 00000000..48ac59e4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_206.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_207.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_207.jpg
new file mode 100644
index 00000000..85c8e8ec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_207.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_208.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_208.jpg
new file mode 100644
index 00000000..5cfa8192
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_208.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_209.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_209.jpg
new file mode 100644
index 00000000..6319cd46
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_209.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_21.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_21.jpg
new file mode 100644
index 00000000..878ddd33
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_21.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_210.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_210.jpg
new file mode 100644
index 00000000..f40b7e9c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_210.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_212.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_212.jpg
new file mode 100644
index 00000000..c7edfe98
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_212.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_213.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_213.jpg
new file mode 100644
index 00000000..e1742b29
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_213.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_215.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_215.jpg
new file mode 100644
index 00000000..5d69225e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_215.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_217.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_217.jpg
new file mode 100644
index 00000000..41755405
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_217.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_218.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_218.jpg
new file mode 100644
index 00000000..d7d36938
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_218.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_22.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_22.jpg
new file mode 100644
index 00000000..ecb86b86
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_22.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_220.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_220.jpg
new file mode 100644
index 00000000..af4a2dfd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_220.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_222.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_222.jpg
new file mode 100644
index 00000000..b78bee63
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_222.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_223.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_223.jpg
new file mode 100644
index 00000000..dd7f38ba
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_223.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_224.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_224.jpg
new file mode 100644
index 00000000..d08da45c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_224.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_225.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_225.jpg
new file mode 100644
index 00000000..879ddc9f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_225.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_227.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_227.jpg
new file mode 100644
index 00000000..01e514fd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_227.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_228.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_228.jpg
new file mode 100644
index 00000000..40e7f751
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_228.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_229.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_229.jpg
new file mode 100644
index 00000000..33809b0d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_229.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_23.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_23.jpg
new file mode 100644
index 00000000..2322e7d8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_23.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_230.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_230.jpg
new file mode 100644
index 00000000..5b3d11a9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_230.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_232.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_232.jpg
new file mode 100644
index 00000000..b058b0f7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_232.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_233.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_233.jpg
new file mode 100644
index 00000000..ec70a6a6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_233.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_234.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_234.jpg
new file mode 100644
index 00000000..1a025344
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_234.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_235.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_235.jpg
new file mode 100644
index 00000000..898e04e8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_235.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_236.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_236.jpg
new file mode 100644
index 00000000..f8990c2d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_236.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_237.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_237.jpg
new file mode 100644
index 00000000..b405e630
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_237.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_238.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_238.jpg
new file mode 100644
index 00000000..b2355561
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_238.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_239.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_239.jpg
new file mode 100644
index 00000000..11f735c5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_239.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_24.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_24.jpg
new file mode 100644
index 00000000..08ba9a4e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_24.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_241.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_241.jpg
new file mode 100644
index 00000000..42d3f07f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_241.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_244.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_244.jpg
new file mode 100644
index 00000000..53e5c396
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_244.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_245.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_245.jpg
new file mode 100644
index 00000000..f5e6f669
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_245.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_246.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_246.jpg
new file mode 100644
index 00000000..17040f05
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_246.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_247.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_247.jpg
new file mode 100644
index 00000000..bfb0d7f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_247.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_248.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_248.jpg
new file mode 100644
index 00000000..9de37d16
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_248.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_249.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_249.jpg
new file mode 100644
index 00000000..7cb0c566
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_249.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_25.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_25.jpg
new file mode 100644
index 00000000..a2eb2617
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_25.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_250.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_250.jpg
new file mode 100644
index 00000000..f57f7236
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_250.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_251.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_251.jpg
new file mode 100644
index 00000000..fdad0d07
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_251.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_252.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_252.jpg
new file mode 100644
index 00000000..9117bb4b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_252.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_254.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_254.jpg
new file mode 100644
index 00000000..1163ac61
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_254.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_255.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_255.jpg
new file mode 100644
index 00000000..b6b81631
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_255.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_256.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_256.jpg
new file mode 100644
index 00000000..59e2c0ef
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_256.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_258.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_258.jpg
new file mode 100644
index 00000000..d0dd0404
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_258.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_259.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_259.jpg
new file mode 100644
index 00000000..5fd5df83
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_259.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_261.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_261.jpg
new file mode 100644
index 00000000..8abc613b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_261.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_262.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_262.jpg
new file mode 100644
index 00000000..82c173af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_262.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_263.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_263.jpg
new file mode 100644
index 00000000..9cfecafb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_263.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_264.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_264.jpg
new file mode 100644
index 00000000..4e9ceb17
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_264.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_265.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_265.jpg
new file mode 100644
index 00000000..021b2adc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_265.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_266.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_266.jpg
new file mode 100644
index 00000000..4e5e297d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_266.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_267.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_267.jpg
new file mode 100644
index 00000000..1807e8e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_267.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_268.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_268.jpg
new file mode 100644
index 00000000..ea5fb48d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_268.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_269.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_269.jpg
new file mode 100644
index 00000000..fff0d006
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_269.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_27.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_27.jpg
new file mode 100644
index 00000000..dbfbace0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_27.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_270.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_270.jpg
new file mode 100644
index 00000000..07ed991a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_270.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_271.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_271.jpg
new file mode 100644
index 00000000..ef2205b6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_271.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_272.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_272.jpg
new file mode 100644
index 00000000..6e076063
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_272.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_273.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_273.jpg
new file mode 100644
index 00000000..ac124b24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_273.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_274.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_274.jpg
new file mode 100644
index 00000000..a86abd0e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_274.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_275.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_275.jpg
new file mode 100644
index 00000000..a1303dc2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_275.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_276.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_276.jpg
new file mode 100644
index 00000000..1f801c5c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_276.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_277.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_277.jpg
new file mode 100644
index 00000000..001747d5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_277.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_278.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_278.jpg
new file mode 100644
index 00000000..b07e6f48
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_278.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_280.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_280.jpg
new file mode 100644
index 00000000..001c320d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_280.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_281.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_281.jpg
new file mode 100644
index 00000000..8ab14116
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_281.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_282.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_282.jpg
new file mode 100644
index 00000000..6f10a338
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_282.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_283.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_283.jpg
new file mode 100644
index 00000000..a00c1092
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_283.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_285.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_285.jpg
new file mode 100644
index 00000000..22804b35
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_285.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_286.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_286.jpg
new file mode 100644
index 00000000..991ee6c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_286.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_288.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_288.jpg
new file mode 100644
index 00000000..c275d8ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_288.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_289.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_289.jpg
new file mode 100644
index 00000000..c558fc23
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_289.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_29.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_29.jpg
new file mode 100644
index 00000000..3f4bd2af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_29.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_290.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_290.jpg
new file mode 100644
index 00000000..91115bc2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_290.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_291.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_291.jpg
new file mode 100644
index 00000000..c9da8ecb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_291.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_292.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_292.jpg
new file mode 100644
index 00000000..3f9b76c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_292.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_293.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_293.jpg
new file mode 100644
index 00000000..80e26dfe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_293.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_294.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_294.jpg
new file mode 100644
index 00000000..cc749259
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_294.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_295.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_295.jpg
new file mode 100644
index 00000000..d4f76b9c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_295.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_296.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_296.jpg
new file mode 100644
index 00000000..01b690ad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_296.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_297.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_297.jpg
new file mode 100644
index 00000000..41b8a8cd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_297.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_299.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_299.jpg
new file mode 100644
index 00000000..529a718a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_299.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_30.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_30.jpg
new file mode 100644
index 00000000..48e39698
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_30.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_300.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_300.jpg
new file mode 100644
index 00000000..6dbe79bc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_300.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_301.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_301.jpg
new file mode 100644
index 00000000..991ce175
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_301.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_303.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_303.jpg
new file mode 100644
index 00000000..9c91463d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_303.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_304.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_304.jpg
new file mode 100644
index 00000000..bb588e0a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_304.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_305.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_305.jpg
new file mode 100644
index 00000000..f4bece4d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_305.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_306.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_306.jpg
new file mode 100644
index 00000000..8c449ad4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_306.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_307.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_307.jpg
new file mode 100644
index 00000000..bde2fd95
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_307.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_308.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_308.jpg
new file mode 100644
index 00000000..c2abb6c7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_308.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_309.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_309.jpg
new file mode 100644
index 00000000..0c5a1957
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_309.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_310.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_310.jpg
new file mode 100644
index 00000000..ea5f727a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_310.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_311.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_311.jpg
new file mode 100644
index 00000000..c74631e0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_311.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_312.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_312.jpg
new file mode 100644
index 00000000..166558f5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_312.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_313.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_313.jpg
new file mode 100644
index 00000000..d2cd0772
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_313.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_314.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_314.jpg
new file mode 100644
index 00000000..c723d87f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_314.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_315.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_315.jpg
new file mode 100644
index 00000000..03fcb39c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_315.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_316.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_316.jpg
new file mode 100644
index 00000000..84573d50
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_316.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_317.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_317.jpg
new file mode 100644
index 00000000..7957abd9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_317.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_318.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_318.jpg
new file mode 100644
index 00000000..25210a5b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_318.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_319.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_319.jpg
new file mode 100644
index 00000000..d54dc1af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_319.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_320.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_320.jpg
new file mode 100644
index 00000000..ffd27ec6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_320.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_321.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_321.jpg
new file mode 100644
index 00000000..4f436da0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_321.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_322.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_322.jpg
new file mode 100644
index 00000000..e649cb09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_322.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_323.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_323.jpg
new file mode 100644
index 00000000..4dede1dc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_323.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_324.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_324.jpg
new file mode 100644
index 00000000..0ed9d6af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_324.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_325.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_325.jpg
new file mode 100644
index 00000000..8acd096b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_325.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_327.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_327.jpg
new file mode 100644
index 00000000..35a7a35d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_327.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_328.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_328.jpg
new file mode 100644
index 00000000..655825eb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_328.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_329.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_329.jpg
new file mode 100644
index 00000000..e09f3f2d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_329.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_33.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_33.jpg
new file mode 100644
index 00000000..1da9580b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_33.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_331.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_331.jpg
new file mode 100644
index 00000000..82a4a8cd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_331.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_333.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_333.jpg
new file mode 100644
index 00000000..80d31c86
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_333.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_334.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_334.jpg
new file mode 100644
index 00000000..e73ed551
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_334.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_335.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_335.jpg
new file mode 100644
index 00000000..09b52f96
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_335.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_336.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_336.jpg
new file mode 100644
index 00000000..4588b6df
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_336.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_337.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_337.jpg
new file mode 100644
index 00000000..79fba94d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_337.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_338.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_338.jpg
new file mode 100644
index 00000000..0d4102a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_338.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_339.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_339.jpg
new file mode 100644
index 00000000..76db7fd6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_339.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_34.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_34.jpg
new file mode 100644
index 00000000..c2237625
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_34.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_341.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_341.jpg
new file mode 100644
index 00000000..68459f13
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_341.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_342.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_342.jpg
new file mode 100644
index 00000000..88bb43b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_342.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_343.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_343.jpg
new file mode 100644
index 00000000..5f95e7cf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_343.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_344.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_344.jpg
new file mode 100644
index 00000000..5afdc111
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_344.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_345.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_345.jpg
new file mode 100644
index 00000000..3fc6f6ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_345.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_346.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_346.jpg
new file mode 100644
index 00000000..622e9ef4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_346.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_349.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_349.jpg
new file mode 100644
index 00000000..0331a8a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_349.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_35.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_35.jpg
new file mode 100644
index 00000000..1dca5443
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_35.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_350.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_350.jpg
new file mode 100644
index 00000000..ef06cad3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_350.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_351.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_351.jpg
new file mode 100644
index 00000000..7f119ffb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_351.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_352.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_352.jpg
new file mode 100644
index 00000000..bcdad3a3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_352.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_353.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_353.jpg
new file mode 100644
index 00000000..5600052f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_353.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_354.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_354.jpg
new file mode 100644
index 00000000..6b985f82
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_354.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_355.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_355.jpg
new file mode 100644
index 00000000..7a6aaf41
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_355.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_356.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_356.jpg
new file mode 100644
index 00000000..05da4c70
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_356.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_357.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_357.jpg
new file mode 100644
index 00000000..60c64039
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_357.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_358.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_358.jpg
new file mode 100644
index 00000000..7843f4e5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_358.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_36.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_36.jpg
new file mode 100644
index 00000000..f8dcea8b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_36.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_360.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_360.jpg
new file mode 100644
index 00000000..5a85da43
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_360.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_361.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_361.jpg
new file mode 100644
index 00000000..c141b1b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_361.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_362.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_362.jpg
new file mode 100644
index 00000000..d5f6ae4d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_362.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_364.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_364.jpg
new file mode 100644
index 00000000..9fe509d1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_364.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_365.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_365.jpg
new file mode 100644
index 00000000..67122e6f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_365.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_366.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_366.jpg
new file mode 100644
index 00000000..f47bce6e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_366.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_367.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_367.jpg
new file mode 100644
index 00000000..2a4c9ad7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_367.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_368.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_368.jpg
new file mode 100644
index 00000000..87fd9f36
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_368.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_369.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_369.jpg
new file mode 100644
index 00000000..8891add3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_369.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_37.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_37.jpg
new file mode 100644
index 00000000..510fc0d2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_37.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_370.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_370.jpg
new file mode 100644
index 00000000..40a4c32b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_370.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_371.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_371.jpg
new file mode 100644
index 00000000..21b5fde9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_371.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_372.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_372.jpg
new file mode 100644
index 00000000..b958cd00
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_372.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_374.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_374.jpg
new file mode 100644
index 00000000..026a73da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_374.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_375.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_375.jpg
new file mode 100644
index 00000000..f118347d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_375.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_376.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_376.jpg
new file mode 100644
index 00000000..05cbc455
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_376.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_377.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_377.jpg
new file mode 100644
index 00000000..e65e8bec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_377.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_378.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_378.jpg
new file mode 100644
index 00000000..560150ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_378.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_379.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_379.jpg
new file mode 100644
index 00000000..4dba78a5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_379.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_38.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_38.jpg
new file mode 100644
index 00000000..47e1c1b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_38.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_380.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_380.jpg
new file mode 100644
index 00000000..3530b472
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_380.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_381.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_381.jpg
new file mode 100644
index 00000000..0088c1af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_381.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_382.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_382.jpg
new file mode 100644
index 00000000..7d67df4c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_382.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_384.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_384.jpg
new file mode 100644
index 00000000..0e76d770
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_384.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_385.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_385.jpg
new file mode 100644
index 00000000..6de70502
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_385.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_386.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_386.jpg
new file mode 100644
index 00000000..572ab8d9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_386.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_387.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_387.jpg
new file mode 100644
index 00000000..ac3b6b92
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_387.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_388.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_388.jpg
new file mode 100644
index 00000000..03c53b33
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_388.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_389.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_389.jpg
new file mode 100644
index 00000000..b96b6d32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_389.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_39.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_39.jpg
new file mode 100644
index 00000000..87c5dfac
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_39.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_390.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_390.jpg
new file mode 100644
index 00000000..d5063a49
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_390.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_391.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_391.jpg
new file mode 100644
index 00000000..00ecd957
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_391.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_392.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_392.jpg
new file mode 100644
index 00000000..89217bcf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_392.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_393.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_393.jpg
new file mode 100644
index 00000000..05382d79
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_393.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_394.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_394.jpg
new file mode 100644
index 00000000..892bc93f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_394.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_395.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_395.jpg
new file mode 100644
index 00000000..272b1b1f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_395.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_396.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_396.jpg
new file mode 100644
index 00000000..800d45e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_396.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_397.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_397.jpg
new file mode 100644
index 00000000..aca2fdba
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_397.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_398.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_398.jpg
new file mode 100644
index 00000000..83c76117
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_398.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_399.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_399.jpg
new file mode 100644
index 00000000..ccf6d955
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_399.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_4.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_4.jpg
new file mode 100644
index 00000000..8af7528e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_4.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_40.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_40.jpg
new file mode 100644
index 00000000..40ed7f7d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_40.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_400.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_400.jpg
new file mode 100644
index 00000000..cfc75616
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_400.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_401.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_401.jpg
new file mode 100644
index 00000000..d9b2e62e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_401.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_402.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_402.jpg
new file mode 100644
index 00000000..36cd5d65
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_402.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_403.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_403.jpg
new file mode 100644
index 00000000..64bc37b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_403.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_404.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_404.jpg
new file mode 100644
index 00000000..1b91380a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_404.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_405.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_405.jpg
new file mode 100644
index 00000000..87cd0d71
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_405.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_406.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_406.jpg
new file mode 100644
index 00000000..f60f876f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_406.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_407.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_407.jpg
new file mode 100644
index 00000000..d05d1925
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_407.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_408.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_408.jpg
new file mode 100644
index 00000000..2683c138
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_408.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_409.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_409.jpg
new file mode 100644
index 00000000..9ebc537e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_409.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_41.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_41.jpg
new file mode 100644
index 00000000..7aeba54d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_41.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_410.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_410.jpg
new file mode 100644
index 00000000..697a9b3a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_410.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_411.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_411.jpg
new file mode 100644
index 00000000..14ec497f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_411.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_412.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_412.jpg
new file mode 100644
index 00000000..07e9bd75
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_412.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_414.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_414.jpg
new file mode 100644
index 00000000..3ee53bd9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_414.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_415.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_415.jpg
new file mode 100644
index 00000000..68aa1597
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_415.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_417.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_417.jpg
new file mode 100644
index 00000000..8cfb7246
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_417.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_418.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_418.jpg
new file mode 100644
index 00000000..599e8d09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_418.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_419.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_419.jpg
new file mode 100644
index 00000000..626581a7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_419.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_42.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_42.jpg
new file mode 100644
index 00000000..0f8d59c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_42.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_420.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_420.jpg
new file mode 100644
index 00000000..0e823822
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_420.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_421.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_421.jpg
new file mode 100644
index 00000000..7a759078
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_421.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_422.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_422.jpg
new file mode 100644
index 00000000..ca44f986
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_422.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_423.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_423.jpg
new file mode 100644
index 00000000..12b7f146
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_423.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_424.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_424.jpg
new file mode 100644
index 00000000..6d6bfbfa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_424.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_425.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_425.jpg
new file mode 100644
index 00000000..efe5d440
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_425.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_426.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_426.jpg
new file mode 100644
index 00000000..0f7b9552
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_426.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_427.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_427.jpg
new file mode 100644
index 00000000..f37c856e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_427.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_428.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_428.jpg
new file mode 100644
index 00000000..6ab130d1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_428.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_429.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_429.jpg
new file mode 100644
index 00000000..ed91ec7c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_429.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_43.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_43.jpg
new file mode 100644
index 00000000..72bcbcb3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_43.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_430.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_430.jpg
new file mode 100644
index 00000000..dcbaea33
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_430.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_431.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_431.jpg
new file mode 100644
index 00000000..0e82e94e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_431.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_432.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_432.jpg
new file mode 100644
index 00000000..05b5e27c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_432.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_433.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_433.jpg
new file mode 100644
index 00000000..70f5cf3a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_433.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_435.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_435.jpg
new file mode 100644
index 00000000..1343bf24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_435.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_436.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_436.jpg
new file mode 100644
index 00000000..857081f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_436.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_437.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_437.jpg
new file mode 100644
index 00000000..e7ba0741
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_437.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_438.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_438.jpg
new file mode 100644
index 00000000..7579f449
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_438.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_44.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_44.jpg
new file mode 100644
index 00000000..768a3be6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_44.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_440.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_440.jpg
new file mode 100644
index 00000000..d2deafca
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_440.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_443.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_443.jpg
new file mode 100644
index 00000000..7c076adf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_443.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_444.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_444.jpg
new file mode 100644
index 00000000..87dcd882
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_444.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_445.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_445.jpg
new file mode 100644
index 00000000..83b75a71
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_445.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_446.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_446.jpg
new file mode 100644
index 00000000..bc13a3b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_446.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_448.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_448.jpg
new file mode 100644
index 00000000..1af60270
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_448.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_449.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_449.jpg
new file mode 100644
index 00000000..07832914
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_449.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_450.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_450.jpg
new file mode 100644
index 00000000..7bcfd404
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_450.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_452.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_452.jpg
new file mode 100644
index 00000000..78484445
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_452.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_453.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_453.jpg
new file mode 100644
index 00000000..dc255197
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_453.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_454.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_454.jpg
new file mode 100644
index 00000000..07a6f171
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_454.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_455.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_455.jpg
new file mode 100644
index 00000000..2273cb66
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_455.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_456.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_456.jpg
new file mode 100644
index 00000000..e71bfa0b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_456.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_457.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_457.jpg
new file mode 100644
index 00000000..01553d70
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_457.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_458.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_458.jpg
new file mode 100644
index 00000000..493bbf9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_458.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_459.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_459.jpg
new file mode 100644
index 00000000..227873bb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_459.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_460.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_460.jpg
new file mode 100644
index 00000000..6f11e26e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_460.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_461.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_461.jpg
new file mode 100644
index 00000000..968be126
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_461.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_462.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_462.jpg
new file mode 100644
index 00000000..a4350b66
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_462.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_463.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_463.jpg
new file mode 100644
index 00000000..30686e6e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_463.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_464.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_464.jpg
new file mode 100644
index 00000000..dbf5202e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_464.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_465.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_465.jpg
new file mode 100644
index 00000000..f40a4d98
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_465.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_466.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_466.jpg
new file mode 100644
index 00000000..9343b1be
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_466.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_467.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_467.jpg
new file mode 100644
index 00000000..1384efff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_467.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_468.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_468.jpg
new file mode 100644
index 00000000..112f4e83
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_468.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_469.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_469.jpg
new file mode 100644
index 00000000..72d084e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_469.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_47.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_47.jpg
new file mode 100644
index 00000000..81dc2fdb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_47.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_470.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_470.jpg
new file mode 100644
index 00000000..529b667f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_470.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_471.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_471.jpg
new file mode 100644
index 00000000..b1359b6d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_471.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_472.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_472.jpg
new file mode 100644
index 00000000..bebd3c8e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_472.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_473.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_473.jpg
new file mode 100644
index 00000000..5b33d15f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_473.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_474.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_474.jpg
new file mode 100644
index 00000000..bf6751b6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_474.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_475.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_475.jpg
new file mode 100644
index 00000000..e24ae7ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_475.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_476.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_476.jpg
new file mode 100644
index 00000000..8f541a79
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_476.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_477.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_477.jpg
new file mode 100644
index 00000000..accfb1c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_477.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_478.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_478.jpg
new file mode 100644
index 00000000..060c3614
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_478.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_479.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_479.jpg
new file mode 100644
index 00000000..3fee97c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_479.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_48.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_48.jpg
new file mode 100644
index 00000000..acc5e381
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_48.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_480.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_480.jpg
new file mode 100644
index 00000000..372d2700
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_480.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_481.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_481.jpg
new file mode 100644
index 00000000..eeaeb165
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_481.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_482.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_482.jpg
new file mode 100644
index 00000000..2f778d59
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_482.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_483.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_483.jpg
new file mode 100644
index 00000000..cbb37693
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_483.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_484.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_484.jpg
new file mode 100644
index 00000000..1a629102
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_484.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_485.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_485.jpg
new file mode 100644
index 00000000..e2b4e837
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_485.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_486.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_486.jpg
new file mode 100644
index 00000000..e9471da9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_486.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_487.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_487.jpg
new file mode 100644
index 00000000..dc6e4618
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_487.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_488.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_488.jpg
new file mode 100644
index 00000000..7c838119
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_488.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_489.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_489.jpg
new file mode 100644
index 00000000..1953670d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_489.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_49.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_49.jpg
new file mode 100644
index 00000000..8560bfc9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_49.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_490.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_490.jpg
new file mode 100644
index 00000000..64081ab7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_490.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_491.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_491.jpg
new file mode 100644
index 00000000..fdc0f6ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_491.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_492.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_492.jpg
new file mode 100644
index 00000000..6b63708b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_492.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_493.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_493.jpg
new file mode 100644
index 00000000..231411c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_493.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_494.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_494.jpg
new file mode 100644
index 00000000..64934f97
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_494.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_496.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_496.jpg
new file mode 100644
index 00000000..3a1449b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_496.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_499.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_499.jpg
new file mode 100644
index 00000000..d153727e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_499.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_5.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_5.jpg
new file mode 100644
index 00000000..a88bef8d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_5.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_50.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_50.jpg
new file mode 100644
index 00000000..5f58ba2f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_50.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_500.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_500.jpg
new file mode 100644
index 00000000..0a949ed5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_500.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_501.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_501.jpg
new file mode 100644
index 00000000..b455a8db
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_501.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_502.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_502.jpg
new file mode 100644
index 00000000..76cd5501
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_502.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_503.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_503.jpg
new file mode 100644
index 00000000..c5321c30
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_503.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_504.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_504.jpg
new file mode 100644
index 00000000..379b930a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_504.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_505.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_505.jpg
new file mode 100644
index 00000000..db2b2a19
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_505.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_507.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_507.jpg
new file mode 100644
index 00000000..7099781b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_507.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_508.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_508.jpg
new file mode 100644
index 00000000..8176d3c6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_508.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_509.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_509.jpg
new file mode 100644
index 00000000..0dac9440
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_509.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_51.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_51.jpg
new file mode 100644
index 00000000..ed0b532a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_51.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_510.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_510.jpg
new file mode 100644
index 00000000..a2a95eb6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_510.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_511.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_511.jpg
new file mode 100644
index 00000000..1ff27f36
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_511.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_512.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_512.jpg
new file mode 100644
index 00000000..b2b218b8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_512.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_513.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_513.jpg
new file mode 100644
index 00000000..56654ae5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_513.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_516.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_516.jpg
new file mode 100644
index 00000000..d2a032b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_516.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_517.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_517.jpg
new file mode 100644
index 00000000..3f8502c0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_517.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_518.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_518.jpg
new file mode 100644
index 00000000..1df432ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_518.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_519.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_519.jpg
new file mode 100644
index 00000000..6b2f0b76
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_519.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_52.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_52.jpg
new file mode 100644
index 00000000..3528ddd8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_52.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_520.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_520.jpg
new file mode 100644
index 00000000..670054d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_520.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_521.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_521.jpg
new file mode 100644
index 00000000..f3df50d4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_521.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_522.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_522.jpg
new file mode 100644
index 00000000..650f2ec6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_522.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_523.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_523.jpg
new file mode 100644
index 00000000..c36a7c98
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_523.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_524.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_524.jpg
new file mode 100644
index 00000000..3afb5101
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_524.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_525.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_525.jpg
new file mode 100644
index 00000000..790aa2b5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_525.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_526.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_526.jpg
new file mode 100644
index 00000000..c23461a8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_526.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_527.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_527.jpg
new file mode 100644
index 00000000..d7322792
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_527.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_528.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_528.jpg
new file mode 100644
index 00000000..00c86270
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_528.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_53.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_53.jpg
new file mode 100644
index 00000000..17218261
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_53.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_530.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_530.jpg
new file mode 100644
index 00000000..56ad416e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_530.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_531.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_531.jpg
new file mode 100644
index 00000000..ce126d86
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_531.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_532.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_532.jpg
new file mode 100644
index 00000000..17b942db
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_532.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_533.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_533.jpg
new file mode 100644
index 00000000..0dc11417
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_533.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_535.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_535.jpg
new file mode 100644
index 00000000..da13e928
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_535.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_536.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_536.jpg
new file mode 100644
index 00000000..08157699
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_536.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_537.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_537.jpg
new file mode 100644
index 00000000..90b021fd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_537.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_539.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_539.jpg
new file mode 100644
index 00000000..1ca1d24f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_539.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_54.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_54.jpg
new file mode 100644
index 00000000..ed0c131f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_54.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_540.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_540.jpg
new file mode 100644
index 00000000..0a60e88e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_540.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_543.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_543.jpg
new file mode 100644
index 00000000..ed6a3f10
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_543.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_544.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_544.jpg
new file mode 100644
index 00000000..1c2d2868
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_544.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_545.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_545.jpg
new file mode 100644
index 00000000..94f9432a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_545.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_546.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_546.jpg
new file mode 100644
index 00000000..ecac2d58
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_546.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_547.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_547.jpg
new file mode 100644
index 00000000..fc477e81
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_547.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_548.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_548.jpg
new file mode 100644
index 00000000..5742f56f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_548.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_549.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_549.jpg
new file mode 100644
index 00000000..600364c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_549.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_55.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_55.jpg
new file mode 100644
index 00000000..3a4bfffa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_55.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_550.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_550.jpg
new file mode 100644
index 00000000..808431e7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_550.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_551.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_551.jpg
new file mode 100644
index 00000000..7d71228d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_551.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_552.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_552.jpg
new file mode 100644
index 00000000..7a21d688
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_552.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_553.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_553.jpg
new file mode 100644
index 00000000..da6cb6d5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_553.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_554.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_554.jpg
new file mode 100644
index 00000000..daa34361
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_554.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_555.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_555.jpg
new file mode 100644
index 00000000..30519d1e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_555.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_556.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_556.jpg
new file mode 100644
index 00000000..949cbc3a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_556.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_557.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_557.jpg
new file mode 100644
index 00000000..a00ebd92
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_557.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_558.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_558.jpg
new file mode 100644
index 00000000..53833986
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_558.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_56.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_56.jpg
new file mode 100644
index 00000000..e6abb500
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_56.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_560.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_560.jpg
new file mode 100644
index 00000000..04279813
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_560.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_561.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_561.jpg
new file mode 100644
index 00000000..3dc34344
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_561.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_562.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_562.jpg
new file mode 100644
index 00000000..16393a71
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_562.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_563.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_563.jpg
new file mode 100644
index 00000000..ba0ccd70
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_563.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_564.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_564.jpg
new file mode 100644
index 00000000..d0af9ade
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_564.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_565.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_565.jpg
new file mode 100644
index 00000000..138a0251
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_565.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_566.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_566.jpg
new file mode 100644
index 00000000..bb927308
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_566.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_567.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_567.jpg
new file mode 100644
index 00000000..a88a05d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_567.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_569.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_569.jpg
new file mode 100644
index 00000000..e497f7d4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_569.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_57.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_57.jpg
new file mode 100644
index 00000000..3639dd8b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_57.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_570.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_570.jpg
new file mode 100644
index 00000000..3c25db9b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_570.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_571.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_571.jpg
new file mode 100644
index 00000000..e5f32f32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_571.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_572.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_572.jpg
new file mode 100644
index 00000000..51884a61
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_572.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_573.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_573.jpg
new file mode 100644
index 00000000..8369ecd1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_573.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_574.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_574.jpg
new file mode 100644
index 00000000..364ee9cd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_574.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_575.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_575.jpg
new file mode 100644
index 00000000..1979d885
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_575.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_576.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_576.jpg
new file mode 100644
index 00000000..d17895de
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_576.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_577.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_577.jpg
new file mode 100644
index 00000000..162afb2d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_577.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_578.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_578.jpg
new file mode 100644
index 00000000..80e18542
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_578.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_579.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_579.jpg
new file mode 100644
index 00000000..2550eeba
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_579.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_580.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_580.jpg
new file mode 100644
index 00000000..b7718aaa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_580.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_581.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_581.jpg
new file mode 100644
index 00000000..e0ab22e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_581.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_582.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_582.jpg
new file mode 100644
index 00000000..3ea2cd48
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_582.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_583.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_583.jpg
new file mode 100644
index 00000000..e282a658
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_583.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_587.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_587.jpg
new file mode 100644
index 00000000..5224f9da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_587.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_588.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_588.jpg
new file mode 100644
index 00000000..5e94adf4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_588.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_589.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_589.jpg
new file mode 100644
index 00000000..f2556d31
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_589.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_590.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_590.jpg
new file mode 100644
index 00000000..c8e27ca1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_590.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_591.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_591.jpg
new file mode 100644
index 00000000..70b10c22
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_591.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_592.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_592.jpg
new file mode 100644
index 00000000..9fea0e24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_592.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_593.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_593.jpg
new file mode 100644
index 00000000..84d966a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_593.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_594.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_594.jpg
new file mode 100644
index 00000000..9a6f3357
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_594.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_595.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_595.jpg
new file mode 100644
index 00000000..986fdb5a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_595.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_596.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_596.jpg
new file mode 100644
index 00000000..6bf63e78
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_596.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_598.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_598.jpg
new file mode 100644
index 00000000..34e65a27
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_598.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_599.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_599.jpg
new file mode 100644
index 00000000..7a1a4ac8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_599.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_6.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_6.jpg
new file mode 100644
index 00000000..472486e5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_6.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_60.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_60.jpg
new file mode 100644
index 00000000..c0144c3d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_60.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_600.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_600.jpg
new file mode 100644
index 00000000..d3321ae2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_600.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_601.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_601.jpg
new file mode 100644
index 00000000..0ec7b149
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_601.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_602.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_602.jpg
new file mode 100644
index 00000000..d84fa747
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_602.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_603.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_603.jpg
new file mode 100644
index 00000000..44a62e48
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_603.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_604.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_604.jpg
new file mode 100644
index 00000000..4ae10e65
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_604.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_606.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_606.jpg
new file mode 100644
index 00000000..279f419f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_606.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_607.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_607.jpg
new file mode 100644
index 00000000..a3123efb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_607.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_610.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_610.jpg
new file mode 100644
index 00000000..df09e965
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_610.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_611.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_611.jpg
new file mode 100644
index 00000000..3fe2b785
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_611.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_612.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_612.jpg
new file mode 100644
index 00000000..1adcf584
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_612.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_613.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_613.jpg
new file mode 100644
index 00000000..6f86a7a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_613.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_614.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_614.jpg
new file mode 100644
index 00000000..ee55044a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_614.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_615.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_615.jpg
new file mode 100644
index 00000000..fce5502f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_615.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_616.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_616.jpg
new file mode 100644
index 00000000..5001e242
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_616.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_617.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_617.jpg
new file mode 100644
index 00000000..b396932f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_617.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_619.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_619.jpg
new file mode 100644
index 00000000..77b3cf56
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_619.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_62.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_62.jpg
new file mode 100644
index 00000000..d25fb0b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_62.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_620.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_620.jpg
new file mode 100644
index 00000000..0ec894f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_620.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_621.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_621.jpg
new file mode 100644
index 00000000..c4219240
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_621.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_622.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_622.jpg
new file mode 100644
index 00000000..ad9cc8ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_622.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_623.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_623.jpg
new file mode 100644
index 00000000..6301153d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_623.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_625.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_625.jpg
new file mode 100644
index 00000000..d4f654c5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_625.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_626.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_626.jpg
new file mode 100644
index 00000000..ae779a21
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_626.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_627.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_627.jpg
new file mode 100644
index 00000000..864cd4ee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_627.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_628.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_628.jpg
new file mode 100644
index 00000000..e64a4413
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_628.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_629.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_629.jpg
new file mode 100644
index 00000000..65d545e8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_629.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_63.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_63.jpg
new file mode 100644
index 00000000..63dbb793
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_63.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_630.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_630.jpg
new file mode 100644
index 00000000..bd0e9bc2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_630.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_631.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_631.jpg
new file mode 100644
index 00000000..68defe10
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_631.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_632.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_632.jpg
new file mode 100644
index 00000000..0709f484
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_632.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_633.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_633.jpg
new file mode 100644
index 00000000..1f07692f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_633.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_635.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_635.jpg
new file mode 100644
index 00000000..b351ea38
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_635.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_636.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_636.jpg
new file mode 100644
index 00000000..9845694a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_636.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_637.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_637.jpg
new file mode 100644
index 00000000..2c827dc6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_637.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_638.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_638.jpg
new file mode 100644
index 00000000..040c7e26
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_638.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_640.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_640.jpg
new file mode 100644
index 00000000..4bf9b024
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_640.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_641.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_641.jpg
new file mode 100644
index 00000000..4856b4a6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_641.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_642.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_642.jpg
new file mode 100644
index 00000000..3b42ff84
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_642.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_643.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_643.jpg
new file mode 100644
index 00000000..b00a25df
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_643.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_644.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_644.jpg
new file mode 100644
index 00000000..92885f6e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_644.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_645.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_645.jpg
new file mode 100644
index 00000000..70bf09d1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_645.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_646.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_646.jpg
new file mode 100644
index 00000000..4cef8ec9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_646.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_647.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_647.jpg
new file mode 100644
index 00000000..7f979d4f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_647.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_648.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_648.jpg
new file mode 100644
index 00000000..2d272343
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_648.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_649.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_649.jpg
new file mode 100644
index 00000000..7e4d74cf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_649.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_65.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_65.jpg
new file mode 100644
index 00000000..4955f2ee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_65.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_651.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_651.jpg
new file mode 100644
index 00000000..248016ca
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_651.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_652.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_652.jpg
new file mode 100644
index 00000000..7b0de018
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_652.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_653.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_653.jpg
new file mode 100644
index 00000000..b3c5d6a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_653.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_654.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_654.jpg
new file mode 100644
index 00000000..956ce4c6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_654.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_655.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_655.jpg
new file mode 100644
index 00000000..7e9c4098
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_655.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_657.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_657.jpg
new file mode 100644
index 00000000..e2e221c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_657.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_658.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_658.jpg
new file mode 100644
index 00000000..eed14f86
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_658.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_659.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_659.jpg
new file mode 100644
index 00000000..cb5b53ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_659.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_66.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_66.jpg
new file mode 100644
index 00000000..e31dc82a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_66.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_660.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_660.jpg
new file mode 100644
index 00000000..ae99616a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_660.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_661.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_661.jpg
new file mode 100644
index 00000000..36c38003
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_661.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_662.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_662.jpg
new file mode 100644
index 00000000..0b3557ad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_662.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_663.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_663.jpg
new file mode 100644
index 00000000..1ead6e28
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_663.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_664.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_664.jpg
new file mode 100644
index 00000000..9a058682
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_664.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_665.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_665.jpg
new file mode 100644
index 00000000..3016a6d1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_665.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_668.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_668.jpg
new file mode 100644
index 00000000..2b7b942e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_668.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_669.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_669.jpg
new file mode 100644
index 00000000..c30616de
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_669.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_67.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_67.jpg
new file mode 100644
index 00000000..db1ff2d9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_67.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_670.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_670.jpg
new file mode 100644
index 00000000..cdd28a8a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_670.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_671.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_671.jpg
new file mode 100644
index 00000000..5cd8ab08
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_671.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_672.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_672.jpg
new file mode 100644
index 00000000..d6b6e151
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_672.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_673.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_673.jpg
new file mode 100644
index 00000000..eaa10355
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_673.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_674.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_674.jpg
new file mode 100644
index 00000000..588494a9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_674.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_675.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_675.jpg
new file mode 100644
index 00000000..7b3fb37e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_675.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_676.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_676.jpg
new file mode 100644
index 00000000..5ec649f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_676.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_677.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_677.jpg
new file mode 100644
index 00000000..80dacd74
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_677.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_678.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_678.jpg
new file mode 100644
index 00000000..8ee5fe29
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_678.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_68.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_68.jpg
new file mode 100644
index 00000000..5142c66d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_68.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_680.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_680.jpg
new file mode 100644
index 00000000..e0f0b5ad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_680.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_681.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_681.jpg
new file mode 100644
index 00000000..aa58d99a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_681.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_682.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_682.jpg
new file mode 100644
index 00000000..e0cd840a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_682.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_683.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_683.jpg
new file mode 100644
index 00000000..773175df
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_683.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_684.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_684.jpg
new file mode 100644
index 00000000..673382ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_684.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_685.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_685.jpg
new file mode 100644
index 00000000..8e5c0e08
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_685.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_686.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_686.jpg
new file mode 100644
index 00000000..4ab92e8c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_686.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_688.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_688.jpg
new file mode 100644
index 00000000..cdac6924
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_688.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_689.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_689.jpg
new file mode 100644
index 00000000..a764db55
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_689.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_69.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_69.jpg
new file mode 100644
index 00000000..a03f3d5a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_69.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_690.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_690.jpg
new file mode 100644
index 00000000..5eceb4c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_690.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_691.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_691.jpg
new file mode 100644
index 00000000..69456cb8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_691.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_692.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_692.jpg
new file mode 100644
index 00000000..615cd8f4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_692.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_693.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_693.jpg
new file mode 100644
index 00000000..cbeb99d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_693.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_694.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_694.jpg
new file mode 100644
index 00000000..1314721a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_694.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_695.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_695.jpg
new file mode 100644
index 00000000..bd3ee515
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_695.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_696.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_696.jpg
new file mode 100644
index 00000000..bb014034
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_696.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_697.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_697.jpg
new file mode 100644
index 00000000..ce88f344
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_697.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_698.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_698.jpg
new file mode 100644
index 00000000..58397927
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_698.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_699.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_699.jpg
new file mode 100644
index 00000000..fad552a5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_699.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_70.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_70.jpg
new file mode 100644
index 00000000..ae3760ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_70.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_700.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_700.jpg
new file mode 100644
index 00000000..501151f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_700.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_701.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_701.jpg
new file mode 100644
index 00000000..65f5bd6a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_701.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_702.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_702.jpg
new file mode 100644
index 00000000..32e2090e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_702.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_703.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_703.jpg
new file mode 100644
index 00000000..c4641cd8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_703.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_704.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_704.jpg
new file mode 100644
index 00000000..fda44d64
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_704.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_705.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_705.jpg
new file mode 100644
index 00000000..ee9e1ca8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_705.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_706.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_706.jpg
new file mode 100644
index 00000000..e47b1533
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_706.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_707.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_707.jpg
new file mode 100644
index 00000000..4a2c10b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_707.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_708.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_708.jpg
new file mode 100644
index 00000000..38a5357c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_708.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_709.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_709.jpg
new file mode 100644
index 00000000..bc685fa8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_709.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_71.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_71.jpg
new file mode 100644
index 00000000..ab784a5f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_71.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_711.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_711.jpg
new file mode 100644
index 00000000..025c9c8b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_711.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_712.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_712.jpg
new file mode 100644
index 00000000..d91689b0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_712.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_713.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_713.jpg
new file mode 100644
index 00000000..00e41367
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_713.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_714.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_714.jpg
new file mode 100644
index 00000000..16cebb42
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_714.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_715.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_715.jpg
new file mode 100644
index 00000000..b0e2ecfd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_715.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_716.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_716.jpg
new file mode 100644
index 00000000..ac8d8415
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_716.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_717.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_717.jpg
new file mode 100644
index 00000000..73250b45
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_717.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_720.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_720.jpg
new file mode 100644
index 00000000..b3a4ed93
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_720.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_721.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_721.jpg
new file mode 100644
index 00000000..a558fc29
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_721.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_722.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_722.jpg
new file mode 100644
index 00000000..5ddbd257
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_722.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_723.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_723.jpg
new file mode 100644
index 00000000..5ab5657f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_723.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_724.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_724.jpg
new file mode 100644
index 00000000..78ba7cfc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_724.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_725.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_725.jpg
new file mode 100644
index 00000000..436574e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_725.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_73.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_73.jpg
new file mode 100644
index 00000000..3ffd415c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_73.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_74.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_74.jpg
new file mode 100644
index 00000000..2d5ea135
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_74.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_75.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_75.jpg
new file mode 100644
index 00000000..80bdb2bc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_75.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_78.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_78.jpg
new file mode 100644
index 00000000..00a83140
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_78.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_79.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_79.jpg
new file mode 100644
index 00000000..d91a9d37
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_79.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_8.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_8.jpg
new file mode 100644
index 00000000..004dc706
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_8.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_80.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_80.jpg
new file mode 100644
index 00000000..7fe16da6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_80.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_81.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_81.jpg
new file mode 100644
index 00000000..cf78fc2e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_81.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_82.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_82.jpg
new file mode 100644
index 00000000..49ef1cb6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_82.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_83.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_83.jpg
new file mode 100644
index 00000000..542f338c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_83.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_84.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_84.jpg
new file mode 100644
index 00000000..a17ef710
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_84.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_85.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_85.jpg
new file mode 100644
index 00000000..b7396191
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_85.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_86.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_86.jpg
new file mode 100644
index 00000000..3bd2bb8e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_86.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_87.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_87.jpg
new file mode 100644
index 00000000..c15da80d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_87.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_88.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_88.jpg
new file mode 100644
index 00000000..6e27d38b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_88.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_89.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_89.jpg
new file mode 100644
index 00000000..7e7f6d62
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_89.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_9.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_9.jpg
new file mode 100644
index 00000000..53f4697b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_9.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_90.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_90.jpg
new file mode 100644
index 00000000..bdc8fa4b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_90.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_91.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_91.jpg
new file mode 100644
index 00000000..b8b05ff7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_91.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_92.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_92.jpg
new file mode 100644
index 00000000..8e46c42a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_92.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_93.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_93.jpg
new file mode 100644
index 00000000..4a146bb1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_93.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_94.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_94.jpg
new file mode 100644
index 00000000..e9f86047
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_94.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_97.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_97.jpg
new file mode 100644
index 00000000..ee6997d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_97.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_98.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_98.jpg
new file mode 100644
index 00000000..a48b55da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_98.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_99.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_99.jpg
new file mode 100644
index 00000000..44a4c53d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/Open/_99.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1.jpg
new file mode 100644
index 00000000..8a65828b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1003.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1003.jpg
new file mode 100644
index 00000000..de9b6444
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1003.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1006.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1006.jpg
new file mode 100644
index 00000000..1eee0713
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1006.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1008.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1008.jpg
new file mode 100644
index 00000000..aecb9b48
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1008.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1009.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1009.jpg
new file mode 100644
index 00000000..68f82956
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1009.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1021.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1021.jpg
new file mode 100644
index 00000000..91ffbdda
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1021.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1028.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1028.jpg
new file mode 100644
index 00000000..c05a3e38
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1028.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1029.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1029.jpg
new file mode 100644
index 00000000..ea180c35
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1029.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1030.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1030.jpg
new file mode 100644
index 00000000..e7cde322
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1030.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1031.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1031.jpg
new file mode 100644
index 00000000..7a724f32
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1031.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1032.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1032.jpg
new file mode 100644
index 00000000..cb9c839b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1032.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1034.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1034.jpg
new file mode 100644
index 00000000..54932ea7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1034.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1038.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1038.jpg
new file mode 100644
index 00000000..73a87ad2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1038.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1039.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1039.jpg
new file mode 100644
index 00000000..98a281d4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1039.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1042.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1042.jpg
new file mode 100644
index 00000000..7df2a9b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1042.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1046.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1046.jpg
new file mode 100644
index 00000000..6d344d07
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1046.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1047.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1047.jpg
new file mode 100644
index 00000000..f57e58c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1047.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1061.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1061.jpg
new file mode 100644
index 00000000..dc288976
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1061.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1062.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1062.jpg
new file mode 100644
index 00000000..3c97e489
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1062.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1068.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1068.jpg
new file mode 100644
index 00000000..68f838f5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1068.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1069.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1069.jpg
new file mode 100644
index 00000000..b35980e1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1069.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1073.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1073.jpg
new file mode 100644
index 00000000..8013046c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1073.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1074.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1074.jpg
new file mode 100644
index 00000000..8fa61b09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1074.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1097.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1097.jpg
new file mode 100644
index 00000000..dd31577a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1097.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1098.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1098.jpg
new file mode 100644
index 00000000..c99fe5f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1098.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/111.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/111.jpg
new file mode 100644
index 00000000..a19e8339
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/111.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1111.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1111.jpg
new file mode 100644
index 00000000..fa299519
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1111.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1116.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1116.jpg
new file mode 100644
index 00000000..8b5b5ec9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1116.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1117.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1117.jpg
new file mode 100644
index 00000000..39ce1df4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1117.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/112.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/112.jpg
new file mode 100644
index 00000000..bc0f24db
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/112.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1120.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1120.jpg
new file mode 100644
index 00000000..fa0c43d1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1120.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1121.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1121.jpg
new file mode 100644
index 00000000..fd719213
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1121.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1122.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1122.jpg
new file mode 100644
index 00000000..cc570829
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1122.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1128.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1128.jpg
new file mode 100644
index 00000000..58a11591
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1128.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1130.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1130.jpg
new file mode 100644
index 00000000..aeacab17
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1130.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1131.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1131.jpg
new file mode 100644
index 00000000..126629bd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1131.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1132.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1132.jpg
new file mode 100644
index 00000000..71ba3330
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1132.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1133.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1133.jpg
new file mode 100644
index 00000000..63934bb1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1133.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1139.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1139.jpg
new file mode 100644
index 00000000..fd55959e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1139.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/114.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/114.jpg
new file mode 100644
index 00000000..e4c6d1e7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/114.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/117.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/117.jpg
new file mode 100644
index 00000000..cf3aa2f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/117.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1172.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1172.jpg
new file mode 100644
index 00000000..00c179c6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1172.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1173.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1173.jpg
new file mode 100644
index 00000000..f3feb342
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1173.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1174.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1174.jpg
new file mode 100644
index 00000000..8735ec51
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1174.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1176.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1176.jpg
new file mode 100644
index 00000000..fd33bd19
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1176.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1177.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1177.jpg
new file mode 100644
index 00000000..8a6d1dea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1177.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1178.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1178.jpg
new file mode 100644
index 00000000..976809bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1178.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1201.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1201.jpg
new file mode 100644
index 00000000..cb78cbb5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1201.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1202.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1202.jpg
new file mode 100644
index 00000000..e3ee8b89
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1202.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1203.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1203.jpg
new file mode 100644
index 00000000..8715f169
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1203.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1208.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1208.jpg
new file mode 100644
index 00000000..f289ded4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1208.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1209.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1209.jpg
new file mode 100644
index 00000000..6d924d40
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1209.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1210.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1210.jpg
new file mode 100644
index 00000000..64421ac6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1210.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1214.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1214.jpg
new file mode 100644
index 00000000..53e0afdd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1214.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1246.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1246.jpg
new file mode 100644
index 00000000..634afb7f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1246.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1247.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1247.jpg
new file mode 100644
index 00000000..01bda388
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1247.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1248.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1248.jpg
new file mode 100644
index 00000000..b72ad96c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1248.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1250.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1250.jpg
new file mode 100644
index 00000000..11104954
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1250.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1261.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1261.jpg
new file mode 100644
index 00000000..3a0bd68e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1261.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1266.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1266.jpg
new file mode 100644
index 00000000..adf19b19
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1266.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1269.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1269.jpg
new file mode 100644
index 00000000..d3d89a58
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1269.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1270.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1270.jpg
new file mode 100644
index 00000000..9047b8a8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1270.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1281.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1281.jpg
new file mode 100644
index 00000000..e08feb77
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1281.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1282.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1282.jpg
new file mode 100644
index 00000000..52832d64
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1282.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1318.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1318.jpg
new file mode 100644
index 00000000..5b2e29a9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1318.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1319.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1319.jpg
new file mode 100644
index 00000000..21da229f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1319.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1320.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1320.jpg
new file mode 100644
index 00000000..675b0d3b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1320.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1322.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1322.jpg
new file mode 100644
index 00000000..faa668e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1322.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1324.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1324.jpg
new file mode 100644
index 00000000..66edd2fe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1324.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1326.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1326.jpg
new file mode 100644
index 00000000..e8713e48
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1326.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1327.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1327.jpg
new file mode 100644
index 00000000..4759df1b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1327.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1332.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1332.jpg
new file mode 100644
index 00000000..11ab9cc1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1332.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1333.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1333.jpg
new file mode 100644
index 00000000..ce774a05
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1333.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1334.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1334.jpg
new file mode 100644
index 00000000..20a12e3e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1334.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1356.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1356.jpg
new file mode 100644
index 00000000..dc9c62eb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1356.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1357.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1357.jpg
new file mode 100644
index 00000000..08ceab15
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1357.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1359.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1359.jpg
new file mode 100644
index 00000000..c1a79ada
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1359.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1362.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1362.jpg
new file mode 100644
index 00000000..af013f4a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1362.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1363.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1363.jpg
new file mode 100644
index 00000000..0072259e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1363.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1369.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1369.jpg
new file mode 100644
index 00000000..73f7b6f8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1369.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1370.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1370.jpg
new file mode 100644
index 00000000..e4a0f89c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1370.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1371.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1371.jpg
new file mode 100644
index 00000000..d6be71ed
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1371.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1374.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1374.jpg
new file mode 100644
index 00000000..9582afa1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1374.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1376.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1376.jpg
new file mode 100644
index 00000000..2865a3c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1376.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1378.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1378.jpg
new file mode 100644
index 00000000..a7cc7eb2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1378.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/141.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/141.jpg
new file mode 100644
index 00000000..777bdcec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/141.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1411.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1411.jpg
new file mode 100644
index 00000000..3f31cb1d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1411.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1412.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1412.jpg
new file mode 100644
index 00000000..8d084fe6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1412.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1413.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1413.jpg
new file mode 100644
index 00000000..b526a11e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1413.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/142.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/142.jpg
new file mode 100644
index 00000000..b49ea3e5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/142.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/144.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/144.jpg
new file mode 100644
index 00000000..3b09c14a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/144.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1447.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1447.jpg
new file mode 100644
index 00000000..ff93e0e6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1447.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1448.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1448.jpg
new file mode 100644
index 00000000..ef583da4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1448.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1449.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1449.jpg
new file mode 100644
index 00000000..7899b8c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1449.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/145.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/145.jpg
new file mode 100644
index 00000000..f3396f93
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/145.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1450.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1450.jpg
new file mode 100644
index 00000000..11f44160
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1450.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1451.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1451.jpg
new file mode 100644
index 00000000..c601da07
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1451.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/146.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/146.jpg
new file mode 100644
index 00000000..97544ae5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/146.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1460.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1460.jpg
new file mode 100644
index 00000000..2c1d80d2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1460.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1461.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1461.jpg
new file mode 100644
index 00000000..7952a7b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1461.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1462.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1462.jpg
new file mode 100644
index 00000000..96cf5f3c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1462.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1463.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1463.jpg
new file mode 100644
index 00000000..ef3d1411
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1463.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1464.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1464.jpg
new file mode 100644
index 00000000..614e3ceb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1464.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/147.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/147.jpg
new file mode 100644
index 00000000..e29a496e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/147.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/148.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/148.jpg
new file mode 100644
index 00000000..e8c5002b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/148.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1487.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1487.jpg
new file mode 100644
index 00000000..a95dbf22
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1487.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/149.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/149.jpg
new file mode 100644
index 00000000..bcb26b31
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/149.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1492.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1492.jpg
new file mode 100644
index 00000000..24cfa8bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1492.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1493.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1493.jpg
new file mode 100644
index 00000000..b2a4a280
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1493.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1496.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1496.jpg
new file mode 100644
index 00000000..10002c99
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1496.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1497.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1497.jpg
new file mode 100644
index 00000000..0d1af1c4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1497.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1498.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1498.jpg
new file mode 100644
index 00000000..20f881af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1498.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1499.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1499.jpg
new file mode 100644
index 00000000..d437e2d1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1499.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1500.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1500.jpg
new file mode 100644
index 00000000..b08436a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1500.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1503.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1503.jpg
new file mode 100644
index 00000000..9c842d0d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1503.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1507.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1507.jpg
new file mode 100644
index 00000000..fbe31f28
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1507.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1508.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1508.jpg
new file mode 100644
index 00000000..e9c89a96
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1508.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1509.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1509.jpg
new file mode 100644
index 00000000..2ac6f75f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1509.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1510.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1510.jpg
new file mode 100644
index 00000000..1a3256c6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1510.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1532.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1532.jpg
new file mode 100644
index 00000000..0a1ae1a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1532.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1537.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1537.jpg
new file mode 100644
index 00000000..3d2a64e6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1537.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1538.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1538.jpg
new file mode 100644
index 00000000..6c79c0d5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1538.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1541.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1541.jpg
new file mode 100644
index 00000000..aac3148d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1541.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1542.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1542.jpg
new file mode 100644
index 00000000..803c2c0c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1542.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1559.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1559.jpg
new file mode 100644
index 00000000..820f4c08
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1559.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1561.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1561.jpg
new file mode 100644
index 00000000..0d5fa1c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1561.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1562.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1562.jpg
new file mode 100644
index 00000000..e19febaa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1562.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1567.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1567.jpg
new file mode 100644
index 00000000..ab294c9b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1567.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1571.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1571.jpg
new file mode 100644
index 00000000..92cb9a34
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1571.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1572.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1572.jpg
new file mode 100644
index 00000000..730498de
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1572.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1573.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1573.jpg
new file mode 100644
index 00000000..28117ad1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1573.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1574.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1574.jpg
new file mode 100644
index 00000000..b3fbfd53
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1574.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1576.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1576.jpg
new file mode 100644
index 00000000..4ee1d5ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1576.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1592.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1592.jpg
new file mode 100644
index 00000000..cc3eabc2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1592.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1593.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1593.jpg
new file mode 100644
index 00000000..6ae2f732
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1593.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1597.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1597.jpg
new file mode 100644
index 00000000..05ed3ab8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1597.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1598.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1598.jpg
new file mode 100644
index 00000000..57014afd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1598.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1599.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1599.jpg
new file mode 100644
index 00000000..8093245f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1599.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1600.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1600.jpg
new file mode 100644
index 00000000..cfa4c1a1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1600.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1611.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1611.jpg
new file mode 100644
index 00000000..7764e296
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1611.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1627.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1627.jpg
new file mode 100644
index 00000000..0b2705e8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1627.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1629.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1629.jpg
new file mode 100644
index 00000000..d9568bdc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1629.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1630.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1630.jpg
new file mode 100644
index 00000000..e5929b44
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1630.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1642.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1642.jpg
new file mode 100644
index 00000000..96625ce6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1642.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1647.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1647.jpg
new file mode 100644
index 00000000..61cf4c26
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1647.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1648.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1648.jpg
new file mode 100644
index 00000000..f1ef2213
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1648.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1651.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1651.jpg
new file mode 100644
index 00000000..3849b7a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1651.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1652.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1652.jpg
new file mode 100644
index 00000000..b19787e5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1652.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1653.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1653.jpg
new file mode 100644
index 00000000..10ef150d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1653.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1686.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1686.jpg
new file mode 100644
index 00000000..eab30ce6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1686.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1689.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1689.jpg
new file mode 100644
index 00000000..e19c4980
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1689.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1690.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1690.jpg
new file mode 100644
index 00000000..bec524b9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1690.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1701.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1701.jpg
new file mode 100644
index 00000000..a1e8f03d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1701.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1703.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1703.jpg
new file mode 100644
index 00000000..7504eeee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1703.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1706.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1706.jpg
new file mode 100644
index 00000000..47acf5ed
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1706.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1707.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1707.jpg
new file mode 100644
index 00000000..8c287e9d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1707.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1708.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1708.jpg
new file mode 100644
index 00000000..784fcf2a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1708.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1711.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1711.jpg
new file mode 100644
index 00000000..033f767c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1711.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1712.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1712.jpg
new file mode 100644
index 00000000..ba22fbe7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1712.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1714.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1714.jpg
new file mode 100644
index 00000000..fc6e90b9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1714.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1736.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1736.jpg
new file mode 100644
index 00000000..7efcad5e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1736.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1738.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1738.jpg
new file mode 100644
index 00000000..f6e6edce
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1738.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/174.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/174.jpg
new file mode 100644
index 00000000..85172ee2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/174.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1740.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1740.jpg
new file mode 100644
index 00000000..b46c6abc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1740.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/175.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/175.jpg
new file mode 100644
index 00000000..eca3a7a9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/175.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/176.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/176.jpg
new file mode 100644
index 00000000..36a63fd5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/176.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1763.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1763.jpg
new file mode 100644
index 00000000..18562dd6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1763.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1764.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1764.jpg
new file mode 100644
index 00000000..161feba6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1764.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1766.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1766.jpg
new file mode 100644
index 00000000..60f77700
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1766.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1767.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1767.jpg
new file mode 100644
index 00000000..92609c80
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1767.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1768.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1768.jpg
new file mode 100644
index 00000000..f902c9ac
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1768.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1769.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1769.jpg
new file mode 100644
index 00000000..3268c073
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1769.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/177.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/177.jpg
new file mode 100644
index 00000000..a34c4dd1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/177.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1777.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1777.jpg
new file mode 100644
index 00000000..bacfb372
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1777.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1778.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1778.jpg
new file mode 100644
index 00000000..a1586faa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1778.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1779.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1779.jpg
new file mode 100644
index 00000000..516b000b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1779.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1780.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1780.jpg
new file mode 100644
index 00000000..81d46503
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1780.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1781.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1781.jpg
new file mode 100644
index 00000000..5fe62b27
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1781.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1782.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1782.jpg
new file mode 100644
index 00000000..a247e62f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1782.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1783.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1783.jpg
new file mode 100644
index 00000000..3cea868b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1783.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1784.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1784.jpg
new file mode 100644
index 00000000..fd06c592
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1784.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1788.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1788.jpg
new file mode 100644
index 00000000..a6edc0a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1788.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/179.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/179.jpg
new file mode 100644
index 00000000..91cb3399
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/179.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1802.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1802.jpg
new file mode 100644
index 00000000..b0573e61
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1802.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1803.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1803.jpg
new file mode 100644
index 00000000..9bc158cd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1803.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1804.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1804.jpg
new file mode 100644
index 00000000..00cd813c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1804.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1816.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1816.jpg
new file mode 100644
index 00000000..db96765b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1816.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1817.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1817.jpg
new file mode 100644
index 00000000..02269a37
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1817.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1820.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1820.jpg
new file mode 100644
index 00000000..0afe5e1a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1820.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1851.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1851.jpg
new file mode 100644
index 00000000..46099c19
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1851.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1852.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1852.jpg
new file mode 100644
index 00000000..cf4c358d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1852.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1856.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1856.jpg
new file mode 100644
index 00000000..5b76f049
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1856.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1857.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1857.jpg
new file mode 100644
index 00000000..95cc8ff7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1857.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1859.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1859.jpg
new file mode 100644
index 00000000..a284d43a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1859.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1864.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1864.jpg
new file mode 100644
index 00000000..a5e33f88
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1864.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1866.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1866.jpg
new file mode 100644
index 00000000..b69fa98f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1866.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1867.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1867.jpg
new file mode 100644
index 00000000..d8ae48ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1867.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1870.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1870.jpg
new file mode 100644
index 00000000..cf430ad1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1870.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1871.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1871.jpg
new file mode 100644
index 00000000..d8e7843a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1871.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1874.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1874.jpg
new file mode 100644
index 00000000..061c9588
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1874.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1876.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1876.jpg
new file mode 100644
index 00000000..c4457ded
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1876.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1878.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1878.jpg
new file mode 100644
index 00000000..247d3963
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1878.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1879.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1879.jpg
new file mode 100644
index 00000000..cb3fff26
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1879.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1880.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1880.jpg
new file mode 100644
index 00000000..606c54a1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1880.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1891.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1891.jpg
new file mode 100644
index 00000000..a150838c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1891.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1893.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1893.jpg
new file mode 100644
index 00000000..9dd9f6a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1893.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1899.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1899.jpg
new file mode 100644
index 00000000..6b91ad3c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1899.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1900.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1900.jpg
new file mode 100644
index 00000000..bf1987b7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1900.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1911.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1911.jpg
new file mode 100644
index 00000000..9b25081a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1911.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1914.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1914.jpg
new file mode 100644
index 00000000..43e5c269
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1914.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1916.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1916.jpg
new file mode 100644
index 00000000..d97ce103
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1916.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1931.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1931.jpg
new file mode 100644
index 00000000..4ae82c0e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1931.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1932.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1932.jpg
new file mode 100644
index 00000000..a0c432d8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1932.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1933.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1933.jpg
new file mode 100644
index 00000000..588f9a4a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1933.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1934.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1934.jpg
new file mode 100644
index 00000000..5add9aeb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1934.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1936.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1936.jpg
new file mode 100644
index 00000000..06077810
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1936.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1937.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1937.jpg
new file mode 100644
index 00000000..736e4c2d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1937.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1938.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1938.jpg
new file mode 100644
index 00000000..7a1786e3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1938.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1948.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1948.jpg
new file mode 100644
index 00000000..5e0a7dd6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1948.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1949.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1949.jpg
new file mode 100644
index 00000000..0e6ba949
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1949.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1963.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1963.jpg
new file mode 100644
index 00000000..fe49b92a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1963.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1964.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1964.jpg
new file mode 100644
index 00000000..4ee941d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1964.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1966.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1966.jpg
new file mode 100644
index 00000000..f2f96627
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1966.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1967.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1967.jpg
new file mode 100644
index 00000000..cb135501
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1967.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1981.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1981.jpg
new file mode 100644
index 00000000..32d8b2c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1981.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1982.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1982.jpg
new file mode 100644
index 00000000..85bb213e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1982.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1986.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1986.jpg
new file mode 100644
index 00000000..4b90f320
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1986.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1987.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1987.jpg
new file mode 100644
index 00000000..d8826bd0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1987.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1988.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1988.jpg
new file mode 100644
index 00000000..14bb5387
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1988.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1989.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1989.jpg
new file mode 100644
index 00000000..82767f05
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1989.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1990.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1990.jpg
new file mode 100644
index 00000000..d2acc131
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/1990.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2.jpg
new file mode 100644
index 00000000..1a263777
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2001.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2001.jpg
new file mode 100644
index 00000000..f37c49a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2001.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2008.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2008.jpg
new file mode 100644
index 00000000..ee14739c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2008.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2009.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2009.jpg
new file mode 100644
index 00000000..4ae589d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2009.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/201.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/201.jpg
new file mode 100644
index 00000000..7bfdb049
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/201.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2010.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2010.jpg
new file mode 100644
index 00000000..7ec31aa8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2010.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2011.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2011.jpg
new file mode 100644
index 00000000..a2fd9af8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2011.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2012.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2012.jpg
new file mode 100644
index 00000000..397a7305
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2012.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2013.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2013.jpg
new file mode 100644
index 00000000..2e1d91c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2013.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2014.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2014.jpg
new file mode 100644
index 00000000..13697811
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2014.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/202.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/202.jpg
new file mode 100644
index 00000000..78bd4342
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/202.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2031.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2031.jpg
new file mode 100644
index 00000000..5cb16a09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2031.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2032.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2032.jpg
new file mode 100644
index 00000000..d7f33d4b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2032.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2033.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2033.jpg
new file mode 100644
index 00000000..a0740bc7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2033.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2034.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2034.jpg
new file mode 100644
index 00000000..b51f5015
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2034.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2056.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2056.jpg
new file mode 100644
index 00000000..23aeffb1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2056.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2057.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2057.jpg
new file mode 100644
index 00000000..61f1ae67
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2057.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2058.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2058.jpg
new file mode 100644
index 00000000..85b15c73
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2058.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/206.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/206.jpg
new file mode 100644
index 00000000..dc0e7138
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/206.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2062.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2062.jpg
new file mode 100644
index 00000000..b1fd4b3c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2062.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2066.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2066.jpg
new file mode 100644
index 00000000..8ac0f8eb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2066.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2067.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2067.jpg
new file mode 100644
index 00000000..5bde3fe2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2067.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2068.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2068.jpg
new file mode 100644
index 00000000..b0275bfa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2068.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2069.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2069.jpg
new file mode 100644
index 00000000..e2f586f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2069.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2070.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2070.jpg
new file mode 100644
index 00000000..92084a25
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2070.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2071.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2071.jpg
new file mode 100644
index 00000000..8ecd7b92
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2071.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2074.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2074.jpg
new file mode 100644
index 00000000..f7ea7bea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2074.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/208.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/208.jpg
new file mode 100644
index 00000000..f485940b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/208.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2086.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2086.jpg
new file mode 100644
index 00000000..6c9e66ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2086.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2087.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2087.jpg
new file mode 100644
index 00000000..917fbbb6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2087.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/209.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/209.jpg
new file mode 100644
index 00000000..0c00f8a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/209.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2091.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2091.jpg
new file mode 100644
index 00000000..2989913d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2091.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2092.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2092.jpg
new file mode 100644
index 00000000..28566344
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2092.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2108.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2108.jpg
new file mode 100644
index 00000000..f7593dc4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2108.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2109.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2109.jpg
new file mode 100644
index 00000000..4e9058c2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2109.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/212.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/212.jpg
new file mode 100644
index 00000000..6e158fa7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/212.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2121.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2121.jpg
new file mode 100644
index 00000000..0dbcc22c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2121.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2124.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2124.jpg
new file mode 100644
index 00000000..f848678a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2124.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2126.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2126.jpg
new file mode 100644
index 00000000..6ec3a938
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2126.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2129.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2129.jpg
new file mode 100644
index 00000000..29266730
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2129.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/213.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/213.jpg
new file mode 100644
index 00000000..55ace06a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/213.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2130.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2130.jpg
new file mode 100644
index 00000000..deb06bb7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2130.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2131.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2131.jpg
new file mode 100644
index 00000000..2a4d7ae5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2131.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2132.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2132.jpg
new file mode 100644
index 00000000..51f30ba1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2132.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2133.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2133.jpg
new file mode 100644
index 00000000..61152479
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2133.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2134.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2134.jpg
new file mode 100644
index 00000000..1ef209c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2134.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2136.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2136.jpg
new file mode 100644
index 00000000..f806c86d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2136.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2151.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2151.jpg
new file mode 100644
index 00000000..f0a1fdc5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2151.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2152.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2152.jpg
new file mode 100644
index 00000000..3012a81d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2152.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2153.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2153.jpg
new file mode 100644
index 00000000..fdc55906
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2153.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2154.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2154.jpg
new file mode 100644
index 00000000..fec8ad50
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2154.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2156.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2156.jpg
new file mode 100644
index 00000000..53c44903
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2156.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2157.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2157.jpg
new file mode 100644
index 00000000..778eba84
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2157.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2158.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2158.jpg
new file mode 100644
index 00000000..40267b7a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2158.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2159.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2159.jpg
new file mode 100644
index 00000000..5478cb80
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2159.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2160.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2160.jpg
new file mode 100644
index 00000000..eb084cde
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2160.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/217.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/217.jpg
new file mode 100644
index 00000000..6959fa9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/217.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/218.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/218.jpg
new file mode 100644
index 00000000..96f882f8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/218.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/219.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/219.jpg
new file mode 100644
index 00000000..e3f3a256
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/219.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2196.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2196.jpg
new file mode 100644
index 00000000..d9828f73
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2196.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2198.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2198.jpg
new file mode 100644
index 00000000..6afa95a7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2198.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2199.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2199.jpg
new file mode 100644
index 00000000..05945495
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2199.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2200.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2200.jpg
new file mode 100644
index 00000000..3b17a955
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2200.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2201.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2201.jpg
new file mode 100644
index 00000000..95276ae0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2201.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2202.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2202.jpg
new file mode 100644
index 00000000..68ee99fb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2202.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/221.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/221.jpg
new file mode 100644
index 00000000..1e1fd5bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/221.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2216.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2216.jpg
new file mode 100644
index 00000000..69bc2e60
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2216.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2217.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2217.jpg
new file mode 100644
index 00000000..6247f375
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2217.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2220.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2220.jpg
new file mode 100644
index 00000000..b0364dfa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2220.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2221.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2221.jpg
new file mode 100644
index 00000000..1dd224cf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2221.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2222.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2222.jpg
new file mode 100644
index 00000000..87b12f26
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2222.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2223.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2223.jpg
new file mode 100644
index 00000000..4105b7b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2223.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2224.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2224.jpg
new file mode 100644
index 00000000..8dcd5d98
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2224.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2228.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2228.jpg
new file mode 100644
index 00000000..729c219b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2228.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2229.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2229.jpg
new file mode 100644
index 00000000..8bff1dbc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2229.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/223.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/223.jpg
new file mode 100644
index 00000000..f3312c6b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/223.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2230.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2230.jpg
new file mode 100644
index 00000000..15c8a099
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2230.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/224.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/224.jpg
new file mode 100644
index 00000000..9fe09600
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/224.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2241.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2241.jpg
new file mode 100644
index 00000000..e400123e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2241.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2244.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2244.jpg
new file mode 100644
index 00000000..63750180
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2244.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2246.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2246.jpg
new file mode 100644
index 00000000..443d9133
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2246.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2247.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2247.jpg
new file mode 100644
index 00000000..2b82f26e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2247.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/225.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/225.jpg
new file mode 100644
index 00000000..58ada76f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/225.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2250.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2250.jpg
new file mode 100644
index 00000000..2d82171c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2250.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2251.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2251.jpg
new file mode 100644
index 00000000..5638eea1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2251.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2252.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2252.jpg
new file mode 100644
index 00000000..13ccebdc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2252.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2253.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2253.jpg
new file mode 100644
index 00000000..bafc78ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2253.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2254.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2254.jpg
new file mode 100644
index 00000000..833ca39d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2254.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2256.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2256.jpg
new file mode 100644
index 00000000..87b76e54
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2256.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2259.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2259.jpg
new file mode 100644
index 00000000..3ead9999
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2259.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/226.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/226.jpg
new file mode 100644
index 00000000..63daf1df
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/226.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2282.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2282.jpg
new file mode 100644
index 00000000..382de010
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2282.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2283.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2283.jpg
new file mode 100644
index 00000000..b1d1d384
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2283.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2284.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2284.jpg
new file mode 100644
index 00000000..41d63772
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2284.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2286.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2286.jpg
new file mode 100644
index 00000000..31633350
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2286.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2287.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2287.jpg
new file mode 100644
index 00000000..43685e2a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2287.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2288.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2288.jpg
new file mode 100644
index 00000000..fc1da98c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2288.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/229.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/229.jpg
new file mode 100644
index 00000000..3e803d1e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/229.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2290.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2290.jpg
new file mode 100644
index 00000000..2c162091
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2290.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2296.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2296.jpg
new file mode 100644
index 00000000..f311e0a6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2296.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2297.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2297.jpg
new file mode 100644
index 00000000..3e2dc671
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2297.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2298.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2298.jpg
new file mode 100644
index 00000000..ea985cc9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2298.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2299.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2299.jpg
new file mode 100644
index 00000000..ae0627bb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2299.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2300.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2300.jpg
new file mode 100644
index 00000000..5741cc68
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2300.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/231.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/231.jpg
new file mode 100644
index 00000000..ebb584b5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/231.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2312.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2312.jpg
new file mode 100644
index 00000000..69817f5a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2312.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2313.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2313.jpg
new file mode 100644
index 00000000..341c8ce5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2313.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2327.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2327.jpg
new file mode 100644
index 00000000..f824b9d8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2327.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2330.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2330.jpg
new file mode 100644
index 00000000..c92f9faa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2330.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/234.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/234.jpg
new file mode 100644
index 00000000..8729611f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/234.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2341.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2341.jpg
new file mode 100644
index 00000000..429b4063
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2341.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2342.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2342.jpg
new file mode 100644
index 00000000..f8745a5b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2342.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2343.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2343.jpg
new file mode 100644
index 00000000..9829e2ad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2343.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2344.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2344.jpg
new file mode 100644
index 00000000..3714e56d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2344.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2349.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2349.jpg
new file mode 100644
index 00000000..f193ce1f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2349.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/235.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/235.jpg
new file mode 100644
index 00000000..f344ea95
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/235.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2350.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2350.jpg
new file mode 100644
index 00000000..e7718ae8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2350.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2356.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2356.jpg
new file mode 100644
index 00000000..f425a400
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2356.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2357.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2357.jpg
new file mode 100644
index 00000000..29f3fa27
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2357.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2358.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2358.jpg
new file mode 100644
index 00000000..8b06aa31
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2358.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2371.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2371.jpg
new file mode 100644
index 00000000..0692ccc9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2371.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2372.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2372.jpg
new file mode 100644
index 00000000..8e2711bc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2372.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2373.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2373.jpg
new file mode 100644
index 00000000..12d26bbc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2373.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2374.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2374.jpg
new file mode 100644
index 00000000..ff0b340b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2374.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/238.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/238.jpg
new file mode 100644
index 00000000..d4f94d64
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/238.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2396.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2396.jpg
new file mode 100644
index 00000000..8b2a4947
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2396.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2399.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2399.jpg
new file mode 100644
index 00000000..e67e8583
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2399.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2400.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2400.jpg
new file mode 100644
index 00000000..96402f63
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2400.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2403.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2403.jpg
new file mode 100644
index 00000000..e16b0ba0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2403.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2404.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2404.jpg
new file mode 100644
index 00000000..e53f7b86
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2404.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2407.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2407.jpg
new file mode 100644
index 00000000..6033ba4c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2407.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2409.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2409.jpg
new file mode 100644
index 00000000..56a06ac8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2409.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2410.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2410.jpg
new file mode 100644
index 00000000..c90e5d1b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2410.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2426.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2426.jpg
new file mode 100644
index 00000000..e7117970
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2426.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2427.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2427.jpg
new file mode 100644
index 00000000..5127f87f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2427.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2428.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2428.jpg
new file mode 100644
index 00000000..2f8bd93c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2428.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2429.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2429.jpg
new file mode 100644
index 00000000..7e41bc44
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2429.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2430.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2430.jpg
new file mode 100644
index 00000000..9e8c8484
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2430.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2432.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2432.jpg
new file mode 100644
index 00000000..22a11203
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2432.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2433.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2433.jpg
new file mode 100644
index 00000000..c2c3e29e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2433.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2434.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2434.jpg
new file mode 100644
index 00000000..12c6b642
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2434.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2440.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2440.jpg
new file mode 100644
index 00000000..21ef95f1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2440.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2461.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2461.jpg
new file mode 100644
index 00000000..994c3937
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2461.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2462.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2462.jpg
new file mode 100644
index 00000000..6da1a380
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2462.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2463.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2463.jpg
new file mode 100644
index 00000000..c977e634
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2463.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2464.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2464.jpg
new file mode 100644
index 00000000..3b02accf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2464.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2466.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2466.jpg
new file mode 100644
index 00000000..19b2f22d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2466.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2467.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2467.jpg
new file mode 100644
index 00000000..ac47ca3b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2467.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2470.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2470.jpg
new file mode 100644
index 00000000..fed3e0cc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2470.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2471.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2471.jpg
new file mode 100644
index 00000000..708c37b7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2471.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2474.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2474.jpg
new file mode 100644
index 00000000..86826a33
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2474.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2476.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2476.jpg
new file mode 100644
index 00000000..4e0b7746
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2476.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2477.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2477.jpg
new file mode 100644
index 00000000..54f8d9f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2477.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2478.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2478.jpg
new file mode 100644
index 00000000..c4634d5b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2478.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2479.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2479.jpg
new file mode 100644
index 00000000..e0a023a3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2479.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2483.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2483.jpg
new file mode 100644
index 00000000..60621ded
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2483.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2484.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2484.jpg
new file mode 100644
index 00000000..ac328156
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2484.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2496.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2496.jpg
new file mode 100644
index 00000000..a7eea2af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2496.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2499.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2499.jpg
new file mode 100644
index 00000000..83b97a88
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2499.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/25.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/25.jpg
new file mode 100644
index 00000000..bb7819f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/25.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2500.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2500.jpg
new file mode 100644
index 00000000..ab17951b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2500.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2513.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2513.jpg
new file mode 100644
index 00000000..c9ed7495
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2513.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2516.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2516.jpg
new file mode 100644
index 00000000..d8b7eba8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2516.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2517.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2517.jpg
new file mode 100644
index 00000000..d5db0755
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2517.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2518.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2518.jpg
new file mode 100644
index 00000000..f57b4818
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2518.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2519.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2519.jpg
new file mode 100644
index 00000000..4e3082fb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2519.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/253.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/253.jpg
new file mode 100644
index 00000000..725d25b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/253.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2532.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2532.jpg
new file mode 100644
index 00000000..0fcfe85c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2532.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2534.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2534.jpg
new file mode 100644
index 00000000..161f02c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2534.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2536.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2536.jpg
new file mode 100644
index 00000000..1fb46569
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2536.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2537.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2537.jpg
new file mode 100644
index 00000000..6466978a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2537.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2538.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2538.jpg
new file mode 100644
index 00000000..42f41ba9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2538.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2539.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2539.jpg
new file mode 100644
index 00000000..e850806c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2539.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/254.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/254.jpg
new file mode 100644
index 00000000..e3079fda
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/254.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2540.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2540.jpg
new file mode 100644
index 00000000..ea1518f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2540.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2547.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2547.jpg
new file mode 100644
index 00000000..c426f2fc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2547.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2549.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2549.jpg
new file mode 100644
index 00000000..d9bed4b7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2549.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/255.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/255.jpg
new file mode 100644
index 00000000..ffb3e10c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/255.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2550.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2550.jpg
new file mode 100644
index 00000000..9724923f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2550.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/256.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/256.jpg
new file mode 100644
index 00000000..c0df4fda
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/256.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/257.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/257.jpg
new file mode 100644
index 00000000..b631453e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/257.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2571.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2571.jpg
new file mode 100644
index 00000000..b4df1d04
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2571.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2572.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2572.jpg
new file mode 100644
index 00000000..02e3106b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2572.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2573.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2573.jpg
new file mode 100644
index 00000000..10d9965a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2573.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2574.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2574.jpg
new file mode 100644
index 00000000..c2477ac1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2574.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2580.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2580.jpg
new file mode 100644
index 00000000..33c6bedb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2580.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2581.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2581.jpg
new file mode 100644
index 00000000..3c76463c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2581.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2582.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2582.jpg
new file mode 100644
index 00000000..9ae41be6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2582.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2583.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2583.jpg
new file mode 100644
index 00000000..a337cd1e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2583.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2584.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2584.jpg
new file mode 100644
index 00000000..ccb2abb1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2584.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2586.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2586.jpg
new file mode 100644
index 00000000..eed8a766
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2586.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2588.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2588.jpg
new file mode 100644
index 00000000..69ffb789
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2588.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2589.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2589.jpg
new file mode 100644
index 00000000..f212fa21
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2589.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/259.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/259.jpg
new file mode 100644
index 00000000..b45a0f92
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/259.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2603.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2603.jpg
new file mode 100644
index 00000000..c4318d70
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2603.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2604.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2604.jpg
new file mode 100644
index 00000000..cdd81326
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2604.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2606.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2606.jpg
new file mode 100644
index 00000000..3a936e55
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2606.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2609.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2609.jpg
new file mode 100644
index 00000000..2427930f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2609.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2610.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2610.jpg
new file mode 100644
index 00000000..b97aa764
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2610.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2622.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2622.jpg
new file mode 100644
index 00000000..fd399a25
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2622.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2623.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2623.jpg
new file mode 100644
index 00000000..c5b7159c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/2623.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/27.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/27.jpg
new file mode 100644
index 00000000..1208a00f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/27.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/271.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/271.jpg
new file mode 100644
index 00000000..96c5fdb6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/271.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/277.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/277.jpg
new file mode 100644
index 00000000..22c451d1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/277.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/278.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/278.jpg
new file mode 100644
index 00000000..b9bc3ca9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/278.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/279.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/279.jpg
new file mode 100644
index 00000000..3a007c2f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/279.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/28.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/28.jpg
new file mode 100644
index 00000000..0c0e190b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/28.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/292.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/292.jpg
new file mode 100644
index 00000000..63984bb1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/292.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/293.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/293.jpg
new file mode 100644
index 00000000..27b3f1ec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/293.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/295.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/295.jpg
new file mode 100644
index 00000000..89f656f2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/295.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/299.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/299.jpg
new file mode 100644
index 00000000..9b1a7b45
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/299.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/3.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/3.jpg
new file mode 100644
index 00000000..a8dce145
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/3.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/312.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/312.jpg
new file mode 100644
index 00000000..fcabf923
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/312.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/313.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/313.jpg
new file mode 100644
index 00000000..1a55cfb7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/313.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/314.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/314.jpg
new file mode 100644
index 00000000..062ee1e6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/314.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/315.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/315.jpg
new file mode 100644
index 00000000..3a3d560f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/315.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/316.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/316.jpg
new file mode 100644
index 00000000..e47c3665
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/316.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/317.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/317.jpg
new file mode 100644
index 00000000..4741823c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/317.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/318.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/318.jpg
new file mode 100644
index 00000000..c0b3a04f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/318.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/332.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/332.jpg
new file mode 100644
index 00000000..28af3d8a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/332.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/333.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/333.jpg
new file mode 100644
index 00000000..4cbd116e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/333.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/336.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/336.jpg
new file mode 100644
index 00000000..94be86b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/336.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/371.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/371.jpg
new file mode 100644
index 00000000..14729862
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/371.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/372.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/372.jpg
new file mode 100644
index 00000000..b4f28589
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/372.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/373.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/373.jpg
new file mode 100644
index 00000000..bc0356be
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/373.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/375.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/375.jpg
new file mode 100644
index 00000000..962837e8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/375.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/378.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/378.jpg
new file mode 100644
index 00000000..f7f3c199
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/378.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/379.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/379.jpg
new file mode 100644
index 00000000..4075b69b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/379.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/380.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/380.jpg
new file mode 100644
index 00000000..0f20ee6e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/380.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/4.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/4.jpg
new file mode 100644
index 00000000..ee91adb1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/4.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/411.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/411.jpg
new file mode 100644
index 00000000..0c1085d2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/411.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/412.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/412.jpg
new file mode 100644
index 00000000..c588d6f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/412.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/416.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/416.jpg
new file mode 100644
index 00000000..169e7f8a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/416.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/417.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/417.jpg
new file mode 100644
index 00000000..21bb38b9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/417.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/420.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/420.jpg
new file mode 100644
index 00000000..0150e06d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/420.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/431.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/431.jpg
new file mode 100644
index 00000000..f4090a31
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/431.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/432.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/432.jpg
new file mode 100644
index 00000000..609bb965
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/432.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/433.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/433.jpg
new file mode 100644
index 00000000..7d9cb7b0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/433.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/435.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/435.jpg
new file mode 100644
index 00000000..4bf25c7a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/435.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/436.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/436.jpg
new file mode 100644
index 00000000..a965c7b6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/436.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/437.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/437.jpg
new file mode 100644
index 00000000..b5b47e52
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/437.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/439.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/439.jpg
new file mode 100644
index 00000000..9c5cc729
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/439.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/443.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/443.jpg
new file mode 100644
index 00000000..6644772a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/443.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/445.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/445.jpg
new file mode 100644
index 00000000..b2775d9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/445.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/446.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/446.jpg
new file mode 100644
index 00000000..79ec02aa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/446.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/447.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/447.jpg
new file mode 100644
index 00000000..0d654f0d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/447.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/448.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/448.jpg
new file mode 100644
index 00000000..006cbe59
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/448.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/449.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/449.jpg
new file mode 100644
index 00000000..efef53ec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/449.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/450.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/450.jpg
new file mode 100644
index 00000000..21394704
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/450.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/466.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/466.jpg
new file mode 100644
index 00000000..e984ed88
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/466.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/467.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/467.jpg
new file mode 100644
index 00000000..98c2d72a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/467.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/469.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/469.jpg
new file mode 100644
index 00000000..e7e6a0b9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/469.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/481.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/481.jpg
new file mode 100644
index 00000000..f2b74aa1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/481.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/482.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/482.jpg
new file mode 100644
index 00000000..50b0dadf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/482.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/483.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/483.jpg
new file mode 100644
index 00000000..923a156a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/483.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/488.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/488.jpg
new file mode 100644
index 00000000..2d2590a3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/488.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/490.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/490.jpg
new file mode 100644
index 00000000..39c16719
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/490.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/5.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/5.jpg
new file mode 100644
index 00000000..5a0c4122
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/5.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/501.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/501.jpg
new file mode 100644
index 00000000..3728aba9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/501.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/502.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/502.jpg
new file mode 100644
index 00000000..926cbf26
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/502.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/505.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/505.jpg
new file mode 100644
index 00000000..7418af03
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/505.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/507.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/507.jpg
new file mode 100644
index 00000000..ddc61f96
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/507.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/509.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/509.jpg
new file mode 100644
index 00000000..cb73374e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/509.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/51.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/51.jpg
new file mode 100644
index 00000000..863a0f66
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/51.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/521.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/521.jpg
new file mode 100644
index 00000000..ba787b7c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/521.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/522.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/522.jpg
new file mode 100644
index 00000000..c3b4d14d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/522.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/525.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/525.jpg
new file mode 100644
index 00000000..872cbaa5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/525.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/528.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/528.jpg
new file mode 100644
index 00000000..6947fb99
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/528.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/529.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/529.jpg
new file mode 100644
index 00000000..74747013
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/529.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/54.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/54.jpg
new file mode 100644
index 00000000..e340765b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/54.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/542.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/542.jpg
new file mode 100644
index 00000000..b43b9e24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/542.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/543.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/543.jpg
new file mode 100644
index 00000000..30ed1e75
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/543.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/546.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/546.jpg
new file mode 100644
index 00000000..c7fe8924
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/546.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/547.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/547.jpg
new file mode 100644
index 00000000..45f344ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/547.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/552.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/552.jpg
new file mode 100644
index 00000000..cb484550
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/552.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/557.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/557.jpg
new file mode 100644
index 00000000..499ba189
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/557.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/558.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/558.jpg
new file mode 100644
index 00000000..28627900
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/558.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/56.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/56.jpg
new file mode 100644
index 00000000..51296ee4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/56.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/560.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/560.jpg
new file mode 100644
index 00000000..b6e43bb5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/560.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/571.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/571.jpg
new file mode 100644
index 00000000..f47fa253
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/571.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/572.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/572.jpg
new file mode 100644
index 00000000..f842804a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/572.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/573.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/573.jpg
new file mode 100644
index 00000000..43fd6d1f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/573.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/578.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/578.jpg
new file mode 100644
index 00000000..858dfa44
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/578.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/579.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/579.jpg
new file mode 100644
index 00000000..8d3b8cd4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/579.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/58.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/58.jpg
new file mode 100644
index 00000000..70cc3dfa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/58.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/580.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/580.jpg
new file mode 100644
index 00000000..6bb8395d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/580.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/6.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/6.jpg
new file mode 100644
index 00000000..5c528a64
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/6.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/601.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/601.jpg
new file mode 100644
index 00000000..298cfd19
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/601.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/602.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/602.jpg
new file mode 100644
index 00000000..7c894691
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/602.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/606.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/606.jpg
new file mode 100644
index 00000000..afa53088
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/606.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/607.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/607.jpg
new file mode 100644
index 00000000..9bdd02b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/607.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/612.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/612.jpg
new file mode 100644
index 00000000..669e4c65
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/612.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/613.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/613.jpg
new file mode 100644
index 00000000..442e589a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/613.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/615.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/615.jpg
new file mode 100644
index 00000000..d76c1a88
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/615.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/617.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/617.jpg
new file mode 100644
index 00000000..6b10956d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/617.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/618.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/618.jpg
new file mode 100644
index 00000000..93ef0809
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/618.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/619.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/619.jpg
new file mode 100644
index 00000000..26314f77
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/619.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/623.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/623.jpg
new file mode 100644
index 00000000..4aca36bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/623.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/635.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/635.jpg
new file mode 100644
index 00000000..fae0f363
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/635.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/638.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/638.jpg
new file mode 100644
index 00000000..ee3cf6d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/638.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/639.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/639.jpg
new file mode 100644
index 00000000..f1861aa4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/639.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/640.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/640.jpg
new file mode 100644
index 00000000..20f60665
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/640.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/641.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/641.jpg
new file mode 100644
index 00000000..9b921102
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/641.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/645.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/645.jpg
new file mode 100644
index 00000000..1fcaafc2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/645.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/647.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/647.jpg
new file mode 100644
index 00000000..279ab052
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/647.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/648.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/648.jpg
new file mode 100644
index 00000000..8ebe9ac7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/648.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/652.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/652.jpg
new file mode 100644
index 00000000..b6585c65
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/652.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/653.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/653.jpg
new file mode 100644
index 00000000..0ededa8a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/653.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/657.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/657.jpg
new file mode 100644
index 00000000..505b3e4e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/657.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/658.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/658.jpg
new file mode 100644
index 00000000..41a25216
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/658.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/659.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/659.jpg
new file mode 100644
index 00000000..28333518
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/659.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/660.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/660.jpg
new file mode 100644
index 00000000..1c3b45e7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/660.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/681.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/681.jpg
new file mode 100644
index 00000000..4abd45ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/681.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/682.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/682.jpg
new file mode 100644
index 00000000..34e69d2f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/682.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/683.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/683.jpg
new file mode 100644
index 00000000..22e57495
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/683.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/689.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/689.jpg
new file mode 100644
index 00000000..8a2e42da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/689.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/7.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/7.jpg
new file mode 100644
index 00000000..d472cb73
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/7.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/701.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/701.jpg
new file mode 100644
index 00000000..5062e1c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/701.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/703.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/703.jpg
new file mode 100644
index 00000000..4cb4d70e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/703.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/72.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/72.jpg
new file mode 100644
index 00000000..d2786674
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/72.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/725.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/725.jpg
new file mode 100644
index 00000000..50bf48da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/725.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/726.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/726.jpg
new file mode 100644
index 00000000..8f6cd6db
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/726.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/729.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/729.jpg
new file mode 100644
index 00000000..001ed82a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/729.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/73.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/73.jpg
new file mode 100644
index 00000000..27f37065
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/73.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/733.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/733.jpg
new file mode 100644
index 00000000..065114de
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/733.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/758.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/758.jpg
new file mode 100644
index 00000000..bcd841ce
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/758.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/76.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/76.jpg
new file mode 100644
index 00000000..22d7b9c5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/76.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/760.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/760.jpg
new file mode 100644
index 00000000..ec7c9823
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/760.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/77.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/77.jpg
new file mode 100644
index 00000000..2b3755d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/77.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/773.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/773.jpg
new file mode 100644
index 00000000..fc279779
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/773.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/775.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/775.jpg
new file mode 100644
index 00000000..f2a332b5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/775.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/778.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/778.jpg
new file mode 100644
index 00000000..46fd983c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/778.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/78.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/78.jpg
new file mode 100644
index 00000000..feb60f4e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/78.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/780.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/780.jpg
new file mode 100644
index 00000000..9f327eb7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/780.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/781.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/781.jpg
new file mode 100644
index 00000000..58119f86
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/781.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/782.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/782.jpg
new file mode 100644
index 00000000..b595fb85
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/782.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/786.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/786.jpg
new file mode 100644
index 00000000..86aae3e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/786.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/787.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/787.jpg
new file mode 100644
index 00000000..cb4f14c3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/787.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/788.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/788.jpg
new file mode 100644
index 00000000..7d65ff11
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/788.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/79.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/79.jpg
new file mode 100644
index 00000000..42678068
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/79.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/791.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/791.jpg
new file mode 100644
index 00000000..ac07c0ed
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/791.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/792.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/792.jpg
new file mode 100644
index 00000000..54b2fcdf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/792.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/793.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/793.jpg
new file mode 100644
index 00000000..8fe3103a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/793.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/8.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/8.jpg
new file mode 100644
index 00000000..82625a28
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/8.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/828.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/828.jpg
new file mode 100644
index 00000000..3f5fa047
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/828.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/829.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/829.jpg
new file mode 100644
index 00000000..c93018d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/829.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/831.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/831.jpg
new file mode 100644
index 00000000..8c1bfea5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/831.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/833.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/833.jpg
new file mode 100644
index 00000000..6100e064
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/833.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/837.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/837.jpg
new file mode 100644
index 00000000..9722c137
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/837.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/851.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/851.jpg
new file mode 100644
index 00000000..ab597a82
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/851.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/852.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/852.jpg
new file mode 100644
index 00000000..d1e25c63
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/852.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/853.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/853.jpg
new file mode 100644
index 00000000..a8228773
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/853.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/854.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/854.jpg
new file mode 100644
index 00000000..aaf55cfa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/854.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/867.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/867.jpg
new file mode 100644
index 00000000..e5271884
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/867.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/868.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/868.jpg
new file mode 100644
index 00000000..fbafc006
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/868.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/884.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/884.jpg
new file mode 100644
index 00000000..8c2e4019
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/884.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/897.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/897.jpg
new file mode 100644
index 00000000..de078bb9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/897.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/899.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/899.jpg
new file mode 100644
index 00000000..4b8b5bea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/899.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/9.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/9.jpg
new file mode 100644
index 00000000..6924a66d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/9.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/911.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/911.jpg
new file mode 100644
index 00000000..39a93d91
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/911.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/914.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/914.jpg
new file mode 100644
index 00000000..4f47365f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/914.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/918.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/918.jpg
new file mode 100644
index 00000000..72d074f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/918.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/919.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/919.jpg
new file mode 100644
index 00000000..de1f33f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/919.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/93.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/93.jpg
new file mode 100644
index 00000000..70e30f91
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/93.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/931.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/931.jpg
new file mode 100644
index 00000000..5660257d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/931.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/932.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/932.jpg
new file mode 100644
index 00000000..4855706a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/932.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/933.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/933.jpg
new file mode 100644
index 00000000..fbd26def
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/933.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/94.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/94.jpg
new file mode 100644
index 00000000..858b1f98
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/94.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/957.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/957.jpg
new file mode 100644
index 00000000..5204b1ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/957.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/962.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/962.jpg
new file mode 100644
index 00000000..cad30dec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/962.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/964.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/964.jpg
new file mode 100644
index 00000000..88c8ee09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/964.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/98.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/98.jpg
new file mode 100644
index 00000000..41066331
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/98.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/980.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/980.jpg
new file mode 100644
index 00000000..94630c46
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/980.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/981.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/981.jpg
new file mode 100644
index 00000000..41560325
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/981.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/982.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/982.jpg
new file mode 100644
index 00000000..ec5403b6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/982.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/983.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/983.jpg
new file mode 100644
index 00000000..7d58a7f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/983.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/987.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/987.jpg
new file mode 100644
index 00000000..b88d1db2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/987.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/988.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/988.jpg
new file mode 100644
index 00000000..45992d64
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/988.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/99.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/99.jpg
new file mode 100644
index 00000000..74b6c833
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/99.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/991.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/991.jpg
new file mode 100644
index 00000000..3a8a0281
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/991.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/992.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/992.jpg
new file mode 100644
index 00000000..984e9c1e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/992.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/993.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/993.jpg
new file mode 100644
index 00000000..50b8542b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/993.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/994.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/994.jpg
new file mode 100644
index 00000000..8678af2e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/994.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/997.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/997.jpg
new file mode 100644
index 00000000..36596787
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/997.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/998.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/998.jpg
new file mode 100644
index 00000000..3535608f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/no_yawn/998.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/1.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/1.jpg
new file mode 100644
index 00000000..2249504c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/1.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/10.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/10.jpg
new file mode 100644
index 00000000..4c58c63a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/10.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/101.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/101.jpg
new file mode 100644
index 00000000..6fe1f890
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/101.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/103.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/103.jpg
new file mode 100644
index 00000000..1feb755f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/103.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/104.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/104.jpg
new file mode 100644
index 00000000..c0af9b5e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/104.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/106.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/106.jpg
new file mode 100644
index 00000000..03cb122b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/106.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/107.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/107.jpg
new file mode 100644
index 00000000..90067d68
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/107.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/108.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/108.jpg
new file mode 100644
index 00000000..2389e892
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/108.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/109.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/109.jpg
new file mode 100644
index 00000000..1509d83f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/109.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/11.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/11.jpg
new file mode 100644
index 00000000..311bb36c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/11.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/110.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/110.jpg
new file mode 100644
index 00000000..bed904b1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/110.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/112.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/112.jpg
new file mode 100644
index 00000000..f6dab67a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/112.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/113.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/113.jpg
new file mode 100644
index 00000000..06c11c26
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/113.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/114.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/114.jpg
new file mode 100644
index 00000000..7a6c9506
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/114.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/115.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/115.jpg
new file mode 100644
index 00000000..1c2e1806
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/115.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/117.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/117.jpg
new file mode 100644
index 00000000..de5bab00
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/117.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/118.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/118.jpg
new file mode 100644
index 00000000..de48f116
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/118.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/12.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/12.jpg
new file mode 100644
index 00000000..381d443a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/12.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/120.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/120.jpg
new file mode 100644
index 00000000..ebc5820d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/120.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/123.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/123.jpg
new file mode 100644
index 00000000..f1b0bbad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/123.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/124.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/124.jpg
new file mode 100644
index 00000000..c839e158
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/124.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/125.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/125.jpg
new file mode 100644
index 00000000..04259bd3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/125.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/126.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/126.jpg
new file mode 100644
index 00000000..a9591aeb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/126.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/128.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/128.jpg
new file mode 100644
index 00000000..525bcfd7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/128.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/129.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/129.jpg
new file mode 100644
index 00000000..e2dbe9fc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/129.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/13.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/13.jpg
new file mode 100644
index 00000000..dbbb2e5e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/13.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/130.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/130.jpg
new file mode 100644
index 00000000..d108f8b0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/130.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/132.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/132.jpg
new file mode 100644
index 00000000..4f5b0320
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/132.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/133.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/133.jpg
new file mode 100644
index 00000000..5707c1a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/133.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/135.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/135.jpg
new file mode 100644
index 00000000..c5f7e2fe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/135.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/136.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/136.jpg
new file mode 100644
index 00000000..3f20f6c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/136.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/137.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/137.jpg
new file mode 100644
index 00000000..36019d39
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/137.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/138.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/138.jpg
new file mode 100644
index 00000000..09bf2b1a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/138.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/139.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/139.jpg
new file mode 100644
index 00000000..d5fdfded
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/139.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/141.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/141.jpg
new file mode 100644
index 00000000..6f9b0613
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/141.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/142.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/142.jpg
new file mode 100644
index 00000000..ed0c8bef
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/142.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/143.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/143.jpg
new file mode 100644
index 00000000..7c106852
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/143.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/144.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/144.jpg
new file mode 100644
index 00000000..53599a89
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/144.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/146.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/146.jpg
new file mode 100644
index 00000000..a35ee560
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/146.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/147.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/147.jpg
new file mode 100644
index 00000000..d1b69ba4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/147.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/149.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/149.jpg
new file mode 100644
index 00000000..16d04842
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/149.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/15.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/15.jpg
new file mode 100644
index 00000000..5472ad8b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/15.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/150.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/150.jpg
new file mode 100644
index 00000000..25c50cf1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/150.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/151.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/151.jpg
new file mode 100644
index 00000000..ec9268a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/151.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/152.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/152.jpg
new file mode 100644
index 00000000..b0f4ad80
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/152.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/153.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/153.jpg
new file mode 100644
index 00000000..ec6d1247
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/153.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/154.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/154.jpg
new file mode 100644
index 00000000..6ba5c50a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/154.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/155.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/155.jpg
new file mode 100644
index 00000000..994ef320
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/155.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/156.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/156.jpg
new file mode 100644
index 00000000..fbef10d4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/156.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/157.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/157.jpg
new file mode 100644
index 00000000..5a845dfc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/157.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/158.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/158.jpg
new file mode 100644
index 00000000..7bdf01fc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/158.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/159.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/159.jpg
new file mode 100644
index 00000000..790daaf2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/159.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/16.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/16.jpg
new file mode 100644
index 00000000..4ef3b5ca
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/16.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/161.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/161.jpg
new file mode 100644
index 00000000..cd618bf9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/161.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/162.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/162.jpg
new file mode 100644
index 00000000..6ed37fc7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/162.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/163.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/163.jpg
new file mode 100644
index 00000000..662d4a23
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/163.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/164.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/164.jpg
new file mode 100644
index 00000000..146f9ca3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/164.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/165.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/165.jpg
new file mode 100644
index 00000000..9f9cc8b6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/165.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/166.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/166.jpg
new file mode 100644
index 00000000..04e0adb2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/166.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/167.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/167.jpg
new file mode 100644
index 00000000..f4ee54bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/167.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/17.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/17.jpg
new file mode 100644
index 00000000..5ce5a593
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/17.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/170.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/170.jpg
new file mode 100644
index 00000000..660c45f7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/170.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/171.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/171.jpg
new file mode 100644
index 00000000..a438498f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/171.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/172.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/172.jpg
new file mode 100644
index 00000000..5189a425
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/172.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/173.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/173.jpg
new file mode 100644
index 00000000..f3d70534
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/173.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/174.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/174.jpg
new file mode 100644
index 00000000..866e3d60
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/174.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/175.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/175.jpg
new file mode 100644
index 00000000..1b8b2b93
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/175.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/176.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/176.jpg
new file mode 100644
index 00000000..bd5a698f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/176.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/178.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/178.jpg
new file mode 100644
index 00000000..2c2414c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/178.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/179.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/179.jpg
new file mode 100644
index 00000000..c720946f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/179.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/18.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/18.jpg
new file mode 100644
index 00000000..ca0ff5da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/18.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/180.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/180.jpg
new file mode 100644
index 00000000..f9d14d03
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/180.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/181.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/181.jpg
new file mode 100644
index 00000000..d88af3d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/181.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/182.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/182.jpg
new file mode 100644
index 00000000..70f912fc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/182.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/183.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/183.jpg
new file mode 100644
index 00000000..81fe55f5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/183.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/184.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/184.jpg
new file mode 100644
index 00000000..5431f900
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/184.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/185.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/185.jpg
new file mode 100644
index 00000000..c1448b6c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/185.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/186.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/186.jpg
new file mode 100644
index 00000000..1ef3031a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/186.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/187.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/187.jpg
new file mode 100644
index 00000000..9012514a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/187.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/19.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/19.jpg
new file mode 100644
index 00000000..9cf748ed
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/19.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/190.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/190.jpg
new file mode 100644
index 00000000..227ca475
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/190.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/191.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/191.jpg
new file mode 100644
index 00000000..6e5fe563
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/191.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/192.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/192.jpg
new file mode 100644
index 00000000..07fc7a6b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/192.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/193.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/193.jpg
new file mode 100644
index 00000000..fa5614da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/193.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/194.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/194.jpg
new file mode 100644
index 00000000..11665256
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/194.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/195.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/195.jpg
new file mode 100644
index 00000000..a31ddae7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/195.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/196.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/196.jpg
new file mode 100644
index 00000000..e9e3507d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/196.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/197.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/197.jpg
new file mode 100644
index 00000000..1913a27b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/197.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/198.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/198.jpg
new file mode 100644
index 00000000..38855528
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/198.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/199.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/199.jpg
new file mode 100644
index 00000000..fb28b234
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/199.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/2.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/2.jpg
new file mode 100644
index 00000000..92711e42
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/2.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/20.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/20.jpg
new file mode 100644
index 00000000..9e3103a3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/20.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/200.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/200.jpg
new file mode 100644
index 00000000..9e5f9732
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/200.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/201.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/201.jpg
new file mode 100644
index 00000000..2e7669ba
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/201.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/202.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/202.jpg
new file mode 100644
index 00000000..93d81c29
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/202.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/203.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/203.jpg
new file mode 100644
index 00000000..a0659950
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/203.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/204.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/204.jpg
new file mode 100644
index 00000000..48ffc70b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/204.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/207.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/207.jpg
new file mode 100644
index 00000000..0d50175c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/207.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/208.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/208.jpg
new file mode 100644
index 00000000..e874f6b1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/208.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/209.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/209.jpg
new file mode 100644
index 00000000..39ea764a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/209.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/21.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/21.jpg
new file mode 100644
index 00000000..218c50e5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/21.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/210.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/210.jpg
new file mode 100644
index 00000000..8ce071d2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/210.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/211.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/211.jpg
new file mode 100644
index 00000000..ff786666
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/211.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/212.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/212.jpg
new file mode 100644
index 00000000..7a48e969
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/212.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/213.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/213.jpg
new file mode 100644
index 00000000..06745dde
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/213.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/215.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/215.jpg
new file mode 100644
index 00000000..43acda2d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/215.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/216.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/216.jpg
new file mode 100644
index 00000000..995d274c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/216.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/217.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/217.jpg
new file mode 100644
index 00000000..6ab3fc9e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/217.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/218.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/218.jpg
new file mode 100644
index 00000000..5acec918
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/218.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/219.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/219.jpg
new file mode 100644
index 00000000..042c4306
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/219.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/22.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/22.jpg
new file mode 100644
index 00000000..cb806447
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/22.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/220.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/220.jpg
new file mode 100644
index 00000000..9fb11f53
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/220.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/221.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/221.jpg
new file mode 100644
index 00000000..3fed2111
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/221.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/222.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/222.jpg
new file mode 100644
index 00000000..9dc594c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/222.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/223.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/223.jpg
new file mode 100644
index 00000000..3d7a1ff6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/223.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/224.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/224.jpg
new file mode 100644
index 00000000..001e7949
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/224.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/225.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/225.jpg
new file mode 100644
index 00000000..63ae8ae3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/225.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/226.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/226.jpg
new file mode 100644
index 00000000..af821da1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/226.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/227.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/227.jpg
new file mode 100644
index 00000000..54116774
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/227.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/228.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/228.jpg
new file mode 100644
index 00000000..454c6a64
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/228.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/23.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/23.jpg
new file mode 100644
index 00000000..bb1e126e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/23.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/230.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/230.jpg
new file mode 100644
index 00000000..b3de4522
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/230.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/231.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/231.jpg
new file mode 100644
index 00000000..c8533cbb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/231.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/232.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/232.jpg
new file mode 100644
index 00000000..fa3c2e54
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/232.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/236.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/236.jpg
new file mode 100644
index 00000000..26e087ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/236.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/237.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/237.jpg
new file mode 100644
index 00000000..bdcdcfe2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/237.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/238.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/238.jpg
new file mode 100644
index 00000000..96b89d6b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/238.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/24.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/24.jpg
new file mode 100644
index 00000000..ae775053
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/24.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/241.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/241.jpg
new file mode 100644
index 00000000..cc8a912d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/241.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/242.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/242.jpg
new file mode 100644
index 00000000..6a251641
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/242.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/243.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/243.jpg
new file mode 100644
index 00000000..f79576d9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/243.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/244.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/244.jpg
new file mode 100644
index 00000000..080f9e57
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/244.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/245.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/245.jpg
new file mode 100644
index 00000000..2574164b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/245.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/246.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/246.jpg
new file mode 100644
index 00000000..0d16dbe3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/246.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/247.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/247.jpg
new file mode 100644
index 00000000..5f17a622
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/247.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/25.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/25.jpg
new file mode 100644
index 00000000..a949a983
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/25.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/250.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/250.jpg
new file mode 100644
index 00000000..a07c990a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/250.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/251.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/251.jpg
new file mode 100644
index 00000000..c4a08d71
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/251.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/252.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/252.jpg
new file mode 100644
index 00000000..501db029
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/252.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/253.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/253.jpg
new file mode 100644
index 00000000..737525ac
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/253.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/254.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/254.jpg
new file mode 100644
index 00000000..457c3bef
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/254.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/255.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/255.jpg
new file mode 100644
index 00000000..9ecdb00e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/255.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/256.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/256.jpg
new file mode 100644
index 00000000..f0a2f780
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/256.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/258.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/258.jpg
new file mode 100644
index 00000000..ae7731e6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/258.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/26.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/26.jpg
new file mode 100644
index 00000000..47e8a073
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/26.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/260.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/260.jpg
new file mode 100644
index 00000000..be678b0f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/260.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/261.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/261.jpg
new file mode 100644
index 00000000..7ad1eb56
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/261.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/262.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/262.jpg
new file mode 100644
index 00000000..7975c8ed
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/262.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/263.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/263.jpg
new file mode 100644
index 00000000..2bf37dff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/263.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/264.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/264.jpg
new file mode 100644
index 00000000..c3efed9c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/264.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/265.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/265.jpg
new file mode 100644
index 00000000..785271c0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/265.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/266.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/266.jpg
new file mode 100644
index 00000000..6fb7774d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/266.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/267.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/267.jpg
new file mode 100644
index 00000000..8a0e7549
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/267.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/268.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/268.jpg
new file mode 100644
index 00000000..214fbb5f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/268.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/269.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/269.jpg
new file mode 100644
index 00000000..1df09c2b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/269.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/27.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/27.jpg
new file mode 100644
index 00000000..ddd2054e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/27.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/270.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/270.jpg
new file mode 100644
index 00000000..2888af10
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/270.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/271.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/271.jpg
new file mode 100644
index 00000000..98accd5a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/271.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/272.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/272.jpg
new file mode 100644
index 00000000..14dfa14b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/272.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/273.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/273.jpg
new file mode 100644
index 00000000..cf2c5c92
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/273.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/274.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/274.jpg
new file mode 100644
index 00000000..7fbb36d9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/274.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/275.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/275.jpg
new file mode 100644
index 00000000..84d87a52
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/275.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/276.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/276.jpg
new file mode 100644
index 00000000..271e3ec7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/276.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/277.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/277.jpg
new file mode 100644
index 00000000..ec18c9e6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/277.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/278.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/278.jpg
new file mode 100644
index 00000000..f42b0b01
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/278.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/279.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/279.jpg
new file mode 100644
index 00000000..aaada021
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/279.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/28.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/28.jpg
new file mode 100644
index 00000000..15a7ad24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/28.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/280.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/280.jpg
new file mode 100644
index 00000000..96cf319d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/280.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/281.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/281.jpg
new file mode 100644
index 00000000..fce014b5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/281.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/282.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/282.jpg
new file mode 100644
index 00000000..e34ccee0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/282.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/283.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/283.jpg
new file mode 100644
index 00000000..34b1330e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/283.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/284.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/284.jpg
new file mode 100644
index 00000000..3d754462
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/284.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/285.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/285.jpg
new file mode 100644
index 00000000..facbb853
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/285.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/287.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/287.jpg
new file mode 100644
index 00000000..26dbeb3b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/287.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/288.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/288.jpg
new file mode 100644
index 00000000..b443e19a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/288.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/289.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/289.jpg
new file mode 100644
index 00000000..0a5aa71c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/289.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/29.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/29.jpg
new file mode 100644
index 00000000..2ecddce0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/29.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/290.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/290.jpg
new file mode 100644
index 00000000..d02c4939
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/290.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/291.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/291.jpg
new file mode 100644
index 00000000..af3f14e0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/291.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/292.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/292.jpg
new file mode 100644
index 00000000..88076edf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/292.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/293.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/293.jpg
new file mode 100644
index 00000000..3d3f6735
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/293.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/294.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/294.jpg
new file mode 100644
index 00000000..261111a9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/294.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/295.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/295.jpg
new file mode 100644
index 00000000..b61e7e9c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/295.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/296.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/296.jpg
new file mode 100644
index 00000000..c50e69c7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/296.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/297.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/297.jpg
new file mode 100644
index 00000000..9bc5bcb6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/297.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/298.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/298.jpg
new file mode 100644
index 00000000..03a2d614
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/298.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/299.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/299.jpg
new file mode 100644
index 00000000..8ff25ae1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/299.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/3.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/3.jpg
new file mode 100644
index 00000000..bcbe9342
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/3.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/30.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/30.jpg
new file mode 100644
index 00000000..2a07a02f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/30.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/300.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/300.jpg
new file mode 100644
index 00000000..f2627336
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/300.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/301.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/301.jpg
new file mode 100644
index 00000000..bd99dfdf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/301.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/302.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/302.jpg
new file mode 100644
index 00000000..8af4c839
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/302.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/303.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/303.jpg
new file mode 100644
index 00000000..ae677491
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/303.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/304.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/304.jpg
new file mode 100644
index 00000000..d29b3eda
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/304.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/307.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/307.jpg
new file mode 100644
index 00000000..5d383363
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/307.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/308.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/308.jpg
new file mode 100644
index 00000000..865f1e86
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/308.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/309.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/309.jpg
new file mode 100644
index 00000000..74d57d77
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/309.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/31.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/31.jpg
new file mode 100644
index 00000000..7179135d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/31.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/310.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/310.jpg
new file mode 100644
index 00000000..af242d42
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/310.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/311.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/311.jpg
new file mode 100644
index 00000000..3eeec338
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/311.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/312.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/312.jpg
new file mode 100644
index 00000000..52270c2f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/312.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/313.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/313.jpg
new file mode 100644
index 00000000..88cc1855
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/313.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/314.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/314.jpg
new file mode 100644
index 00000000..06e1416f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/314.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/315.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/315.jpg
new file mode 100644
index 00000000..53854418
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/315.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/316.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/316.jpg
new file mode 100644
index 00000000..e4da8655
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/316.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/317.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/317.jpg
new file mode 100644
index 00000000..673e1fd2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/317.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/32.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/32.jpg
new file mode 100644
index 00000000..0518df9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/32.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/320.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/320.jpg
new file mode 100644
index 00000000..4c7c4f9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/320.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/321.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/321.jpg
new file mode 100644
index 00000000..b8cee218
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/321.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/323.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/323.jpg
new file mode 100644
index 00000000..6c7cbade
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/323.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/324.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/324.jpg
new file mode 100644
index 00000000..60ebe2ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/324.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/325.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/325.jpg
new file mode 100644
index 00000000..bfd75ceb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/325.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/326.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/326.jpg
new file mode 100644
index 00000000..1770d6ee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/326.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/327.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/327.jpg
new file mode 100644
index 00000000..f6a16986
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/327.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/328.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/328.jpg
new file mode 100644
index 00000000..2cedf2f2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/328.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/329.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/329.jpg
new file mode 100644
index 00000000..1315530e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/329.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/33.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/33.jpg
new file mode 100644
index 00000000..601a781c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/33.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/330.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/330.jpg
new file mode 100644
index 00000000..354ad86a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/330.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/334.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/334.jpg
new file mode 100644
index 00000000..cd5d5d56
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/334.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/335.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/335.jpg
new file mode 100644
index 00000000..cd6bb9a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/335.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/337.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/337.jpg
new file mode 100644
index 00000000..7d496e47
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/337.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/338.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/338.jpg
new file mode 100644
index 00000000..ff5f9c40
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/338.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/339.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/339.jpg
new file mode 100644
index 00000000..7a201a64
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/339.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/34.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/34.jpg
new file mode 100644
index 00000000..d771c063
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/34.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/340.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/340.jpg
new file mode 100644
index 00000000..31222857
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/340.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/341.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/341.jpg
new file mode 100644
index 00000000..15013134
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/341.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/342.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/342.jpg
new file mode 100644
index 00000000..5b046386
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/342.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/343.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/343.jpg
new file mode 100644
index 00000000..fa99dda6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/343.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/344.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/344.jpg
new file mode 100644
index 00000000..bcb0a24b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/344.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/345.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/345.jpg
new file mode 100644
index 00000000..6ac84cf8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/345.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/346.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/346.jpg
new file mode 100644
index 00000000..ca7c3d03
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/346.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/347.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/347.jpg
new file mode 100644
index 00000000..3deec74e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/347.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/348.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/348.jpg
new file mode 100644
index 00000000..fb6a43db
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/348.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/35.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/35.jpg
new file mode 100644
index 00000000..716e9499
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/35.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/350.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/350.jpg
new file mode 100644
index 00000000..1c0f3ba4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/350.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/351.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/351.jpg
new file mode 100644
index 00000000..931872d0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/351.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/352.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/352.jpg
new file mode 100644
index 00000000..5fa976e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/352.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/353.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/353.jpg
new file mode 100644
index 00000000..f091c3aa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/353.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/354.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/354.jpg
new file mode 100644
index 00000000..05cf9898
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/354.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/355.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/355.jpg
new file mode 100644
index 00000000..a5f91ee2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/355.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/356.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/356.jpg
new file mode 100644
index 00000000..855e4c92
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/356.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/358.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/358.jpg
new file mode 100644
index 00000000..5c6d502f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/358.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/359.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/359.jpg
new file mode 100644
index 00000000..cb6cd7c1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/359.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/36.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/36.jpg
new file mode 100644
index 00000000..50a07fb9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/36.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/360.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/360.jpg
new file mode 100644
index 00000000..8af0a8ae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/360.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/361.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/361.jpg
new file mode 100644
index 00000000..999e5dc6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/361.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/363.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/363.jpg
new file mode 100644
index 00000000..20e7f387
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/363.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/364.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/364.jpg
new file mode 100644
index 00000000..904e51e6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/364.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/365.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/365.jpg
new file mode 100644
index 00000000..a5885c5c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/365.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/367.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/367.jpg
new file mode 100644
index 00000000..2e0a6aee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/367.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/368.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/368.jpg
new file mode 100644
index 00000000..7f294756
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/368.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/369.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/369.jpg
new file mode 100644
index 00000000..473a7995
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/369.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/37.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/37.jpg
new file mode 100644
index 00000000..2302abd5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/37.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/370.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/370.jpg
new file mode 100644
index 00000000..5bc798e1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/370.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/371.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/371.jpg
new file mode 100644
index 00000000..43a0cab3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/371.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/372.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/372.jpg
new file mode 100644
index 00000000..0a032b75
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/372.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/373.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/373.jpg
new file mode 100644
index 00000000..c52696b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/373.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/374.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/374.jpg
new file mode 100644
index 00000000..671691da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/374.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/375.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/375.jpg
new file mode 100644
index 00000000..44d30574
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/375.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/376.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/376.jpg
new file mode 100644
index 00000000..d2ece7fc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/376.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/377.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/377.jpg
new file mode 100644
index 00000000..b6749415
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/377.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/378.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/378.jpg
new file mode 100644
index 00000000..073073da
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/378.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/38.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/38.jpg
new file mode 100644
index 00000000..ae687289
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/38.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/380.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/380.jpg
new file mode 100644
index 00000000..e017c1bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/380.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/383.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/383.jpg
new file mode 100644
index 00000000..ca2662a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/383.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/384.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/384.jpg
new file mode 100644
index 00000000..04f74285
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/384.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/387.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/387.jpg
new file mode 100644
index 00000000..ae6276c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/387.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/388.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/388.jpg
new file mode 100644
index 00000000..530b889b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/388.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/389.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/389.jpg
new file mode 100644
index 00000000..0f376b41
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/389.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/39.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/39.jpg
new file mode 100644
index 00000000..69b2aebd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/39.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/390.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/390.jpg
new file mode 100644
index 00000000..54947fd3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/390.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/391.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/391.jpg
new file mode 100644
index 00000000..49ae1a0b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/391.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/392.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/392.jpg
new file mode 100644
index 00000000..8ef9cc5d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/392.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/393.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/393.jpg
new file mode 100644
index 00000000..1897737c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/393.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/394.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/394.jpg
new file mode 100644
index 00000000..065fb720
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/394.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/395.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/395.jpg
new file mode 100644
index 00000000..a96db997
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/395.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/396.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/396.jpg
new file mode 100644
index 00000000..098f2ddd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/396.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/397.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/397.jpg
new file mode 100644
index 00000000..4ff1d205
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/397.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/398.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/398.jpg
new file mode 100644
index 00000000..9b114384
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/398.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/399.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/399.jpg
new file mode 100644
index 00000000..04935306
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/399.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/4.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/4.jpg
new file mode 100644
index 00000000..27c4dae5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/4.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/40.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/40.jpg
new file mode 100644
index 00000000..251d358f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/40.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/400.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/400.jpg
new file mode 100644
index 00000000..b809d94d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/400.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/401.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/401.jpg
new file mode 100644
index 00000000..e81ac186
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/401.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/402.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/402.jpg
new file mode 100644
index 00000000..2abe55de
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/402.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/403.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/403.jpg
new file mode 100644
index 00000000..87daa9ab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/403.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/404.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/404.jpg
new file mode 100644
index 00000000..cc15843d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/404.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/405.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/405.jpg
new file mode 100644
index 00000000..79f5964f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/405.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/406.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/406.jpg
new file mode 100644
index 00000000..bf931e4f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/406.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/407.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/407.jpg
new file mode 100644
index 00000000..51ddc686
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/407.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/408.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/408.jpg
new file mode 100644
index 00000000..75cae68d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/408.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/41.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/41.jpg
new file mode 100644
index 00000000..fdb96eff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/41.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/410.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/410.jpg
new file mode 100644
index 00000000..1b103b92
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/410.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/411.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/411.jpg
new file mode 100644
index 00000000..bc85dabe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/411.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/412.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/412.jpg
new file mode 100644
index 00000000..17e75125
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/412.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/413.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/413.jpg
new file mode 100644
index 00000000..9630a1db
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/413.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/414.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/414.jpg
new file mode 100644
index 00000000..e7c8b563
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/414.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/415.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/415.jpg
new file mode 100644
index 00000000..fd41d0dc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/415.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/416.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/416.jpg
new file mode 100644
index 00000000..6ed92436
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/416.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/417.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/417.jpg
new file mode 100644
index 00000000..506d4a60
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/417.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/418.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/418.jpg
new file mode 100644
index 00000000..8946c777
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/418.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/419.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/419.jpg
new file mode 100644
index 00000000..c14d0114
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/419.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/42.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/42.jpg
new file mode 100644
index 00000000..b6101c3f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/42.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/420.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/420.jpg
new file mode 100644
index 00000000..d48de90d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/420.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/421.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/421.jpg
new file mode 100644
index 00000000..ae0f2ee0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/421.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/422.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/422.jpg
new file mode 100644
index 00000000..ae208e97
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/422.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/423.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/423.jpg
new file mode 100644
index 00000000..6c1d8a1f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/423.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/424.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/424.jpg
new file mode 100644
index 00000000..b6dbdcc1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/424.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/425.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/425.jpg
new file mode 100644
index 00000000..c47ba381
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/425.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/426.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/426.jpg
new file mode 100644
index 00000000..ef7cd99c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/426.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/427.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/427.jpg
new file mode 100644
index 00000000..eadfcbde
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/427.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/428.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/428.jpg
new file mode 100644
index 00000000..95d9d905
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/428.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/429.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/429.jpg
new file mode 100644
index 00000000..5b2faad0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/429.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/43.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/43.jpg
new file mode 100644
index 00000000..42284046
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/43.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/430.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/430.jpg
new file mode 100644
index 00000000..893d5ee9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/430.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/431.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/431.jpg
new file mode 100644
index 00000000..0ae8a43b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/431.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/432.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/432.jpg
new file mode 100644
index 00000000..5d2d3e09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/432.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/433.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/433.jpg
new file mode 100644
index 00000000..f00dfe55
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/433.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/434.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/434.jpg
new file mode 100644
index 00000000..d98d692c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/434.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/435.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/435.jpg
new file mode 100644
index 00000000..e1608258
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/435.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/436.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/436.jpg
new file mode 100644
index 00000000..ef935e3e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/436.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/437.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/437.jpg
new file mode 100644
index 00000000..766fd2c7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/437.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/438.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/438.jpg
new file mode 100644
index 00000000..d1c2a590
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/438.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/439.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/439.jpg
new file mode 100644
index 00000000..cb750244
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/439.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/44.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/44.jpg
new file mode 100644
index 00000000..4fbce27b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/44.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/440.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/440.jpg
new file mode 100644
index 00000000..bff447aa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/440.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/441.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/441.jpg
new file mode 100644
index 00000000..32bbad29
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/441.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/442.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/442.jpg
new file mode 100644
index 00000000..b3f1f5a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/442.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/444.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/444.jpg
new file mode 100644
index 00000000..a2077fbb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/444.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/445.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/445.jpg
new file mode 100644
index 00000000..37ddf3d9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/445.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/446.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/446.jpg
new file mode 100644
index 00000000..512c48ff
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/446.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/447.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/447.jpg
new file mode 100644
index 00000000..ad720f14
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/447.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/448.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/448.jpg
new file mode 100644
index 00000000..b92b4923
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/448.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/449.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/449.jpg
new file mode 100644
index 00000000..30cd3569
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/449.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/45.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/45.jpg
new file mode 100644
index 00000000..df2a63fa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/45.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/450.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/450.jpg
new file mode 100644
index 00000000..8e88e9e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/450.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/452.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/452.jpg
new file mode 100644
index 00000000..2cea4da9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/452.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/453.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/453.jpg
new file mode 100644
index 00000000..749bd6e7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/453.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/454.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/454.jpg
new file mode 100644
index 00000000..30462920
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/454.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/456.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/456.jpg
new file mode 100644
index 00000000..7dc9a714
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/456.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/457.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/457.jpg
new file mode 100644
index 00000000..1e205fae
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/457.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/458.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/458.jpg
new file mode 100644
index 00000000..102eeb17
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/458.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/459.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/459.jpg
new file mode 100644
index 00000000..7b0d6c0d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/459.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/46.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/46.jpg
new file mode 100644
index 00000000..aa51a233
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/46.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/460.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/460.jpg
new file mode 100644
index 00000000..e5fe7817
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/460.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/462.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/462.jpg
new file mode 100644
index 00000000..45693fd0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/462.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/463.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/463.jpg
new file mode 100644
index 00000000..02cf6825
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/463.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/464.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/464.jpg
new file mode 100644
index 00000000..5da3169b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/464.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/467.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/467.jpg
new file mode 100644
index 00000000..e4c3b5b3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/467.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/468.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/468.jpg
new file mode 100644
index 00000000..6d5bdeb9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/468.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/469.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/469.jpg
new file mode 100644
index 00000000..5df30e14
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/469.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/470.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/470.jpg
new file mode 100644
index 00000000..de92efd2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/470.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/471.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/471.jpg
new file mode 100644
index 00000000..10c57353
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/471.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/472.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/472.jpg
new file mode 100644
index 00000000..5e636bb2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/472.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/473.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/473.jpg
new file mode 100644
index 00000000..f460bade
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/473.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/474.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/474.jpg
new file mode 100644
index 00000000..447db911
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/474.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/475.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/475.jpg
new file mode 100644
index 00000000..2aed5d01
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/475.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/476.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/476.jpg
new file mode 100644
index 00000000..0ac922ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/476.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/478.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/478.jpg
new file mode 100644
index 00000000..926896b7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/478.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/479.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/479.jpg
new file mode 100644
index 00000000..a735f8ca
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/479.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/48.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/48.jpg
new file mode 100644
index 00000000..7bdd030c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/48.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/481.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/481.jpg
new file mode 100644
index 00000000..f80b7a83
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/481.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/483.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/483.jpg
new file mode 100644
index 00000000..d3f054df
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/483.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/484.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/484.jpg
new file mode 100644
index 00000000..d2d122c8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/484.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/485.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/485.jpg
new file mode 100644
index 00000000..36366ddb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/485.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/486.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/486.jpg
new file mode 100644
index 00000000..86da09bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/486.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/487.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/487.jpg
new file mode 100644
index 00000000..f57a9631
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/487.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/488.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/488.jpg
new file mode 100644
index 00000000..99a66588
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/488.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/489.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/489.jpg
new file mode 100644
index 00000000..7e947c9f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/489.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/490.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/490.jpg
new file mode 100644
index 00000000..a2e785fe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/490.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/491.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/491.jpg
new file mode 100644
index 00000000..98e46b24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/491.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/492.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/492.jpg
new file mode 100644
index 00000000..840a277a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/492.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/493.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/493.jpg
new file mode 100644
index 00000000..d521b55b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/493.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/494.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/494.jpg
new file mode 100644
index 00000000..aac10f57
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/494.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/495.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/495.jpg
new file mode 100644
index 00000000..2e0dc337
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/495.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/496.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/496.jpg
new file mode 100644
index 00000000..3c2d43ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/496.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/497.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/497.jpg
new file mode 100644
index 00000000..40924e88
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/497.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/498.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/498.jpg
new file mode 100644
index 00000000..ccb5e640
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/498.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/499.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/499.jpg
new file mode 100644
index 00000000..98957d0d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/499.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/5.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/5.jpg
new file mode 100644
index 00000000..ed4c0b2c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/5.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/50.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/50.jpg
new file mode 100644
index 00000000..f09771b1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/50.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/500.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/500.jpg
new file mode 100644
index 00000000..0b1ad1bd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/500.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/501.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/501.jpg
new file mode 100644
index 00000000..2be8eee3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/501.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/502.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/502.jpg
new file mode 100644
index 00000000..637cd81e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/502.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/503.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/503.jpg
new file mode 100644
index 00000000..769b02bc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/503.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/504.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/504.jpg
new file mode 100644
index 00000000..93236dfe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/504.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/506.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/506.jpg
new file mode 100644
index 00000000..fc97a75b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/506.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/507.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/507.jpg
new file mode 100644
index 00000000..065311d6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/507.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/508.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/508.jpg
new file mode 100644
index 00000000..fc7e8339
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/508.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/509.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/509.jpg
new file mode 100644
index 00000000..db1a5ba0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/509.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/51.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/51.jpg
new file mode 100644
index 00000000..7a0aa6e9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/51.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/510.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/510.jpg
new file mode 100644
index 00000000..ada677bf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/510.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/512.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/512.jpg
new file mode 100644
index 00000000..aee0966f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/512.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/514.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/514.jpg
new file mode 100644
index 00000000..73be4394
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/514.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/515.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/515.jpg
new file mode 100644
index 00000000..d0868e4e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/515.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/516.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/516.jpg
new file mode 100644
index 00000000..afd0ddb0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/516.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/517.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/517.jpg
new file mode 100644
index 00000000..45eb75c7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/517.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/518.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/518.jpg
new file mode 100644
index 00000000..8a940b9a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/518.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/519.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/519.jpg
new file mode 100644
index 00000000..1c705df2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/519.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/52.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/52.jpg
new file mode 100644
index 00000000..f2c50069
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/52.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/520.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/520.jpg
new file mode 100644
index 00000000..c94a35b0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/520.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/521.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/521.jpg
new file mode 100644
index 00000000..fc398a74
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/521.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/522.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/522.jpg
new file mode 100644
index 00000000..45dee45a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/522.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/523.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/523.jpg
new file mode 100644
index 00000000..daf78263
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/523.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/524.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/524.jpg
new file mode 100644
index 00000000..5060101b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/524.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/525.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/525.jpg
new file mode 100644
index 00000000..5ea61223
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/525.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/528.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/528.jpg
new file mode 100644
index 00000000..a31ca5dd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/528.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/53.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/53.jpg
new file mode 100644
index 00000000..cdeebbdd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/53.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/530.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/530.jpg
new file mode 100644
index 00000000..76e57e6a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/530.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/531.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/531.jpg
new file mode 100644
index 00000000..ddbae917
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/531.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/532.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/532.jpg
new file mode 100644
index 00000000..dc082c13
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/532.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/533.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/533.jpg
new file mode 100644
index 00000000..4f815cc6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/533.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/534.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/534.jpg
new file mode 100644
index 00000000..cd53c514
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/534.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/535.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/535.jpg
new file mode 100644
index 00000000..9ecc160e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/535.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/536.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/536.jpg
new file mode 100644
index 00000000..571bb57a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/536.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/537.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/537.jpg
new file mode 100644
index 00000000..ad777280
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/537.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/539.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/539.jpg
new file mode 100644
index 00000000..5cb6d5b8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/539.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/54.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/54.jpg
new file mode 100644
index 00000000..03074551
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/54.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/540.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/540.jpg
new file mode 100644
index 00000000..4d7a6641
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/540.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/541.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/541.jpg
new file mode 100644
index 00000000..458cb1cb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/541.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/542.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/542.jpg
new file mode 100644
index 00000000..7a114c4e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/542.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/543.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/543.jpg
new file mode 100644
index 00000000..9da750e0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/543.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/544.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/544.jpg
new file mode 100644
index 00000000..063ebd0e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/544.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/545.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/545.jpg
new file mode 100644
index 00000000..8a79f656
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/545.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/546.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/546.jpg
new file mode 100644
index 00000000..5e016bc1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/546.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/549.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/549.jpg
new file mode 100644
index 00000000..b4a95cf7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/549.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/55.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/55.jpg
new file mode 100644
index 00000000..ad971efc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/55.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/550.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/550.jpg
new file mode 100644
index 00000000..a49d38e3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/550.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/552.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/552.jpg
new file mode 100644
index 00000000..d6fe83d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/552.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/553.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/553.jpg
new file mode 100644
index 00000000..af7b23ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/553.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/555.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/555.jpg
new file mode 100644
index 00000000..be12d471
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/555.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/556.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/556.jpg
new file mode 100644
index 00000000..92434f1a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/556.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/557.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/557.jpg
new file mode 100644
index 00000000..f576596a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/557.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/558.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/558.jpg
new file mode 100644
index 00000000..aa07f079
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/558.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/56.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/56.jpg
new file mode 100644
index 00000000..dcbf6636
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/56.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/560.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/560.jpg
new file mode 100644
index 00000000..a49034ea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/560.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/561.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/561.jpg
new file mode 100644
index 00000000..e40dc18d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/561.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/562.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/562.jpg
new file mode 100644
index 00000000..1752fe0a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/562.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/565.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/565.jpg
new file mode 100644
index 00000000..49a3dcbf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/565.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/566.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/566.jpg
new file mode 100644
index 00000000..3c73c0c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/566.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/567.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/567.jpg
new file mode 100644
index 00000000..9e4e81f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/567.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/568.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/568.jpg
new file mode 100644
index 00000000..09bb9b50
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/568.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/569.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/569.jpg
new file mode 100644
index 00000000..22921bb6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/569.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/57.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/57.jpg
new file mode 100644
index 00000000..7de65f63
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/57.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/570.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/570.jpg
new file mode 100644
index 00000000..309f0254
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/570.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/571.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/571.jpg
new file mode 100644
index 00000000..32029662
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/571.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/572.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/572.jpg
new file mode 100644
index 00000000..a0800c48
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/572.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/573.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/573.jpg
new file mode 100644
index 00000000..d53e0595
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/573.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/574.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/574.jpg
new file mode 100644
index 00000000..b425cd64
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/574.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/575.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/575.jpg
new file mode 100644
index 00000000..fdb614f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/575.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/576.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/576.jpg
new file mode 100644
index 00000000..cb43a23a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/576.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/577.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/577.jpg
new file mode 100644
index 00000000..82c6ffab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/577.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/578.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/578.jpg
new file mode 100644
index 00000000..55d952be
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/578.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/579.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/579.jpg
new file mode 100644
index 00000000..4d8b92ad
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/579.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/58.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/58.jpg
new file mode 100644
index 00000000..bc4bbdb8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/58.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/580.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/580.jpg
new file mode 100644
index 00000000..b10be0e1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/580.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/581.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/581.jpg
new file mode 100644
index 00000000..e1ebf60d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/581.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/582.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/582.jpg
new file mode 100644
index 00000000..0762b5f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/582.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/583.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/583.jpg
new file mode 100644
index 00000000..bc6627ac
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/583.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/584.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/584.jpg
new file mode 100644
index 00000000..b91489af
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/584.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/585.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/585.jpg
new file mode 100644
index 00000000..e0912b55
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/585.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/586.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/586.jpg
new file mode 100644
index 00000000..6c69797d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/586.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/587.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/587.jpg
new file mode 100644
index 00000000..7d81693b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/587.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/588.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/588.jpg
new file mode 100644
index 00000000..be449a10
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/588.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/589.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/589.jpg
new file mode 100644
index 00000000..e36159f0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/589.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/59.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/59.jpg
new file mode 100644
index 00000000..56c45eab
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/59.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/590.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/590.jpg
new file mode 100644
index 00000000..ced39f33
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/590.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/591.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/591.jpg
new file mode 100644
index 00000000..e345b5fe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/591.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/592.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/592.jpg
new file mode 100644
index 00000000..a642bb6f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/592.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/593.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/593.jpg
new file mode 100644
index 00000000..74c2e6de
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/593.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/594.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/594.jpg
new file mode 100644
index 00000000..c06e5df5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/594.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/595.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/595.jpg
new file mode 100644
index 00000000..c18ea0c9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/595.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/596.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/596.jpg
new file mode 100644
index 00000000..6011fef9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/596.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/597.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/597.jpg
new file mode 100644
index 00000000..272534bb
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/597.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/598.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/598.jpg
new file mode 100644
index 00000000..7037d8e0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/598.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/599.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/599.jpg
new file mode 100644
index 00000000..777c9cea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/599.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/6.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/6.jpg
new file mode 100644
index 00000000..03544d25
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/6.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/60.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/60.jpg
new file mode 100644
index 00000000..8fb07ce3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/60.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/600.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/600.jpg
new file mode 100644
index 00000000..894a12cf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/600.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/601.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/601.jpg
new file mode 100644
index 00000000..a0c2e93e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/601.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/603.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/603.jpg
new file mode 100644
index 00000000..9fcc272c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/603.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/604.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/604.jpg
new file mode 100644
index 00000000..039dd809
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/604.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/605.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/605.jpg
new file mode 100644
index 00000000..f24957e5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/605.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/607.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/607.jpg
new file mode 100644
index 00000000..ff00d28d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/607.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/608.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/608.jpg
new file mode 100644
index 00000000..eab1b995
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/608.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/609.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/609.jpg
new file mode 100644
index 00000000..c3ccd894
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/609.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/610.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/610.jpg
new file mode 100644
index 00000000..012dc598
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/610.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/611.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/611.jpg
new file mode 100644
index 00000000..536c05a0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/611.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/612.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/612.jpg
new file mode 100644
index 00000000..c994bf1a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/612.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/613.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/613.jpg
new file mode 100644
index 00000000..6b40f913
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/613.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/614.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/614.jpg
new file mode 100644
index 00000000..30296df8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/614.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/615.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/615.jpg
new file mode 100644
index 00000000..bf493c91
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/615.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/616.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/616.jpg
new file mode 100644
index 00000000..8358d087
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/616.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/617.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/617.jpg
new file mode 100644
index 00000000..da83d735
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/617.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/618.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/618.jpg
new file mode 100644
index 00000000..7241004d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/618.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/62.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/62.jpg
new file mode 100644
index 00000000..706d9bb9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/62.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/620.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/620.jpg
new file mode 100644
index 00000000..4b611ff3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/620.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/621.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/621.jpg
new file mode 100644
index 00000000..0b27e878
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/621.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/623.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/623.jpg
new file mode 100644
index 00000000..dde26cf2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/623.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/624.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/624.jpg
new file mode 100644
index 00000000..11269bc3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/624.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/625.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/625.jpg
new file mode 100644
index 00000000..163098b4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/625.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/626.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/626.jpg
new file mode 100644
index 00000000..144286d6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/626.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/627.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/627.jpg
new file mode 100644
index 00000000..d73134d4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/627.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/628.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/628.jpg
new file mode 100644
index 00000000..c65473aa
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/628.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/629.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/629.jpg
new file mode 100644
index 00000000..02564e60
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/629.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/631.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/631.jpg
new file mode 100644
index 00000000..d1d1d7cf
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/631.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/633.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/633.jpg
new file mode 100644
index 00000000..bfd60cea
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/633.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/634.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/634.jpg
new file mode 100644
index 00000000..019e2d06
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/634.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/635.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/635.jpg
new file mode 100644
index 00000000..64b0f785
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/635.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/636.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/636.jpg
new file mode 100644
index 00000000..e85b1a7f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/636.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/637.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/637.jpg
new file mode 100644
index 00000000..195aad24
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/637.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/638.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/638.jpg
new file mode 100644
index 00000000..fe642780
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/638.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/639.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/639.jpg
new file mode 100644
index 00000000..1dfd0a34
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/639.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/64.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/64.jpg
new file mode 100644
index 00000000..5150ede8
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/64.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/640.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/640.jpg
new file mode 100644
index 00000000..db37bec6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/640.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/641.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/641.jpg
new file mode 100644
index 00000000..cbc4aa2a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/641.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/642.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/642.jpg
new file mode 100644
index 00000000..a35788d5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/642.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/643.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/643.jpg
new file mode 100644
index 00000000..8168c92d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/643.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/644.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/644.jpg
new file mode 100644
index 00000000..1143a93f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/644.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/645.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/645.jpg
new file mode 100644
index 00000000..91dc3fc0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/645.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/647.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/647.jpg
new file mode 100644
index 00000000..5f0ff800
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/647.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/648.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/648.jpg
new file mode 100644
index 00000000..4ad5c367
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/648.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/65.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/65.jpg
new file mode 100644
index 00000000..2db8a2f2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/65.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/650.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/650.jpg
new file mode 100644
index 00000000..5b916a4f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/650.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/651.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/651.jpg
new file mode 100644
index 00000000..1b4e5e61
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/651.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/653.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/653.jpg
new file mode 100644
index 00000000..b9c0e1be
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/653.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/654.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/654.jpg
new file mode 100644
index 00000000..8fbe10d3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/654.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/655.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/655.jpg
new file mode 100644
index 00000000..0b1e5943
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/655.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/656.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/656.jpg
new file mode 100644
index 00000000..ecd262ee
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/656.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/657.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/657.jpg
new file mode 100644
index 00000000..04f25703
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/657.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/658.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/658.jpg
new file mode 100644
index 00000000..789440a3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/658.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/659.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/659.jpg
new file mode 100644
index 00000000..0ce7ce21
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/659.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/66.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/66.jpg
new file mode 100644
index 00000000..6d0213b7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/66.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/660.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/660.jpg
new file mode 100644
index 00000000..8e979885
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/660.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/661.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/661.jpg
new file mode 100644
index 00000000..fc7a4ad0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/661.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/663.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/663.jpg
new file mode 100644
index 00000000..c9f3c96d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/663.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/664.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/664.jpg
new file mode 100644
index 00000000..0d6f1524
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/664.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/665.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/665.jpg
new file mode 100644
index 00000000..754a66f9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/665.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/666.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/666.jpg
new file mode 100644
index 00000000..5a7042f5
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/666.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/667.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/667.jpg
new file mode 100644
index 00000000..91821028
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/667.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/668.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/668.jpg
new file mode 100644
index 00000000..67edd1d1
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/668.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/669.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/669.jpg
new file mode 100644
index 00000000..60bf60d7
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/669.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/67.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/67.jpg
new file mode 100644
index 00000000..710cae78
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/67.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/670.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/670.jpg
new file mode 100644
index 00000000..ab885636
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/670.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/671.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/671.jpg
new file mode 100644
index 00000000..c1d00cd3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/671.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/672.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/672.jpg
new file mode 100644
index 00000000..096aeffe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/672.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/673.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/673.jpg
new file mode 100644
index 00000000..40860245
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/673.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/674.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/674.jpg
new file mode 100644
index 00000000..00c7ffb3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/674.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/675.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/675.jpg
new file mode 100644
index 00000000..31c8e90a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/675.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/677.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/677.jpg
new file mode 100644
index 00000000..9e8c71e4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/677.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/679.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/679.jpg
new file mode 100644
index 00000000..ab694037
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/679.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/68.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/68.jpg
new file mode 100644
index 00000000..80698f4d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/68.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/680.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/680.jpg
new file mode 100644
index 00000000..ef554d74
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/680.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/682.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/682.jpg
new file mode 100644
index 00000000..9d513887
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/682.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/683.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/683.jpg
new file mode 100644
index 00000000..c7528eec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/683.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/684.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/684.jpg
new file mode 100644
index 00000000..f7fb30fe
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/684.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/685.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/685.jpg
new file mode 100644
index 00000000..076ee142
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/685.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/687.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/687.jpg
new file mode 100644
index 00000000..06447e4f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/687.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/688.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/688.jpg
new file mode 100644
index 00000000..bf6ab49d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/688.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/689.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/689.jpg
new file mode 100644
index 00000000..a0c62f44
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/689.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/69.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/69.jpg
new file mode 100644
index 00000000..975be7a2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/69.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/691.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/691.jpg
new file mode 100644
index 00000000..2e3b1405
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/691.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/692.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/692.jpg
new file mode 100644
index 00000000..372b9ede
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/692.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/693.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/693.jpg
new file mode 100644
index 00000000..ddf7bf27
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/693.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/694.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/694.jpg
new file mode 100644
index 00000000..7de9bb3b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/694.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/696.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/696.jpg
new file mode 100644
index 00000000..9468dc2c
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/696.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/697.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/697.jpg
new file mode 100644
index 00000000..35bd0684
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/697.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/698.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/698.jpg
new file mode 100644
index 00000000..4f1ac69f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/698.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/699.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/699.jpg
new file mode 100644
index 00000000..b20b9f18
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/699.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/7.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/7.jpg
new file mode 100644
index 00000000..734fddce
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/7.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/70.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/70.jpg
new file mode 100644
index 00000000..b021c4e2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/70.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/700.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/700.jpg
new file mode 100644
index 00000000..fcb00890
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/700.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/701.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/701.jpg
new file mode 100644
index 00000000..db1e7050
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/701.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/702.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/702.jpg
new file mode 100644
index 00000000..ddd8795f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/702.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/703.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/703.jpg
new file mode 100644
index 00000000..764fa4bc
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/703.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/704.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/704.jpg
new file mode 100644
index 00000000..d5942eec
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/704.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/705.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/705.jpg
new file mode 100644
index 00000000..b5f8c7d9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/705.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/706.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/706.jpg
new file mode 100644
index 00000000..68015f76
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/706.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/708.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/708.jpg
new file mode 100644
index 00000000..86030c44
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/708.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/71.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/71.jpg
new file mode 100644
index 00000000..9d9c91a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/71.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/710.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/710.jpg
new file mode 100644
index 00000000..48bf2f07
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/710.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/712.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/712.jpg
new file mode 100644
index 00000000..a2adfa63
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/712.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/713.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/713.jpg
new file mode 100644
index 00000000..94fdcdd0
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/713.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/714.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/714.jpg
new file mode 100644
index 00000000..6a73692a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/714.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/716.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/716.jpg
new file mode 100644
index 00000000..dc87b3f3
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/716.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/717.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/717.jpg
new file mode 100644
index 00000000..3d3df5a4
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/717.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/718.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/718.jpg
new file mode 100644
index 00000000..048b7e7a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/718.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/72.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/72.jpg
new file mode 100644
index 00000000..027b0c31
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/72.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/722.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/722.jpg
new file mode 100644
index 00000000..0ebd6c72
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/722.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/723.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/723.jpg
new file mode 100644
index 00000000..300cad42
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/723.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/724.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/724.jpg
new file mode 100644
index 00000000..4d1d355a
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/724.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/726.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/726.jpg
new file mode 100644
index 00000000..ce4cfc11
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/726.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/73.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/73.jpg
new file mode 100644
index 00000000..01586774
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/73.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/74.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/74.jpg
new file mode 100644
index 00000000..be55ba42
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/74.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/75.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/75.jpg
new file mode 100644
index 00000000..9859ea67
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/75.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/76.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/76.jpg
new file mode 100644
index 00000000..335dfc09
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/76.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/77.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/77.jpg
new file mode 100644
index 00000000..7747c9cd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/77.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/78.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/78.jpg
new file mode 100644
index 00000000..37f7594f
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/78.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/79.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/79.jpg
new file mode 100644
index 00000000..7b1b2a44
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/79.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/8.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/8.jpg
new file mode 100644
index 00000000..a06cc511
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/8.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/80.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/80.jpg
new file mode 100644
index 00000000..83f76def
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/80.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/82.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/82.jpg
new file mode 100644
index 00000000..8fff9048
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/82.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/83.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/83.jpg
new file mode 100644
index 00000000..12279078
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/83.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/85.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/85.jpg
new file mode 100644
index 00000000..406bd7fd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/85.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/87.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/87.jpg
new file mode 100644
index 00000000..095b58f6
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/87.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/88.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/88.jpg
new file mode 100644
index 00000000..7af22160
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/88.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/89.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/89.jpg
new file mode 100644
index 00000000..07b1fa44
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/89.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/9.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/9.jpg
new file mode 100644
index 00000000..35200c8e
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/9.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/90.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/90.jpg
new file mode 100644
index 00000000..4be6dcbd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/90.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/91.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/91.jpg
new file mode 100644
index 00000000..0a730e22
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/91.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/92.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/92.jpg
new file mode 100644
index 00000000..96c0ef4b
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/92.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/93.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/93.jpg
new file mode 100644
index 00000000..35556b51
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/93.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/94.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/94.jpg
new file mode 100644
index 00000000..639daf89
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/94.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/96.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/96.jpg
new file mode 100644
index 00000000..5db846be
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/96.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/97.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/97.jpg
new file mode 100644
index 00000000..c6710dd9
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/97.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/98.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/98.jpg
new file mode 100644
index 00000000..b439b9cd
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/98.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/99.jpg b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/99.jpg
new file mode 100644
index 00000000..e37050b2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/dataset_new/train/yawn/99.jpg differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/docs/docs.pdf b/MachineLearning Projects/Driver-Drowsiness-Detection/docs/docs.pdf
new file mode 100644
index 00000000..0d751dc2
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/docs/docs.pdf differ
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_frontalface_alt.xml b/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_frontalface_alt.xml
new file mode 100644
index 00000000..ade4b212
--- /dev/null
+++ b/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_frontalface_alt.xml
@@ -0,0 +1,24350 @@
+
+
+
+BOOST
+ HAAR
+ 20
+ 20
+
+ 213
+
+ 0
+ 22
+
+ <_>
+ 3
+ 8.2268941402435303e-01
+
+ <_>
+
+ 0 -1 0 4.0141958743333817e-03
+
+ 3.3794190734624863e-02 8.3781069517135620e-01
+ <_>
+
+ 0 -1 1 1.5151339583098888e-02
+
+ 1.5141320228576660e-01 7.4888122081756592e-01
+ <_>
+
+ 0 -1 2 4.2109931819140911e-03
+
+ 9.0049281716346741e-02 6.3748198747634888e-01
+ <_>
+ 16
+ 6.9566087722778320e+00
+
+ <_>
+
+ 0 -1 3 1.6227109590545297e-03
+
+ 6.9308586418628693e-02 7.1109461784362793e-01
+ <_>
+
+ 0 -1 4 2.2906649392098188e-03
+
+ 1.7958030104637146e-01 6.6686922311782837e-01
+ <_>
+
+ 0 -1 5 5.0025708042085171e-03
+
+ 1.6936729848384857e-01 6.5540069341659546e-01
+ <_>
+
+ 0 -1 6 7.9659894108772278e-03
+
+ 5.8663320541381836e-01 9.1414518654346466e-02
+ <_>
+
+ 0 -1 7 -3.5227010957896709e-03
+
+ 1.4131669700145721e-01 6.0318958759307861e-01
+ <_>
+
+ 0 -1 8 3.6667689681053162e-02
+
+ 3.6756721138954163e-01 7.9203182458877563e-01
+ <_>
+
+ 0 -1 9 9.3361474573612213e-03
+
+ 6.1613857746124268e-01 2.0885099470615387e-01
+ <_>
+
+ 0 -1 10 8.6961314082145691e-03
+
+ 2.8362309932708740e-01 6.3602739572525024e-01
+ <_>
+
+ 0 -1 11 1.1488880263641477e-03
+
+ 2.2235809266567230e-01 5.8007007837295532e-01
+ <_>
+
+ 0 -1 12 -2.1484689787030220e-03
+
+ 2.4064640700817108e-01 5.7870548963546753e-01
+ <_>
+
+ 0 -1 13 2.1219060290604830e-03
+
+ 5.5596548318862915e-01 1.3622370362281799e-01
+ <_>
+
+ 0 -1 14 -9.3949146568775177e-02
+
+ 8.5027372837066650e-01 4.7177401185035706e-01
+ <_>
+
+ 0 -1 15 1.3777789426967502e-03
+
+ 5.9936738014221191e-01 2.8345298767089844e-01
+ <_>
+
+ 0 -1 16 7.3063157498836517e-02
+
+ 4.3418860435485840e-01 7.0600342750549316e-01
+ <_>
+
+ 0 -1 17 3.6767389974556863e-04
+
+ 3.0278879404067993e-01 6.0515749454498291e-01
+ <_>
+
+ 0 -1 18 -6.0479710809886456e-03
+
+ 1.7984339594841003e-01 5.6752568483352661e-01
+ <_>
+ 21
+ 9.4985427856445312e+00
+
+ <_>
+
+ 0 -1 19 -1.6510689631104469e-02
+
+ 6.6442251205444336e-01 1.4248579740524292e-01
+ <_>
+
+ 0 -1 20 2.7052499353885651e-03
+
+ 6.3253521919250488e-01 1.2884770333766937e-01
+ <_>
+
+ 0 -1 21 2.8069869149476290e-03
+
+ 1.2402880191802979e-01 6.1931931972503662e-01
+ <_>
+
+ 0 -1 22 -1.5402400167658925e-03
+
+ 1.4321430027484894e-01 5.6700158119201660e-01
+ <_>
+
+ 0 -1 23 -5.6386279175058007e-04
+
+ 1.6574330627918243e-01 5.9052079916000366e-01
+ <_>
+
+ 0 -1 24 1.9253729842603207e-03
+
+ 2.6955071091651917e-01 5.7388240098953247e-01
+ <_>
+
+ 0 -1 25 -5.0214841030538082e-03
+
+ 1.8935389816761017e-01 5.7827740907669067e-01
+ <_>
+
+ 0 -1 26 2.6365420781075954e-03
+
+ 2.3093290627002716e-01 5.6954258680343628e-01
+ <_>
+
+ 0 -1 27 -1.5127769438549876e-03
+
+ 2.7596020698547363e-01 5.9566420316696167e-01
+ <_>
+
+ 0 -1 28 -1.0157439857721329e-02
+
+ 1.7325380444526672e-01 5.5220472812652588e-01
+ <_>
+
+ 0 -1 29 -1.1953660286962986e-02
+
+ 1.3394099473953247e-01 5.5590140819549561e-01
+ <_>
+
+ 0 -1 30 4.8859491944313049e-03
+
+ 3.6287039518356323e-01 6.1888492107391357e-01
+ <_>
+
+ 0 -1 31 -8.0132916569709778e-02
+
+ 9.1211050748825073e-02 5.4759448766708374e-01
+ <_>
+
+ 0 -1 32 1.0643280111253262e-03
+
+ 3.7151429057121277e-01 5.7113999128341675e-01
+ <_>
+
+ 0 -1 33 -1.3419450260698795e-03
+
+ 5.9533137083053589e-01 3.3180978894233704e-01
+ <_>
+
+ 0 -1 34 -5.4601140320301056e-02
+
+ 1.8440659344196320e-01 5.6028461456298828e-01
+ <_>
+
+ 0 -1 35 2.9071690514683723e-03
+
+ 3.5942441225051880e-01 6.1317151784896851e-01
+ <_>
+
+ 0 -1 36 7.4718717951327562e-04
+
+ 5.9943532943725586e-01 3.4595629572868347e-01
+ <_>
+
+ 0 -1 37 4.3013808317482471e-03
+
+ 4.1726520657539368e-01 6.9908452033996582e-01
+ <_>
+
+ 0 -1 38 4.5017572119832039e-03
+
+ 4.5097151398658752e-01 7.8014570474624634e-01
+ <_>
+
+ 0 -1 39 2.4138500913977623e-02
+
+ 5.4382127523422241e-01 1.3198269903659821e-01
+ <_>
+ 39
+ 1.8412969589233398e+01
+
+ <_>
+
+ 0 -1 40 1.9212230108678341e-03
+
+ 1.4152669906616211e-01 6.1998707056045532e-01
+ <_>
+
+ 0 -1 41 -1.2748669541906565e-04
+
+ 6.1910742521286011e-01 1.8849289417266846e-01
+ <_>
+
+ 0 -1 42 5.1409931620582938e-04
+
+ 1.4873969554901123e-01 5.8579277992248535e-01
+ <_>
+
+ 0 -1 43 4.1878609918057919e-03
+
+ 2.7469098567962646e-01 6.3592398166656494e-01
+ <_>
+
+ 0 -1 44 5.1015717908740044e-03
+
+ 5.8708512783050537e-01 2.1756289899349213e-01
+ <_>
+
+ 0 -1 45 -2.1448440384119749e-03
+
+ 5.8809447288513184e-01 2.9795908927917480e-01
+ <_>
+
+ 0 -1 46 -2.8977119363844395e-03
+
+ 2.3733270168304443e-01 5.8766472339630127e-01
+ <_>
+
+ 0 -1 47 -2.1610679104924202e-02
+
+ 1.2206549942493439e-01 5.1942020654678345e-01
+ <_>
+
+ 0 -1 48 -4.6299318782985210e-03
+
+ 2.6312309503555298e-01 5.8174091577529907e-01
+ <_>
+
+ 0 -1 49 5.9393711853772402e-04
+
+ 3.6386200785636902e-01 5.6985449790954590e-01
+ <_>
+
+ 0 -1 50 5.3878661245107651e-02
+
+ 4.3035310506820679e-01 7.5593662261962891e-01
+ <_>
+
+ 0 -1 51 1.8887349870055914e-03
+
+ 2.1226030588150024e-01 5.6134271621704102e-01
+ <_>
+
+ 0 -1 52 -2.3635339457541704e-03
+
+ 5.6318491697311401e-01 2.6427671313285828e-01
+ <_>
+
+ 0 -1 53 2.4017799645662308e-02
+
+ 5.7971078157424927e-01 2.7517059445381165e-01
+ <_>
+
+ 0 -1 54 2.0543030404951423e-04
+
+ 2.7052420377731323e-01 5.7525688409805298e-01
+ <_>
+
+ 0 -1 55 8.4790197433903813e-04
+
+ 5.4356247186660767e-01 2.3348769545555115e-01
+ <_>
+
+ 0 -1 56 1.4091329649090767e-03
+
+ 5.3194248676300049e-01 2.0631550252437592e-01
+ <_>
+
+ 0 -1 57 1.4642629539594054e-03
+
+ 5.4189807176589966e-01 3.0688610672950745e-01
+ <_>
+
+ 0 -1 58 1.6352549428120255e-03
+
+ 3.6953729391098022e-01 6.1128681898117065e-01
+ <_>
+
+ 0 -1 59 8.3172752056270838e-04
+
+ 3.5650369524955750e-01 6.0252362489700317e-01
+ <_>
+
+ 0 -1 60 -2.0998890977352858e-03
+
+ 1.9139820337295532e-01 5.3628271818161011e-01
+ <_>
+
+ 0 -1 61 -7.4213981861248612e-04
+
+ 3.8355550169944763e-01 5.5293101072311401e-01
+ <_>
+
+ 0 -1 62 3.2655049581080675e-03
+
+ 4.3128961324691772e-01 7.1018958091735840e-01
+ <_>
+
+ 0 -1 63 8.9134991867467761e-04
+
+ 3.9848309755325317e-01 6.3919639587402344e-01
+ <_>
+
+ 0 -1 64 -1.5284179709851742e-02
+
+ 2.3667329549789429e-01 5.4337137937545776e-01
+ <_>
+
+ 0 -1 65 4.8381411470472813e-03
+
+ 5.8175009489059448e-01 3.2391890883445740e-01
+ <_>
+
+ 0 -1 66 -9.1093179071322083e-04
+
+ 5.5405938625335693e-01 2.9118689894676208e-01
+ <_>
+
+ 0 -1 67 -6.1275060288608074e-03
+
+ 1.7752550542354584e-01 5.1966291666030884e-01
+ <_>
+
+ 0 -1 68 -4.4576259097084403e-04
+
+ 3.0241701006889343e-01 5.5335938930511475e-01
+ <_>
+
+ 0 -1 69 2.2646540775895119e-02
+
+ 4.4149309396743774e-01 6.9753772020339966e-01
+ <_>
+
+ 0 -1 70 -1.8804960418492556e-03
+
+ 2.7913948893547058e-01 5.4979521036148071e-01
+ <_>
+
+ 0 -1 71 7.0889107882976532e-03
+
+ 5.2631992101669312e-01 2.3855470120906830e-01
+ <_>
+
+ 0 -1 72 1.7318050377070904e-03
+
+ 4.3193790316581726e-01 6.9836008548736572e-01
+ <_>
+
+ 0 -1 73 -6.8482700735330582e-03
+
+ 3.0820429325103760e-01 5.3909200429916382e-01
+ <_>
+
+ 0 -1 74 -1.5062530110299122e-05
+
+ 5.5219221115112305e-01 3.1203660368919373e-01
+ <_>
+
+ 0 -1 75 2.9475569725036621e-02
+
+ 5.4013228416442871e-01 1.7706030607223511e-01
+ <_>
+
+ 0 -1 76 8.1387329846620560e-03
+
+ 5.1786178350448608e-01 1.2110190093517303e-01
+ <_>
+
+ 0 -1 77 2.0942950621247292e-02
+
+ 5.2902942895889282e-01 3.3112218976020813e-01
+ <_>
+
+ 0 -1 78 -9.5665529370307922e-03
+
+ 7.4719941616058350e-01 4.4519689679145813e-01
+ <_>
+ 33
+ 1.5324139595031738e+01
+
+ <_>
+
+ 0 -1 79 -2.8206960996612906e-04
+
+ 2.0640860497951508e-01 6.0767322778701782e-01
+ <_>
+
+ 0 -1 80 1.6790600493550301e-03
+
+ 5.8519971370697021e-01 1.2553839385509491e-01
+ <_>
+
+ 0 -1 81 6.9827912375330925e-04
+
+ 9.4018429517745972e-02 5.7289612293243408e-01
+ <_>
+
+ 0 -1 82 7.8959012171253562e-04
+
+ 1.7819879949092865e-01 5.6943088769912720e-01
+ <_>
+
+ 0 -1 83 -2.8560499195009470e-03
+
+ 1.6383990645408630e-01 5.7886648178100586e-01
+ <_>
+
+ 0 -1 84 -3.8122469559311867e-03
+
+ 2.0854400098323822e-01 5.5085647106170654e-01
+ <_>
+
+ 0 -1 85 1.5896620461717248e-03
+
+ 5.7027608156204224e-01 1.8572150170803070e-01
+ <_>
+
+ 0 -1 86 1.0078339837491512e-02
+
+ 5.1169431209564209e-01 2.1897700428962708e-01
+ <_>
+
+ 0 -1 87 -6.3526302576065063e-02
+
+ 7.1313798427581787e-01 4.0438130497932434e-01
+ <_>
+
+ 0 -1 88 -9.1031491756439209e-03
+
+ 2.5671818852424622e-01 5.4639732837677002e-01
+ <_>
+
+ 0 -1 89 -2.4035000242292881e-03
+
+ 1.7006659507751465e-01 5.5909740924835205e-01
+ <_>
+
+ 0 -1 90 1.5226360410451889e-03
+
+ 5.4105567932128906e-01 2.6190540194511414e-01
+ <_>
+
+ 0 -1 91 1.7997439950704575e-02
+
+ 3.7324368953704834e-01 6.5352207422256470e-01
+ <_>
+
+ 0 -1 92 -6.4538191072642803e-03
+
+ 2.6264819502830505e-01 5.5374461412429810e-01
+ <_>
+
+ 0 -1 93 -1.1880760081112385e-02
+
+ 2.0037539303302765e-01 5.5447459220886230e-01
+ <_>
+
+ 0 -1 94 1.2713660253211856e-03
+
+ 5.5919027328491211e-01 3.0319759249687195e-01
+ <_>
+
+ 0 -1 95 1.1376109905540943e-03
+
+ 2.7304071187973022e-01 5.6465089321136475e-01
+ <_>
+
+ 0 -1 96 -4.2651998810470104e-03
+
+ 1.4059090614318848e-01 5.4618209600448608e-01
+ <_>
+
+ 0 -1 97 -2.9602861031889915e-03
+
+ 1.7950350046157837e-01 5.4592901468276978e-01
+ <_>
+
+ 0 -1 98 -8.8448226451873779e-03
+
+ 5.7367831468582153e-01 2.8092199563980103e-01
+ <_>
+
+ 0 -1 99 -6.6430689767003059e-03
+
+ 2.3706759512424469e-01 5.5038261413574219e-01
+ <_>
+
+ 0 -1 100 3.9997808635234833e-03
+
+ 5.6081998348236084e-01 3.3042821288108826e-01
+ <_>
+
+ 0 -1 101 -4.1221720166504383e-03
+
+ 1.6401059925556183e-01 5.3789931535720825e-01
+ <_>
+
+ 0 -1 102 1.5624909661710262e-02
+
+ 5.2276492118835449e-01 2.2886039316654205e-01
+ <_>
+
+ 0 -1 103 -1.0356419719755650e-02
+
+ 7.0161938667297363e-01 4.2529278993606567e-01
+ <_>
+
+ 0 -1 104 -8.7960809469223022e-03
+
+ 2.7673470973968506e-01 5.3558301925659180e-01
+ <_>
+
+ 0 -1 105 1.6226939857006073e-01
+
+ 4.3422400951385498e-01 7.4425792694091797e-01
+ <_>
+
+ 0 -1 106 4.5542530715465546e-03
+
+ 5.7264858484268188e-01 2.5821250677108765e-01
+ <_>
+
+ 0 -1 107 -2.1309209987521172e-03
+
+ 2.1068480610847473e-01 5.3610187768936157e-01
+ <_>
+
+ 0 -1 108 -1.3208420015871525e-02
+
+ 7.5937908887863159e-01 4.5524680614471436e-01
+ <_>
+
+ 0 -1 109 -6.5996676683425903e-02
+
+ 1.2524759769439697e-01 5.3440397977828979e-01
+ <_>
+
+ 0 -1 110 7.9142656177282333e-03
+
+ 3.3153840899467468e-01 5.6010431051254272e-01
+ <_>
+
+ 0 -1 111 2.0894279703497887e-02
+
+ 5.5060499906539917e-01 2.7688381075859070e-01
+ <_>
+ 44
+ 2.1010639190673828e+01
+
+ <_>
+
+ 0 -1 112 1.1961159761995077e-03
+
+ 1.7626909911632538e-01 6.1562412977218628e-01
+ <_>
+
+ 0 -1 113 -1.8679830245673656e-03
+
+ 6.1181068420410156e-01 1.8323999643325806e-01
+ <_>
+
+ 0 -1 114 -1.9579799845814705e-04
+
+ 9.9044263362884521e-02 5.7238161563873291e-01
+ <_>
+
+ 0 -1 115 -8.0255657667294145e-04
+
+ 5.5798798799514771e-01 2.3772829771041870e-01
+ <_>
+
+ 0 -1 116 -2.4510810617357492e-03
+
+ 2.2314579784870148e-01 5.8589351177215576e-01
+ <_>
+
+ 0 -1 117 5.0361850298941135e-04
+
+ 2.6539939641952515e-01 5.7941037416458130e-01
+ <_>
+
+ 0 -1 118 4.0293349884450436e-03
+
+ 5.8038270473480225e-01 2.4848650395870209e-01
+ <_>
+
+ 0 -1 119 -1.4451709575951099e-02
+
+ 1.8303519487380981e-01 5.4842048883438110e-01
+ <_>
+
+ 0 -1 120 2.0380979403853416e-03
+
+ 3.3635589480400085e-01 6.0510927438735962e-01
+ <_>
+
+ 0 -1 121 -1.6155190533027053e-03
+
+ 2.2866420447826385e-01 5.4412460327148438e-01
+ <_>
+
+ 0 -1 122 3.3458340913057327e-03
+
+ 5.6259131431579590e-01 2.3923380672931671e-01
+ <_>
+
+ 0 -1 123 1.6379579901695251e-03
+
+ 3.9069938659667969e-01 5.9646219015121460e-01
+ <_>
+
+ 0 -1 124 3.0251210555434227e-02
+
+ 5.2484822273254395e-01 1.5757469832897186e-01
+ <_>
+
+ 0 -1 125 3.7251990288496017e-02
+
+ 4.1943109035491943e-01 6.7484188079833984e-01
+ <_>
+
+ 0 -1 126 -2.5109790265560150e-02
+
+ 1.8825499713420868e-01 5.4734510183334351e-01
+ <_>
+
+ 0 -1 127 -5.3099058568477631e-03
+
+ 1.3399730622768402e-01 5.2271109819412231e-01
+ <_>
+
+ 0 -1 128 1.2086479691788554e-03
+
+ 3.7620881199836731e-01 6.1096358299255371e-01
+ <_>
+
+ 0 -1 129 -2.1907679736614227e-02
+
+ 2.6631429791450500e-01 5.4040068387985229e-01
+ <_>
+
+ 0 -1 130 5.4116579703986645e-03
+
+ 5.3635787963867188e-01 2.2322730720043182e-01
+ <_>
+
+ 0 -1 131 6.9946326315402985e-02
+
+ 5.3582328557968140e-01 2.4536980688571930e-01
+ <_>
+
+ 0 -1 132 3.4520021290518343e-04
+
+ 2.4096719920635223e-01 5.3769302368164062e-01
+ <_>
+
+ 0 -1 133 1.2627709656953812e-03
+
+ 5.4258567094802856e-01 3.1556931138038635e-01
+ <_>
+
+ 0 -1 134 2.2719509899616241e-02
+
+ 4.1584059596061707e-01 6.5978652238845825e-01
+ <_>
+
+ 0 -1 135 -1.8111000536009669e-03
+
+ 2.8112530708312988e-01 5.5052447319030762e-01
+ <_>
+
+ 0 -1 136 3.3469670452177525e-03
+
+ 5.2600282430648804e-01 1.8914650380611420e-01
+ <_>
+
+ 0 -1 137 4.0791751234792173e-04
+
+ 5.6735092401504517e-01 3.3442100882530212e-01
+ <_>
+
+ 0 -1 138 1.2734799645841122e-02
+
+ 5.3435921669006348e-01 2.3956120014190674e-01
+ <_>
+
+ 0 -1 139 -7.3119727894663811e-03
+
+ 6.0108900070190430e-01 4.0222078561782837e-01
+ <_>
+
+ 0 -1 140 -5.6948751211166382e-02
+
+ 8.1991511583328247e-01 4.5431908965110779e-01
+ <_>
+
+ 0 -1 141 -5.0116591155529022e-03
+
+ 2.2002810239791870e-01 5.3577107191085815e-01
+ <_>
+
+ 0 -1 142 6.0334368608891964e-03
+
+ 4.4130811095237732e-01 7.1817511320114136e-01
+ <_>
+
+ 0 -1 143 3.9437441155314445e-03
+
+ 5.4788607358932495e-01 2.7917331457138062e-01
+ <_>
+
+ 0 -1 144 -3.6591119132936001e-03
+
+ 6.3578677177429199e-01 3.9897239208221436e-01
+ <_>
+
+ 0 -1 145 -3.8456181064248085e-03
+
+ 3.4936860203742981e-01 5.3006649017333984e-01
+ <_>
+
+ 0 -1 146 -7.1926261298358440e-03
+
+ 1.1196149885654449e-01 5.2296727895736694e-01
+ <_>
+
+ 0 -1 147 -5.2798941731452942e-02
+
+ 2.3871029913425446e-01 5.4534512758255005e-01
+ <_>
+
+ 0 -1 148 -7.9537667334079742e-03
+
+ 7.5869178771972656e-01 4.4393768906593323e-01
+ <_>
+
+ 0 -1 149 -2.7344180271029472e-03
+
+ 2.5654768943786621e-01 5.4893219470977783e-01
+ <_>
+
+ 0 -1 150 -1.8507939530536532e-03
+
+ 6.7343479394912720e-01 4.2524749040603638e-01
+ <_>
+
+ 0 -1 151 1.5918919816613197e-02
+
+ 5.4883527755737305e-01 2.2926619648933411e-01
+ <_>
+
+ 0 -1 152 -1.2687679845839739e-03
+
+ 6.1043310165405273e-01 4.0223899483680725e-01
+ <_>
+
+ 0 -1 153 6.2883910723030567e-03
+
+ 5.3108531236648560e-01 1.5361930429935455e-01
+ <_>
+
+ 0 -1 154 -6.2259892001748085e-03
+
+ 1.7291119694709778e-01 5.2416062355041504e-01
+ <_>
+
+ 0 -1 155 -1.2132599949836731e-02
+
+ 6.5977597236633301e-01 4.3251821398735046e-01
+ <_>
+ 50
+ 2.3918790817260742e+01
+
+ <_>
+
+ 0 -1 156 -3.9184908382594585e-03
+
+ 6.1034351587295532e-01 1.4693309366703033e-01
+ <_>
+
+ 0 -1 157 1.5971299726516008e-03
+
+ 2.6323631405830383e-01 5.8964669704437256e-01
+ <_>
+
+ 0 -1 158 1.7780110239982605e-02
+
+ 5.8728742599487305e-01 1.7603619396686554e-01
+ <_>
+
+ 0 -1 159 6.5334769897162914e-04
+
+ 1.5678019821643829e-01 5.5960661172866821e-01
+ <_>
+
+ 0 -1 160 -2.8353091329336166e-04
+
+ 1.9131539762020111e-01 5.7320362329483032e-01
+ <_>
+
+ 0 -1 161 1.6104689566418529e-03
+
+ 2.9149138927459717e-01 5.6230807304382324e-01
+ <_>
+
+ 0 -1 162 -9.7750619053840637e-02
+
+ 1.9434769451618195e-01 5.6482332944869995e-01
+ <_>
+
+ 0 -1 163 5.5182358482852578e-04
+
+ 3.1346169114112854e-01 5.5046397447586060e-01
+ <_>
+
+ 0 -1 164 -1.2858220376074314e-02
+
+ 2.5364819169044495e-01 5.7601428031921387e-01
+ <_>
+
+ 0 -1 165 4.1530239395797253e-03
+
+ 5.7677221298217773e-01 3.6597740650177002e-01
+ <_>
+
+ 0 -1 166 1.7092459602281451e-03
+
+ 2.8431910276412964e-01 5.9189391136169434e-01
+ <_>
+
+ 0 -1 167 7.5217359699308872e-03
+
+ 4.0524271130561829e-01 6.1831092834472656e-01
+ <_>
+
+ 0 -1 168 2.2479810286313295e-03
+
+ 5.7837551832199097e-01 3.1354010105133057e-01
+ <_>
+
+ 0 -1 169 5.2006211131811142e-02
+
+ 5.5413120985031128e-01 1.9166369736194611e-01
+ <_>
+
+ 0 -1 170 1.2085529975593090e-02
+
+ 4.0326559543609619e-01 6.6445910930633545e-01
+ <_>
+
+ 0 -1 171 1.4687820112158079e-05
+
+ 3.5359779000282288e-01 5.7093828916549683e-01
+ <_>
+
+ 0 -1 172 7.1395188570022583e-06
+
+ 3.0374449491500854e-01 5.6102699041366577e-01
+ <_>
+
+ 0 -1 173 -4.6001640148460865e-03
+
+ 7.1810871362686157e-01 4.5803260803222656e-01
+ <_>
+
+ 0 -1 174 2.0058949012309313e-03
+
+ 5.6219518184661865e-01 2.9536840319633484e-01
+ <_>
+
+ 0 -1 175 4.5050270855426788e-03
+
+ 4.6153879165649414e-01 7.6190179586410522e-01
+ <_>
+
+ 0 -1 176 1.1746830306947231e-02
+
+ 5.3438371419906616e-01 1.7725290358066559e-01
+ <_>
+
+ 0 -1 177 -5.8316338807344437e-02
+
+ 1.6862459480762482e-01 5.3407722711563110e-01
+ <_>
+
+ 0 -1 178 2.3629379575140774e-04
+
+ 3.7920561432838440e-01 6.0268038511276245e-01
+ <_>
+
+ 0 -1 179 -7.8156180679798126e-03
+
+ 1.5128670632839203e-01 5.3243237733840942e-01
+ <_>
+
+ 0 -1 180 -1.0876160115003586e-02
+
+ 2.0818220078945160e-01 5.3199452161788940e-01
+ <_>
+
+ 0 -1 181 -2.7745519764721394e-03
+
+ 4.0982469916343689e-01 5.2103281021118164e-01
+ <_>
+
+ 0 -1 182 -7.8276381827890873e-04
+
+ 5.6932741403579712e-01 3.4788420796394348e-01
+ <_>
+
+ 0 -1 183 1.3870409689843655e-02
+
+ 5.3267508745193481e-01 2.2576980292797089e-01
+ <_>
+
+ 0 -1 184 -2.3674910888075829e-02
+
+ 1.5513050556182861e-01 5.2007079124450684e-01
+ <_>
+
+ 0 -1 185 -1.4879409718560055e-05
+
+ 5.5005669593811035e-01 3.8201761245727539e-01
+ <_>
+
+ 0 -1 186 3.6190641112625599e-03
+
+ 4.2386838793754578e-01 6.6397482156753540e-01
+ <_>
+
+ 0 -1 187 -1.9817110151052475e-02
+
+ 2.1500380337238312e-01 5.3823578357696533e-01
+ <_>
+
+ 0 -1 188 -3.8154039066284895e-03
+
+ 6.6757112741470337e-01 4.2152971029281616e-01
+ <_>
+
+ 0 -1 189 -4.9775829538702965e-03
+
+ 2.2672890126705170e-01 5.3863281011581421e-01
+ <_>
+
+ 0 -1 190 2.2441020701080561e-03
+
+ 4.3086910247802734e-01 6.8557357788085938e-01
+ <_>
+
+ 0 -1 191 1.2282459996640682e-02
+
+ 5.8366149663925171e-01 3.4674790501594543e-01
+ <_>
+
+ 0 -1 192 -2.8548699337989092e-03
+
+ 7.0169448852539062e-01 4.3114539980888367e-01
+ <_>
+
+ 0 -1 193 -3.7875669077038765e-03
+
+ 2.8953450918197632e-01 5.2249461412429810e-01
+ <_>
+
+ 0 -1 194 -1.2201230274513364e-03
+
+ 2.9755708575248718e-01 5.4816448688507080e-01
+ <_>
+
+ 0 -1 195 1.0160599835216999e-02
+
+ 4.8888179659843445e-01 8.1826978921890259e-01
+ <_>
+
+ 0 -1 196 -1.6174569725990295e-02
+
+ 1.4814929664134979e-01 5.2399927377700806e-01
+ <_>
+
+ 0 -1 197 1.9292460754513741e-02
+
+ 4.7863098978996277e-01 7.3781907558441162e-01
+ <_>
+
+ 0 -1 198 -3.2479539513587952e-03
+
+ 7.3742228746414185e-01 4.4706439971923828e-01
+ <_>
+
+ 0 -1 199 -9.3803480267524719e-03
+
+ 3.4891548752784729e-01 5.5379962921142578e-01
+ <_>
+
+ 0 -1 200 -1.2606129981577396e-02
+
+ 2.3796869814395905e-01 5.3154432773590088e-01
+ <_>
+
+ 0 -1 201 -2.5621930137276649e-02
+
+ 1.9646880030632019e-01 5.1387697458267212e-01
+ <_>
+
+ 0 -1 202 -7.5741496402770281e-05
+
+ 5.5905228853225708e-01 3.3658531308174133e-01
+ <_>
+
+ 0 -1 203 -8.9210882782936096e-02
+
+ 6.3404656946659088e-02 5.1626348495483398e-01
+ <_>
+
+ 0 -1 204 -2.7670480776578188e-03
+
+ 7.3234677314758301e-01 4.4907060265541077e-01
+ <_>
+
+ 0 -1 205 2.7152578695677221e-04
+
+ 4.1148349642753601e-01 5.9855180978775024e-01
+ <_>
+ 51
+ 2.4527879714965820e+01
+
+ <_>
+
+ 0 -1 206 1.4786219689995050e-03
+
+ 2.6635450124740601e-01 6.6433167457580566e-01
+ <_>
+
+ 0 -1 207 -1.8741659587249160e-03
+
+ 6.1438488960266113e-01 2.5185129046440125e-01
+ <_>
+
+ 0 -1 208 -1.7151009524241090e-03
+
+ 5.7663410902023315e-01 2.3974630236625671e-01
+ <_>
+
+ 0 -1 209 -1.8939269939437509e-03
+
+ 5.6820458173751831e-01 2.5291448831558228e-01
+ <_>
+
+ 0 -1 210 -5.3006052039563656e-03
+
+ 1.6406759619712830e-01 5.5560797452926636e-01
+ <_>
+
+ 0 -1 211 -4.6662531793117523e-02
+
+ 6.1231541633605957e-01 4.7628301382064819e-01
+ <_>
+
+ 0 -1 212 -7.9431332414969802e-04
+
+ 5.7078588008880615e-01 2.8394040465354919e-01
+ <_>
+
+ 0 -1 213 1.4891670085489750e-02
+
+ 4.0896728634834290e-01 6.0063672065734863e-01
+ <_>
+
+ 0 -1 214 -1.2046529445797205e-03
+
+ 5.7124507427215576e-01 2.7052891254425049e-01
+ <_>
+
+ 0 -1 215 6.0619381256401539e-03
+
+ 5.2625042200088501e-01 3.2622259855270386e-01
+ <_>
+
+ 0 -1 216 -2.5286648888140917e-03
+
+ 6.8538308143615723e-01 4.1992568969726562e-01
+ <_>
+
+ 0 -1 217 -5.9010218828916550e-03
+
+ 3.2662820816040039e-01 5.4348129034042358e-01
+ <_>
+
+ 0 -1 218 5.6702760048210621e-03
+
+ 5.4684108495712280e-01 2.3190039396286011e-01
+ <_>
+
+ 0 -1 219 -3.0304100364446640e-03
+
+ 5.5706679821014404e-01 2.7082380652427673e-01
+ <_>
+
+ 0 -1 220 2.9803649522364140e-03
+
+ 3.7005689740180969e-01 5.8906257152557373e-01
+ <_>
+
+ 0 -1 221 -7.5840510427951813e-02
+
+ 2.1400700509548187e-01 5.4199481010437012e-01
+ <_>
+
+ 0 -1 222 1.9262539222836494e-02
+
+ 5.5267721414566040e-01 2.7265900373458862e-01
+ <_>
+
+ 0 -1 223 1.8888259364757687e-04
+
+ 3.9580118656158447e-01 6.0172098875045776e-01
+ <_>
+
+ 0 -1 224 2.9369549825787544e-02
+
+ 5.2413737773895264e-01 1.4357580244541168e-01
+ <_>
+
+ 0 -1 225 1.0417619487270713e-03
+
+ 3.3854091167449951e-01 5.9299832582473755e-01
+ <_>
+
+ 0 -1 226 2.6125640142709017e-03
+
+ 5.4853779077529907e-01 3.0215978622436523e-01
+ <_>
+
+ 0 -1 227 9.6977467183023691e-04
+
+ 3.3752760291099548e-01 5.5320328474044800e-01
+ <_>
+
+ 0 -1 228 5.9512659208849072e-04
+
+ 5.6317430734634399e-01 3.3593991398811340e-01
+ <_>
+
+ 0 -1 229 -1.0156559944152832e-01
+
+ 6.3735038042068481e-02 5.2304250001907349e-01
+ <_>
+
+ 0 -1 230 3.6156699061393738e-02
+
+ 5.1369631290435791e-01 1.0295289754867554e-01
+ <_>
+
+ 0 -1 231 3.4624140243977308e-03
+
+ 3.8793200254440308e-01 5.5582892894744873e-01
+ <_>
+
+ 0 -1 232 1.9554980099201202e-02
+
+ 5.2500867843627930e-01 1.8758599460124969e-01
+ <_>
+
+ 0 -1 233 -2.3121440317481756e-03
+
+ 6.6720288991928101e-01 4.6796411275863647e-01
+ <_>
+
+ 0 -1 234 -1.8605289515107870e-03
+
+ 7.1633791923522949e-01 4.3346709012985229e-01
+ <_>
+
+ 0 -1 235 -9.4026362057775259e-04
+
+ 3.0213609337806702e-01 5.6502032279968262e-01
+ <_>
+
+ 0 -1 236 -5.2418331615626812e-03
+
+ 1.8200090527534485e-01 5.2502560615539551e-01
+ <_>
+
+ 0 -1 237 1.1729019752237946e-04
+
+ 3.3891880512237549e-01 5.4459732770919800e-01
+ <_>
+
+ 0 -1 238 1.1878840159624815e-03
+
+ 4.0853491425514221e-01 6.2535631656646729e-01
+ <_>
+
+ 0 -1 239 -1.0881359688937664e-02
+
+ 3.3783990144729614e-01 5.7000827789306641e-01
+ <_>
+
+ 0 -1 240 1.7354859737679362e-03
+
+ 4.2046359181404114e-01 6.5230387449264526e-01
+ <_>
+
+ 0 -1 241 -6.5119052305817604e-03
+
+ 2.5952160358428955e-01 5.4281437397003174e-01
+ <_>
+
+ 0 -1 242 -1.2136430013924837e-03
+
+ 6.1651438474655151e-01 3.9778938889503479e-01
+ <_>
+
+ 0 -1 243 -1.0354240424931049e-02
+
+ 1.6280280053615570e-01 5.2195048332214355e-01
+ <_>
+
+ 0 -1 244 5.5858830455690622e-04
+
+ 3.1996509432792664e-01 5.5035740137100220e-01
+ <_>
+
+ 0 -1 245 1.5299649909138680e-02
+
+ 4.1039940714836121e-01 6.1223882436752319e-01
+ <_>
+
+ 0 -1 246 -2.1588210016489029e-02
+
+ 1.0349129885435104e-01 5.1973849534988403e-01
+ <_>
+
+ 0 -1 247 -1.2834629416465759e-01
+
+ 8.4938651323318481e-01 4.8931029438972473e-01
+ <_>
+
+ 0 -1 248 -2.2927189711481333e-03
+
+ 3.1301578879356384e-01 5.4715752601623535e-01
+ <_>
+
+ 0 -1 249 7.9915106296539307e-02
+
+ 4.8563209176063538e-01 6.0739892721176147e-01
+ <_>
+
+ 0 -1 250 -7.9441092908382416e-02
+
+ 8.3946740627288818e-01 4.6245330572128296e-01
+ <_>
+
+ 0 -1 251 -5.2800010889768600e-03
+
+ 1.8816959857940674e-01 5.3066980838775635e-01
+ <_>
+
+ 0 -1 252 1.0463109938427806e-03
+
+ 5.2712291479110718e-01 2.5830659270286560e-01
+ <_>
+
+ 0 -1 253 2.6317298761568964e-04
+
+ 4.2353048920631409e-01 5.7354408502578735e-01
+ <_>
+
+ 0 -1 254 -3.6173160187900066e-03
+
+ 6.9343960285186768e-01 4.4954448938369751e-01
+ <_>
+
+ 0 -1 255 1.1421879753470421e-02
+
+ 5.9009212255477905e-01 4.1381931304931641e-01
+ <_>
+
+ 0 -1 256 -1.9963278900831938e-03
+
+ 6.4663827419281006e-01 4.3272399902343750e-01
+ <_>
+ 56
+ 2.7153350830078125e+01
+
+ <_>
+
+ 0 -1 257 -9.9691245704889297e-03
+
+ 6.1423242092132568e-01 2.4822120368480682e-01
+ <_>
+
+ 0 -1 258 7.3073059320449829e-04
+
+ 5.7049518823623657e-01 2.3219659924507141e-01
+ <_>
+
+ 0 -1 259 6.4045301405712962e-04
+
+ 2.1122519671916962e-01 5.8149331808090210e-01
+ <_>
+
+ 0 -1 260 4.5424019917845726e-03
+
+ 2.9504820704460144e-01 5.8663117885589600e-01
+ <_>
+
+ 0 -1 261 9.2477443104144186e-05
+
+ 2.9909908771514893e-01 5.7913267612457275e-01
+ <_>
+
+ 0 -1 262 -8.6603146046400070e-03
+
+ 2.8130298852920532e-01 5.6355422735214233e-01
+ <_>
+
+ 0 -1 263 8.0515816807746887e-03
+
+ 3.5353690385818481e-01 6.0547572374343872e-01
+ <_>
+
+ 0 -1 264 4.3835240649059415e-04
+
+ 5.5965322256088257e-01 2.7315109968185425e-01
+ <_>
+
+ 0 -1 265 -9.8168973636347800e-05
+
+ 5.9780317544937134e-01 3.6385610699653625e-01
+ <_>
+
+ 0 -1 266 -1.1298790341243148e-03
+
+ 2.7552521228790283e-01 5.4327291250228882e-01
+ <_>
+
+ 0 -1 267 6.4356150105595589e-03
+
+ 4.3056419491767883e-01 7.0698332786560059e-01
+ <_>
+
+ 0 -1 268 -5.6829329580068588e-02
+
+ 2.4952429533004761e-01 5.2949970960617065e-01
+ <_>
+
+ 0 -1 269 4.0668169967830181e-03
+
+ 5.4785531759262085e-01 2.4977239966392517e-01
+ <_>
+
+ 0 -1 270 4.8164798499783501e-05
+
+ 3.9386010169982910e-01 5.7063561677932739e-01
+ <_>
+
+ 0 -1 271 6.1795017682015896e-03
+
+ 4.4076061248779297e-01 7.3947668075561523e-01
+ <_>
+
+ 0 -1 272 6.4985752105712891e-03
+
+ 5.4452431201934814e-01 2.4791529774665833e-01
+ <_>
+
+ 0 -1 273 -1.0211090557277203e-03
+
+ 2.5447669625282288e-01 5.3389710187911987e-01
+ <_>
+
+ 0 -1 274 -5.4247528314590454e-03
+
+ 2.7188581228256226e-01 5.3240692615509033e-01
+ <_>
+
+ 0 -1 275 -1.0559899965301156e-03
+
+ 3.1782880425453186e-01 5.5345088243484497e-01
+ <_>
+
+ 0 -1 276 6.6465808777138591e-04
+
+ 4.2842191457748413e-01 6.5581941604614258e-01
+ <_>
+
+ 0 -1 277 -2.7524109464138746e-04
+
+ 5.9028607606887817e-01 3.8102629780769348e-01
+ <_>
+
+ 0 -1 278 4.2293202131986618e-03
+
+ 3.8164898753166199e-01 5.7093858718872070e-01
+ <_>
+
+ 0 -1 279 -3.2868210691958666e-03
+
+ 1.7477439343929291e-01 5.2595442533493042e-01
+ <_>
+
+ 0 -1 280 1.5611879643984139e-04
+
+ 3.6017221212387085e-01 5.7256120443344116e-01
+ <_>
+
+ 0 -1 281 -7.3621381488919724e-06
+
+ 5.4018580913543701e-01 3.0444970726966858e-01
+ <_>
+
+ 0 -1 282 -1.4767250046133995e-02
+
+ 3.2207700610160828e-01 5.5734348297119141e-01
+ <_>
+
+ 0 -1 283 2.4489590898156166e-02
+
+ 4.3015280365943909e-01 6.5188127756118774e-01
+ <_>
+
+ 0 -1 284 -3.7652091123163700e-04
+
+ 3.5645830631256104e-01 5.5982369184494019e-01
+ <_>
+
+ 0 -1 285 7.3657688517414499e-06
+
+ 3.4907829761505127e-01 5.5618977546691895e-01
+ <_>
+
+ 0 -1 286 -1.5099939890205860e-02
+
+ 1.7762720584869385e-01 5.3352999687194824e-01
+ <_>
+
+ 0 -1 287 -3.8316650316119194e-03
+
+ 6.1496877670288086e-01 4.2213940620422363e-01
+ <_>
+
+ 0 -1 288 1.6925400123000145e-02
+
+ 5.4130148887634277e-01 2.1665850281715393e-01
+ <_>
+
+ 0 -1 289 -3.0477850232273340e-03
+
+ 6.4494907855987549e-01 4.3546178936958313e-01
+ <_>
+
+ 0 -1 290 3.2140589319169521e-03
+
+ 5.4001551866531372e-01 3.5232171416282654e-01
+ <_>
+
+ 0 -1 291 -4.0023201145231724e-03
+
+ 2.7745240926742554e-01 5.3384172916412354e-01
+ <_>
+
+ 0 -1 292 7.4182129465043545e-03
+
+ 5.6767392158508301e-01 3.7028178572654724e-01
+ <_>
+
+ 0 -1 293 -8.8764587417244911e-03
+
+ 7.7492219209671021e-01 4.5836889743804932e-01
+ <_>
+
+ 0 -1 294 2.7311739977449179e-03
+
+ 5.3387218713760376e-01 3.9966610074043274e-01
+ <_>
+
+ 0 -1 295 -2.5082379579544067e-03
+
+ 5.6119632720947266e-01 3.7774989008903503e-01
+ <_>
+
+ 0 -1 296 -8.0541074275970459e-03
+
+ 2.9152289032936096e-01 5.1791828870773315e-01
+ <_>
+
+ 0 -1 297 -9.7938813269138336e-04
+
+ 5.5364328622817993e-01 3.7001928687095642e-01
+ <_>
+
+ 0 -1 298 -5.8745909482240677e-03
+
+ 3.7543910741806030e-01 5.6793761253356934e-01
+ <_>
+
+ 0 -1 299 -4.4936719350516796e-03
+
+ 7.0196992158889771e-01 4.4809499382972717e-01
+ <_>
+
+ 0 -1 300 -5.4389229044318199e-03
+
+ 2.3103649914264679e-01 5.3133869171142578e-01
+ <_>
+
+ 0 -1 301 -7.5094640487805009e-04
+
+ 5.8648687601089478e-01 4.1293430328369141e-01
+ <_>
+
+ 0 -1 302 1.4528800420521293e-05
+
+ 3.7324070930480957e-01 5.6196212768554688e-01
+ <_>
+
+ 0 -1 303 4.0758069604635239e-02
+
+ 5.3120911121368408e-01 2.7205219864845276e-01
+ <_>
+
+ 0 -1 304 6.6505931317806244e-03
+
+ 4.7100159525871277e-01 6.6934937238693237e-01
+ <_>
+
+ 0 -1 305 4.5759351924061775e-03
+
+ 5.1678192615509033e-01 1.6372759640216827e-01
+ <_>
+
+ 0 -1 306 6.5269311890006065e-03
+
+ 5.3976088762283325e-01 2.9385319352149963e-01
+ <_>
+
+ 0 -1 307 -1.3660379685461521e-02
+
+ 7.0864880084991455e-01 4.5322000980377197e-01
+ <_>
+
+ 0 -1 308 2.7358869090676308e-02
+
+ 5.2064812183380127e-01 3.5892319679260254e-01
+ <_>
+
+ 0 -1 309 6.2197551596909761e-04
+
+ 3.5070759057998657e-01 5.4411232471466064e-01
+ <_>
+
+ 0 -1 310 -3.3077080734074116e-03
+
+ 5.8595228195190430e-01 4.0248918533325195e-01
+ <_>
+
+ 0 -1 311 -1.0631109587848186e-02
+
+ 6.7432671785354614e-01 4.4226029515266418e-01
+ <_>
+
+ 0 -1 312 1.9441649317741394e-02
+
+ 5.2827161550521851e-01 1.7979049682617188e-01
+ <_>
+ 71
+ 3.4554111480712891e+01
+
+ <_>
+
+ 0 -1 313 -5.5052167735993862e-03
+
+ 5.9147310256958008e-01 2.6265591382980347e-01
+ <_>
+
+ 0 -1 314 1.9562279339879751e-03
+
+ 2.3125819861888885e-01 5.7416272163391113e-01
+ <_>
+
+ 0 -1 315 -8.8924784213304520e-03
+
+ 1.6565300524234772e-01 5.6266540288925171e-01
+ <_>
+
+ 0 -1 316 8.3638377487659454e-02
+
+ 5.4234498739242554e-01 1.9572949409484863e-01
+ <_>
+
+ 0 -1 317 1.2282270472496748e-03
+
+ 3.4179040789604187e-01 5.9925037622451782e-01
+ <_>
+
+ 0 -1 318 5.7629169896245003e-03
+
+ 3.7195819616317749e-01 6.0799038410186768e-01
+ <_>
+
+ 0 -1 319 -1.6417410224676132e-03
+
+ 2.5774860382080078e-01 5.5769157409667969e-01
+ <_>
+
+ 0 -1 320 3.4113149158656597e-03
+
+ 2.9507490992546082e-01 5.5141717195510864e-01
+ <_>
+
+ 0 -1 321 -1.1069320142269135e-02
+
+ 7.5693589448928833e-01 4.4770789146423340e-01
+ <_>
+
+ 0 -1 322 3.4865971654653549e-02
+
+ 5.5837088823318481e-01 2.6696211099624634e-01
+ <_>
+
+ 0 -1 323 6.5701099811121821e-04
+
+ 5.6273132562637329e-01 2.9888901114463806e-01
+ <_>
+
+ 0 -1 324 -2.4339130148291588e-02
+
+ 2.7711850404739380e-01 5.1088631153106689e-01
+ <_>
+
+ 0 -1 325 5.9435202274471521e-04
+
+ 5.5806517601013184e-01 3.1203418970108032e-01
+ <_>
+
+ 0 -1 326 2.2971509024500847e-03
+
+ 3.3302500844001770e-01 5.6790757179260254e-01
+ <_>
+
+ 0 -1 327 -3.7801829166710377e-03
+
+ 2.9905349016189575e-01 5.3448081016540527e-01
+ <_>
+
+ 0 -1 328 -1.3420669734477997e-01
+
+ 1.4638589322566986e-01 5.3925681114196777e-01
+ <_>
+
+ 0 -1 329 7.5224548345431685e-04
+
+ 3.7469539046287537e-01 5.6927347183227539e-01
+ <_>
+
+ 0 -1 330 -4.0545541793107986e-02
+
+ 2.7547478675842285e-01 5.4842978715896606e-01
+ <_>
+
+ 0 -1 331 1.2572970008477569e-03
+
+ 3.7445840239524841e-01 5.7560759782791138e-01
+ <_>
+
+ 0 -1 332 -7.4249948374927044e-03
+
+ 7.5138592720031738e-01 4.7282311320304871e-01
+ <_>
+
+ 0 -1 333 5.0908129196614027e-04
+
+ 5.4048967361450195e-01 2.9323211312294006e-01
+ <_>
+
+ 0 -1 334 -1.2808450264856219e-03
+
+ 6.1697798967361450e-01 4.2733490467071533e-01
+ <_>
+
+ 0 -1 335 -1.8348860321566463e-03
+
+ 2.0484960079193115e-01 5.2064722776412964e-01
+ <_>
+
+ 0 -1 336 2.7484869584441185e-02
+
+ 5.2529847621917725e-01 1.6755220293998718e-01
+ <_>
+
+ 0 -1 337 2.2372419480234385e-03
+
+ 5.2677828073501587e-01 2.7776581048965454e-01
+ <_>
+
+ 0 -1 338 -8.8635291904211044e-03
+
+ 6.9545578956604004e-01 4.8120489716529846e-01
+ <_>
+
+ 0 -1 339 4.1753971017897129e-03
+
+ 4.2918878793716431e-01 6.3491958379745483e-01
+ <_>
+
+ 0 -1 340 -1.7098189564421773e-03
+
+ 2.9305368661880493e-01 5.3612488508224487e-01
+ <_>
+
+ 0 -1 341 6.5328548662364483e-03
+
+ 4.4953250885009766e-01 7.4096941947937012e-01
+ <_>
+
+ 0 -1 342 -9.5372907817363739e-03
+
+ 3.1491199135780334e-01 5.4165017604827881e-01
+ <_>
+
+ 0 -1 343 2.5310989469289780e-02
+
+ 5.1218920946121216e-01 1.3117079436779022e-01
+ <_>
+
+ 0 -1 344 3.6460969597101212e-02
+
+ 5.1759117841720581e-01 2.5913399457931519e-01
+ <_>
+
+ 0 -1 345 2.0854329690337181e-02
+
+ 5.1371401548385620e-01 1.5823160111904144e-01
+ <_>
+
+ 0 -1 346 -8.7207747856155038e-04
+
+ 5.5743098258972168e-01 4.3989789485931396e-01
+ <_>
+
+ 0 -1 347 -1.5227000403683633e-05
+
+ 5.5489408969879150e-01 3.7080699205398560e-01
+ <_>
+
+ 0 -1 348 -8.4316509310156107e-04
+
+ 3.3874198794364929e-01 5.5542111396789551e-01
+ <_>
+
+ 0 -1 349 3.6037859972566366e-03
+
+ 5.3580617904663086e-01 3.4111711382865906e-01
+ <_>
+
+ 0 -1 350 -6.8057891912758350e-03
+
+ 6.1252027750015259e-01 4.3458628654479980e-01
+ <_>
+
+ 0 -1 351 -4.7021660953760147e-02
+
+ 2.3581659793853760e-01 5.1937389373779297e-01
+ <_>
+
+ 0 -1 352 -3.6954108625650406e-02
+
+ 7.3231112957000732e-01 4.7609439492225647e-01
+ <_>
+
+ 0 -1 353 1.0439479956403375e-03
+
+ 5.4194551706314087e-01 3.4113308787345886e-01
+ <_>
+
+ 0 -1 354 -2.1050689974799752e-04
+
+ 2.8216940164566040e-01 5.5549472570419312e-01
+ <_>
+
+ 0 -1 355 -8.0831587314605713e-02
+
+ 9.1299301385879517e-01 4.6974349021911621e-01
+ <_>
+
+ 0 -1 356 -3.6579059087671340e-04
+
+ 6.0226702690124512e-01 3.9782929420471191e-01
+ <_>
+
+ 0 -1 357 -1.2545920617412776e-04
+
+ 5.6132131814956665e-01 3.8455399870872498e-01
+ <_>
+
+ 0 -1 358 -6.8786486983299255e-02
+
+ 2.2616119682788849e-01 5.3004968166351318e-01
+ <_>
+
+ 0 -1 359 1.2415789999067783e-02
+
+ 4.0756919980049133e-01 5.8288121223449707e-01
+ <_>
+
+ 0 -1 360 -4.7174817882478237e-03
+
+ 2.8272539377212524e-01 5.2677577733993530e-01
+ <_>
+
+ 0 -1 361 3.8136858493089676e-02
+
+ 5.0747412443161011e-01 1.0236159712076187e-01
+ <_>
+
+ 0 -1 362 -2.8168049175292253e-03
+
+ 6.1690068244934082e-01 4.3596929311752319e-01
+ <_>
+
+ 0 -1 363 8.1303603947162628e-03
+
+ 4.5244330167770386e-01 7.6060950756072998e-01
+ <_>
+
+ 0 -1 364 6.0056019574403763e-03
+
+ 5.2404087781906128e-01 1.8597120046615601e-01
+ <_>
+
+ 0 -1 365 1.9139319658279419e-02
+
+ 5.2093791961669922e-01 2.3320719599723816e-01
+ <_>
+
+ 0 -1 366 1.6445759683847427e-02
+
+ 5.4507029056549072e-01 3.2642349600791931e-01
+ <_>
+
+ 0 -1 367 -3.7356890738010406e-02
+
+ 6.9990468025207520e-01 4.5332419872283936e-01
+ <_>
+
+ 0 -1 368 -1.9727900624275208e-02
+
+ 2.6536649465560913e-01 5.4128098487854004e-01
+ <_>
+
+ 0 -1 369 6.6972579807043076e-03
+
+ 4.4805660843849182e-01 7.1386522054672241e-01
+ <_>
+
+ 0 -1 370 7.4457528535276651e-04
+
+ 4.2313501238822937e-01 5.4713201522827148e-01
+ <_>
+
+ 0 -1 371 1.1790640419349074e-03
+
+ 5.3417021036148071e-01 3.1304550170898438e-01
+ <_>
+
+ 0 -1 372 3.4980610013008118e-02
+
+ 5.1186597347259521e-01 3.4305301308631897e-01
+ <_>
+
+ 0 -1 373 5.6859792675822973e-04
+
+ 3.5321870446205139e-01 5.4686397314071655e-01
+ <_>
+
+ 0 -1 374 -1.1340649798512459e-02
+
+ 2.8423538804054260e-01 5.3487008810043335e-01
+ <_>
+
+ 0 -1 375 -6.6228108480572701e-03
+
+ 6.8836402893066406e-01 4.4926649332046509e-01
+ <_>
+
+ 0 -1 376 -8.0160330981016159e-03
+
+ 1.7098939418792725e-01 5.2243089675903320e-01
+ <_>
+
+ 0 -1 377 1.4206819469109178e-03
+
+ 5.2908462285995483e-01 2.9933831095695496e-01
+ <_>
+
+ 0 -1 378 -2.7801711112260818e-03
+
+ 6.4988541603088379e-01 4.4604998826980591e-01
+ <_>
+
+ 0 -1 379 -1.4747589593753219e-03
+
+ 3.2604381442070007e-01 5.3881132602691650e-01
+ <_>
+
+ 0 -1 380 -2.3830339312553406e-02
+
+ 7.5289410352706909e-01 4.8012199997901917e-01
+ <_>
+
+ 0 -1 381 6.9369790144264698e-03
+
+ 5.3351658582687378e-01 3.2614278793334961e-01
+ <_>
+
+ 0 -1 382 8.2806255668401718e-03
+
+ 4.5803940296173096e-01 5.7378298044204712e-01
+ <_>
+
+ 0 -1 383 -1.0439500212669373e-02
+
+ 2.5923201441764832e-01 5.2338278293609619e-01
+ <_>
+ 80
+ 3.9107288360595703e+01
+
+ <_>
+
+ 0 -1 384 7.2006587870419025e-03
+
+ 3.2588860392570496e-01 6.8498080968856812e-01
+ <_>
+
+ 0 -1 385 -2.8593589086085558e-03
+
+ 5.8388811349868774e-01 2.5378298759460449e-01
+ <_>
+
+ 0 -1 386 6.8580528022721410e-04
+
+ 5.7080817222595215e-01 2.8124240040779114e-01
+ <_>
+
+ 0 -1 387 7.9580191522836685e-03
+
+ 2.5010511279106140e-01 5.5442607402801514e-01
+ <_>
+
+ 0 -1 388 -1.2124150525778532e-03
+
+ 2.3853680491447449e-01 5.4333502054214478e-01
+ <_>
+
+ 0 -1 389 7.9426132142543793e-03
+
+ 3.9550709724426270e-01 6.2207579612731934e-01
+ <_>
+
+ 0 -1 390 2.4630590341985226e-03
+
+ 5.6397080421447754e-01 2.9923579096794128e-01
+ <_>
+
+ 0 -1 391 -6.0396599583327770e-03
+
+ 2.1865129470825195e-01 5.4116767644882202e-01
+ <_>
+
+ 0 -1 392 -1.2988339876756072e-03
+
+ 2.3507060110569000e-01 5.3645849227905273e-01
+ <_>
+
+ 0 -1 393 2.2299369447864592e-04
+
+ 3.8041129708290100e-01 5.7296061515808105e-01
+ <_>
+
+ 0 -1 394 1.4654280385002494e-03
+
+ 2.5101679563522339e-01 5.2582687139511108e-01
+ <_>
+
+ 0 -1 395 -8.1210042117163539e-04
+
+ 5.9928238391876221e-01 3.8511589169502258e-01
+ <_>
+
+ 0 -1 396 -1.3836020370945334e-03
+
+ 5.6813961267471313e-01 3.6365869641304016e-01
+ <_>
+
+ 0 -1 397 -2.7936449274420738e-02
+
+ 1.4913170039653778e-01 5.3775602579116821e-01
+ <_>
+
+ 0 -1 398 -4.6919551095925272e-04
+
+ 3.6924299597740173e-01 5.5724847316741943e-01
+ <_>
+
+ 0 -1 399 -4.9829659983515739e-03
+
+ 6.7585092782974243e-01 4.5325040817260742e-01
+ <_>
+
+ 0 -1 400 1.8815309740602970e-03
+
+ 5.3680229187011719e-01 2.9325398802757263e-01
+ <_>
+
+ 0 -1 401 -1.9067550078034401e-02
+
+ 1.6493770480155945e-01 5.3300672769546509e-01
+ <_>
+
+ 0 -1 402 -4.6906559728085995e-03
+
+ 1.9639259576797485e-01 5.1193618774414062e-01
+ <_>
+
+ 0 -1 403 5.9777139686048031e-03
+
+ 4.6711719036102295e-01 7.0083981752395630e-01
+ <_>
+
+ 0 -1 404 -3.3303130418062210e-02
+
+ 1.1554169654846191e-01 5.1041620969772339e-01
+ <_>
+
+ 0 -1 405 9.0744107961654663e-02
+
+ 5.1496601104736328e-01 1.3061730563640594e-01
+ <_>
+
+ 0 -1 406 9.3555898638442159e-04
+
+ 3.6054810881614685e-01 5.4398590326309204e-01
+ <_>
+
+ 0 -1 407 1.4901650138199329e-02
+
+ 4.8862120509147644e-01 7.6875698566436768e-01
+ <_>
+
+ 0 -1 408 6.1594118596985936e-04
+
+ 5.3568130731582642e-01 3.2409390807151794e-01
+ <_>
+
+ 0 -1 409 -5.0670988857746124e-02
+
+ 1.8486219644546509e-01 5.2304041385650635e-01
+ <_>
+
+ 0 -1 410 6.8665749859064817e-04
+
+ 3.8405799865722656e-01 5.5179458856582642e-01
+ <_>
+
+ 0 -1 411 8.3712432533502579e-03
+
+ 4.2885640263557434e-01 6.1317539215087891e-01
+ <_>
+
+ 0 -1 412 -1.2953069526702166e-03
+
+ 2.9136741161346436e-01 5.2807378768920898e-01
+ <_>
+
+ 0 -1 413 -4.1941680014133453e-02
+
+ 7.5547999143600464e-01 4.8560309410095215e-01
+ <_>
+
+ 0 -1 414 -2.3529380559921265e-02
+
+ 2.8382799029350281e-01 5.2560812234878540e-01
+ <_>
+
+ 0 -1 415 4.0857449173927307e-02
+
+ 4.8709350824356079e-01 6.2772971391677856e-01
+ <_>
+
+ 0 -1 416 -2.5406869128346443e-02
+
+ 7.0997077226638794e-01 4.5750290155410767e-01
+ <_>
+
+ 0 -1 417 -4.1415440500713885e-04
+
+ 4.0308868885040283e-01 5.4694122076034546e-01
+ <_>
+
+ 0 -1 418 2.1824119612574577e-02
+
+ 4.5020240545272827e-01 6.7687010765075684e-01
+ <_>
+
+ 0 -1 419 1.4114039950072765e-02
+
+ 5.4428607225418091e-01 3.7917000055313110e-01
+ <_>
+
+ 0 -1 420 6.7214590671937913e-05
+
+ 4.2004638910293579e-01 5.8734762668609619e-01
+ <_>
+
+ 0 -1 421 -7.9417638480663300e-03
+
+ 3.7925618886947632e-01 5.5852657556533813e-01
+ <_>
+
+ 0 -1 422 -7.2144409641623497e-03
+
+ 7.2531038522720337e-01 4.6035489439964294e-01
+ <_>
+
+ 0 -1 423 2.5817339774221182e-03
+
+ 4.6933019161224365e-01 5.9002387523651123e-01
+ <_>
+
+ 0 -1 424 1.3409319519996643e-01
+
+ 5.1492130756378174e-01 1.8088449537754059e-01
+ <_>
+
+ 0 -1 425 2.2962710354477167e-03
+
+ 5.3997439146041870e-01 3.7178671360015869e-01
+ <_>
+
+ 0 -1 426 -2.1575849968940020e-03
+
+ 2.4084959924221039e-01 5.1488637924194336e-01
+ <_>
+
+ 0 -1 427 -4.9196188338100910e-03
+
+ 6.5735882520675659e-01 4.7387400269508362e-01
+ <_>
+
+ 0 -1 428 1.6267469618469477e-03
+
+ 4.1928219795227051e-01 6.3031142950057983e-01
+ <_>
+
+ 0 -1 429 3.3413388882763684e-04
+
+ 5.5402982234954834e-01 3.7021011114120483e-01
+ <_>
+
+ 0 -1 430 -2.6698080822825432e-02
+
+ 1.7109179496765137e-01 5.1014107465744019e-01
+ <_>
+
+ 0 -1 431 -3.0561879277229309e-02
+
+ 1.9042180478572845e-01 5.1687937974929810e-01
+ <_>
+
+ 0 -1 432 2.8511548880487680e-03
+
+ 4.4475069642066956e-01 6.3138538599014282e-01
+ <_>
+
+ 0 -1 433 -3.6211479455232620e-02
+
+ 2.4907270073890686e-01 5.3773492574691772e-01
+ <_>
+
+ 0 -1 434 -2.4115189444273710e-03
+
+ 5.3812432289123535e-01 3.6642369627952576e-01
+ <_>
+
+ 0 -1 435 -7.7253201743587852e-04
+
+ 5.5302321910858154e-01 3.5415500402450562e-01
+ <_>
+
+ 0 -1 436 2.9481729143299162e-04
+
+ 4.1326990723609924e-01 5.6672430038452148e-01
+ <_>
+
+ 0 -1 437 -6.2334560789167881e-03
+
+ 9.8787233233451843e-02 5.1986688375473022e-01
+ <_>
+
+ 0 -1 438 -2.6274729520082474e-02
+
+ 9.1127492487430573e-02 5.0281071662902832e-01
+ <_>
+
+ 0 -1 439 5.3212260827422142e-03
+
+ 4.7266489267349243e-01 6.2227207422256470e-01
+ <_>
+
+ 0 -1 440 -4.1129058226943016e-03
+
+ 2.1574570238590240e-01 5.1378047466278076e-01
+ <_>
+
+ 0 -1 441 3.2457809429615736e-03
+
+ 5.4107707738876343e-01 3.7217769026756287e-01
+ <_>
+
+ 0 -1 442 -1.6359709203243256e-02
+
+ 7.7878749370574951e-01 4.6852919459342957e-01
+ <_>
+
+ 0 -1 443 3.2166109303943813e-04
+
+ 5.4789870977401733e-01 4.2403739690780640e-01
+ <_>
+
+ 0 -1 444 6.4452440710738301e-04
+
+ 5.3305608034133911e-01 3.5013249516487122e-01
+ <_>
+
+ 0 -1 445 -7.8909732401371002e-03
+
+ 6.9235211610794067e-01 4.7265690565109253e-01
+ <_>
+
+ 0 -1 446 4.8336211591959000e-02
+
+ 5.0559002161026001e-01 7.5749203562736511e-02
+ <_>
+
+ 0 -1 447 -7.5178127735853195e-04
+
+ 3.7837418913841248e-01 5.5385738611221313e-01
+ <_>
+
+ 0 -1 448 -2.4953910615295172e-03
+
+ 3.0816510319709778e-01 5.3596121072769165e-01
+ <_>
+
+ 0 -1 449 -2.2385010961443186e-03
+
+ 6.6339588165283203e-01 4.6493428945541382e-01
+ <_>
+
+ 0 -1 450 -1.7988430336117744e-03
+
+ 6.5968447923660278e-01 4.3471878767013550e-01
+ <_>
+
+ 0 -1 451 8.7860915809869766e-03
+
+ 5.2318328619003296e-01 2.3155799508094788e-01
+ <_>
+
+ 0 -1 452 3.6715380847454071e-03
+
+ 5.2042502164840698e-01 2.9773768782615662e-01
+ <_>
+
+ 0 -1 453 -3.5336449742317200e-02
+
+ 7.2388780117034912e-01 4.8615050315856934e-01
+ <_>
+
+ 0 -1 454 -6.9189240457490087e-04
+
+ 3.1050220131874084e-01 5.2298247814178467e-01
+ <_>
+
+ 0 -1 455 -3.3946109469980001e-03
+
+ 3.1389680504798889e-01 5.2101737260818481e-01
+ <_>
+
+ 0 -1 456 9.8569283727556467e-04
+
+ 4.5365801453590393e-01 6.5850979089736938e-01
+ <_>
+
+ 0 -1 457 -5.0163101404905319e-02
+
+ 1.8044540286064148e-01 5.1989167928695679e-01
+ <_>
+
+ 0 -1 458 -2.2367259953171015e-03
+
+ 7.2557020187377930e-01 4.6513590216636658e-01
+ <_>
+
+ 0 -1 459 7.4326287722215056e-04
+
+ 4.4129210710525513e-01 5.8985459804534912e-01
+ <_>
+
+ 0 -1 460 -9.3485182151198387e-04
+
+ 3.5000529885292053e-01 5.3660178184509277e-01
+ <_>
+
+ 0 -1 461 1.7497939988970757e-02
+
+ 4.9121949076652527e-01 8.3152848482131958e-01
+ <_>
+
+ 0 -1 462 -1.5200000489130616e-03
+
+ 3.5702759027481079e-01 5.3705602884292603e-01
+ <_>
+
+ 0 -1 463 7.8003940870985389e-04
+
+ 4.3537721037864685e-01 5.9673351049423218e-01
+ <_>
+ 103
+ 5.0610481262207031e+01
+
+ <_>
+
+ 0 -1 464 -9.9945552647113800e-03
+
+ 6.1625832319259644e-01 3.0545330047607422e-01
+ <_>
+
+ 0 -1 465 -1.1085229925811291e-03
+
+ 5.8182948827743530e-01 3.1555780768394470e-01
+ <_>
+
+ 0 -1 466 1.0364380432292819e-03
+
+ 2.5520521402359009e-01 5.6929117441177368e-01
+ <_>
+
+ 0 -1 467 6.8211311008781195e-04
+
+ 3.6850899457931519e-01 5.9349310398101807e-01
+ <_>
+
+ 0 -1 468 -6.8057340104132891e-04
+
+ 2.3323920369148254e-01 5.4747921228408813e-01
+ <_>
+
+ 0 -1 469 2.6068789884448051e-04
+
+ 3.2574570178985596e-01 5.6675457954406738e-01
+ <_>
+
+ 0 -1 470 5.1607372006401420e-04
+
+ 3.7447169423103333e-01 5.8454728126525879e-01
+ <_>
+
+ 0 -1 471 8.5007521556690335e-04
+
+ 3.4203711152076721e-01 5.5228072404861450e-01
+ <_>
+
+ 0 -1 472 -1.8607829697430134e-03
+
+ 2.8044199943542480e-01 5.3754240274429321e-01
+ <_>
+
+ 0 -1 473 -1.5033970121294260e-03
+
+ 2.5790509581565857e-01 5.4989522695541382e-01
+ <_>
+
+ 0 -1 474 2.3478909861296415e-03
+
+ 4.1751560568809509e-01 6.3137108087539673e-01
+ <_>
+
+ 0 -1 475 -2.8880240279249847e-04
+
+ 5.8651697635650635e-01 4.0526661276817322e-01
+ <_>
+
+ 0 -1 476 8.9405477046966553e-03
+
+ 5.2111411094665527e-01 2.3186540603637695e-01
+ <_>
+
+ 0 -1 477 -1.9327739253640175e-02
+
+ 2.7534329891204834e-01 5.2415257692337036e-01
+ <_>
+
+ 0 -1 478 -2.0202060113660991e-04
+
+ 5.7229787111282349e-01 3.6771959066390991e-01
+ <_>
+
+ 0 -1 479 2.1179069299250841e-03
+
+ 4.4661080837249756e-01 5.5424308776855469e-01
+ <_>
+
+ 0 -1 480 -1.7743760254234076e-03
+
+ 2.8132531046867371e-01 5.3009599447250366e-01
+ <_>
+
+ 0 -1 481 4.2234458960592747e-03
+
+ 4.3997099995613098e-01 5.7954281568527222e-01
+ <_>
+
+ 0 -1 482 -1.4375220052897930e-02
+
+ 2.9811179637908936e-01 5.2920591831207275e-01
+ <_>
+
+ 0 -1 483 -1.5349180437624454e-02
+
+ 7.7052152156829834e-01 4.7481718659400940e-01
+ <_>
+
+ 0 -1 484 1.5152279956964776e-05
+
+ 3.7188440561294556e-01 5.5768972635269165e-01
+ <_>
+
+ 0 -1 485 -9.1293919831514359e-03
+
+ 3.6151960492134094e-01 5.2867668867111206e-01
+ <_>
+
+ 0 -1 486 2.2512159775942564e-03
+
+ 5.3647047281265259e-01 3.4862980246543884e-01
+ <_>
+
+ 0 -1 487 -4.9696918576955795e-03
+
+ 6.9276517629623413e-01 4.6768361330032349e-01
+ <_>
+
+ 0 -1 488 -1.2829010374844074e-02
+
+ 7.7121537923812866e-01 4.6607351303100586e-01
+ <_>
+
+ 0 -1 489 -9.3660065904259682e-03
+
+ 3.3749839663505554e-01 5.3512877225875854e-01
+ <_>
+
+ 0 -1 490 3.2452319283038378e-03
+
+ 5.3251898288726807e-01 3.2896101474761963e-01
+ <_>
+
+ 0 -1 491 -1.1723560281097889e-02
+
+ 6.8376529216766357e-01 4.7543001174926758e-01
+ <_>
+
+ 0 -1 492 2.9257940695970319e-05
+
+ 3.5720878839492798e-01 5.3605020046234131e-01
+ <_>
+
+ 0 -1 493 -2.2244219508138485e-05
+
+ 5.5414271354675293e-01 3.5520640015602112e-01
+ <_>
+
+ 0 -1 494 5.0881509669125080e-03
+
+ 5.0708442926406860e-01 1.2564620375633240e-01
+ <_>
+
+ 0 -1 495 2.7429679408669472e-02
+
+ 5.2695602178573608e-01 1.6258180141448975e-01
+ <_>
+
+ 0 -1 496 -6.4142867922782898e-03
+
+ 7.1455889940261841e-01 4.5841971039772034e-01
+ <_>
+
+ 0 -1 497 3.3479959238320589e-03
+
+ 5.3986120223999023e-01 3.4946969151496887e-01
+ <_>
+
+ 0 -1 498 -8.2635492086410522e-02
+
+ 2.4391929805278778e-01 5.1602262258529663e-01
+ <_>
+
+ 0 -1 499 1.0261740535497665e-03
+
+ 3.8868919014930725e-01 5.7679080963134766e-01
+ <_>
+
+ 0 -1 500 -1.6307090409100056e-03
+
+ 3.3894580602645874e-01 5.3477007150650024e-01
+ <_>
+
+ 0 -1 501 2.4546680506318808e-03
+
+ 4.6014139056205750e-01 6.3872468471527100e-01
+ <_>
+
+ 0 -1 502 -9.9476519972085953e-04
+
+ 5.7698792219161987e-01 4.1203960776329041e-01
+ <_>
+
+ 0 -1 503 1.5409190207719803e-02
+
+ 4.8787090182304382e-01 7.0898222923278809e-01
+ <_>
+
+ 0 -1 504 1.1784400558099151e-03
+
+ 5.2635532617568970e-01 2.8952449560165405e-01
+ <_>
+
+ 0 -1 505 -2.7701919898390770e-02
+
+ 1.4988289773464203e-01 5.2196067571640015e-01
+ <_>
+
+ 0 -1 506 -2.9505399987101555e-02
+
+ 2.4893319234251976e-02 4.9998161196708679e-01
+ <_>
+
+ 0 -1 507 4.5159430010244250e-04
+
+ 5.4646229743957520e-01 4.0296629071235657e-01
+ <_>
+
+ 0 -1 508 7.1772639639675617e-03
+
+ 4.2710569500923157e-01 5.8662968873977661e-01
+ <_>
+
+ 0 -1 509 -7.4182048439979553e-02
+
+ 6.8741792440414429e-01 4.9190279841423035e-01
+ <_>
+
+ 0 -1 510 -1.7254160717129707e-02
+
+ 3.3706760406494141e-01 5.3487390279769897e-01
+ <_>
+
+ 0 -1 511 1.4851559884846210e-02
+
+ 4.6267929673194885e-01 6.1299049854278564e-01
+ <_>
+
+ 0 -1 512 1.0002000257372856e-02
+
+ 5.3461229801177979e-01 3.4234538674354553e-01
+ <_>
+
+ 0 -1 513 2.0138120744377375e-03
+
+ 4.6438300609588623e-01 5.8243042230606079e-01
+ <_>
+
+ 0 -1 514 1.5135470312088728e-03
+
+ 5.1963961124420166e-01 2.8561499714851379e-01
+ <_>
+
+ 0 -1 515 3.1381431035697460e-03
+
+ 4.8381629586219788e-01 5.9585297107696533e-01
+ <_>
+
+ 0 -1 516 -5.1450440660119057e-03
+
+ 8.9203029870986938e-01 4.7414121031761169e-01
+ <_>
+
+ 0 -1 517 -4.4736708514392376e-03
+
+ 2.0339429378509521e-01 5.3372788429260254e-01
+ <_>
+
+ 0 -1 518 1.9628470763564110e-03
+
+ 4.5716339349746704e-01 6.7258632183074951e-01
+ <_>
+
+ 0 -1 519 5.4260450415313244e-03
+
+ 5.2711081504821777e-01 2.8456708788871765e-01
+ <_>
+
+ 0 -1 520 4.9611460417509079e-04
+
+ 4.1383129358291626e-01 5.7185977697372437e-01
+ <_>
+
+ 0 -1 521 9.3728788197040558e-03
+
+ 5.2251511812210083e-01 2.8048470616340637e-01
+ <_>
+
+ 0 -1 522 6.0500897234305739e-04
+
+ 5.2367687225341797e-01 3.3145239949226379e-01
+ <_>
+
+ 0 -1 523 5.6792551185935736e-04
+
+ 4.5310598611831665e-01 6.2769711017608643e-01
+ <_>
+
+ 0 -1 524 2.4644339457154274e-02
+
+ 5.1308518648147583e-01 2.0171439647674561e-01
+ <_>
+
+ 0 -1 525 -1.0290450416505337e-02
+
+ 7.7865952253341675e-01 4.8766410350799561e-01
+ <_>
+
+ 0 -1 526 2.0629419013857841e-03
+
+ 4.2885988950729370e-01 5.8812642097473145e-01
+ <_>
+
+ 0 -1 527 -5.0519481301307678e-03
+
+ 3.5239779949188232e-01 5.2860087156295776e-01
+ <_>
+
+ 0 -1 528 -5.7692620903253555e-03
+
+ 6.8410861492156982e-01 4.5880940556526184e-01
+ <_>
+
+ 0 -1 529 -4.5789941214025021e-04
+
+ 3.5655200481414795e-01 5.4859781265258789e-01
+ <_>
+
+ 0 -1 530 -7.5918837683275342e-04
+
+ 3.3687931299209595e-01 5.2541971206665039e-01
+ <_>
+
+ 0 -1 531 -1.7737259622663260e-03
+
+ 3.4221610426902771e-01 5.4540151357650757e-01
+ <_>
+
+ 0 -1 532 -8.5610467940568924e-03
+
+ 6.5336120128631592e-01 4.4858568906784058e-01
+ <_>
+
+ 0 -1 533 1.7277270089834929e-03
+
+ 5.3075802326202393e-01 3.9253529906272888e-01
+ <_>
+
+ 0 -1 534 -2.8199609369039536e-02
+
+ 6.8574589490890503e-01 4.5885840058326721e-01
+ <_>
+
+ 0 -1 535 -1.7781109781935811e-03
+
+ 4.0378510951995850e-01 5.3698569536209106e-01
+ <_>
+
+ 0 -1 536 3.3177141449414194e-04
+
+ 5.3997987508773804e-01 3.7057501077651978e-01
+ <_>
+
+ 0 -1 537 2.6385399978607893e-03
+
+ 4.6654370427131653e-01 6.4527308940887451e-01
+ <_>
+
+ 0 -1 538 -2.1183069329708815e-03
+
+ 5.9147810935974121e-01 4.0646770596504211e-01
+ <_>
+
+ 0 -1 539 -1.4773289673030376e-02
+
+ 3.6420381069183350e-01 5.2947628498077393e-01
+ <_>
+
+ 0 -1 540 -1.6815440729260445e-02
+
+ 2.6642319560050964e-01 5.1449728012084961e-01
+ <_>
+
+ 0 -1 541 -6.3370140269398689e-03
+
+ 6.7795312404632568e-01 4.8520979285240173e-01
+ <_>
+
+ 0 -1 542 -4.4560048991115764e-05
+
+ 5.6139647960662842e-01 4.1530540585517883e-01
+ <_>
+
+ 0 -1 543 -1.0240620467811823e-03
+
+ 5.9644782543182373e-01 4.5663040876388550e-01
+ <_>
+
+ 0 -1 544 -2.3161689750850201e-03
+
+ 2.9761150479316711e-01 5.1881599426269531e-01
+ <_>
+
+ 0 -1 545 5.3217571973800659e-01
+
+ 5.1878392696380615e-01 2.2026319801807404e-01
+ <_>
+
+ 0 -1 546 -1.6643050312995911e-01
+
+ 1.8660229444503784e-01 5.0603431463241577e-01
+ <_>
+
+ 0 -1 547 1.1253529787063599e-01
+
+ 5.2121251821517944e-01 1.1850229650735855e-01
+ <_>
+
+ 0 -1 548 9.3046864494681358e-03
+
+ 4.5899370312690735e-01 6.8261492252349854e-01
+ <_>
+
+ 0 -1 549 -4.6255099587142467e-03
+
+ 3.0799409747123718e-01 5.2250087261199951e-01
+ <_>
+
+ 0 -1 550 -1.1116469651460648e-01
+
+ 2.1010440587997437e-01 5.0808018445968628e-01
+ <_>
+
+ 0 -1 551 -1.0888439603149891e-02
+
+ 5.7653552293777466e-01 4.7904640436172485e-01
+ <_>
+
+ 0 -1 552 5.8564301580190659e-03
+
+ 5.0651001930236816e-01 1.5635989606380463e-01
+ <_>
+
+ 0 -1 553 5.4854389280080795e-02
+
+ 4.9669149518013000e-01 7.2305107116699219e-01
+ <_>
+
+ 0 -1 554 -1.1197339743375778e-02
+
+ 2.1949790418148041e-01 5.0987982749938965e-01
+ <_>
+
+ 0 -1 555 4.4069071300327778e-03
+
+ 4.7784018516540527e-01 6.7709028720855713e-01
+ <_>
+
+ 0 -1 556 -6.3665293157100677e-02
+
+ 1.9363629817962646e-01 5.0810241699218750e-01
+ <_>
+
+ 0 -1 557 -9.8081491887569427e-03
+
+ 5.9990632534027100e-01 4.8103410005569458e-01
+ <_>
+
+ 0 -1 558 -2.1717099007219076e-03
+
+ 3.3383339643478394e-01 5.2354729175567627e-01
+ <_>
+
+ 0 -1 559 -1.3315520249307156e-02
+
+ 6.6170698404312134e-01 4.9192130565643311e-01
+ <_>
+
+ 0 -1 560 2.5442079640924931e-03
+
+ 4.4887441396713257e-01 6.0821849107742310e-01
+ <_>
+
+ 0 -1 561 1.2037839740514755e-02
+
+ 5.4093921184539795e-01 3.2924321293830872e-01
+ <_>
+
+ 0 -1 562 -2.0701050758361816e-02
+
+ 6.8191200494766235e-01 4.5949959754943848e-01
+ <_>
+
+ 0 -1 563 2.7608279138803482e-02
+
+ 4.6307921409606934e-01 5.7672828435897827e-01
+ <_>
+
+ 0 -1 564 1.2370620388537645e-03
+
+ 5.1653790473937988e-01 2.6350161433219910e-01
+ <_>
+
+ 0 -1 565 -3.7669338285923004e-02
+
+ 2.5363931059837341e-01 5.2789801359176636e-01
+ <_>
+
+ 0 -1 566 -1.8057259730994701e-03
+
+ 3.9851561188697815e-01 5.5175000429153442e-01
+ <_>
+ 111
+ 5.4620071411132812e+01
+
+ <_>
+
+ 0 -1 567 4.4299028813838959e-03
+
+ 2.8910180926322937e-01 6.3352262973785400e-01
+ <_>
+
+ 0 -1 568 -2.3813319858163595e-03
+
+ 6.2117892503738403e-01 3.4774878621101379e-01
+ <_>
+
+ 0 -1 569 2.2915711160749197e-03
+
+ 2.2544120252132416e-01 5.5821180343627930e-01
+ <_>
+
+ 0 -1 570 9.9457940086722374e-04
+
+ 3.7117108702659607e-01 5.9300708770751953e-01
+ <_>
+
+ 0 -1 571 7.7164667891338468e-04
+
+ 5.6517201662063599e-01 3.3479958772659302e-01
+ <_>
+
+ 0 -1 572 -1.1386410333216190e-03
+
+ 3.0691260099411011e-01 5.5086308717727661e-01
+ <_>
+
+ 0 -1 573 -1.6403039626311511e-04
+
+ 5.7628279924392700e-01 3.6990478634834290e-01
+ <_>
+
+ 0 -1 574 2.9793529392918572e-05
+
+ 2.6442441344261169e-01 5.4379111528396606e-01
+ <_>
+
+ 0 -1 575 8.5774902254343033e-03
+
+ 5.0511389970779419e-01 1.7957249283790588e-01
+ <_>
+
+ 0 -1 576 -2.6032689493149519e-04
+
+ 5.8269691467285156e-01 4.4468268752098083e-01
+ <_>
+
+ 0 -1 577 -6.1404630541801453e-03
+
+ 3.1138521432876587e-01 5.3469717502593994e-01
+ <_>
+
+ 0 -1 578 -2.3086950182914734e-02
+
+ 3.2779461145401001e-01 5.3311979770660400e-01
+ <_>
+
+ 0 -1 579 -1.4243650250136852e-02
+
+ 7.3817098140716553e-01 4.5880630612373352e-01
+ <_>
+
+ 0 -1 580 1.9487129524350166e-02
+
+ 5.2566307783126831e-01 2.2744719684123993e-01
+ <_>
+
+ 0 -1 581 -9.6681108698248863e-04
+
+ 5.5112308263778687e-01 3.8150069117546082e-01
+ <_>
+
+ 0 -1 582 3.1474709976464510e-03
+
+ 5.4256367683410645e-01 2.5437268614768982e-01
+ <_>
+
+ 0 -1 583 -1.8026070029009134e-04
+
+ 5.3801918029785156e-01 3.4063041210174561e-01
+ <_>
+
+ 0 -1 584 -6.0266260989010334e-03
+
+ 3.0358019471168518e-01 5.4205721616744995e-01
+ <_>
+
+ 0 -1 585 4.4462960795499384e-04
+
+ 3.9909970760345459e-01 5.6601101160049438e-01
+ <_>
+
+ 0 -1 586 2.2609760053455830e-03
+
+ 5.5628067255020142e-01 3.9406880736351013e-01
+ <_>
+
+ 0 -1 587 5.1133058965206146e-02
+
+ 4.6096539497375488e-01 7.1185618638992310e-01
+ <_>
+
+ 0 -1 588 -1.7786309123039246e-02
+
+ 2.3161660134792328e-01 5.3221440315246582e-01
+ <_>
+
+ 0 -1 589 -4.9679628573358059e-03
+
+ 2.3307719826698303e-01 5.1220291852951050e-01
+ <_>
+
+ 0 -1 590 2.0667689386755228e-03
+
+ 4.6574440598487854e-01 6.4554882049560547e-01
+ <_>
+
+ 0 -1 591 7.4413768015801907e-03
+
+ 5.1543921232223511e-01 2.3616339266300201e-01
+ <_>
+
+ 0 -1 592 -3.6277279723435640e-03
+
+ 6.2197732925415039e-01 4.4766610860824585e-01
+ <_>
+
+ 0 -1 593 -5.3530759178102016e-03
+
+ 1.8373550474643707e-01 5.1022082567214966e-01
+ <_>
+
+ 0 -1 594 1.4530919492244720e-01
+
+ 5.1459872722625732e-01 1.5359309315681458e-01
+ <_>
+
+ 0 -1 595 2.4394490756094456e-03
+
+ 5.3436601161956787e-01 3.6246618628501892e-01
+ <_>
+
+ 0 -1 596 -3.1283390708267689e-03
+
+ 6.2150079011917114e-01 4.8455920815467834e-01
+ <_>
+
+ 0 -1 597 1.7940260004252195e-03
+
+ 4.2992618680000305e-01 5.8241981267929077e-01
+ <_>
+
+ 0 -1 598 3.6253821104764938e-02
+
+ 5.2603340148925781e-01 1.4394679665565491e-01
+ <_>
+
+ 0 -1 599 -5.1746722310781479e-03
+
+ 3.5065388679504395e-01 5.2870452404022217e-01
+ <_>
+
+ 0 -1 600 6.5383297624066472e-04
+
+ 4.8096409440040588e-01 6.1220401525497437e-01
+ <_>
+
+ 0 -1 601 -2.6480229571461678e-02
+
+ 1.1393620073795319e-01 5.0455862283706665e-01
+ <_>
+
+ 0 -1 602 -3.0440660193562508e-03
+
+ 6.3520950078964233e-01 4.7947341203689575e-01
+ <_>
+
+ 0 -1 603 3.6993520334362984e-03
+
+ 5.1311182975769043e-01 2.4985109269618988e-01
+ <_>
+
+ 0 -1 604 -3.6762931267730892e-04
+
+ 5.4213947057723999e-01 3.7095320224761963e-01
+ <_>
+
+ 0 -1 605 -4.1382260620594025e-02
+
+ 1.8949599564075470e-01 5.0816917419433594e-01
+ <_>
+
+ 0 -1 606 -1.0532729793339968e-03
+
+ 6.4543670415878296e-01 4.7836089134216309e-01
+ <_>
+
+ 0 -1 607 -2.1648600231856108e-03
+
+ 6.2150311470031738e-01 4.4998261332511902e-01
+ <_>
+
+ 0 -1 608 -5.6747748749330640e-04
+
+ 3.7126109004020691e-01 5.4193347692489624e-01
+ <_>
+
+ 0 -1 609 1.7375840246677399e-01
+
+ 5.0236439704895020e-01 1.2157420068979263e-01
+ <_>
+
+ 0 -1 610 -2.9049699660390615e-03
+
+ 3.2402679324150085e-01 5.3818839788436890e-01
+ <_>
+
+ 0 -1 611 1.2299539521336555e-03
+
+ 4.1655078530311584e-01 5.7034862041473389e-01
+ <_>
+
+ 0 -1 612 -5.4329237900674343e-04
+
+ 3.8540428876876831e-01 5.5475491285324097e-01
+ <_>
+
+ 0 -1 613 -8.3297258242964745e-03
+
+ 2.2044940292835236e-01 5.0970828533172607e-01
+ <_>
+
+ 0 -1 614 -1.0417630255687982e-04
+
+ 5.6070661544799805e-01 4.3030360341072083e-01
+ <_>
+
+ 0 -1 615 3.1204700469970703e-02
+
+ 4.6216571331024170e-01 6.9820040464401245e-01
+ <_>
+
+ 0 -1 616 7.8943502157926559e-03
+
+ 5.2695941925048828e-01 2.2690680623054504e-01
+ <_>
+
+ 0 -1 617 -4.3645310215651989e-03
+
+ 6.3592231273651123e-01 4.5379561185836792e-01
+ <_>
+
+ 0 -1 618 7.6793059706687927e-03
+
+ 5.2747678756713867e-01 2.7404838800430298e-01
+ <_>
+
+ 0 -1 619 -2.5431139394640923e-02
+
+ 2.0385199785232544e-01 5.0717329978942871e-01
+ <_>
+
+ 0 -1 620 8.2000601105391979e-04
+
+ 4.5874550938606262e-01 6.1198681592941284e-01
+ <_>
+
+ 0 -1 621 2.9284600168466568e-03
+
+ 5.0712740421295166e-01 2.0282049477100372e-01
+ <_>
+
+ 0 -1 622 4.5256470912136137e-05
+
+ 4.8121041059494019e-01 5.4308217763900757e-01
+ <_>
+
+ 0 -1 623 1.3158309739083052e-03
+
+ 4.6258139610290527e-01 6.7793232202529907e-01
+ <_>
+
+ 0 -1 624 1.5870389761403203e-03
+
+ 5.3862917423248291e-01 3.4314650297164917e-01
+ <_>
+
+ 0 -1 625 -2.1539660170674324e-02
+
+ 2.5942500680685043e-02 5.0032228231430054e-01
+ <_>
+
+ 0 -1 626 1.4334480278193951e-02
+
+ 5.2028447389602661e-01 1.5906329452991486e-01
+ <_>
+
+ 0 -1 627 -8.3881383761763573e-03
+
+ 7.2824811935424805e-01 4.6480441093444824e-01
+ <_>
+
+ 0 -1 628 9.1906841844320297e-03
+
+ 5.5623567104339600e-01 3.9231911301612854e-01
+ <_>
+
+ 0 -1 629 -5.8453059755265713e-03
+
+ 6.8033927679061890e-01 4.6291279792785645e-01
+ <_>
+
+ 0 -1 630 -5.4707799106836319e-02
+
+ 2.5616711378097534e-01 5.2061259746551514e-01
+ <_>
+
+ 0 -1 631 9.1142775490880013e-03
+
+ 5.1896202564239502e-01 3.0538770556449890e-01
+ <_>
+
+ 0 -1 632 -1.5575000084936619e-02
+
+ 1.2950749695301056e-01 5.1690948009490967e-01
+ <_>
+
+ 0 -1 633 -1.2050600344082341e-04
+
+ 5.7350981235504150e-01 4.2308250069618225e-01
+ <_>
+
+ 0 -1 634 1.2273970060050488e-03
+
+ 5.2898782491683960e-01 4.0797919034957886e-01
+ <_>
+
+ 0 -1 635 -1.2186600361019373e-03
+
+ 6.5756398439407349e-01 4.5744091272354126e-01
+ <_>
+
+ 0 -1 636 -3.3256649039685726e-03
+
+ 3.6280471086502075e-01 5.1950198411941528e-01
+ <_>
+
+ 0 -1 637 -1.3288309797644615e-02
+
+ 1.2842659652233124e-01 5.0434887409210205e-01
+ <_>
+
+ 0 -1 638 -3.3839771058410406e-03
+
+ 6.2922400236129761e-01 4.7575059533119202e-01
+ <_>
+
+ 0 -1 639 -2.1954220533370972e-01
+
+ 1.4877319335937500e-01 5.0650137662887573e-01
+ <_>
+
+ 0 -1 640 4.9111708067357540e-03
+
+ 4.2561021447181702e-01 5.6658387184143066e-01
+ <_>
+
+ 0 -1 641 -1.8744950648397207e-04
+
+ 4.0041440725326538e-01 5.5868571996688843e-01
+ <_>
+
+ 0 -1 642 -5.2178641781210899e-03
+
+ 6.0091161727905273e-01 4.8127061128616333e-01
+ <_>
+
+ 0 -1 643 -1.1111519997939467e-03
+
+ 3.5149338841438293e-01 5.2870899438858032e-01
+ <_>
+
+ 0 -1 644 4.4036400504410267e-03
+
+ 4.6422758698463440e-01 5.9240859746932983e-01
+ <_>
+
+ 0 -1 645 1.2299499660730362e-01
+
+ 5.0255292654037476e-01 6.9152481853961945e-02
+ <_>
+
+ 0 -1 646 -1.2313510291278362e-02
+
+ 5.8845919370651245e-01 4.9340128898620605e-01
+ <_>
+
+ 0 -1 647 4.1471039876341820e-03
+
+ 4.3722391128540039e-01 5.8934777975082397e-01
+ <_>
+
+ 0 -1 648 -3.5502649843692780e-03
+
+ 4.3275511264801025e-01 5.3962701559066772e-01
+ <_>
+
+ 0 -1 649 -1.9224269315600395e-02
+
+ 1.9131340086460114e-01 5.0683307647705078e-01
+ <_>
+
+ 0 -1 650 1.4395059552043676e-03
+
+ 5.3081780672073364e-01 4.2435330152511597e-01
+ <_>
+
+ 0 -1 651 -6.7751999013125896e-03
+
+ 6.3653957843780518e-01 4.5400860905647278e-01
+ <_>
+
+ 0 -1 652 7.0119630545377731e-03
+
+ 5.1898342370986938e-01 3.0261999368667603e-01
+ <_>
+
+ 0 -1 653 5.4014651104807854e-03
+
+ 5.1050621271133423e-01 2.5576829910278320e-01
+ <_>
+
+ 0 -1 654 9.0274988906458020e-04
+
+ 4.6969148516654968e-01 5.8618277311325073e-01
+ <_>
+
+ 0 -1 655 1.1474450118839741e-02
+
+ 5.0536459684371948e-01 1.5271779894828796e-01
+ <_>
+
+ 0 -1 656 -6.7023430019617081e-03
+
+ 6.5089809894561768e-01 4.8906040191650391e-01
+ <_>
+
+ 0 -1 657 -2.0462959073483944e-03
+
+ 6.2418168783187866e-01 4.5146000385284424e-01
+ <_>
+
+ 0 -1 658 -9.9951568990945816e-03
+
+ 3.4327811002731323e-01 5.4009538888931274e-01
+ <_>
+
+ 0 -1 659 -3.5700708627700806e-02
+
+ 1.8780590593814850e-01 5.0740778446197510e-01
+ <_>
+
+ 0 -1 660 4.5584561303257942e-04
+
+ 3.8052770495414734e-01 5.4025697708129883e-01
+ <_>
+
+ 0 -1 661 -5.4260600358247757e-02
+
+ 6.8437147140502930e-01 4.5950970053672791e-01
+ <_>
+
+ 0 -1 662 6.0600461438298225e-03
+
+ 5.5029052495956421e-01 4.5005279779434204e-01
+ <_>
+
+ 0 -1 663 -6.4791832119226456e-03
+
+ 3.3688580989837646e-01 5.3107571601867676e-01
+ <_>
+
+ 0 -1 664 -1.4939469983801246e-03
+
+ 6.4876401424407959e-01 4.7561758756637573e-01
+ <_>
+
+ 0 -1 665 1.4610530342906713e-05
+
+ 4.0345790982246399e-01 5.4510641098022461e-01
+ <_>
+
+ 0 -1 666 -7.2321938350796700e-03
+
+ 6.3868737220764160e-01 4.8247399926185608e-01
+ <_>
+
+ 0 -1 667 -4.0645818226039410e-03
+
+ 2.9864218831062317e-01 5.1573359966278076e-01
+ <_>
+
+ 0 -1 668 3.0463080853223801e-02
+
+ 5.0221997499465942e-01 7.1599560976028442e-01
+ <_>
+
+ 0 -1 669 -8.0544911324977875e-03
+
+ 6.4924520254135132e-01 4.6192750334739685e-01
+ <_>
+
+ 0 -1 670 3.9505138993263245e-02
+
+ 5.1505708694458008e-01 2.4506139755249023e-01
+ <_>
+
+ 0 -1 671 8.4530208259820938e-03
+
+ 4.5736691355705261e-01 6.3940370082855225e-01
+ <_>
+
+ 0 -1 672 -1.1688120430335402e-03
+
+ 3.8655120134353638e-01 5.4836612939834595e-01
+ <_>
+
+ 0 -1 673 2.8070670086890459e-03
+
+ 5.1285791397094727e-01 2.7014800906181335e-01
+ <_>
+
+ 0 -1 674 4.7365209320560098e-04
+
+ 4.0515819191932678e-01 5.3874611854553223e-01
+ <_>
+
+ 0 -1 675 1.1741080321371555e-02
+
+ 5.2959501743316650e-01 3.7194138765335083e-01
+ <_>
+
+ 0 -1 676 3.1833238899707794e-03
+
+ 4.7894069552421570e-01 6.8951261043548584e-01
+ <_>
+
+ 0 -1 677 7.0241501089185476e-04
+
+ 5.3844892978668213e-01 3.9180809259414673e-01
+ <_>
+ 102
+ 5.0169731140136719e+01
+
+ <_>
+
+ 0 -1 678 1.7059929668903351e-02
+
+ 3.9485278725624084e-01 7.1425348520278931e-01
+ <_>
+
+ 0 -1 679 2.1840840578079224e-02
+
+ 3.3703160285949707e-01 6.0900169610977173e-01
+ <_>
+
+ 0 -1 680 2.4520049919374287e-04
+
+ 3.5005760192871094e-01 5.9879022836685181e-01
+ <_>
+
+ 0 -1 681 8.3272606134414673e-03
+
+ 3.2675281167030334e-01 5.6972408294677734e-01
+ <_>
+
+ 0 -1 682 5.7148298947140574e-04
+
+ 3.0445998907089233e-01 5.5316567420959473e-01
+ <_>
+
+ 0 -1 683 6.7373987985774875e-04
+
+ 3.6500120162963867e-01 5.6726312637329102e-01
+ <_>
+
+ 0 -1 684 3.4681590477703139e-05
+
+ 3.3135411143302917e-01 5.3887271881103516e-01
+ <_>
+
+ 0 -1 685 -5.8563398197293282e-03
+
+ 2.6979428529739380e-01 5.4987788200378418e-01
+ <_>
+
+ 0 -1 686 8.5102273151278496e-03
+
+ 5.2693581581115723e-01 2.7628791332244873e-01
+ <_>
+
+ 0 -1 687 -6.9817207753658295e-02
+
+ 2.9096031188964844e-01 5.2592468261718750e-01
+ <_>
+
+ 0 -1 688 -8.6113670840859413e-04
+
+ 5.8925771713256836e-01 4.0736979246139526e-01
+ <_>
+
+ 0 -1 689 9.7149249631911516e-04
+
+ 3.5235640406608582e-01 5.4158622026443481e-01
+ <_>
+
+ 0 -1 690 -1.4727490452060010e-05
+
+ 5.4230177402496338e-01 3.5031560063362122e-01
+ <_>
+
+ 0 -1 691 4.8420291393995285e-02
+
+ 5.1939457654953003e-01 3.4111958742141724e-01
+ <_>
+
+ 0 -1 692 1.3257140526548028e-03
+
+ 3.1577691435813904e-01 5.3353762626647949e-01
+ <_>
+
+ 0 -1 693 1.4922149603080470e-05
+
+ 4.4512999057769775e-01 5.5365538597106934e-01
+ <_>
+
+ 0 -1 694 -2.7173398993909359e-03
+
+ 3.0317419767379761e-01 5.2480888366699219e-01
+ <_>
+
+ 0 -1 695 2.9219500720500946e-03
+
+ 4.7814530134201050e-01 6.6060417890548706e-01
+ <_>
+
+ 0 -1 696 -1.9804988987743855e-03
+
+ 3.1863081455230713e-01 5.2876251935958862e-01
+ <_>
+
+ 0 -1 697 -4.0012109093368053e-03
+
+ 6.4135968685150146e-01 4.7499281167984009e-01
+ <_>
+
+ 0 -1 698 -4.3491991236805916e-03
+
+ 1.5074980258941650e-01 5.0989967584609985e-01
+ <_>
+
+ 0 -1 699 1.3490889687091112e-03
+
+ 4.3161588907241821e-01 5.8811670541763306e-01
+ <_>
+
+ 0 -1 700 1.8597070127725601e-02
+
+ 4.7355538606643677e-01 9.0897941589355469e-01
+ <_>
+
+ 0 -1 701 -1.8562379991635680e-03
+
+ 3.5531890392303467e-01 5.5778372287750244e-01
+ <_>
+
+ 0 -1 702 2.2940430790185928e-03
+
+ 4.5000949501991272e-01 6.5808779001235962e-01
+ <_>
+
+ 0 -1 703 2.9982850537635386e-04
+
+ 5.6292420625686646e-01 3.9758789539337158e-01
+ <_>
+
+ 0 -1 704 3.5455459728837013e-03
+
+ 5.3815472126007080e-01 3.6054858565330505e-01
+ <_>
+
+ 0 -1 705 9.6104722470045090e-03
+
+ 5.2559971809387207e-01 1.7967459559440613e-01
+ <_>
+
+ 0 -1 706 -6.2783220782876015e-03
+
+ 2.2728569805622101e-01 5.1140302419662476e-01
+ <_>
+
+ 0 -1 707 3.4598479978740215e-03
+
+ 4.6263080835342407e-01 6.6082191467285156e-01
+ <_>
+
+ 0 -1 708 -1.3112019514665008e-03
+
+ 6.3175398111343384e-01 4.4368579983711243e-01
+ <_>
+
+ 0 -1 709 2.6876179035753012e-03
+
+ 5.4211097955703735e-01 4.0540221333503723e-01
+ <_>
+
+ 0 -1 710 3.9118169806897640e-03
+
+ 5.3584778308868408e-01 3.2734549045562744e-01
+ <_>
+
+ 0 -1 711 -1.4206450432538986e-02
+
+ 7.7935767173767090e-01 4.9757811427116394e-01
+ <_>
+
+ 0 -1 712 7.1705528534948826e-04
+
+ 5.2973198890686035e-01 3.5609039664268494e-01
+ <_>
+
+ 0 -1 713 1.6635019565001130e-03
+
+ 4.6780940890312195e-01 5.8164817094802856e-01
+ <_>
+
+ 0 -1 714 3.3686188980937004e-03
+
+ 5.2767342329025269e-01 3.4464201331138611e-01
+ <_>
+
+ 0 -1 715 1.2799530290067196e-02
+
+ 4.8346799612045288e-01 7.4721592664718628e-01
+ <_>
+
+ 0 -1 716 3.3901201095432043e-03
+
+ 4.5118591189384460e-01 6.4017212390899658e-01
+ <_>
+
+ 0 -1 717 4.7070779837667942e-03
+
+ 5.3356587886810303e-01 3.5552209615707397e-01
+ <_>
+
+ 0 -1 718 1.4819339849054813e-03
+
+ 4.2507070302963257e-01 5.7727241516113281e-01
+ <_>
+
+ 0 -1 719 -6.9995759986341000e-03
+
+ 3.0033200979232788e-01 5.2929002046585083e-01
+ <_>
+
+ 0 -1 720 1.5939010307192802e-02
+
+ 5.0673192739486694e-01 1.6755819320678711e-01
+ <_>
+
+ 0 -1 721 7.6377349905669689e-03
+
+ 4.7950699925422668e-01 7.0856010913848877e-01
+ <_>
+
+ 0 -1 722 6.7334040068089962e-03
+
+ 5.1331132650375366e-01 2.1624700725078583e-01
+ <_>
+
+ 0 -1 723 -1.2858809903264046e-02
+
+ 1.9388419389724731e-01 5.2513718605041504e-01
+ <_>
+
+ 0 -1 724 -6.2270800117403269e-04
+
+ 5.6865382194519043e-01 4.1978681087493896e-01
+ <_>
+
+ 0 -1 725 -5.2651681471616030e-04
+
+ 4.2241689562797546e-01 5.4296958446502686e-01
+ <_>
+
+ 0 -1 726 1.1075099930167198e-02
+
+ 5.1137751340866089e-01 2.5145179033279419e-01
+ <_>
+
+ 0 -1 727 -3.6728251725435257e-02
+
+ 7.1946620941162109e-01 4.8496189713478088e-01
+ <_>
+
+ 0 -1 728 -2.8207109426148236e-04
+
+ 3.8402619957923889e-01 5.3944462537765503e-01
+ <_>
+
+ 0 -1 729 -2.7489690110087395e-03
+
+ 5.9370887279510498e-01 4.5691820979118347e-01
+ <_>
+
+ 0 -1 730 1.0047519579529762e-02
+
+ 5.1385760307312012e-01 2.8022980690002441e-01
+ <_>
+
+ 0 -1 731 -8.1497840583324432e-03
+
+ 6.0900372266769409e-01 4.6361210942268372e-01
+ <_>
+
+ 0 -1 732 -6.8833888508379459e-03
+
+ 3.4586110711097717e-01 5.2546602487564087e-01
+ <_>
+
+ 0 -1 733 -1.4039360394235700e-05
+
+ 5.6931042671203613e-01 4.0820831060409546e-01
+ <_>
+
+ 0 -1 734 1.5498419525101781e-03
+
+ 4.3505370616912842e-01 5.8065170049667358e-01
+ <_>
+
+ 0 -1 735 -6.7841499112546444e-03
+
+ 1.4688730239868164e-01 5.1827752590179443e-01
+ <_>
+
+ 0 -1 736 2.1705629478674382e-04
+
+ 5.2935242652893066e-01 3.4561741352081299e-01
+ <_>
+
+ 0 -1 737 3.1198898795992136e-04
+
+ 4.6524509787559509e-01 5.9424138069152832e-01
+ <_>
+
+ 0 -1 738 5.4507530294358730e-03
+
+ 4.6535089612007141e-01 7.0248460769653320e-01
+ <_>
+
+ 0 -1 739 -2.5818689027801156e-04
+
+ 5.4972952604293823e-01 3.7689670920372009e-01
+ <_>
+
+ 0 -1 740 -1.7442539334297180e-02
+
+ 3.9190879464149475e-01 5.4574978351593018e-01
+ <_>
+
+ 0 -1 741 -4.5343529433012009e-02
+
+ 1.6313570737838745e-01 5.1549088954925537e-01
+ <_>
+
+ 0 -1 742 1.9190689781680703e-03
+
+ 5.1458978652954102e-01 2.7918958663940430e-01
+ <_>
+
+ 0 -1 743 -6.0177869163453579e-03
+
+ 6.5176361799240112e-01 4.7563329339027405e-01
+ <_>
+
+ 0 -1 744 -4.0720738470554352e-03
+
+ 5.5146527290344238e-01 4.0926858782768250e-01
+ <_>
+
+ 0 -1 745 3.9855059003457427e-04
+
+ 3.1652408838272095e-01 5.2855509519577026e-01
+ <_>
+
+ 0 -1 746 -6.5418570302426815e-03
+
+ 6.8533778190612793e-01 4.6528089046478271e-01
+ <_>
+
+ 0 -1 747 3.4845089539885521e-03
+
+ 5.4845881462097168e-01 4.5027598738670349e-01
+ <_>
+
+ 0 -1 748 -1.3696780428290367e-02
+
+ 6.3957798480987549e-01 4.5725551247596741e-01
+ <_>
+
+ 0 -1 749 -1.7347140237689018e-02
+
+ 2.7510729432106018e-01 5.1816147565841675e-01
+ <_>
+
+ 0 -1 750 -4.0885428898036480e-03
+
+ 3.3256360888481140e-01 5.1949840784072876e-01
+ <_>
+
+ 0 -1 751 -9.4687901437282562e-03
+
+ 5.9422808885574341e-01 4.8518198728561401e-01
+ <_>
+
+ 0 -1 752 1.7084840219467878e-03
+
+ 4.1671109199523926e-01 5.5198061466217041e-01
+ <_>
+
+ 0 -1 753 9.4809094443917274e-03
+
+ 5.4338949918746948e-01 4.2085149884223938e-01
+ <_>
+
+ 0 -1 754 -4.7389650717377663e-03
+
+ 6.4071899652481079e-01 4.5606550574302673e-01
+ <_>
+
+ 0 -1 755 6.5761050209403038e-03
+
+ 5.2145552635192871e-01 2.2582270205020905e-01
+ <_>
+
+ 0 -1 756 -2.1690549328923225e-03
+
+ 3.1515279412269592e-01 5.1567047834396362e-01
+ <_>
+
+ 0 -1 757 1.4660170301795006e-02
+
+ 4.8708370327949524e-01 6.6899412870407104e-01
+ <_>
+
+ 0 -1 758 1.7231999663636088e-04
+
+ 3.5697489976882935e-01 5.2510780096054077e-01
+ <_>
+
+ 0 -1 759 -2.1803760901093483e-02
+
+ 8.8259208202362061e-01 4.9663299322128296e-01
+ <_>
+
+ 0 -1 760 -9.4736106693744659e-02
+
+ 1.4461620151996613e-01 5.0611138343811035e-01
+ <_>
+
+ 0 -1 761 5.5825551971793175e-03
+
+ 5.3964787721633911e-01 4.2380660772323608e-01
+ <_>
+
+ 0 -1 762 1.9517090404406190e-03
+
+ 4.1704109311103821e-01 5.4977869987487793e-01
+ <_>
+
+ 0 -1 763 1.2149900197982788e-02
+
+ 4.6983671188354492e-01 5.6642740964889526e-01
+ <_>
+
+ 0 -1 764 -7.5169620104134083e-03
+
+ 6.2677729129791260e-01 4.4631358981132507e-01
+ <_>
+
+ 0 -1 765 -7.1667909622192383e-02
+
+ 3.0970111489295959e-01 5.2210032939910889e-01
+ <_>
+
+ 0 -1 766 -8.8292419910430908e-02
+
+ 8.1123888492584229e-02 5.0063651800155640e-01
+ <_>
+
+ 0 -1 767 3.1063079833984375e-02
+
+ 5.1555037498474121e-01 1.2822559475898743e-01
+ <_>
+
+ 0 -1 768 4.6621840447187424e-02
+
+ 4.6997779607772827e-01 7.3639607429504395e-01
+ <_>
+
+ 0 -1 769 -1.2189489789307117e-02
+
+ 3.9205300807952881e-01 5.5189967155456543e-01
+ <_>
+
+ 0 -1 770 1.3016110286116600e-02
+
+ 5.2606582641601562e-01 3.6851361393928528e-01
+ <_>
+
+ 0 -1 771 -3.4952899441123009e-03
+
+ 6.3392949104309082e-01 4.7162809967994690e-01
+ <_>
+
+ 0 -1 772 -4.4015039748046547e-05
+
+ 5.3330272436141968e-01 3.7761849164962769e-01
+ <_>
+
+ 0 -1 773 -1.0966490209102631e-01
+
+ 1.7653420567512512e-01 5.1983469724655151e-01
+ <_>
+
+ 0 -1 774 -9.0279558207839727e-04
+
+ 5.3241598606109619e-01 3.8389080762863159e-01
+ <_>
+
+ 0 -1 775 7.1126641705632210e-04
+
+ 4.6479299664497375e-01 5.7552242279052734e-01
+ <_>
+
+ 0 -1 776 -3.1250279862433672e-03
+
+ 3.2367089390754700e-01 5.1667708158493042e-01
+ <_>
+
+ 0 -1 777 2.4144679773598909e-03
+
+ 4.7874391078948975e-01 6.4597177505493164e-01
+ <_>
+
+ 0 -1 778 4.4391240226104856e-04
+
+ 4.4093081355094910e-01 6.0102558135986328e-01
+ <_>
+
+ 0 -1 779 -2.2611189342569560e-04
+
+ 4.0381139516830444e-01 5.4932558536529541e-01
+ <_>
+ 135
+ 6.6669120788574219e+01
+
+ <_>
+
+ 0 -1 780 -4.6901289373636246e-02
+
+ 6.6001719236373901e-01 3.7438011169433594e-01
+ <_>
+
+ 0 -1 781 -1.4568349579349160e-03
+
+ 5.7839912176132202e-01 3.4377971291542053e-01
+ <_>
+
+ 0 -1 782 5.5598369799554348e-03
+
+ 3.6222669482231140e-01 5.9082162380218506e-01
+ <_>
+
+ 0 -1 783 7.3170487303286791e-04
+
+ 5.5004191398620605e-01 2.8735581040382385e-01
+ <_>
+
+ 0 -1 784 1.3318009441718459e-03
+
+ 2.6731699705123901e-01 5.4310190677642822e-01
+ <_>
+
+ 0 -1 785 2.4347059661522508e-04
+
+ 3.8550278544425964e-01 5.7413887977600098e-01
+ <_>
+
+ 0 -1 786 -3.0512469820678234e-03
+
+ 5.5032098293304443e-01 3.4628450870513916e-01
+ <_>
+
+ 0 -1 787 -6.8657199153676629e-04
+
+ 3.2912218570709229e-01 5.4295092821121216e-01
+ <_>
+
+ 0 -1 788 1.4668200165033340e-03
+
+ 3.5883820056915283e-01 5.3518110513687134e-01
+ <_>
+
+ 0 -1 789 3.2021870720200241e-04
+
+ 4.2968419194221497e-01 5.7002341747283936e-01
+ <_>
+
+ 0 -1 790 7.4122188379988074e-04
+
+ 5.2821648120880127e-01 3.3668708801269531e-01
+ <_>
+
+ 0 -1 791 3.8330298848450184e-03
+
+ 4.5595678687095642e-01 6.2573361396789551e-01
+ <_>
+
+ 0 -1 792 -1.5456439927220345e-02
+
+ 2.3501169681549072e-01 5.1294529438018799e-01
+ <_>
+
+ 0 -1 793 2.6796779129654169e-03
+
+ 5.3294152021408081e-01 4.1550621390342712e-01
+ <_>
+
+ 0 -1 794 2.8296569362282753e-03
+
+ 4.2730879783630371e-01 5.8045381307601929e-01
+ <_>
+
+ 0 -1 795 -3.9444249123334885e-03
+
+ 2.9126119613647461e-01 5.2026861906051636e-01
+ <_>
+
+ 0 -1 796 2.7179559692740440e-03
+
+ 5.3076881170272827e-01 3.5856771469116211e-01
+ <_>
+
+ 0 -1 797 5.9077627956867218e-03
+
+ 4.7037750482559204e-01 5.9415858983993530e-01
+ <_>
+
+ 0 -1 798 -4.2240349575877190e-03
+
+ 2.1415670216083527e-01 5.0887960195541382e-01
+ <_>
+
+ 0 -1 799 4.0725888684391975e-03
+
+ 4.7664138674736023e-01 6.8410611152648926e-01
+ <_>
+
+ 0 -1 800 1.0149530135095119e-02
+
+ 5.3607988357543945e-01 3.7484970688819885e-01
+ <_>
+
+ 0 -1 801 -1.8864999583456665e-04
+
+ 5.7201302051544189e-01 3.8538050651550293e-01
+ <_>
+
+ 0 -1 802 -4.8864358104765415e-03
+
+ 3.6931228637695312e-01 5.3409588336944580e-01
+ <_>
+
+ 0 -1 803 2.6158479973673820e-02
+
+ 4.9623748660087585e-01 6.0599899291992188e-01
+ <_>
+
+ 0 -1 804 4.8560759751126170e-04
+
+ 4.4389459490776062e-01 6.0124689340591431e-01
+ <_>
+
+ 0 -1 805 1.1268709786236286e-02
+
+ 5.2442502975463867e-01 1.8403880298137665e-01
+ <_>
+
+ 0 -1 806 -2.8114619199186563e-03
+
+ 6.0602837800979614e-01 4.4098970293998718e-01
+ <_>
+
+ 0 -1 807 -5.6112729944288731e-03
+
+ 3.8911709189414978e-01 5.5892372131347656e-01
+ <_>
+
+ 0 -1 808 8.5680093616247177e-03
+
+ 5.0693458318710327e-01 2.0626190304756165e-01
+ <_>
+
+ 0 -1 809 -3.8172779022715986e-04
+
+ 5.8822017908096313e-01 4.1926109790802002e-01
+ <_>
+
+ 0 -1 810 -1.7680290329735726e-04
+
+ 5.5336058139801025e-01 4.0033689141273499e-01
+ <_>
+
+ 0 -1 811 6.5112537704408169e-03
+
+ 3.3101469278335571e-01 5.4441910982131958e-01
+ <_>
+
+ 0 -1 812 -6.5948683186434209e-05
+
+ 5.4338318109512329e-01 3.9449059963226318e-01
+ <_>
+
+ 0 -1 813 6.9939051754772663e-03
+
+ 5.6003582477569580e-01 4.1927140951156616e-01
+ <_>
+
+ 0 -1 814 -4.6744439750909805e-03
+
+ 6.6854667663574219e-01 4.6049609780311584e-01
+ <_>
+
+ 0 -1 815 1.1589850299060345e-02
+
+ 5.3571212291717529e-01 2.9268300533294678e-01
+ <_>
+
+ 0 -1 816 1.3007840141654015e-02
+
+ 4.6798178553581238e-01 7.3074632883071899e-01
+ <_>
+
+ 0 -1 817 -1.1008579749614000e-03
+
+ 3.9375010132789612e-01 5.4150652885437012e-01
+ <_>
+
+ 0 -1 818 6.0472649056464434e-04
+
+ 4.2423760890960693e-01 5.6040412187576294e-01
+ <_>
+
+ 0 -1 819 -1.4494840055704117e-02
+
+ 3.6312100291252136e-01 5.2931827306747437e-01
+ <_>
+
+ 0 -1 820 -5.3056948818266392e-03
+
+ 6.8604522943496704e-01 4.6218210458755493e-01
+ <_>
+
+ 0 -1 821 -8.1829127157106996e-04
+
+ 3.9440968632698059e-01 5.4204392433166504e-01
+ <_>
+
+ 0 -1 822 -1.9077520817518234e-02
+
+ 1.9626219570636749e-01 5.0378918647766113e-01
+ <_>
+
+ 0 -1 823 3.5549470339901745e-04
+
+ 4.0862590074539185e-01 5.6139731407165527e-01
+ <_>
+
+ 0 -1 824 1.9679730758070946e-03
+
+ 4.4891211390495300e-01 5.9261232614517212e-01
+ <_>
+
+ 0 -1 825 6.9189141504466534e-03
+
+ 5.3359258174896240e-01 3.7283858656883240e-01
+ <_>
+
+ 0 -1 826 2.9872779268771410e-03
+
+ 5.1113212108612061e-01 2.9756438732147217e-01
+ <_>
+
+ 0 -1 827 -6.2264618463814259e-03
+
+ 5.5414897203445435e-01 4.8245379328727722e-01
+ <_>
+
+ 0 -1 828 1.3353300280869007e-02
+
+ 4.5864239335060120e-01 6.4147979021072388e-01
+ <_>
+
+ 0 -1 829 3.3505238592624664e-02
+
+ 5.3924250602722168e-01 3.4299948811531067e-01
+ <_>
+
+ 0 -1 830 -2.5294460356235504e-03
+
+ 1.7037139832973480e-01 5.0133150815963745e-01
+ <_>
+
+ 0 -1 831 -1.2801629491150379e-03
+
+ 5.3054618835449219e-01 4.6974050998687744e-01
+ <_>
+
+ 0 -1 832 7.0687388069927692e-03
+
+ 4.6155458688735962e-01 6.4365047216415405e-01
+ <_>
+
+ 0 -1 833 9.6880499040707946e-04
+
+ 4.8335990309715271e-01 6.0438942909240723e-01
+ <_>
+
+ 0 -1 834 3.9647659286856651e-03
+
+ 5.1876372098922729e-01 3.2318168878555298e-01
+ <_>
+
+ 0 -1 835 -2.2057730704545975e-02
+
+ 4.0792569518089294e-01 5.2009809017181396e-01
+ <_>
+
+ 0 -1 836 -6.6906312713399529e-04
+
+ 5.3316092491149902e-01 3.8156008720397949e-01
+ <_>
+
+ 0 -1 837 -6.7009328631684184e-04
+
+ 5.6554222106933594e-01 4.6889019012451172e-01
+ <_>
+
+ 0 -1 838 7.4284552829340100e-04
+
+ 4.5343810319900513e-01 6.2874001264572144e-01
+ <_>
+
+ 0 -1 839 2.2227810695767403e-03
+
+ 5.3506332635879517e-01 3.3036559820175171e-01
+ <_>
+
+ 0 -1 840 -5.4130521602928638e-03
+
+ 1.1136870086193085e-01 5.0054347515106201e-01
+ <_>
+
+ 0 -1 841 -1.4520040167553816e-05
+
+ 5.6287378072738647e-01 4.3251338601112366e-01
+ <_>
+
+ 0 -1 842 2.3369169502984732e-04
+
+ 4.1658350825309753e-01 5.4477912187576294e-01
+ <_>
+
+ 0 -1 843 4.2894547805190086e-03
+
+ 4.8603910207748413e-01 6.7786490917205811e-01
+ <_>
+
+ 0 -1 844 5.9103150852024555e-03
+
+ 5.2623051404953003e-01 3.6121138930320740e-01
+ <_>
+
+ 0 -1 845 1.2900539673864841e-02
+
+ 5.3193771839141846e-01 3.2502880692481995e-01
+ <_>
+
+ 0 -1 846 4.6982979401946068e-03
+
+ 4.6182450652122498e-01 6.6659259796142578e-01
+ <_>
+
+ 0 -1 847 1.0439859703183174e-02
+
+ 5.5056709051132202e-01 3.8836041092872620e-01
+ <_>
+
+ 0 -1 848 3.0443191062659025e-03
+
+ 4.6978530287742615e-01 7.3018449544906616e-01
+ <_>
+
+ 0 -1 849 -6.1593751888722181e-04
+
+ 3.8308390974998474e-01 5.4649841785430908e-01
+ <_>
+
+ 0 -1 850 -3.4247159492224455e-03
+
+ 2.5663000345230103e-01 5.0895309448242188e-01
+ <_>
+
+ 0 -1 851 -9.3538565561175346e-03
+
+ 6.4699661731719971e-01 4.9407958984375000e-01
+ <_>
+
+ 0 -1 852 5.2338998764753342e-02
+
+ 4.7459828853607178e-01 7.8787708282470703e-01
+ <_>
+
+ 0 -1 853 3.5765620414167643e-03
+
+ 5.3066647052764893e-01 2.7484980225563049e-01
+ <_>
+
+ 0 -1 854 7.1555317845195532e-04
+
+ 5.4131257534027100e-01 4.0419089794158936e-01
+ <_>
+
+ 0 -1 855 -1.0516679845750332e-02
+
+ 6.1585122346878052e-01 4.8152831196784973e-01
+ <_>
+
+ 0 -1 856 7.7347927726805210e-03
+
+ 4.6958059072494507e-01 7.0289808511734009e-01
+ <_>
+
+ 0 -1 857 -4.3226778507232666e-03
+
+ 2.8495660424232483e-01 5.3046840429306030e-01
+ <_>
+
+ 0 -1 858 -2.5534399319440126e-03
+
+ 7.0569849014282227e-01 4.6888920664787292e-01
+ <_>
+
+ 0 -1 859 1.0268510231981054e-04
+
+ 3.9029321074485779e-01 5.5734640359878540e-01
+ <_>
+
+ 0 -1 860 7.1395188570022583e-06
+
+ 3.6842319369316101e-01 5.2639877796173096e-01
+ <_>
+
+ 0 -1 861 -1.6711989883333445e-03
+
+ 3.8491758704185486e-01 5.3872710466384888e-01
+ <_>
+
+ 0 -1 862 4.9260449595749378e-03
+
+ 4.7297719120979309e-01 7.4472510814666748e-01
+ <_>
+
+ 0 -1 863 4.3908702209591866e-03
+
+ 4.8091810941696167e-01 5.5919218063354492e-01
+ <_>
+
+ 0 -1 864 -1.7793629318475723e-02
+
+ 6.9036781787872314e-01 4.6769270300865173e-01
+ <_>
+
+ 0 -1 865 2.0469669252634048e-03
+
+ 5.3706902265548706e-01 3.3081620931625366e-01
+ <_>
+
+ 0 -1 866 2.9891489073634148e-02
+
+ 5.1398652791976929e-01 3.3090591430664062e-01
+ <_>
+
+ 0 -1 867 1.5494900289922953e-03
+
+ 4.6602371335029602e-01 6.0783427953720093e-01
+ <_>
+
+ 0 -1 868 1.4956969534978271e-03
+
+ 4.4048359990119934e-01 5.8639198541641235e-01
+ <_>
+
+ 0 -1 869 9.5885928021743894e-04
+
+ 5.4359710216522217e-01 4.2085230350494385e-01
+ <_>
+
+ 0 -1 870 4.9643701640889049e-04
+
+ 5.3705781698226929e-01 4.0006220340728760e-01
+ <_>
+
+ 0 -1 871 -2.7280810754746199e-03
+
+ 5.6594127416610718e-01 4.2596429586410522e-01
+ <_>
+
+ 0 -1 872 2.3026480339467525e-03
+
+ 5.1616579294204712e-01 3.3508691191673279e-01
+ <_>
+
+ 0 -1 873 2.5151631236076355e-01
+
+ 4.8696619272232056e-01 7.1473097801208496e-01
+ <_>
+
+ 0 -1 874 -4.6328022144734859e-03
+
+ 2.7274489402770996e-01 5.0837898254394531e-01
+ <_>
+
+ 0 -1 875 -4.0434490889310837e-02
+
+ 6.8514388799667358e-01 5.0217670202255249e-01
+ <_>
+
+ 0 -1 876 1.4972220014897175e-05
+
+ 4.2844650149345398e-01 5.5225551128387451e-01
+ <_>
+
+ 0 -1 877 -2.4050309730228037e-04
+
+ 4.2261189222335815e-01 5.3900748491287231e-01
+ <_>
+
+ 0 -1 878 2.3657839745283127e-02
+
+ 4.7446319460868835e-01 7.5043660402297974e-01
+ <_>
+
+ 0 -1 879 -8.1449104472994804e-03
+
+ 4.2450588941574097e-01 5.5383628606796265e-01
+ <_>
+
+ 0 -1 880 -3.6992130335420370e-03
+
+ 5.9523570537567139e-01 4.5297130942344666e-01
+ <_>
+
+ 0 -1 881 -6.7718601785600185e-03
+
+ 4.1377940773963928e-01 5.4733997583389282e-01
+ <_>
+
+ 0 -1 882 4.2669530957937241e-03
+
+ 4.4841149449348450e-01 5.7979941368103027e-01
+ <_>
+
+ 0 -1 883 1.7791989957913756e-03
+
+ 5.6248587369918823e-01 4.4324448704719543e-01
+ <_>
+
+ 0 -1 884 1.6774770338088274e-03
+
+ 4.6377518773078918e-01 6.3642418384552002e-01
+ <_>
+
+ 0 -1 885 1.1732629500329494e-03
+
+ 4.5445030927658081e-01 5.9144157171249390e-01
+ <_>
+
+ 0 -1 886 8.6998171173036098e-04
+
+ 5.3347527980804443e-01 3.8859179615974426e-01
+ <_>
+
+ 0 -1 887 7.6378340600058436e-04
+
+ 5.3985852003097534e-01 3.7449419498443604e-01
+ <_>
+
+ 0 -1 888 1.5684569370932877e-04
+
+ 4.3178731203079224e-01 5.6146162748336792e-01
+ <_>
+
+ 0 -1 889 -2.1511370316147804e-02
+
+ 1.7859250307083130e-01 5.1855427026748657e-01
+ <_>
+
+ 0 -1 890 1.3081369979772717e-04
+
+ 4.3424990773200989e-01 5.6828498840332031e-01
+ <_>
+
+ 0 -1 891 2.1992040798068047e-02
+
+ 5.1617169380187988e-01 2.3793940246105194e-01
+ <_>
+
+ 0 -1 892 -8.0136500764638186e-04
+
+ 5.9867632389068604e-01 4.4664269685745239e-01
+ <_>
+
+ 0 -1 893 -8.2736099138855934e-03
+
+ 4.1082179546356201e-01 5.2510571479797363e-01
+ <_>
+
+ 0 -1 894 3.6831789184361696e-03
+
+ 5.1738142967224121e-01 3.3975180983543396e-01
+ <_>
+
+ 0 -1 895 -7.9525681212544441e-03
+
+ 6.8889832496643066e-01 4.8459240794181824e-01
+ <_>
+
+ 0 -1 896 1.5382299898192286e-03
+
+ 5.1785671710968018e-01 3.4541139006614685e-01
+ <_>
+
+ 0 -1 897 -1.4043530449271202e-02
+
+ 1.6784210503101349e-01 5.1886677742004395e-01
+ <_>
+
+ 0 -1 898 1.4315890148282051e-03
+
+ 4.3682569265365601e-01 5.6557738780975342e-01
+ <_>
+
+ 0 -1 899 -3.4014228731393814e-02
+
+ 7.8022962808609009e-01 4.9592170119285583e-01
+ <_>
+
+ 0 -1 900 -1.2027299962937832e-02
+
+ 1.5851010382175446e-01 5.0322318077087402e-01
+ <_>
+
+ 0 -1 901 1.3316619396209717e-01
+
+ 5.1633048057556152e-01 2.7551281452178955e-01
+ <_>
+
+ 0 -1 902 -1.5221949433907866e-03
+
+ 3.7283179163932800e-01 5.2145522832870483e-01
+ <_>
+
+ 0 -1 903 -9.3929271679371595e-04
+
+ 5.8383792638778687e-01 4.5111650228500366e-01
+ <_>
+
+ 0 -1 904 2.7719739824533463e-02
+
+ 4.7282868623733521e-01 7.3315447568893433e-01
+ <_>
+
+ 0 -1 905 3.1030150130391121e-03
+
+ 5.3022021055221558e-01 4.1015630960464478e-01
+ <_>
+
+ 0 -1 906 7.7861219644546509e-02
+
+ 4.9983340501785278e-01 1.2729619443416595e-01
+ <_>
+
+ 0 -1 907 -1.5854939818382263e-02
+
+ 5.0833359360694885e-02 5.1656562089920044e-01
+ <_>
+
+ 0 -1 908 -4.9725300632417202e-03
+
+ 6.7981338500976562e-01 4.6842318773269653e-01
+ <_>
+
+ 0 -1 909 -9.7676506265997887e-04
+
+ 6.0107719898223877e-01 4.7889319062232971e-01
+ <_>
+
+ 0 -1 910 -2.4647710379213095e-03
+
+ 3.3933979272842407e-01 5.2205038070678711e-01
+ <_>
+
+ 0 -1 911 -6.7937700077891350e-03
+
+ 4.3651369214057922e-01 5.2396631240844727e-01
+ <_>
+
+ 0 -1 912 3.2608021050691605e-02
+
+ 5.0527238845825195e-01 2.4252149462699890e-01
+ <_>
+
+ 0 -1 913 -5.8514421107247472e-04
+
+ 5.7339739799499512e-01 4.7585740685462952e-01
+ <_>
+
+ 0 -1 914 -2.9632600024342537e-02
+
+ 3.8922891020774841e-01 5.2635979652404785e-01
+ <_>
+ 137
+ 6.7698921203613281e+01
+
+ <_>
+
+ 0 -1 915 4.6550851315259933e-02
+
+ 3.2769501209259033e-01 6.2405228614807129e-01
+ <_>
+
+ 0 -1 916 7.9537127166986465e-03
+
+ 4.2564851045608521e-01 6.9429391622543335e-01
+ <_>
+
+ 0 -1 917 6.8221561377868056e-04
+
+ 3.7114870548248291e-01 5.9007328748703003e-01
+ <_>
+
+ 0 -1 918 -1.9348249770700932e-04
+
+ 2.0411339402198792e-01 5.3005450963973999e-01
+ <_>
+
+ 0 -1 919 -2.6710508973337710e-04
+
+ 5.4161262512207031e-01 3.1031790375709534e-01
+ <_>
+
+ 0 -1 920 2.7818060480058193e-03
+
+ 5.2778327465057373e-01 3.4670698642730713e-01
+ <_>
+
+ 0 -1 921 -4.6779078547842801e-04
+
+ 5.3082311153411865e-01 3.2944920659065247e-01
+ <_>
+
+ 0 -1 922 -3.0335160772665404e-05
+
+ 5.7738727331161499e-01 3.8520970940589905e-01
+ <_>
+
+ 0 -1 923 7.8038009814918041e-04
+
+ 4.3174389004707336e-01 6.1500579118728638e-01
+ <_>
+
+ 0 -1 924 -4.2553851380944252e-03
+
+ 2.9339039325714111e-01 5.3242927789688110e-01
+ <_>
+
+ 0 -1 925 -2.4735610350035131e-04
+
+ 5.4688447713851929e-01 3.8430300354957581e-01
+ <_>
+
+ 0 -1 926 -1.4724259381182492e-04
+
+ 4.2815428972244263e-01 5.7555872201919556e-01
+ <_>
+
+ 0 -1 927 1.1864770203828812e-03
+
+ 3.7473011016845703e-01 5.4714661836624146e-01
+ <_>
+
+ 0 -1 928 2.3936580400913954e-03
+
+ 4.5377838611602783e-01 6.1115288734436035e-01
+ <_>
+
+ 0 -1 929 -1.5390539774671197e-03
+
+ 2.9713419079780579e-01 5.1895380020141602e-01
+ <_>
+
+ 0 -1 930 -7.1968790143728256e-03
+
+ 6.6990667581558228e-01 4.7264769673347473e-01
+ <_>
+
+ 0 -1 931 -4.1499789222143590e-04
+
+ 3.3849540352821350e-01 5.2603179216384888e-01
+ <_>
+
+ 0 -1 932 4.4359830208122730e-03
+
+ 5.3991222381591797e-01 3.9201408624649048e-01
+ <_>
+
+ 0 -1 933 2.6606200262904167e-03
+
+ 4.4825780391693115e-01 6.1196178197860718e-01
+ <_>
+
+ 0 -1 934 -1.5287200221791863e-03
+
+ 3.7112379074096680e-01 5.3402662277221680e-01
+ <_>
+
+ 0 -1 935 -4.7397250309586525e-03
+
+ 6.0310882329940796e-01 4.4551450014114380e-01
+ <_>
+
+ 0 -1 936 -1.4829129911959171e-02
+
+ 2.8387540578842163e-01 5.3418618440628052e-01
+ <_>
+
+ 0 -1 937 9.2275557108223438e-04
+
+ 5.2095472812652588e-01 3.3616539835929871e-01
+ <_>
+
+ 0 -1 938 8.3529807627201080e-02
+
+ 5.1199698448181152e-01 8.1164449453353882e-02
+ <_>
+
+ 0 -1 939 -7.5633148662745953e-04
+
+ 3.3171200752258301e-01 5.1898312568664551e-01
+ <_>
+
+ 0 -1 940 9.8403859883546829e-03
+
+ 5.2475982904434204e-01 2.3349590599536896e-01
+ <_>
+
+ 0 -1 941 -1.5953830443322659e-03
+
+ 5.7500940561294556e-01 4.2956221103668213e-01
+ <_>
+
+ 0 -1 942 3.4766020689858124e-05
+
+ 4.3424451351165771e-01 5.5640292167663574e-01
+ <_>
+
+ 0 -1 943 2.9862910509109497e-02
+
+ 4.5791471004486084e-01 6.5791881084442139e-01
+ <_>
+
+ 0 -1 944 1.1325590312480927e-02
+
+ 5.2743119001388550e-01 3.6738881468772888e-01
+ <_>
+
+ 0 -1 945 -8.7828645482659340e-03
+
+ 7.1003687381744385e-01 4.6421670913696289e-01
+ <_>
+
+ 0 -1 946 4.3639959767460823e-03
+
+ 5.2792161703109741e-01 2.7058771252632141e-01
+ <_>
+
+ 0 -1 947 4.1804728098213673e-03
+
+ 5.0725251436233521e-01 2.4490830302238464e-01
+ <_>
+
+ 0 -1 948 -4.5668511302210391e-04
+
+ 4.2831051349639893e-01 5.5486911535263062e-01
+ <_>
+
+ 0 -1 949 -3.7140368949621916e-03
+
+ 5.5193877220153809e-01 4.1036531329154968e-01
+ <_>
+
+ 0 -1 950 -2.5304289534687996e-02
+
+ 6.8670022487640381e-01 4.8698890209197998e-01
+ <_>
+
+ 0 -1 951 -3.4454080741852522e-04
+
+ 3.7288740277290344e-01 5.2876931428909302e-01
+ <_>
+
+ 0 -1 952 -8.3935231668874621e-04
+
+ 6.0601520538330078e-01 4.6160620450973511e-01
+ <_>
+
+ 0 -1 953 1.7280049622058868e-02
+
+ 5.0496357679367065e-01 1.8198239803314209e-01
+ <_>
+
+ 0 -1 954 -6.3595077954232693e-03
+
+ 1.6312399506568909e-01 5.2327787876129150e-01
+ <_>
+
+ 0 -1 955 1.0298109846189618e-03
+
+ 4.4632780551910400e-01 6.1765491962432861e-01
+ <_>
+
+ 0 -1 956 1.0117109632119536e-03
+
+ 5.4733848571777344e-01 4.3006989359855652e-01
+ <_>
+
+ 0 -1 957 -1.0308800265192986e-02
+
+ 1.1669850349426270e-01 5.0008672475814819e-01
+ <_>
+
+ 0 -1 958 5.4682018235325813e-03
+
+ 4.7692871093750000e-01 6.7192137241363525e-01
+ <_>
+
+ 0 -1 959 -9.1696460731327534e-04
+
+ 3.4710898995399475e-01 5.1781648397445679e-01
+ <_>
+
+ 0 -1 960 2.3922820109874010e-03
+
+ 4.7852361202239990e-01 6.2163108587265015e-01
+ <_>
+
+ 0 -1 961 -7.5573818758130074e-03
+
+ 5.8147960901260376e-01 4.4100850820541382e-01
+ <_>
+
+ 0 -1 962 -7.7024032361805439e-04
+
+ 3.8780000805854797e-01 5.4657220840454102e-01
+ <_>
+
+ 0 -1 963 -8.7125990539789200e-03
+
+ 1.6600510478019714e-01 4.9958360195159912e-01
+ <_>
+
+ 0 -1 964 -1.0306320153176785e-02
+
+ 4.0933910012245178e-01 5.2742338180541992e-01
+ <_>
+
+ 0 -1 965 -2.0940979011356831e-03
+
+ 6.2061947584152222e-01 4.5722800493240356e-01
+ <_>
+
+ 0 -1 966 6.8099051713943481e-03
+
+ 5.5677592754364014e-01 4.1556000709533691e-01
+ <_>
+
+ 0 -1 967 -1.0746059706434608e-03
+
+ 5.6389278173446655e-01 4.3530249595642090e-01
+ <_>
+
+ 0 -1 968 2.1550289820879698e-03
+
+ 4.8262658715248108e-01 6.7497581243515015e-01
+ <_>
+
+ 0 -1 969 3.1742319464683533e-02
+
+ 5.0483798980712891e-01 1.8832489848136902e-01
+ <_>
+
+ 0 -1 970 -7.8382723033428192e-02
+
+ 2.3695489764213562e-01 5.2601581811904907e-01
+ <_>
+
+ 0 -1 971 5.7415119372308254e-03
+
+ 5.0488287210464478e-01 2.7764698863029480e-01
+ <_>
+
+ 0 -1 972 -2.9014600440859795e-03
+
+ 6.2386047840118408e-01 4.6933171153068542e-01
+ <_>
+
+ 0 -1 973 -2.6427931152284145e-03
+
+ 3.3141419291496277e-01 5.1697772741317749e-01
+ <_>
+
+ 0 -1 974 -1.0949660092592239e-01
+
+ 2.3800450563430786e-01 5.1834410429000854e-01
+ <_>
+
+ 0 -1 975 7.4075913289561868e-05
+
+ 4.0696358680725098e-01 5.3621500730514526e-01
+ <_>
+
+ 0 -1 976 -5.0593802006915212e-04
+
+ 5.5067062377929688e-01 4.3745940923690796e-01
+ <_>
+
+ 0 -1 977 -8.2131777890026569e-04
+
+ 5.5257099866867065e-01 4.2093759775161743e-01
+ <_>
+
+ 0 -1 978 -6.0276539443293586e-05
+
+ 5.4554748535156250e-01 4.7482660412788391e-01
+ <_>
+
+ 0 -1 979 6.8065142259001732e-03
+
+ 5.1579958200454712e-01 3.4245771169662476e-01
+ <_>
+
+ 0 -1 980 1.7202789895236492e-03
+
+ 5.0132077932357788e-01 6.3312637805938721e-01
+ <_>
+
+ 0 -1 981 -1.3016929733566940e-04
+
+ 5.5397182703018188e-01 4.2268699407577515e-01
+ <_>
+
+ 0 -1 982 -4.8016388900578022e-03
+
+ 4.4250950217247009e-01 5.4307800531387329e-01
+ <_>
+
+ 0 -1 983 -2.5399310979992151e-03
+
+ 7.1457821130752563e-01 4.6976050734519958e-01
+ <_>
+
+ 0 -1 984 -1.4278929447755218e-03
+
+ 4.0704450011253357e-01 5.3996050357818604e-01
+ <_>
+
+ 0 -1 985 -2.5142550468444824e-02
+
+ 7.8846907615661621e-01 4.7473520040512085e-01
+ <_>
+
+ 0 -1 986 -3.8899609353393316e-03
+
+ 4.2961919307708740e-01 5.5771100521087646e-01
+ <_>
+
+ 0 -1 987 4.3947459198534489e-03
+
+ 4.6931621432304382e-01 7.0239442586898804e-01
+ <_>
+
+ 0 -1 988 2.4678420275449753e-02
+
+ 5.2423220872879028e-01 3.8125100731849670e-01
+ <_>
+
+ 0 -1 989 3.8047678768634796e-02
+
+ 5.0117397308349609e-01 1.6878280043601990e-01
+ <_>
+
+ 0 -1 990 7.9424865543842316e-03
+
+ 4.8285821080207825e-01 6.3695681095123291e-01
+ <_>
+
+ 0 -1 991 -1.5110049862414598e-03
+
+ 5.9064859151840210e-01 4.4876679778099060e-01
+ <_>
+
+ 0 -1 992 6.4201741479337215e-03
+
+ 5.2410978078842163e-01 2.9905700683593750e-01
+ <_>
+
+ 0 -1 993 -2.9802159406244755e-03
+
+ 3.0414658784866333e-01 5.0784897804260254e-01
+ <_>
+
+ 0 -1 994 -7.4580078944563866e-04
+
+ 4.1281390190124512e-01 5.2568262815475464e-01
+ <_>
+
+ 0 -1 995 -1.0470950044691563e-02
+
+ 5.8083951473236084e-01 4.4942960143089294e-01
+ <_>
+
+ 0 -1 996 9.3369204550981522e-03
+
+ 5.2465528249740601e-01 2.6589488983154297e-01
+ <_>
+
+ 0 -1 997 2.7936900034546852e-02
+
+ 4.6749550104141235e-01 7.0872569084167480e-01
+ <_>
+
+ 0 -1 998 7.4277678504586220e-03
+
+ 5.4094868898391724e-01 3.7585180997848511e-01
+ <_>
+
+ 0 -1 999 -2.3584509268403053e-02
+
+ 3.7586399912834167e-01 5.2385509014129639e-01
+ <_>
+
+ 0 -1 1000 1.1452640173956752e-03
+
+ 4.3295788764953613e-01 5.8042472600936890e-01
+ <_>
+
+ 0 -1 1001 -4.3468660442158580e-04
+
+ 5.2806180715560913e-01 3.8730698823928833e-01
+ <_>
+
+ 0 -1 1002 1.0648540221154690e-02
+
+ 4.9021130800247192e-01 5.6812518835067749e-01
+ <_>
+
+ 0 -1 1003 -3.9418050437234342e-04
+
+ 5.5708801746368408e-01 4.3182510137557983e-01
+ <_>
+
+ 0 -1 1004 -1.3270479394122958e-04
+
+ 5.6584399938583374e-01 4.3435549736022949e-01
+ <_>
+
+ 0 -1 1005 -2.0125510636717081e-03
+
+ 6.0567390918731689e-01 4.5375239849090576e-01
+ <_>
+
+ 0 -1 1006 2.4854319635778666e-03
+
+ 5.3904771804809570e-01 4.1380101442337036e-01
+ <_>
+
+ 0 -1 1007 1.8237880431115627e-03
+
+ 4.3548288941383362e-01 5.7171887159347534e-01
+ <_>
+
+ 0 -1 1008 -1.6656659543514252e-02
+
+ 3.0109131336212158e-01 5.2161228656768799e-01
+ <_>
+
+ 0 -1 1009 8.0349558265879750e-04
+
+ 5.3001511096954346e-01 3.8183969259262085e-01
+ <_>
+
+ 0 -1 1010 3.4170378930866718e-03
+
+ 5.3280287981033325e-01 4.2414000630378723e-01
+ <_>
+
+ 0 -1 1011 -3.6222729249857366e-04
+
+ 5.4917281866073608e-01 4.1869771480560303e-01
+ <_>
+
+ 0 -1 1012 -1.1630020290613174e-01
+
+ 1.4407220482826233e-01 5.2264511585235596e-01
+ <_>
+
+ 0 -1 1013 -1.4695010147988796e-02
+
+ 7.7477252483367920e-01 4.7157171368598938e-01
+ <_>
+
+ 0 -1 1014 2.1972130052745342e-03
+
+ 5.3554338216781616e-01 3.3156448602676392e-01
+ <_>
+
+ 0 -1 1015 -4.6965209185145795e-04
+
+ 5.7672351598739624e-01 4.4581368565559387e-01
+ <_>
+
+ 0 -1 1016 6.5144998952746391e-03
+
+ 5.2156740427017212e-01 3.6478888988494873e-01
+ <_>
+
+ 0 -1 1017 2.1300060674548149e-02
+
+ 4.9942049384117126e-01 1.5679509937763214e-01
+ <_>
+
+ 0 -1 1018 3.1881409231573343e-03
+
+ 4.7422000765800476e-01 6.2872701883316040e-01
+ <_>
+
+ 0 -1 1019 9.0019777417182922e-04
+
+ 5.3479540348052979e-01 3.9437520503997803e-01
+ <_>
+
+ 0 -1 1020 -5.1772277802228928e-03
+
+ 6.7271918058395386e-01 5.0131380558013916e-01
+ <_>
+
+ 0 -1 1021 -4.3764649890363216e-03
+
+ 3.1066751480102539e-01 5.1287931203842163e-01
+ <_>
+
+ 0 -1 1022 2.6299960445612669e-03
+
+ 4.8863101005554199e-01 5.7552158832550049e-01
+ <_>
+
+ 0 -1 1023 -2.0458688959479332e-03
+
+ 6.0257941484451294e-01 4.5580768585205078e-01
+ <_>
+
+ 0 -1 1024 6.9482706487178802e-02
+
+ 5.2407479286193848e-01 2.1852590143680573e-01
+ <_>
+
+ 0 -1 1025 2.4048939347267151e-02
+
+ 5.0118672847747803e-01 2.0906220376491547e-01
+ <_>
+
+ 0 -1 1026 3.1095340382307768e-03
+
+ 4.8667120933532715e-01 7.1085482835769653e-01
+ <_>
+
+ 0 -1 1027 -1.2503260513767600e-03
+
+ 3.4078910946846008e-01 5.1561951637268066e-01
+ <_>
+
+ 0 -1 1028 -1.0281190043315291e-03
+
+ 5.5755722522735596e-01 4.4394320249557495e-01
+ <_>
+
+ 0 -1 1029 -8.8893622159957886e-03
+
+ 6.4020007848739624e-01 4.6204420924186707e-01
+ <_>
+
+ 0 -1 1030 -6.1094801640138030e-04
+
+ 3.7664419412612915e-01 5.4488998651504517e-01
+ <_>
+
+ 0 -1 1031 -5.7686357758939266e-03
+
+ 3.3186489343643188e-01 5.1336771249771118e-01
+ <_>
+
+ 0 -1 1032 1.8506490159779787e-03
+
+ 4.9035701155662537e-01 6.4069348573684692e-01
+ <_>
+
+ 0 -1 1033 -9.9799469113349915e-02
+
+ 1.5360510349273682e-01 5.0155621767044067e-01
+ <_>
+
+ 0 -1 1034 -3.5128349065780640e-01
+
+ 5.8823131024837494e-02 5.1743787527084351e-01
+ <_>
+
+ 0 -1 1035 -4.5244570821523666e-02
+
+ 6.9614887237548828e-01 4.6778729557991028e-01
+ <_>
+
+ 0 -1 1036 7.1481578052043915e-02
+
+ 5.1679861545562744e-01 1.0380929708480835e-01
+ <_>
+
+ 0 -1 1037 2.1895780228078365e-03
+
+ 4.2730781435966492e-01 5.5320608615875244e-01
+ <_>
+
+ 0 -1 1038 -5.9242651332169771e-04
+
+ 4.6389439702033997e-01 5.2763891220092773e-01
+ <_>
+
+ 0 -1 1039 1.6788389766588807e-03
+
+ 5.3016489744186401e-01 3.9320349693298340e-01
+ <_>
+
+ 0 -1 1040 -2.2163488902151585e-03
+
+ 5.6306940317153931e-01 4.7570338845252991e-01
+ <_>
+
+ 0 -1 1041 1.1568699846975505e-04
+
+ 4.3075358867645264e-01 5.5357027053833008e-01
+ <_>
+
+ 0 -1 1042 -7.2017288766801357e-03
+
+ 1.4448820054531097e-01 5.1930642127990723e-01
+ <_>
+
+ 0 -1 1043 8.9081272017210722e-04
+
+ 4.3844321370124817e-01 5.5936211347579956e-01
+ <_>
+
+ 0 -1 1044 1.9605009583756328e-04
+
+ 5.3404158353805542e-01 4.7059568762779236e-01
+ <_>
+
+ 0 -1 1045 5.2022142335772514e-04
+
+ 5.2138561010360718e-01 3.8100790977478027e-01
+ <_>
+
+ 0 -1 1046 9.4588572392240167e-04
+
+ 4.7694149613380432e-01 6.1307388544082642e-01
+ <_>
+
+ 0 -1 1047 9.1698471806012094e-05
+
+ 4.2450091242790222e-01 5.4293632507324219e-01
+ <_>
+
+ 0 -1 1048 2.1833200007677078e-03
+
+ 5.4577308893203735e-01 4.1910758614540100e-01
+ <_>
+
+ 0 -1 1049 -8.6039671441540122e-04
+
+ 5.7645887136459351e-01 4.4716599583625793e-01
+ <_>
+
+ 0 -1 1050 -1.3236239552497864e-02
+
+ 6.3728231191635132e-01 4.6950098872184753e-01
+ <_>
+
+ 0 -1 1051 4.3376701069064438e-04
+
+ 5.3178739547729492e-01 3.9458298683166504e-01
+ <_>
+ 140
+ 6.9229873657226562e+01
+
+ <_>
+
+ 0 -1 1052 -2.4847149848937988e-02
+
+ 6.5555167198181152e-01 3.8733118772506714e-01
+ <_>
+
+ 0 -1 1053 6.1348611488938332e-03
+
+ 3.7480720877647400e-01 5.9739977121353149e-01
+ <_>
+
+ 0 -1 1054 6.4498498104512691e-03
+
+ 5.4254919290542603e-01 2.5488111376762390e-01
+ <_>
+
+ 0 -1 1055 6.3491211039945483e-04
+
+ 2.4624420702457428e-01 5.3872537612915039e-01
+ <_>
+
+ 0 -1 1056 1.4023890253156424e-03
+
+ 5.5943220853805542e-01 3.5286578536033630e-01
+ <_>
+
+ 0 -1 1057 3.0044000595808029e-04
+
+ 3.9585039019584656e-01 5.7659381628036499e-01
+ <_>
+
+ 0 -1 1058 1.0042409849120304e-04
+
+ 3.6989969015121460e-01 5.5349981784820557e-01
+ <_>
+
+ 0 -1 1059 -5.0841490738093853e-03
+
+ 3.7110909819602966e-01 5.5478000640869141e-01
+ <_>
+
+ 0 -1 1060 -1.9537260755896568e-02
+
+ 7.4927550554275513e-01 4.5792970061302185e-01
+ <_>
+
+ 0 -1 1061 -7.4532740654831287e-06
+
+ 5.6497871875762939e-01 3.9040699601173401e-01
+ <_>
+
+ 0 -1 1062 -3.6079459823668003e-03
+
+ 3.3810880780220032e-01 5.2678012847900391e-01
+ <_>
+
+ 0 -1 1063 2.0697501022368670e-03
+
+ 5.5192911624908447e-01 3.7143889069557190e-01
+ <_>
+
+ 0 -1 1064 -4.6463840408250690e-04
+
+ 5.6082147359848022e-01 4.1135668754577637e-01
+ <_>
+
+ 0 -1 1065 7.5490452582016587e-04
+
+ 3.5592061281204224e-01 5.3293561935424805e-01
+ <_>
+
+ 0 -1 1066 -9.8322238773107529e-04
+
+ 5.4147958755493164e-01 3.7632051110267639e-01
+ <_>
+
+ 0 -1 1067 -1.9940640777349472e-02
+
+ 6.3479030132293701e-01 4.7052991390228271e-01
+ <_>
+
+ 0 -1 1068 3.7680300883948803e-03
+
+ 3.9134898781776428e-01 5.5637162923812866e-01
+ <_>
+
+ 0 -1 1069 -9.4528505578637123e-03
+
+ 2.5548928976058960e-01 5.2151167392730713e-01
+ <_>
+
+ 0 -1 1070 2.9560849070549011e-03
+
+ 5.1746791601181030e-01 3.0639201402664185e-01
+ <_>
+
+ 0 -1 1071 9.1078737750649452e-03
+
+ 5.3884482383728027e-01 2.8859630227088928e-01
+ <_>
+
+ 0 -1 1072 1.8219229532405734e-03
+
+ 4.3360430002212524e-01 5.8521968126296997e-01
+ <_>
+
+ 0 -1 1073 1.4688739553093910e-02
+
+ 5.2873617410659790e-01 2.8700059652328491e-01
+ <_>
+
+ 0 -1 1074 -1.4387990348041058e-02
+
+ 7.0194488763809204e-01 4.6473708748817444e-01
+ <_>
+
+ 0 -1 1075 -1.8986649811267853e-02
+
+ 2.9865521192550659e-01 5.2470117807388306e-01
+ <_>
+
+ 0 -1 1076 1.1527639580890536e-03
+
+ 4.3234738707542419e-01 5.9316617250442505e-01
+ <_>
+
+ 0 -1 1077 1.0933670215308666e-02
+
+ 5.2868640422821045e-01 3.1303191184997559e-01
+ <_>
+
+ 0 -1 1078 -1.4932730235159397e-02
+
+ 2.6584190130233765e-01 5.0840771198272705e-01
+ <_>
+
+ 0 -1 1079 -2.9970539617352188e-04
+
+ 5.4635268449783325e-01 3.7407240271568298e-01
+ <_>
+
+ 0 -1 1080 4.1677621193230152e-03
+
+ 4.7034969925880432e-01 7.4357217550277710e-01
+ <_>
+
+ 0 -1 1081 -6.3905320130288601e-03
+
+ 2.0692589879035950e-01 5.2805382013320923e-01
+ <_>
+
+ 0 -1 1082 4.5029609464108944e-03
+
+ 5.1826488971710205e-01 3.4835430979728699e-01
+ <_>
+
+ 0 -1 1083 -9.2040365561842918e-03
+
+ 6.8037772178649902e-01 4.9323600530624390e-01
+ <_>
+
+ 0 -1 1084 8.1327259540557861e-02
+
+ 5.0583988428115845e-01 2.2530519962310791e-01
+ <_>
+
+ 0 -1 1085 -1.5079280734062195e-01
+
+ 2.9634249210357666e-01 5.2646797895431519e-01
+ <_>
+
+ 0 -1 1086 3.3179009333252907e-03
+
+ 4.6554958820343018e-01 7.0729321241378784e-01
+ <_>
+
+ 0 -1 1087 7.7402801252901554e-04
+
+ 4.7803479433059692e-01 5.6682378053665161e-01
+ <_>
+
+ 0 -1 1088 6.8199541419744492e-04
+
+ 4.2869961261749268e-01 5.7221567630767822e-01
+ <_>
+
+ 0 -1 1089 5.3671570494771004e-03
+
+ 5.2993071079254150e-01 3.1146219372749329e-01
+ <_>
+
+ 0 -1 1090 9.7018666565418243e-05
+
+ 3.6746388673782349e-01 5.2694618701934814e-01
+ <_>
+
+ 0 -1 1091 -1.2534089386463165e-01
+
+ 2.3514920473098755e-01 5.2457910776138306e-01
+ <_>
+
+ 0 -1 1092 -5.2516269497573376e-03
+
+ 7.1159368753433228e-01 4.6937671303749084e-01
+ <_>
+
+ 0 -1 1093 -7.8342109918594360e-03
+
+ 4.4626510143280029e-01 5.4090857505798340e-01
+ <_>
+
+ 0 -1 1094 -1.1310069821774960e-03
+
+ 5.9456187486648560e-01 4.4176620244979858e-01
+ <_>
+
+ 0 -1 1095 1.7601120052859187e-03
+
+ 5.3532499074935913e-01 3.9734530448913574e-01
+ <_>
+
+ 0 -1 1096 -8.1581249833106995e-04
+
+ 3.7602680921554565e-01 5.2647268772125244e-01
+ <_>
+
+ 0 -1 1097 -3.8687589112669230e-03
+
+ 6.3099128007888794e-01 4.7498199343681335e-01
+ <_>
+
+ 0 -1 1098 1.5207129763439298e-03
+
+ 5.2301818132400513e-01 3.3612239360809326e-01
+ <_>
+
+ 0 -1 1099 5.4586738348007202e-01
+
+ 5.1671397686004639e-01 1.1726350337266922e-01
+ <_>
+
+ 0 -1 1100 1.5650190412998199e-02
+
+ 4.9794390797615051e-01 1.3932949304580688e-01
+ <_>
+
+ 0 -1 1101 -1.1731860227882862e-02
+
+ 7.1296507120132446e-01 4.9211961030960083e-01
+ <_>
+
+ 0 -1 1102 -6.1765122227370739e-03
+
+ 2.2881029546260834e-01 5.0497019290924072e-01
+ <_>
+
+ 0 -1 1103 2.2457661107182503e-03
+
+ 4.6324339509010315e-01 6.0487258434295654e-01
+ <_>
+
+ 0 -1 1104 -5.1915869116783142e-03
+
+ 6.4674210548400879e-01 4.6021929383277893e-01
+ <_>
+
+ 0 -1 1105 -2.3827880620956421e-02
+
+ 1.4820009469985962e-01 5.2260792255401611e-01
+ <_>
+
+ 0 -1 1106 1.0284580057486892e-03
+
+ 5.1354891061782837e-01 3.3759570121765137e-01
+ <_>
+
+ 0 -1 1107 -1.0078850202262402e-02
+
+ 2.7405610680580139e-01 5.3035670518875122e-01
+ <_>
+
+ 0 -1 1108 2.6168930344283581e-03
+
+ 5.3326708078384399e-01 3.9724540710449219e-01
+ <_>
+
+ 0 -1 1109 5.4385367548093200e-04
+
+ 5.3656041622161865e-01 4.0634119510650635e-01
+ <_>
+
+ 0 -1 1110 5.3510512225329876e-03
+
+ 4.6537590026855469e-01 6.8890458345413208e-01
+ <_>
+
+ 0 -1 1111 -1.5274790348485112e-03
+
+ 5.4495012760162354e-01 3.6247238516807556e-01
+ <_>
+
+ 0 -1 1112 -8.0624416470527649e-02
+
+ 1.6560870409011841e-01 5.0002872943878174e-01
+ <_>
+
+ 0 -1 1113 2.2192029282450676e-02
+
+ 5.1327311992645264e-01 2.0028080046176910e-01
+ <_>
+
+ 0 -1 1114 7.3100631125271320e-03
+
+ 4.6179479360580444e-01 6.3665360212326050e-01
+ <_>
+
+ 0 -1 1115 -6.4063072204589844e-03
+
+ 5.9162509441375732e-01 4.8678609728813171e-01
+ <_>
+
+ 0 -1 1116 -7.6415040530264378e-04
+
+ 3.8884091377258301e-01 5.3157979249954224e-01
+ <_>
+
+ 0 -1 1117 7.6734489994123578e-04
+
+ 4.1590648889541626e-01 5.6052798032760620e-01
+ <_>
+
+ 0 -1 1118 6.1474501853808761e-04
+
+ 3.0890220403671265e-01 5.1201480627059937e-01
+ <_>
+
+ 0 -1 1119 -5.0105270929634571e-03
+
+ 3.9721998572349548e-01 5.2073061466217041e-01
+ <_>
+
+ 0 -1 1120 -8.6909132078289986e-03
+
+ 6.2574082612991333e-01 4.6085759997367859e-01
+ <_>
+
+ 0 -1 1121 -1.6391459852457047e-02
+
+ 2.0852099359035492e-01 5.2422660589218140e-01
+ <_>
+
+ 0 -1 1122 4.0973909199237823e-04
+
+ 5.2224272489547729e-01 3.7803208827972412e-01
+ <_>
+
+ 0 -1 1123 -2.5242289993911982e-03
+
+ 5.8039271831512451e-01 4.6118900179862976e-01
+ <_>
+
+ 0 -1 1124 5.0945312250405550e-04
+
+ 4.4012719392776489e-01 5.8460158109664917e-01
+ <_>
+
+ 0 -1 1125 1.9656419754028320e-03
+
+ 5.3223252296447754e-01 4.1845908761024475e-01
+ <_>
+
+ 0 -1 1126 5.6298897834494710e-04
+
+ 3.7418448925018311e-01 5.2345657348632812e-01
+ <_>
+
+ 0 -1 1127 -6.7946797935292125e-04
+
+ 4.6310418844223022e-01 5.3564780950546265e-01
+ <_>
+
+ 0 -1 1128 7.2856349870562553e-03
+
+ 5.0446701049804688e-01 2.3775640130043030e-01
+ <_>
+
+ 0 -1 1129 -1.7459489405155182e-02
+
+ 7.2891211509704590e-01 5.0504350662231445e-01
+ <_>
+
+ 0 -1 1130 -2.5421749800443649e-02
+
+ 6.6671347618103027e-01 4.6781000494956970e-01
+ <_>
+
+ 0 -1 1131 -1.5647639520466328e-03
+
+ 4.3917590379714966e-01 5.3236269950866699e-01
+ <_>
+
+ 0 -1 1132 1.1444360017776489e-02
+
+ 4.3464401364326477e-01 5.6800121068954468e-01
+ <_>
+
+ 0 -1 1133 -6.7352550104260445e-04
+
+ 4.4771409034729004e-01 5.2968120574951172e-01
+ <_>
+
+ 0 -1 1134 9.3194209039211273e-03
+
+ 4.7402000427246094e-01 7.4626070261001587e-01
+ <_>
+
+ 0 -1 1135 1.3328490604180843e-04
+
+ 5.3650617599487305e-01 4.7521349787712097e-01
+ <_>
+
+ 0 -1 1136 -7.8815799206495285e-03
+
+ 1.7522190511226654e-01 5.0152552127838135e-01
+ <_>
+
+ 0 -1 1137 -5.7985680177807808e-03
+
+ 7.2712367773056030e-01 4.8962008953094482e-01
+ <_>
+
+ 0 -1 1138 -3.8922499516047537e-04
+
+ 4.0039089322090149e-01 5.3449410200119019e-01
+ <_>
+
+ 0 -1 1139 -1.9288610201328993e-03
+
+ 5.6056129932403564e-01 4.8039558529853821e-01
+ <_>
+
+ 0 -1 1140 8.4214154630899429e-03
+
+ 4.7532469034194946e-01 7.6236087083816528e-01
+ <_>
+
+ 0 -1 1141 8.1655876711010933e-03
+
+ 5.3932619094848633e-01 4.1916438937187195e-01
+ <_>
+
+ 0 -1 1142 4.8280550981871784e-04
+
+ 4.2408001422882080e-01 5.3998219966888428e-01
+ <_>
+
+ 0 -1 1143 -2.7186630759388208e-03
+
+ 4.2445999383926392e-01 5.4249238967895508e-01
+ <_>
+
+ 0 -1 1144 -1.2507230043411255e-02
+
+ 5.8958417177200317e-01 4.5504111051559448e-01
+ <_>
+
+ 0 -1 1145 -2.4286519736051559e-02
+
+ 2.6471349596977234e-01 5.1891797780990601e-01
+ <_>
+
+ 0 -1 1146 -2.9676330741494894e-03
+
+ 7.3476827144622803e-01 4.7497498989105225e-01
+ <_>
+
+ 0 -1 1147 -1.2528999708592892e-02
+
+ 2.7560499310493469e-01 5.1775997877120972e-01
+ <_>
+
+ 0 -1 1148 -1.0104000102728605e-03
+
+ 3.5105609893798828e-01 5.1447242498397827e-01
+ <_>
+
+ 0 -1 1149 -2.1348530426621437e-03
+
+ 5.6379258632659912e-01 4.6673199534416199e-01
+ <_>
+
+ 0 -1 1150 1.9564259797334671e-02
+
+ 4.6145731210708618e-01 6.1376398801803589e-01
+ <_>
+
+ 0 -1 1151 -9.7146347165107727e-02
+
+ 2.9983788728713989e-01 5.1935559511184692e-01
+ <_>
+
+ 0 -1 1152 4.5014568604528904e-03
+
+ 5.0778847932815552e-01 3.0457559227943420e-01
+ <_>
+
+ 0 -1 1153 6.3706971704959869e-03
+
+ 4.8610189557075500e-01 6.8875008821487427e-01
+ <_>
+
+ 0 -1 1154 -9.0721528977155685e-03
+
+ 1.6733959317207336e-01 5.0175631046295166e-01
+ <_>
+
+ 0 -1 1155 -5.3537208586931229e-03
+
+ 2.6927569508552551e-01 5.2426332235336304e-01
+ <_>
+
+ 0 -1 1156 -1.0932840406894684e-02
+
+ 7.1838641166687012e-01 4.7360289096832275e-01
+ <_>
+
+ 0 -1 1157 8.2356072962284088e-03
+
+ 5.2239668369293213e-01 2.3898629844188690e-01
+ <_>
+
+ 0 -1 1158 -1.0038160253316164e-03
+
+ 5.7193559408187866e-01 4.4339430332183838e-01
+ <_>
+
+ 0 -1 1159 4.0859128348529339e-03
+
+ 5.4728418588638306e-01 4.1488361358642578e-01
+ <_>
+
+ 0 -1 1160 1.5485419332981110e-01
+
+ 4.9738121032714844e-01 6.1061598360538483e-02
+ <_>
+
+ 0 -1 1161 2.0897459762636572e-04
+
+ 4.7091740369796753e-01 5.4238891601562500e-01
+ <_>
+
+ 0 -1 1162 3.3316991175524890e-04
+
+ 4.0896269679069519e-01 5.3009921312332153e-01
+ <_>
+
+ 0 -1 1163 -1.0813400149345398e-02
+
+ 6.1043697595596313e-01 4.9573341012001038e-01
+ <_>
+
+ 0 -1 1164 4.5656010508537292e-02
+
+ 5.0696891546249390e-01 2.8666600584983826e-01
+ <_>
+
+ 0 -1 1165 1.2569549726322293e-03
+
+ 4.8469170928001404e-01 6.3181710243225098e-01
+ <_>
+
+ 0 -1 1166 -1.2015070021152496e-01
+
+ 6.0526140034198761e-02 4.9809598922729492e-01
+ <_>
+
+ 0 -1 1167 -1.0533799650147557e-04
+
+ 5.3631097078323364e-01 4.7080421447753906e-01
+ <_>
+
+ 0 -1 1168 -2.0703190565109253e-01
+
+ 5.9660330414772034e-02 4.9790981411933899e-01
+ <_>
+
+ 0 -1 1169 1.2909180077258497e-04
+
+ 4.7129771113395691e-01 5.3779977560043335e-01
+ <_>
+
+ 0 -1 1170 3.8818528992123902e-04
+
+ 4.3635380268096924e-01 5.5341911315917969e-01
+ <_>
+
+ 0 -1 1171 -2.9243610333651304e-03
+
+ 5.8111858367919922e-01 4.8252159357070923e-01
+ <_>
+
+ 0 -1 1172 8.3882332546636462e-04
+
+ 5.3117001056671143e-01 4.0381389856338501e-01
+ <_>
+
+ 0 -1 1173 -1.9061550265178084e-03
+
+ 3.7707018852233887e-01 5.2600151300430298e-01
+ <_>
+
+ 0 -1 1174 8.9514348655939102e-03
+
+ 4.7661679983139038e-01 7.6821839809417725e-01
+ <_>
+
+ 0 -1 1175 1.3083459809422493e-02
+
+ 5.2644628286361694e-01 3.0622220039367676e-01
+ <_>
+
+ 0 -1 1176 -2.1159330010414124e-01
+
+ 6.7371982336044312e-01 4.6958100795745850e-01
+ <_>
+
+ 0 -1 1177 3.1493250280618668e-03
+
+ 5.6448352336883545e-01 4.3869531154632568e-01
+ <_>
+
+ 0 -1 1178 3.9754100725986063e-04
+
+ 4.5260611176490784e-01 5.8956301212310791e-01
+ <_>
+
+ 0 -1 1179 -1.3814480043947697e-03
+
+ 6.0705822706222534e-01 4.9424138665199280e-01
+ <_>
+
+ 0 -1 1180 -5.8122188784182072e-04
+
+ 5.9982132911682129e-01 4.5082521438598633e-01
+ <_>
+
+ 0 -1 1181 -2.3905329871922731e-03
+
+ 4.2055889964103699e-01 5.2238482236862183e-01
+ <_>
+
+ 0 -1 1182 2.7268929407000542e-02
+
+ 5.2064472436904907e-01 3.5633018612861633e-01
+ <_>
+
+ 0 -1 1183 -3.7658358924090862e-03
+
+ 3.1447041034698486e-01 5.2188140153884888e-01
+ <_>
+
+ 0 -1 1184 -1.4903489500284195e-03
+
+ 3.3801960945129395e-01 5.1244372129440308e-01
+ <_>
+
+ 0 -1 1185 -1.7428230494260788e-02
+
+ 5.8299607038497925e-01 4.9197259545326233e-01
+ <_>
+
+ 0 -1 1186 -1.5278030186891556e-02
+
+ 6.1631447076797485e-01 4.6178871393203735e-01
+ <_>
+
+ 0 -1 1187 3.1995609402656555e-02
+
+ 5.1663571596145630e-01 1.7127640545368195e-01
+ <_>
+
+ 0 -1 1188 -3.8256710395216942e-03
+
+ 3.4080120921134949e-01 5.1313877105712891e-01
+ <_>
+
+ 0 -1 1189 -8.5186436772346497e-03
+
+ 6.1055189371109009e-01 4.9979418516159058e-01
+ <_>
+
+ 0 -1 1190 9.0641621500253677e-04
+
+ 4.3272709846496582e-01 5.5823111534118652e-01
+ <_>
+
+ 0 -1 1191 1.0344849899411201e-02
+
+ 4.8556530475616455e-01 5.4524201154708862e-01
+ <_>
+ 160
+ 7.9249076843261719e+01
+
+ <_>
+
+ 0 -1 1192 7.8981826081871986e-03
+
+ 3.3325248956680298e-01 5.9464621543884277e-01
+ <_>
+
+ 0 -1 1193 1.6170160379260778e-03
+
+ 3.4906411170959473e-01 5.5778688192367554e-01
+ <_>
+
+ 0 -1 1194 -5.5449741194024682e-04
+
+ 5.5425661802291870e-01 3.2915300130844116e-01
+ <_>
+
+ 0 -1 1195 1.5428980113938451e-03
+
+ 3.6125791072845459e-01 5.5459791421890259e-01
+ <_>
+
+ 0 -1 1196 -1.0329450014978647e-03
+
+ 3.5301390290260315e-01 5.5761402845382690e-01
+ <_>
+
+ 0 -1 1197 7.7698158565908670e-04
+
+ 3.9167788624763489e-01 5.6453210115432739e-01
+ <_>
+
+ 0 -1 1198 1.4320300519466400e-01
+
+ 4.6674820780754089e-01 7.0236331224441528e-01
+ <_>
+
+ 0 -1 1199 -7.3866490274667740e-03
+
+ 3.0736848711967468e-01 5.2892577648162842e-01
+ <_>
+
+ 0 -1 1200 -6.2936742324382067e-04
+
+ 5.6221181154251099e-01 4.0370491147041321e-01
+ <_>
+
+ 0 -1 1201 7.8893528552725911e-04
+
+ 5.2676612138748169e-01 3.5578748583793640e-01
+ <_>
+
+ 0 -1 1202 -1.2228050269186497e-02
+
+ 6.6683208942413330e-01 4.6255499124526978e-01
+ <_>
+
+ 0 -1 1203 3.5420239437371492e-03
+
+ 5.5214381217956543e-01 3.8696730136871338e-01
+ <_>
+
+ 0 -1 1204 -1.0585320414975286e-03
+
+ 3.6286780238151550e-01 5.3209269046783447e-01
+ <_>
+
+ 0 -1 1205 1.4935660146875307e-05
+
+ 4.6324449777603149e-01 5.3633230924606323e-01
+ <_>
+
+ 0 -1 1206 5.2537708543241024e-03
+
+ 5.1322317123413086e-01 3.2657089829444885e-01
+ <_>
+
+ 0 -1 1207 -8.2338023930788040e-03
+
+ 6.6936898231506348e-01 4.7741401195526123e-01
+ <_>
+
+ 0 -1 1208 2.1866810129722580e-05
+
+ 4.0538620948791504e-01 5.4579311609268188e-01
+ <_>
+
+ 0 -1 1209 -3.8150229956954718e-03
+
+ 6.4549958705902100e-01 4.7931781411170959e-01
+ <_>
+
+ 0 -1 1210 1.1105879675596952e-03
+
+ 5.2704071998596191e-01 3.5296788811683655e-01
+ <_>
+
+ 0 -1 1211 -5.7707689702510834e-03
+
+ 3.8035470247268677e-01 5.3529578447341919e-01
+ <_>
+
+ 0 -1 1212 -3.0158339068293571e-03
+
+ 5.3394031524658203e-01 3.8871330022811890e-01
+ <_>
+
+ 0 -1 1213 -8.5453689098358154e-04
+
+ 3.5646161437034607e-01 5.2736037969589233e-01
+ <_>
+
+ 0 -1 1214 1.1050510220229626e-02
+
+ 4.6719071269035339e-01 6.8497377634048462e-01
+ <_>
+
+ 0 -1 1215 4.2605839669704437e-02
+
+ 5.1514732837677002e-01 7.0220090448856354e-02
+ <_>
+
+ 0 -1 1216 -3.0781750101596117e-03
+
+ 3.0416610836982727e-01 5.1526021957397461e-01
+ <_>
+
+ 0 -1 1217 -5.4815728217363358e-03
+
+ 6.4302957057952881e-01 4.8972299695014954e-01
+ <_>
+
+ 0 -1 1218 3.1881860923022032e-03
+
+ 5.3074932098388672e-01 3.8262099027633667e-01
+ <_>
+
+ 0 -1 1219 3.5947180003859103e-04
+
+ 4.6500471234321594e-01 5.4219049215316772e-01
+ <_>
+
+ 0 -1 1220 -4.0705031715333462e-03
+
+ 2.8496798872947693e-01 5.0791162252426147e-01
+ <_>
+
+ 0 -1 1221 -1.4594170264899731e-02
+
+ 2.9716458916664124e-01 5.1284617185592651e-01
+ <_>
+
+ 0 -1 1222 -1.1947689927183092e-04
+
+ 5.6310981512069702e-01 4.3430820107460022e-01
+ <_>
+
+ 0 -1 1223 -6.9344649091362953e-04
+
+ 4.4035780429840088e-01 5.3599590063095093e-01
+ <_>
+
+ 0 -1 1224 1.4834799912932795e-05
+
+ 3.4210088849067688e-01 5.1646977663040161e-01
+ <_>
+
+ 0 -1 1225 9.0296985581517220e-03
+
+ 4.6393430233001709e-01 6.1140751838684082e-01
+ <_>
+
+ 0 -1 1226 -8.0640818923711777e-03
+
+ 2.8201588988304138e-01 5.0754940509796143e-01
+ <_>
+
+ 0 -1 1227 2.6062119752168655e-02
+
+ 5.2089059352874756e-01 2.6887780427932739e-01
+ <_>
+
+ 0 -1 1228 1.7314659431576729e-02
+
+ 4.6637138724327087e-01 6.7385399341583252e-01
+ <_>
+
+ 0 -1 1229 2.2666640579700470e-02
+
+ 5.2093499898910522e-01 2.2127239406108856e-01
+ <_>
+
+ 0 -1 1230 -2.1965929772704840e-03
+
+ 6.0631012916564941e-01 4.5381900668144226e-01
+ <_>
+
+ 0 -1 1231 -9.5282476395368576e-03
+
+ 4.6352049708366394e-01 5.2474308013916016e-01
+ <_>
+
+ 0 -1 1232 8.0943619832396507e-03
+
+ 5.2894401550292969e-01 3.9138820767402649e-01
+ <_>
+
+ 0 -1 1233 -7.2877332568168640e-02
+
+ 7.7520018815994263e-01 4.9902349710464478e-01
+ <_>
+
+ 0 -1 1234 -6.9009521976113319e-03
+
+ 2.4280390143394470e-01 5.0480902194976807e-01
+ <_>
+
+ 0 -1 1235 -1.1308239772915840e-02
+
+ 5.7343649864196777e-01 4.8423761129379272e-01
+ <_>
+
+ 0 -1 1236 5.9613201767206192e-02
+
+ 5.0298362970352173e-01 2.5249770283699036e-01
+ <_>
+
+ 0 -1 1237 -2.8624620754271746e-03
+
+ 6.0730451345443726e-01 4.8984599113464355e-01
+ <_>
+
+ 0 -1 1238 4.4781449250876904e-03
+
+ 5.0152891874313354e-01 2.2203169763088226e-01
+ <_>
+
+ 0 -1 1239 -1.7513240454718471e-03
+
+ 6.6144287586212158e-01 4.9338689446449280e-01
+ <_>
+
+ 0 -1 1240 4.0163420140743256e-02
+
+ 5.1808780431747437e-01 3.7410449981689453e-01
+ <_>
+
+ 0 -1 1241 3.4768949262797832e-04
+
+ 4.7204169631004333e-01 5.8180320262908936e-01
+ <_>
+
+ 0 -1 1242 2.6551650371402502e-03
+
+ 3.8050109148025513e-01 5.2213358879089355e-01
+ <_>
+
+ 0 -1 1243 -8.7706279009580612e-03
+
+ 2.9441660642623901e-01 5.2312952280044556e-01
+ <_>
+
+ 0 -1 1244 -5.5122091434895992e-03
+
+ 7.3461771011352539e-01 4.7228169441223145e-01
+ <_>
+
+ 0 -1 1245 6.8672042107209563e-04
+
+ 5.4528760910034180e-01 4.2424130439758301e-01
+ <_>
+
+ 0 -1 1246 5.6019669864326715e-04
+
+ 4.3988621234893799e-01 5.6012850999832153e-01
+ <_>
+
+ 0 -1 1247 2.4143769405782223e-03
+
+ 4.7416868805885315e-01 6.1366218328475952e-01
+ <_>
+
+ 0 -1 1248 -1.5680900542065501e-03
+
+ 6.0445529222488403e-01 4.5164099335670471e-01
+ <_>
+
+ 0 -1 1249 -3.6827491130679846e-03
+
+ 2.4524590373039246e-01 5.2949821949005127e-01
+ <_>
+
+ 0 -1 1250 -2.9409190756268799e-04
+
+ 3.7328380346298218e-01 5.2514511346817017e-01
+ <_>
+
+ 0 -1 1251 4.2847759323194623e-04
+
+ 5.4988098144531250e-01 4.0655350685119629e-01
+ <_>
+
+ 0 -1 1252 -4.8817070201039314e-03
+
+ 2.1399089694023132e-01 4.9999570846557617e-01
+ <_>
+
+ 0 -1 1253 2.7272020815871656e-04
+
+ 4.6502870321273804e-01 5.8134287595748901e-01
+ <_>
+
+ 0 -1 1254 2.0947199664078653e-04
+
+ 4.3874868750572205e-01 5.5727928876876831e-01
+ <_>
+
+ 0 -1 1255 4.8501189798116684e-02
+
+ 5.2449727058410645e-01 3.2128891348838806e-01
+ <_>
+
+ 0 -1 1256 -4.5166411437094212e-03
+
+ 6.0568130016326904e-01 4.5458820462226868e-01
+ <_>
+
+ 0 -1 1257 -1.2291680090129375e-02
+
+ 2.0409290492534637e-01 5.1522141695022583e-01
+ <_>
+
+ 0 -1 1258 4.8549679922871292e-04
+
+ 5.2376049757003784e-01 3.7395030260086060e-01
+ <_>
+
+ 0 -1 1259 3.0556049197912216e-02
+
+ 4.9605339765548706e-01 5.9382462501525879e-01
+ <_>
+
+ 0 -1 1260 -1.5105320198927075e-04
+
+ 5.3513038158416748e-01 4.1452041268348694e-01
+ <_>
+
+ 0 -1 1261 2.4937440175563097e-03
+
+ 4.6933668851852417e-01 5.5149412155151367e-01
+ <_>
+
+ 0 -1 1262 -1.2382130138576031e-02
+
+ 6.7913967370986938e-01 4.6816679835319519e-01
+ <_>
+
+ 0 -1 1263 -5.1333461888134480e-03
+
+ 3.6087390780448914e-01 5.2291601896286011e-01
+ <_>
+
+ 0 -1 1264 5.1919277757406235e-04
+
+ 5.3000730276107788e-01 3.6336138844490051e-01
+ <_>
+
+ 0 -1 1265 1.5060420334339142e-01
+
+ 5.1573169231414795e-01 2.2117820382118225e-01
+ <_>
+
+ 0 -1 1266 7.7144149690866470e-03
+
+ 4.4104969501495361e-01 5.7766091823577881e-01
+ <_>
+
+ 0 -1 1267 9.4443522393703461e-03
+
+ 5.4018551111221313e-01 3.7566500902175903e-01
+ <_>
+
+ 0 -1 1268 2.5006249779835343e-04
+
+ 4.3682709336280823e-01 5.6073749065399170e-01
+ <_>
+
+ 0 -1 1269 -3.3077150583267212e-03
+
+ 4.2447990179061890e-01 5.5182307958602905e-01
+ <_>
+
+ 0 -1 1270 7.4048910755664110e-04
+
+ 4.4969621300697327e-01 5.9005767107009888e-01
+ <_>
+
+ 0 -1 1271 4.4092051684856415e-02
+
+ 5.2934932708740234e-01 3.1563550233840942e-01
+ <_>
+
+ 0 -1 1272 3.3639909233897924e-03
+
+ 4.4832968711853027e-01 5.8486622571945190e-01
+ <_>
+
+ 0 -1 1273 -3.9760079234838486e-03
+
+ 4.5595070719718933e-01 5.4836392402648926e-01
+ <_>
+
+ 0 -1 1274 2.7716930489987135e-03
+
+ 5.3417861461639404e-01 3.7924841046333313e-01
+ <_>
+
+ 0 -1 1275 -2.4123019829858094e-04
+
+ 5.6671887636184692e-01 4.5769730210304260e-01
+ <_>
+
+ 0 -1 1276 4.9425667384639382e-04
+
+ 4.4212448596954346e-01 5.6287872791290283e-01
+ <_>
+
+ 0 -1 1277 -3.8876468897797167e-04
+
+ 4.2883709073066711e-01 5.3910630941390991e-01
+ <_>
+
+ 0 -1 1278 -5.0048898905515671e-02
+
+ 6.8995130062103271e-01 4.7037428617477417e-01
+ <_>
+
+ 0 -1 1279 -3.6635480821132660e-02
+
+ 2.2177790105342865e-01 5.1918262243270874e-01
+ <_>
+
+ 0 -1 1280 2.4273579474538565e-03
+
+ 5.1362240314483643e-01 3.4973978996276855e-01
+ <_>
+
+ 0 -1 1281 1.9558030180633068e-03
+
+ 4.8261928558349609e-01 6.4083808660507202e-01
+ <_>
+
+ 0 -1 1282 -1.7494610510766506e-03
+
+ 3.9228358864784241e-01 5.2726852893829346e-01
+ <_>
+
+ 0 -1 1283 1.3955079950392246e-02
+
+ 5.0782018899917603e-01 8.4165048599243164e-01
+ <_>
+
+ 0 -1 1284 -2.1896739781368524e-04
+
+ 5.5204898118972778e-01 4.3142348527908325e-01
+ <_>
+
+ 0 -1 1285 -1.5131309628486633e-03
+
+ 3.9346051216125488e-01 5.3825712203979492e-01
+ <_>
+
+ 0 -1 1286 -4.3622800149023533e-03
+
+ 7.3706287145614624e-01 4.7364759445190430e-01
+ <_>
+
+ 0 -1 1287 6.5160587430000305e-02
+
+ 5.1592797040939331e-01 3.2815951108932495e-01
+ <_>
+
+ 0 -1 1288 -2.3567399475723505e-03
+
+ 3.6728268861770630e-01 5.1728862524032593e-01
+ <_>
+
+ 0 -1 1289 1.5146659687161446e-02
+
+ 5.0314939022064209e-01 6.6876041889190674e-01
+ <_>
+
+ 0 -1 1290 -2.2850960493087769e-02
+
+ 6.7675197124481201e-01 4.7095969319343567e-01
+ <_>
+
+ 0 -1 1291 4.8867650330066681e-03
+
+ 5.2579981088638306e-01 4.0598788857460022e-01
+ <_>
+
+ 0 -1 1292 1.7619599821045995e-03
+
+ 4.6962729096412659e-01 6.6882789134979248e-01
+ <_>
+
+ 0 -1 1293 -1.2942519970238209e-03
+
+ 4.3207129836082458e-01 5.3442817926406860e-01
+ <_>
+
+ 0 -1 1294 1.0929949581623077e-02
+
+ 4.9977061152458191e-01 1.6374860703945160e-01
+ <_>
+
+ 0 -1 1295 2.9958489903947338e-05
+
+ 4.2824178934097290e-01 5.6332242488861084e-01
+ <_>
+
+ 0 -1 1296 -6.5884361974895000e-03
+
+ 6.7721211910247803e-01 4.7005268931388855e-01
+ <_>
+
+ 0 -1 1297 3.2527779694646597e-03
+
+ 5.3133970499038696e-01 4.5361489057540894e-01
+ <_>
+
+ 0 -1 1298 -4.0435739792883396e-03
+
+ 5.6600618362426758e-01 4.4133889675140381e-01
+ <_>
+
+ 0 -1 1299 -1.2523540062829852e-03
+
+ 3.7319138646125793e-01 5.3564518690109253e-01
+ <_>
+
+ 0 -1 1300 1.9246719602961093e-04
+
+ 5.1899862289428711e-01 3.7388110160827637e-01
+ <_>
+
+ 0 -1 1301 -3.8589671254158020e-02
+
+ 2.9563739895820618e-01 5.1888108253479004e-01
+ <_>
+
+ 0 -1 1302 1.5489870565943420e-04
+
+ 4.3471351265907288e-01 5.5095332860946655e-01
+ <_>
+
+ 0 -1 1303 -3.3763848245143890e-02
+
+ 3.2303300499916077e-01 5.1954758167266846e-01
+ <_>
+
+ 0 -1 1304 -8.2657067105174065e-03
+
+ 5.9754890203475952e-01 4.5521140098571777e-01
+ <_>
+
+ 0 -1 1305 1.4481440302915871e-05
+
+ 4.7456780076026917e-01 5.4974269866943359e-01
+ <_>
+
+ 0 -1 1306 1.4951299817766994e-05
+
+ 4.3244731426239014e-01 5.4806441068649292e-01
+ <_>
+
+ 0 -1 1307 -1.8741799518465996e-02
+
+ 1.5800529718399048e-01 5.1785331964492798e-01
+ <_>
+
+ 0 -1 1308 1.7572239739820361e-03
+
+ 4.5176368951797485e-01 5.7737642526626587e-01
+ <_>
+
+ 0 -1 1309 -3.1391119118779898e-03
+
+ 4.1496479511260986e-01 5.4608422517776489e-01
+ <_>
+
+ 0 -1 1310 6.6656779381446540e-05
+
+ 4.0390908718109131e-01 5.2930849790573120e-01
+ <_>
+
+ 0 -1 1311 6.7743421532213688e-03
+
+ 4.7676518559455872e-01 6.1219561100006104e-01
+ <_>
+
+ 0 -1 1312 -7.3868161998689175e-03
+
+ 3.5862588882446289e-01 5.1872807741165161e-01
+ <_>
+
+ 0 -1 1313 1.4040930196642876e-02
+
+ 4.7121399641036987e-01 5.5761557817459106e-01
+ <_>
+
+ 0 -1 1314 -5.5258329957723618e-03
+
+ 2.6610270142555237e-01 5.0392812490463257e-01
+ <_>
+
+ 0 -1 1315 3.8684239983558655e-01
+
+ 5.1443397998809814e-01 2.5258991122245789e-01
+ <_>
+
+ 0 -1 1316 1.1459240340627730e-04
+
+ 4.2849949002265930e-01 5.4233711957931519e-01
+ <_>
+
+ 0 -1 1317 -1.8467569723725319e-02
+
+ 3.8858351111412048e-01 5.2130621671676636e-01
+ <_>
+
+ 0 -1 1318 -4.5907011372037232e-04
+
+ 5.4125630855560303e-01 4.2359098792076111e-01
+ <_>
+
+ 0 -1 1319 1.2527540093287826e-03
+
+ 4.8993051052093506e-01 6.6240912675857544e-01
+ <_>
+
+ 0 -1 1320 1.4910609461367130e-03
+
+ 5.2867782115936279e-01 4.0400519967079163e-01
+ <_>
+
+ 0 -1 1321 -7.5435562757775187e-04
+
+ 6.0329902172088623e-01 4.7951200604438782e-01
+ <_>
+
+ 0 -1 1322 -6.9478838704526424e-03
+
+ 4.0844011306762695e-01 5.3735041618347168e-01
+ <_>
+
+ 0 -1 1323 2.8092920547351241e-04
+
+ 4.8460629582405090e-01 5.7593822479248047e-01
+ <_>
+
+ 0 -1 1324 9.6073717577382922e-04
+
+ 5.1647412776947021e-01 3.5549798607826233e-01
+ <_>
+
+ 0 -1 1325 -2.6883929967880249e-04
+
+ 5.6775820255279541e-01 4.7317659854888916e-01
+ <_>
+
+ 0 -1 1326 2.1599370520561934e-03
+
+ 4.7314870357513428e-01 7.0705670118331909e-01
+ <_>
+
+ 0 -1 1327 5.6235301308333874e-03
+
+ 5.2402430772781372e-01 2.7817919850349426e-01
+ <_>
+
+ 0 -1 1328 -5.0243991427123547e-03
+
+ 2.8370139002799988e-01 5.0623041391372681e-01
+ <_>
+
+ 0 -1 1329 -9.7611639648675919e-03
+
+ 7.4007177352905273e-01 4.9345690011978149e-01
+ <_>
+
+ 0 -1 1330 4.1515100747346878e-03
+
+ 5.1191312074661255e-01 3.4070080518722534e-01
+ <_>
+
+ 0 -1 1331 6.2465080991387367e-03
+
+ 4.9237880110740662e-01 6.5790587663650513e-01
+ <_>
+
+ 0 -1 1332 -7.0597478188574314e-03
+
+ 2.4347110092639923e-01 5.0328421592712402e-01
+ <_>
+
+ 0 -1 1333 -2.0587709732353687e-03
+
+ 5.9003108739852905e-01 4.6950870752334595e-01
+ <_>
+
+ 0 -1 1334 -2.4146060459315777e-03
+
+ 3.6473178863525391e-01 5.1892018318176270e-01
+ <_>
+
+ 0 -1 1335 -1.4817609917372465e-03
+
+ 6.0349482297897339e-01 4.9401280283927917e-01
+ <_>
+
+ 0 -1 1336 -6.3016400672495365e-03
+
+ 5.8189898729324341e-01 4.5604279637336731e-01
+ <_>
+
+ 0 -1 1337 3.4763428848236799e-03
+
+ 5.2174758911132812e-01 3.4839931130409241e-01
+ <_>
+
+ 0 -1 1338 -2.2250870242714882e-02
+
+ 2.3607000708580017e-01 5.0320827960968018e-01
+ <_>
+
+ 0 -1 1339 -3.0612550675868988e-02
+
+ 6.4991867542266846e-01 4.9149191379547119e-01
+ <_>
+
+ 0 -1 1340 1.3057479634881020e-02
+
+ 4.4133231043815613e-01 5.6837642192840576e-01
+ <_>
+
+ 0 -1 1341 -6.0095742810517550e-04
+
+ 4.3597310781478882e-01 5.3334832191467285e-01
+ <_>
+
+ 0 -1 1342 -4.1514250915497541e-04
+
+ 5.5040627717971802e-01 4.3260601162910461e-01
+ <_>
+
+ 0 -1 1343 -1.3776290230453014e-02
+
+ 4.0641129016876221e-01 5.2015489339828491e-01
+ <_>
+
+ 0 -1 1344 -3.2296508550643921e-02
+
+ 4.7351971268653870e-02 4.9771949648857117e-01
+ <_>
+
+ 0 -1 1345 5.3556978702545166e-02
+
+ 4.8817330598831177e-01 6.6669392585754395e-01
+ <_>
+
+ 0 -1 1346 8.1889545544981956e-03
+
+ 5.4000371694564819e-01 4.2408201098442078e-01
+ <_>
+
+ 0 -1 1347 2.1055320394225419e-04
+
+ 4.8020479083061218e-01 5.5638527870178223e-01
+ <_>
+
+ 0 -1 1348 -2.4382730480283499e-03
+
+ 7.3877930641174316e-01 4.7736850380897522e-01
+ <_>
+
+ 0 -1 1349 3.2835570164024830e-03
+
+ 5.2885460853576660e-01 3.1712919473648071e-01
+ <_>
+
+ 0 -1 1350 2.3729570675641298e-03
+
+ 4.7508129477500916e-01 7.0601707696914673e-01
+ <_>
+
+ 0 -1 1351 -1.4541699783876538e-03
+
+ 3.8117301464080811e-01 5.3307390213012695e-01
+ <_>
+ 177
+ 8.7696029663085938e+01
+
+ <_>
+
+ 0 -1 1352 5.5755238980054855e-02
+
+ 4.0191569924354553e-01 6.8060368299484253e-01
+ <_>
+
+ 0 -1 1353 2.4730248842388391e-03
+
+ 3.3511489629745483e-01 5.9657198190689087e-01
+ <_>
+
+ 0 -1 1354 -3.5031698644161224e-04
+
+ 5.5577081441879272e-01 3.4822869300842285e-01
+ <_>
+
+ 0 -1 1355 5.4167630150914192e-04
+
+ 4.2608588933944702e-01 5.6933808326721191e-01
+ <_>
+
+ 0 -1 1356 7.7193678589537740e-04
+
+ 3.4942400455474854e-01 5.4336887598037720e-01
+ <_>
+
+ 0 -1 1357 -1.5999219613149762e-03
+
+ 4.0284991264343262e-01 5.4843592643737793e-01
+ <_>
+
+ 0 -1 1358 -1.1832080053864047e-04
+
+ 3.8069018721580505e-01 5.4254651069641113e-01
+ <_>
+
+ 0 -1 1359 3.2909031142480671e-04
+
+ 2.6201000809669495e-01 5.4295217990875244e-01
+ <_>
+
+ 0 -1 1360 2.9518108931370080e-04
+
+ 3.7997689843177795e-01 5.3992640972137451e-01
+ <_>
+
+ 0 -1 1361 9.0466710389591753e-05
+
+ 4.4336450099945068e-01 5.4402261972427368e-01
+ <_>
+
+ 0 -1 1362 1.5007190086180344e-05
+
+ 3.7196549773216248e-01 5.4091197252273560e-01
+ <_>
+
+ 0 -1 1363 1.3935610651969910e-01
+
+ 5.5253958702087402e-01 4.4790428876876831e-01
+ <_>
+
+ 0 -1 1364 1.6461990308016539e-03
+
+ 4.2645010352134705e-01 5.7721698284149170e-01
+ <_>
+
+ 0 -1 1365 4.9984431825578213e-04
+
+ 4.3595260381698608e-01 5.6858712434768677e-01
+ <_>
+
+ 0 -1 1366 -1.0971280280500650e-03
+
+ 3.3901369571685791e-01 5.2054089307785034e-01
+ <_>
+
+ 0 -1 1367 6.6919892560690641e-04
+
+ 4.5574560761451721e-01 5.9806597232818604e-01
+ <_>
+
+ 0 -1 1368 8.6471042595803738e-04
+
+ 5.1348412036895752e-01 2.9440331459045410e-01
+ <_>
+
+ 0 -1 1369 -2.7182599296793342e-04
+
+ 3.9065781235694885e-01 5.3771811723709106e-01
+ <_>
+
+ 0 -1 1370 3.0249499104684219e-05
+
+ 3.6796098947525024e-01 5.2256888151168823e-01
+ <_>
+
+ 0 -1 1371 -8.5225896909832954e-03
+
+ 7.2931021451950073e-01 4.8923650383949280e-01
+ <_>
+
+ 0 -1 1372 1.6705560265108943e-03
+
+ 4.3453249335289001e-01 5.6961381435394287e-01
+ <_>
+
+ 0 -1 1373 -7.1433838456869125e-03
+
+ 2.5912800431251526e-01 5.2256238460540771e-01
+ <_>
+
+ 0 -1 1374 -1.6319369897246361e-02
+
+ 6.9222790002822876e-01 4.6515759825706482e-01
+ <_>
+
+ 0 -1 1375 4.8034260980784893e-03
+
+ 5.3522628545761108e-01 3.2863029837608337e-01
+ <_>
+
+ 0 -1 1376 -7.5421929359436035e-03
+
+ 2.0405440032482147e-01 5.0345462560653687e-01
+ <_>
+
+ 0 -1 1377 -1.4363110065460205e-02
+
+ 6.8048888444900513e-01 4.8890590667724609e-01
+ <_>
+
+ 0 -1 1378 8.9063588529825211e-04
+
+ 5.3106957674026489e-01 3.8954809308052063e-01
+ <_>
+
+ 0 -1 1379 -4.4060191139578819e-03
+
+ 5.7415628433227539e-01 4.3724268674850464e-01
+ <_>
+
+ 0 -1 1380 -1.8862540309783071e-04
+
+ 2.8317859768867493e-01 5.0982052087783813e-01
+ <_>
+
+ 0 -1 1381 -3.7979281041771173e-03
+
+ 3.3725079894065857e-01 5.2465802431106567e-01
+ <_>
+
+ 0 -1 1382 1.4627049677073956e-04
+
+ 5.3066742420196533e-01 3.9117100834846497e-01
+ <_>
+
+ 0 -1 1383 -4.9164638767251745e-05
+
+ 5.4624962806701660e-01 3.9427208900451660e-01
+ <_>
+
+ 0 -1 1384 -3.3582501113414764e-02
+
+ 2.1578240394592285e-01 5.0482118129730225e-01
+ <_>
+
+ 0 -1 1385 -3.5339309833943844e-03
+
+ 6.4653122425079346e-01 4.8726969957351685e-01
+ <_>
+
+ 0 -1 1386 5.0144111737608910e-03
+
+ 4.6176680922508240e-01 6.2480747699737549e-01
+ <_>
+
+ 0 -1 1387 1.8817370757460594e-02
+
+ 5.2206891775131226e-01 2.0000520348548889e-01
+ <_>
+
+ 0 -1 1388 -1.3434339780360460e-03
+
+ 4.0145379304885864e-01 5.3016197681427002e-01
+ <_>
+
+ 0 -1 1389 1.7557960236445069e-03
+
+ 4.7940391302108765e-01 5.6531697511672974e-01
+ <_>
+
+ 0 -1 1390 -9.5637463033199310e-02
+
+ 2.0341950654983521e-01 5.0067067146301270e-01
+ <_>
+
+ 0 -1 1391 -2.2241229191422462e-02
+
+ 7.6724731922149658e-01 5.0463402271270752e-01
+ <_>
+
+ 0 -1 1392 -1.5575819648802280e-02
+
+ 7.4903422594070435e-01 4.7558510303497314e-01
+ <_>
+
+ 0 -1 1393 5.3599118255078793e-03
+
+ 5.3653037548065186e-01 4.0046709775924683e-01
+ <_>
+
+ 0 -1 1394 -2.1763499826192856e-02
+
+ 7.4015498161315918e-02 4.9641749262809753e-01
+ <_>
+
+ 0 -1 1395 -1.6561590135097504e-01
+
+ 2.8591030836105347e-01 5.2180862426757812e-01
+ <_>
+
+ 0 -1 1396 1.6461320046801120e-04
+
+ 4.1916158795356750e-01 5.3807932138442993e-01
+ <_>
+
+ 0 -1 1397 -8.9077502489089966e-03
+
+ 6.2731927633285522e-01 4.8774048686027527e-01
+ <_>
+
+ 0 -1 1398 8.6346449097618461e-04
+
+ 5.1599407196044922e-01 3.6710259318351746e-01
+ <_>
+
+ 0 -1 1399 -1.3751760125160217e-03
+
+ 5.8843767642974854e-01 4.5790839195251465e-01
+ <_>
+
+ 0 -1 1400 -1.4081239933148026e-03
+
+ 3.5605099797248840e-01 5.1399451494216919e-01
+ <_>
+
+ 0 -1 1401 -3.9342888630926609e-03
+
+ 5.9942889213562012e-01 4.6642720699310303e-01
+ <_>
+
+ 0 -1 1402 -3.1966928392648697e-02
+
+ 3.3454620838165283e-01 5.1441830396652222e-01
+ <_>
+
+ 0 -1 1403 -1.5089280168467667e-05
+
+ 5.5826562643051147e-01 4.4140571355819702e-01
+ <_>
+
+ 0 -1 1404 5.1994470413774252e-04
+
+ 4.6236801147460938e-01 6.1689937114715576e-01
+ <_>
+
+ 0 -1 1405 -3.4220460802316666e-03
+
+ 6.5570747852325439e-01 4.9748051166534424e-01
+ <_>
+
+ 0 -1 1406 1.7723299970384687e-04
+
+ 5.2695018053054810e-01 3.9019080996513367e-01
+ <_>
+
+ 0 -1 1407 1.5716759953647852e-03
+
+ 4.6333730220794678e-01 5.7904577255249023e-01
+ <_>
+
+ 0 -1 1408 -8.9041329920291901e-03
+
+ 2.6896080374717712e-01 5.0535911321640015e-01
+ <_>
+
+ 0 -1 1409 4.0677518700249493e-04
+
+ 5.4566031694412231e-01 4.3298989534378052e-01
+ <_>
+
+ 0 -1 1410 6.7604780197143555e-03
+
+ 4.6489939093589783e-01 6.6897618770599365e-01
+ <_>
+
+ 0 -1 1411 2.9100088868290186e-03
+
+ 5.3097039461135864e-01 3.3778399229049683e-01
+ <_>
+
+ 0 -1 1412 1.3885459629818797e-03
+
+ 4.0747389197349548e-01 5.3491330146789551e-01
+ <_>
+
+ 0 -1 1413 -7.6764263212680817e-02
+
+ 1.9921760261058807e-01 5.2282422780990601e-01
+ <_>
+
+ 0 -1 1414 -2.2688310127705336e-04
+
+ 5.4385018348693848e-01 4.2530721426010132e-01
+ <_>
+
+ 0 -1 1415 -6.3094152137637138e-03
+
+ 4.2591789364814758e-01 5.3789097070693970e-01
+ <_>
+
+ 0 -1 1416 -1.1007279902696609e-01
+
+ 6.9041568040847778e-01 4.7217491269111633e-01
+ <_>
+
+ 0 -1 1417 2.8619659133255482e-04
+
+ 4.5249149203300476e-01 5.5483061075210571e-01
+ <_>
+
+ 0 -1 1418 2.9425329557852820e-05
+
+ 5.3703737258911133e-01 4.2364639043807983e-01
+ <_>
+
+ 0 -1 1419 -2.4886570870876312e-02
+
+ 6.4235579967498779e-01 4.9693039059638977e-01
+ <_>
+
+ 0 -1 1420 3.3148851245641708e-02
+
+ 4.9884751439094543e-01 1.6138119995594025e-01
+ <_>
+
+ 0 -1 1421 7.8491691965609789e-04
+
+ 5.4160261154174805e-01 4.2230090498924255e-01
+ <_>
+
+ 0 -1 1422 4.7087189741432667e-03
+
+ 4.5763289928436279e-01 6.0275578498840332e-01
+ <_>
+
+ 0 -1 1423 2.4144479539245367e-03
+
+ 5.3089731931686401e-01 4.4224989414215088e-01
+ <_>
+
+ 0 -1 1424 1.9523180089890957e-03
+
+ 4.7056341171264648e-01 6.6633248329162598e-01
+ <_>
+
+ 0 -1 1425 1.3031980488449335e-03
+
+ 4.4061261415481567e-01 5.5269622802734375e-01
+ <_>
+
+ 0 -1 1426 4.4735497795045376e-03
+
+ 5.1290237903594971e-01 3.3014988899230957e-01
+ <_>
+
+ 0 -1 1427 -2.6652868837118149e-03
+
+ 3.1354710459709167e-01 5.1750361919403076e-01
+ <_>
+
+ 0 -1 1428 1.3666770246345550e-04
+
+ 4.1193708777427673e-01 5.3068768978118896e-01
+ <_>
+
+ 0 -1 1429 -1.7126450315117836e-02
+
+ 6.1778062582015991e-01 4.8365789651870728e-01
+ <_>
+
+ 0 -1 1430 -2.6601430727168918e-04
+
+ 3.6543309688568115e-01 5.1697367429733276e-01
+ <_>
+
+ 0 -1 1431 -2.2932380437850952e-02
+
+ 3.4909150004386902e-01 5.1639920473098755e-01
+ <_>
+
+ 0 -1 1432 2.3316550068557262e-03
+
+ 5.1662999391555786e-01 3.7093898653984070e-01
+ <_>
+
+ 0 -1 1433 1.6925660893321037e-02
+
+ 5.0147360563278198e-01 8.0539882183074951e-01
+ <_>
+
+ 0 -1 1434 -8.9858826249837875e-03
+
+ 6.4707887172698975e-01 4.6570208668708801e-01
+ <_>
+
+ 0 -1 1435 -1.1874699965119362e-02
+
+ 3.2463788986206055e-01 5.2587550878524780e-01
+ <_>
+
+ 0 -1 1436 1.9350569345988333e-04
+
+ 5.1919418573379517e-01 3.8396438956260681e-01
+ <_>
+
+ 0 -1 1437 5.8713490143418312e-03
+
+ 4.9181339144706726e-01 6.1870431900024414e-01
+ <_>
+
+ 0 -1 1438 -2.4838790297508240e-01
+
+ 1.8368029594421387e-01 4.9881500005722046e-01
+ <_>
+
+ 0 -1 1439 1.2256000190973282e-02
+
+ 5.2270537614822388e-01 3.6320298910140991e-01
+ <_>
+
+ 0 -1 1440 8.3990179700776935e-04
+
+ 4.4902500510215759e-01 5.7741481065750122e-01
+ <_>
+
+ 0 -1 1441 2.5407369248569012e-03
+
+ 4.8047870397567749e-01 5.8582991361618042e-01
+ <_>
+
+ 0 -1 1442 -1.4822429977357388e-02
+
+ 2.5210499763488770e-01 5.0235372781753540e-01
+ <_>
+
+ 0 -1 1443 -5.7973959483206272e-03
+
+ 5.9966957569122314e-01 4.8537150025367737e-01
+ <_>
+
+ 0 -1 1444 7.2662148158997297e-04
+
+ 5.1537168025970459e-01 3.6717799305915833e-01
+ <_>
+
+ 0 -1 1445 -1.7232580110430717e-02
+
+ 6.6217190027236938e-01 4.9946561455726624e-01
+ <_>
+
+ 0 -1 1446 7.8624086454510689e-03
+
+ 4.6333950757980347e-01 6.2561017274856567e-01
+ <_>
+
+ 0 -1 1447 -4.7343620099127293e-03
+
+ 3.6155730485916138e-01 5.2818852663040161e-01
+ <_>
+
+ 0 -1 1448 8.3048478700220585e-04
+
+ 4.4428890943527222e-01 5.5509579181671143e-01
+ <_>
+
+ 0 -1 1449 7.6602199114859104e-03
+
+ 5.1629352569580078e-01 2.6133549213409424e-01
+ <_>
+
+ 0 -1 1450 -4.1048377752304077e-03
+
+ 2.7896320819854736e-01 5.0190317630767822e-01
+ <_>
+
+ 0 -1 1451 4.8512578941881657e-03
+
+ 4.9689841270446777e-01 5.6616681814193726e-01
+ <_>
+
+ 0 -1 1452 9.9896453320980072e-04
+
+ 4.4456079602241516e-01 5.5518132448196411e-01
+ <_>
+
+ 0 -1 1453 -2.7023631334304810e-01
+
+ 2.9388209804892540e-02 5.1513141393661499e-01
+ <_>
+
+ 0 -1 1454 -1.3090680353343487e-02
+
+ 5.6993997097015381e-01 4.4474598765373230e-01
+ <_>
+
+ 0 -1 1455 -9.4342790544033051e-03
+
+ 4.3054661154747009e-01 5.4878950119018555e-01
+ <_>
+
+ 0 -1 1456 -1.5482039889320731e-03
+
+ 3.6803171038627625e-01 5.1280808448791504e-01
+ <_>
+
+ 0 -1 1457 5.3746132180094719e-03
+
+ 4.8389169573783875e-01 6.1015558242797852e-01
+ <_>
+
+ 0 -1 1458 1.5786769799888134e-03
+
+ 5.3252232074737549e-01 4.1185480356216431e-01
+ <_>
+
+ 0 -1 1459 3.6856050137430429e-03
+
+ 4.8109480738639832e-01 6.2523031234741211e-01
+ <_>
+
+ 0 -1 1460 9.3887019902467728e-03
+
+ 5.2002298831939697e-01 3.6294108629226685e-01
+ <_>
+
+ 0 -1 1461 1.2792630121111870e-02
+
+ 4.9617099761962891e-01 6.7380160093307495e-01
+ <_>
+
+ 0 -1 1462 -3.3661040943115950e-03
+
+ 4.0602791309356689e-01 5.2835988998413086e-01
+ <_>
+
+ 0 -1 1463 3.9771420415490866e-04
+
+ 4.6741139888763428e-01 5.9007751941680908e-01
+ <_>
+
+ 0 -1 1464 1.4868030557408929e-03
+
+ 4.5191168785095215e-01 6.0820537805557251e-01
+ <_>
+
+ 0 -1 1465 -8.8686749339103699e-02
+
+ 2.8078991174697876e-01 5.1809918880462646e-01
+ <_>
+
+ 0 -1 1466 -7.4296112870797515e-05
+
+ 5.2955842018127441e-01 4.0876251459121704e-01
+ <_>
+
+ 0 -1 1467 -1.4932939848222304e-05
+
+ 5.4614001512527466e-01 4.5385429263114929e-01
+ <_>
+
+ 0 -1 1468 5.9162238612771034e-03
+
+ 5.3291612863540649e-01 4.1921341419219971e-01
+ <_>
+
+ 0 -1 1469 1.1141640134155750e-03
+
+ 4.5120179653167725e-01 5.7062172889709473e-01
+ <_>
+
+ 0 -1 1470 8.9249362645205110e-05
+
+ 4.5778059959411621e-01 5.8976382017135620e-01
+ <_>
+
+ 0 -1 1471 2.5319510605186224e-03
+
+ 5.2996039390563965e-01 3.3576390147209167e-01
+ <_>
+
+ 0 -1 1472 1.2426200322806835e-02
+
+ 4.9590590596199036e-01 1.3466019928455353e-01
+ <_>
+
+ 0 -1 1473 2.8335750102996826e-02
+
+ 5.1170790195465088e-01 6.1043637106195092e-04
+ <_>
+
+ 0 -1 1474 6.6165882162749767e-03
+
+ 4.7363498806953430e-01 7.0116281509399414e-01
+ <_>
+
+ 0 -1 1475 8.0468766391277313e-03
+
+ 5.2164179086685181e-01 3.2828199863433838e-01
+ <_>
+
+ 0 -1 1476 -1.1193980462849140e-03
+
+ 5.8098608255386353e-01 4.5637390017509460e-01
+ <_>
+
+ 0 -1 1477 1.3277590274810791e-02
+
+ 5.3983622789382935e-01 4.1039010882377625e-01
+ <_>
+
+ 0 -1 1478 4.8794739996083081e-04
+
+ 4.2492860555648804e-01 5.4105907678604126e-01
+ <_>
+
+ 0 -1 1479 1.1243170127272606e-02
+
+ 5.2699637413024902e-01 3.4382158517837524e-01
+ <_>
+
+ 0 -1 1480 -8.9896668214350939e-04
+
+ 5.6330758333206177e-01 4.4566130638122559e-01
+ <_>
+
+ 0 -1 1481 6.6677159629762173e-03
+
+ 5.3128892183303833e-01 4.3626791238784790e-01
+ <_>
+
+ 0 -1 1482 2.8947299346327782e-02
+
+ 4.7017949819564819e-01 6.5757977962493896e-01
+ <_>
+
+ 0 -1 1483 -2.3400049656629562e-02
+
+ 0. 5.1373988389968872e-01
+ <_>
+
+ 0 -1 1484 -8.9117050170898438e-02
+
+ 2.3745279759168625e-02 4.9424308538436890e-01
+ <_>
+
+ 0 -1 1485 -1.4054600149393082e-02
+
+ 3.1273230910301208e-01 5.1175111532211304e-01
+ <_>
+
+ 0 -1 1486 8.1239398568868637e-03
+
+ 5.0090491771697998e-01 2.5200259685516357e-01
+ <_>
+
+ 0 -1 1487 -4.9964650534093380e-03
+
+ 6.3871437311172485e-01 4.9278119206428528e-01
+ <_>
+
+ 0 -1 1488 3.1253970228135586e-03
+
+ 5.1368498802185059e-01 3.6804521083831787e-01
+ <_>
+
+ 0 -1 1489 6.7669642157852650e-03
+
+ 5.5098438262939453e-01 4.3636319041252136e-01
+ <_>
+
+ 0 -1 1490 -2.3711440153419971e-03
+
+ 6.1623352766036987e-01 4.5869469642639160e-01
+ <_>
+
+ 0 -1 1491 -5.3522791713476181e-03
+
+ 6.1854577064514160e-01 4.9204909801483154e-01
+ <_>
+
+ 0 -1 1492 -1.5968859195709229e-02
+
+ 1.3826179504394531e-01 4.9832528829574585e-01
+ <_>
+
+ 0 -1 1493 4.7676060348749161e-03
+
+ 4.6880578994750977e-01 5.4900461435317993e-01
+ <_>
+
+ 0 -1 1494 -2.4714691098779440e-03
+
+ 2.3685149848461151e-01 5.0039529800415039e-01
+ <_>
+
+ 0 -1 1495 -7.1033788844943047e-04
+
+ 5.8563941717147827e-01 4.7215330600738525e-01
+ <_>
+
+ 0 -1 1496 -1.4117559790611267e-01
+
+ 8.6900062859058380e-02 4.9615910649299622e-01
+ <_>
+
+ 0 -1 1497 1.0651809722185135e-01
+
+ 5.1388370990753174e-01 1.7410050332546234e-01
+ <_>
+
+ 0 -1 1498 -5.2744749933481216e-02
+
+ 7.3536360263824463e-01 4.7728818655014038e-01
+ <_>
+
+ 0 -1 1499 -4.7431760467588902e-03
+
+ 3.8844060897827148e-01 5.2927017211914062e-01
+ <_>
+
+ 0 -1 1500 9.9676765967160463e-04
+
+ 5.2234929800033569e-01 4.0034240484237671e-01
+ <_>
+
+ 0 -1 1501 8.0284131690859795e-03
+
+ 4.9591061472892761e-01 7.2129642963409424e-01
+ <_>
+
+ 0 -1 1502 8.6025858763605356e-04
+
+ 4.4448840618133545e-01 5.5384761095046997e-01
+ <_>
+
+ 0 -1 1503 9.3191501218825579e-04
+
+ 5.3983712196350098e-01 4.1632440686225891e-01
+ <_>
+
+ 0 -1 1504 -2.5082060601562262e-03
+
+ 5.8542650938034058e-01 4.5625001192092896e-01
+ <_>
+
+ 0 -1 1505 -2.1378761157393456e-03
+
+ 4.6080690622329712e-01 5.2802592515945435e-01
+ <_>
+
+ 0 -1 1506 -2.1546049974858761e-03
+
+ 3.7911269068717957e-01 5.2559971809387207e-01
+ <_>
+
+ 0 -1 1507 -7.6214009895920753e-03
+
+ 5.9986090660095215e-01 4.9520739912986755e-01
+ <_>
+
+ 0 -1 1508 2.2055360022932291e-03
+
+ 4.4842061400413513e-01 5.5885308980941772e-01
+ <_>
+
+ 0 -1 1509 1.2586950324475765e-03
+
+ 5.4507470130920410e-01 4.4238409399986267e-01
+ <_>
+
+ 0 -1 1510 -5.0926720723509789e-03
+
+ 4.1182750463485718e-01 5.2630358934402466e-01
+ <_>
+
+ 0 -1 1511 -2.5095739401876926e-03
+
+ 5.7879078388214111e-01 4.9984949827194214e-01
+ <_>
+
+ 0 -1 1512 -7.7327556908130646e-02
+
+ 8.3978658914566040e-01 4.8111200332641602e-01
+ <_>
+
+ 0 -1 1513 -4.1485819965600967e-02
+
+ 2.4086110293865204e-01 5.1769930124282837e-01
+ <_>
+
+ 0 -1 1514 1.0355669655837119e-04
+
+ 4.3553608655929565e-01 5.4170542955398560e-01
+ <_>
+
+ 0 -1 1515 1.3255809899419546e-03
+
+ 5.4539710283279419e-01 4.8940950632095337e-01
+ <_>
+
+ 0 -1 1516 -8.0598732456564903e-03
+
+ 5.7710242271423340e-01 4.5779189467430115e-01
+ <_>
+
+ 0 -1 1517 1.9058620557188988e-02
+
+ 5.1698678731918335e-01 3.4004750847816467e-01
+ <_>
+
+ 0 -1 1518 -3.5057891160249710e-02
+
+ 2.2032439708709717e-01 5.0005030632019043e-01
+ <_>
+
+ 0 -1 1519 5.7296059094369411e-03
+
+ 5.0434082746505737e-01 6.5975707769393921e-01
+ <_>
+
+ 0 -1 1520 -1.1648329906165600e-02
+
+ 2.1862849593162537e-01 4.9966529011726379e-01
+ <_>
+
+ 0 -1 1521 1.4544479781761765e-03
+
+ 5.0076818466186523e-01 5.5037277936935425e-01
+ <_>
+
+ 0 -1 1522 -2.5030909455381334e-04
+
+ 4.1298410296440125e-01 5.2416700124740601e-01
+ <_>
+
+ 0 -1 1523 -8.2907272735610604e-04
+
+ 5.4128682613372803e-01 4.9744960665702820e-01
+ <_>
+
+ 0 -1 1524 1.0862209601327777e-03
+
+ 4.6055299043655396e-01 5.8792287111282349e-01
+ <_>
+
+ 0 -1 1525 2.0000500080641359e-04
+
+ 5.2788549661636353e-01 4.7052091360092163e-01
+ <_>
+
+ 0 -1 1526 2.9212920926511288e-03
+
+ 5.1296097040176392e-01 3.7555369734764099e-01
+ <_>
+
+ 0 -1 1527 2.5387400761246681e-02
+
+ 4.8226919770240784e-01 5.7907682657241821e-01
+ <_>
+
+ 0 -1 1528 -3.1968469265848398e-03
+
+ 5.2483952045440674e-01 3.9628401398658752e-01
+ <_>
+ 182
+ 9.0253349304199219e+01
+
+ <_>
+
+ 0 -1 1529 5.8031738735735416e-03
+
+ 3.4989839792251587e-01 5.9619832038879395e-01
+ <_>
+
+ 0 -1 1530 -9.0003069490194321e-03
+
+ 6.8166369199752808e-01 4.4785520434379578e-01
+ <_>
+
+ 0 -1 1531 -1.1549659539014101e-03
+
+ 5.5857062339782715e-01 3.5782510042190552e-01
+ <_>
+
+ 0 -1 1532 -1.1069850297644734e-03
+
+ 5.3650361299514771e-01 3.0504280328750610e-01
+ <_>
+
+ 0 -1 1533 1.0308309720130637e-04
+
+ 3.6390951275825500e-01 5.3446358442306519e-01
+ <_>
+
+ 0 -1 1534 -5.0984839908778667e-03
+
+ 2.8591570258140564e-01 5.5042648315429688e-01
+ <_>
+
+ 0 -1 1535 8.2572200335562229e-04
+
+ 5.2365237474441528e-01 3.4760418534278870e-01
+ <_>
+
+ 0 -1 1536 9.9783325567841530e-03
+
+ 4.7503221035003662e-01 6.2196469306945801e-01
+ <_>
+
+ 0 -1 1537 -3.7402529269456863e-02
+
+ 3.3433759212493896e-01 5.2780628204345703e-01
+ <_>
+
+ 0 -1 1538 4.8548257909715176e-03
+
+ 5.1921808719635010e-01 3.7004441022872925e-01
+ <_>
+
+ 0 -1 1539 -1.8664470408111811e-03
+
+ 2.9298439621925354e-01 5.0919449329376221e-01
+ <_>
+
+ 0 -1 1540 1.6888890415430069e-02
+
+ 3.6868458986282349e-01 5.4312258958816528e-01
+ <_>
+
+ 0 -1 1541 -5.8372621424496174e-03
+
+ 3.6321839690208435e-01 5.2213358879089355e-01
+ <_>
+
+ 0 -1 1542 -1.4713739510625601e-03
+
+ 5.8706837892532349e-01 4.7006508708000183e-01
+ <_>
+
+ 0 -1 1543 -1.1522950371727347e-03
+
+ 3.1958949565887451e-01 5.1409542560577393e-01
+ <_>
+
+ 0 -1 1544 -4.2560300789773464e-03
+
+ 6.3018590211868286e-01 4.8149210214614868e-01
+ <_>
+
+ 0 -1 1545 -6.7378291860222816e-03
+
+ 1.9770480692386627e-01 5.0258082151412964e-01
+ <_>
+
+ 0 -1 1546 1.1382670141756535e-02
+
+ 4.9541321396827698e-01 6.8670457601547241e-01
+ <_>
+
+ 0 -1 1547 5.1794708706438541e-03
+
+ 5.1644277572631836e-01 3.3506479859352112e-01
+ <_>
+
+ 0 -1 1548 -1.1743789911270142e-01
+
+ 2.3152460157871246e-01 5.2344137430191040e-01
+ <_>
+
+ 0 -1 1549 2.8703449293971062e-02
+
+ 4.6642971038818359e-01 6.7225211858749390e-01
+ <_>
+
+ 0 -1 1550 4.8231030814349651e-03
+
+ 5.2208751440048218e-01 2.7235329151153564e-01
+ <_>
+
+ 0 -1 1551 2.6798530016094446e-03
+
+ 5.0792771577835083e-01 2.9069489240646362e-01
+ <_>
+
+ 0 -1 1552 8.0504082143306732e-03
+
+ 4.8859509825706482e-01 6.3950210809707642e-01
+ <_>
+
+ 0 -1 1553 4.8054959625005722e-03
+
+ 5.1972568035125732e-01 3.6566638946533203e-01
+ <_>
+
+ 0 -1 1554 -2.2420159075409174e-03
+
+ 6.1534678936004639e-01 4.7637018561363220e-01
+ <_>
+
+ 0 -1 1555 -1.3757710345089436e-02
+
+ 2.6373448967933655e-01 5.0309032201766968e-01
+ <_>
+
+ 0 -1 1556 -1.0338299721479416e-01
+
+ 2.2875219583511353e-01 5.1824611425399780e-01
+ <_>
+
+ 0 -1 1557 -9.4432085752487183e-03
+
+ 6.9533038139343262e-01 4.6949490904808044e-01
+ <_>
+
+ 0 -1 1558 8.0271181650459766e-04
+
+ 5.4506552219390869e-01 4.2687839269638062e-01
+ <_>
+
+ 0 -1 1559 -4.1945669800043106e-03
+
+ 6.0913878679275513e-01 4.5716428756713867e-01
+ <_>
+
+ 0 -1 1560 1.0942210443317890e-02
+
+ 5.2410632371902466e-01 3.2845470309257507e-01
+ <_>
+
+ 0 -1 1561 -5.7841069065034389e-04
+
+ 5.3879290819168091e-01 4.1793689131736755e-01
+ <_>
+
+ 0 -1 1562 -2.0888620056211948e-03
+
+ 4.2926910519599915e-01 5.3017157316207886e-01
+ <_>
+
+ 0 -1 1563 3.2383969519287348e-03
+
+ 3.7923479080200195e-01 5.2207440137863159e-01
+ <_>
+
+ 0 -1 1564 4.9075027927756310e-03
+
+ 5.2372831106185913e-01 4.1267579793930054e-01
+ <_>
+
+ 0 -1 1565 -3.2277941703796387e-02
+
+ 1.9476559758186340e-01 4.9945020675659180e-01
+ <_>
+
+ 0 -1 1566 -8.9711230248212814e-03
+
+ 6.0112851858139038e-01 4.9290320277214050e-01
+ <_>
+
+ 0 -1 1567 1.5321089886128902e-02
+
+ 5.0097537040710449e-01 2.0398220419883728e-01
+ <_>
+
+ 0 -1 1568 2.0855569746345282e-03
+
+ 4.8621898889541626e-01 5.7216948270797729e-01
+ <_>
+
+ 0 -1 1569 5.0615021027624607e-03
+
+ 5.0002187490463257e-01 1.8018059432506561e-01
+ <_>
+
+ 0 -1 1570 -3.7174751050770283e-03
+
+ 5.5301171541213989e-01 4.8975929617881775e-01
+ <_>
+
+ 0 -1 1571 -1.2170500122010708e-02
+
+ 4.1786059737205505e-01 5.3837239742279053e-01
+ <_>
+
+ 0 -1 1572 4.6248398721218109e-03
+
+ 4.9971699714660645e-01 5.7613271474838257e-01
+ <_>
+
+ 0 -1 1573 -2.1040429419372231e-04
+
+ 5.3318071365356445e-01 4.0976810455322266e-01
+ <_>
+
+ 0 -1 1574 -1.4641780406236649e-02
+
+ 5.7559251785278320e-01 5.0517761707305908e-01
+ <_>
+
+ 0 -1 1575 3.3199489116668701e-03
+
+ 4.5769768953323364e-01 6.0318058729171753e-01
+ <_>
+
+ 0 -1 1576 3.7236879579722881e-03
+
+ 4.3803969025611877e-01 5.4158830642700195e-01
+ <_>
+
+ 0 -1 1577 8.2951161311939359e-04
+
+ 5.1630318164825439e-01 3.7022191286087036e-01
+ <_>
+
+ 0 -1 1578 -1.1408490128815174e-02
+
+ 6.0729467868804932e-01 4.8625651001930237e-01
+ <_>
+
+ 0 -1 1579 -4.5320121571421623e-03
+
+ 3.2924759387969971e-01 5.0889629125595093e-01
+ <_>
+
+ 0 -1 1580 5.1276017911732197e-03
+
+ 4.8297679424285889e-01 6.1227089166641235e-01
+ <_>
+
+ 0 -1 1581 9.8583158105611801e-03
+
+ 4.6606799960136414e-01 6.5561771392822266e-01
+ <_>
+
+ 0 -1 1582 3.6985918879508972e-02
+
+ 5.2048492431640625e-01 1.6904720664024353e-01
+ <_>
+
+ 0 -1 1583 4.6491161920130253e-03
+
+ 5.1673221588134766e-01 3.7252250313758850e-01
+ <_>
+
+ 0 -1 1584 -4.2664702050387859e-03
+
+ 6.4064931869506836e-01 4.9873429536819458e-01
+ <_>
+
+ 0 -1 1585 -4.7956590424291790e-04
+
+ 5.8972930908203125e-01 4.4648739695549011e-01
+ <_>
+
+ 0 -1 1586 3.6827160511165857e-03
+
+ 5.4415607452392578e-01 3.4726628661155701e-01
+ <_>
+
+ 0 -1 1587 -1.0059880092740059e-02
+
+ 2.1431629359722137e-01 5.0048297643661499e-01
+ <_>
+
+ 0 -1 1588 -3.0361840617842972e-04
+
+ 5.3864240646362305e-01 4.5903238654136658e-01
+ <_>
+
+ 0 -1 1589 -1.4545479789376259e-03
+
+ 5.7511842250823975e-01 4.4970950484275818e-01
+ <_>
+
+ 0 -1 1590 1.6515209572389722e-03
+
+ 5.4219377040863037e-01 4.2385208606719971e-01
+ <_>
+
+ 0 -1 1591 -7.8468639403581619e-03
+
+ 4.0779209136962891e-01 5.2581572532653809e-01
+ <_>
+
+ 0 -1 1592 -5.1259850151836872e-03
+
+ 4.2292758822441101e-01 5.4794532060623169e-01
+ <_>
+
+ 0 -1 1593 -3.6890961229801178e-02
+
+ 6.5963757038116455e-01 4.6746781468391418e-01
+ <_>
+
+ 0 -1 1594 2.4035639944486320e-04
+
+ 4.2511358857154846e-01 5.5732029676437378e-01
+ <_>
+
+ 0 -1 1595 -1.5150169929256663e-05
+
+ 5.2592468261718750e-01 4.0741148591041565e-01
+ <_>
+
+ 0 -1 1596 2.2108471021056175e-03
+
+ 4.6717229485511780e-01 5.8863520622253418e-01
+ <_>
+
+ 0 -1 1597 -1.1568620102480054e-03
+
+ 5.7110661268234253e-01 4.4871619343757629e-01
+ <_>
+
+ 0 -1 1598 4.9996292218565941e-03
+
+ 5.2641981840133667e-01 2.8983271121978760e-01
+ <_>
+
+ 0 -1 1599 -1.4656189596280456e-03
+
+ 3.8917380571365356e-01 5.1978719234466553e-01
+ <_>
+
+ 0 -1 1600 -1.1975039960816503e-03
+
+ 5.7958728075027466e-01 4.9279558658599854e-01
+ <_>
+
+ 0 -1 1601 -4.4954330660402775e-03
+
+ 2.3776030540466309e-01 5.0125551223754883e-01
+ <_>
+
+ 0 -1 1602 1.4997160178609192e-04
+
+ 4.8766261339187622e-01 5.6176078319549561e-01
+ <_>
+
+ 0 -1 1603 2.6391509454697371e-03
+
+ 5.1680880784988403e-01 3.7655091285705566e-01
+ <_>
+
+ 0 -1 1604 -2.9368131072260439e-04
+
+ 5.4466491937637329e-01 4.8746308684349060e-01
+ <_>
+
+ 0 -1 1605 1.4211760135367513e-03
+
+ 4.6878978610038757e-01 6.6913318634033203e-01
+ <_>
+
+ 0 -1 1606 7.9427637159824371e-02
+
+ 5.1934438943862915e-01 2.7329459786415100e-01
+ <_>
+
+ 0 -1 1607 7.9937502741813660e-02
+
+ 4.9717310070991516e-01 1.7820839583873749e-01
+ <_>
+
+ 0 -1 1608 1.1089259758591652e-02
+
+ 5.1659947633743286e-01 3.2094758749008179e-01
+ <_>
+
+ 0 -1 1609 1.6560709627810866e-04
+
+ 4.0584719181060791e-01 5.3072762489318848e-01
+ <_>
+
+ 0 -1 1610 -5.3354292176663876e-03
+
+ 3.4450569748878479e-01 5.1581299304962158e-01
+ <_>
+
+ 0 -1 1611 1.1287260567769408e-03
+
+ 4.5948630571365356e-01 6.0755330324172974e-01
+ <_>
+
+ 0 -1 1612 -2.1969219669699669e-02
+
+ 1.6804009675979614e-01 5.2285957336425781e-01
+ <_>
+
+ 0 -1 1613 -2.1775320055894554e-04
+
+ 3.8615968823432922e-01 5.2156728506088257e-01
+ <_>
+
+ 0 -1 1614 2.0200149447191507e-04
+
+ 5.5179792642593384e-01 4.3630391359329224e-01
+ <_>
+
+ 0 -1 1615 -2.1733149886131287e-02
+
+ 7.9994601011276245e-01 4.7898510098457336e-01
+ <_>
+
+ 0 -1 1616 -8.4399932529777288e-04
+
+ 4.0859758853912354e-01 5.3747731447219849e-01
+ <_>
+
+ 0 -1 1617 -4.3895249837078154e-04
+
+ 5.4704052209854126e-01 4.3661430478096008e-01
+ <_>
+
+ 0 -1 1618 1.5092400135472417e-03
+
+ 4.9889969825744629e-01 5.8421492576599121e-01
+ <_>
+
+ 0 -1 1619 -3.5547839943319559e-03
+
+ 6.7536902427673340e-01 4.7210058569908142e-01
+ <_>
+
+ 0 -1 1620 4.8191400128416717e-04
+
+ 5.4158538579940796e-01 4.3571090698242188e-01
+ <_>
+
+ 0 -1 1621 -6.0264398343861103e-03
+
+ 2.2585099935531616e-01 4.9918809533119202e-01
+ <_>
+
+ 0 -1 1622 -1.1668140068650246e-02
+
+ 6.2565547227859497e-01 4.9274989962577820e-01
+ <_>
+
+ 0 -1 1623 -2.8718370012938976e-03
+
+ 3.9477849006652832e-01 5.2458018064498901e-01
+ <_>
+
+ 0 -1 1624 1.7051169648766518e-02
+
+ 4.7525110840797424e-01 5.7942241430282593e-01
+ <_>
+
+ 0 -1 1625 -1.3352080248296261e-02
+
+ 6.0411047935485840e-01 4.5445358753204346e-01
+ <_>
+
+ 0 -1 1626 -3.9301801007241011e-04
+
+ 4.2582759261131287e-01 5.5449050664901733e-01
+ <_>
+
+ 0 -1 1627 3.0483349692076445e-03
+
+ 5.2334201335906982e-01 3.7802729010581970e-01
+ <_>
+
+ 0 -1 1628 -4.3579288758337498e-03
+
+ 6.3718891143798828e-01 4.8386740684509277e-01
+ <_>
+
+ 0 -1 1629 5.6661018170416355e-03
+
+ 5.3747057914733887e-01 4.1636660695075989e-01
+ <_>
+
+ 0 -1 1630 6.0677339206449687e-05
+
+ 4.6387958526611328e-01 5.3116250038146973e-01
+ <_>
+
+ 0 -1 1631 3.6738160997629166e-02
+
+ 4.6886560320854187e-01 6.4665240049362183e-01
+ <_>
+
+ 0 -1 1632 8.6528137326240540e-03
+
+ 5.2043187618255615e-01 2.1886579692363739e-01
+ <_>
+
+ 0 -1 1633 -1.5371359884738922e-01
+
+ 1.6303719580173492e-01 4.9588400125503540e-01
+ <_>
+
+ 0 -1 1634 -4.1560421232134104e-04
+
+ 5.7744592428207397e-01 4.6964588761329651e-01
+ <_>
+
+ 0 -1 1635 -1.2640169588848948e-03
+
+ 3.9771759510040283e-01 5.2171981334686279e-01
+ <_>
+
+ 0 -1 1636 -3.5473341122269630e-03
+
+ 6.0465282201766968e-01 4.8083150386810303e-01
+ <_>
+
+ 0 -1 1637 3.0019069527043030e-05
+
+ 3.9967238903045654e-01 5.2282011508941650e-01
+ <_>
+
+ 0 -1 1638 1.3113019522279501e-03
+
+ 4.7121581435203552e-01 5.7659977674484253e-01
+ <_>
+
+ 0 -1 1639 -1.3374709524214268e-03
+
+ 4.1095849871635437e-01 5.2531701326370239e-01
+ <_>
+
+ 0 -1 1640 2.0876709371805191e-02
+
+ 5.2029937505722046e-01 1.7579819262027740e-01
+ <_>
+
+ 0 -1 1641 -7.5497948564589024e-03
+
+ 6.5666097402572632e-01 4.6949750185012817e-01
+ <_>
+
+ 0 -1 1642 2.4188550189137459e-02
+
+ 5.1286739110946655e-01 3.3702209591865540e-01
+ <_>
+
+ 0 -1 1643 -2.9358828905969858e-03
+
+ 6.5807867050170898e-01 4.6945410966873169e-01
+ <_>
+
+ 0 -1 1644 5.7557929307222366e-02
+
+ 5.1464450359344482e-01 2.7752599120140076e-01
+ <_>
+
+ 0 -1 1645 -1.1343370424583554e-03
+
+ 3.8366019725799561e-01 5.1926672458648682e-01
+ <_>
+
+ 0 -1 1646 1.6816999763250351e-02
+
+ 5.0855928659439087e-01 6.1772608757019043e-01
+ <_>
+
+ 0 -1 1647 5.0535178743302822e-03
+
+ 5.1387631893157959e-01 3.6847919225692749e-01
+ <_>
+
+ 0 -1 1648 -4.5874710194766521e-03
+
+ 5.9896552562713623e-01 4.8352020978927612e-01
+ <_>
+
+ 0 -1 1649 1.6882460331544280e-03
+
+ 4.5094868540763855e-01 5.7230567932128906e-01
+ <_>
+
+ 0 -1 1650 -1.6554000321775675e-03
+
+ 3.4967708587646484e-01 5.2433192729949951e-01
+ <_>
+
+ 0 -1 1651 -1.9373800605535507e-02
+
+ 1.1205369979143143e-01 4.9687129259109497e-01
+ <_>
+
+ 0 -1 1652 1.0374450124800205e-02
+
+ 5.1481968164443970e-01 4.3952131271362305e-01
+ <_>
+
+ 0 -1 1653 1.4973050565458834e-04
+
+ 4.0849998593330383e-01 5.2698868513107300e-01
+ <_>
+
+ 0 -1 1654 -4.2981930077075958e-02
+
+ 6.3941049575805664e-01 5.0185042619705200e-01
+ <_>
+
+ 0 -1 1655 8.3065936341881752e-03
+
+ 4.7075539827346802e-01 6.6983532905578613e-01
+ <_>
+
+ 0 -1 1656 -4.1285790503025055e-03
+
+ 4.5413690805435181e-01 5.3236472606658936e-01
+ <_>
+
+ 0 -1 1657 1.7399420030415058e-03
+
+ 4.3339619040489197e-01 5.4398661851882935e-01
+ <_>
+
+ 0 -1 1658 1.1739750334527344e-04
+
+ 4.5796871185302734e-01 5.5434262752532959e-01
+ <_>
+
+ 0 -1 1659 1.8585780344437808e-04
+
+ 4.3246439099311829e-01 5.4267549514770508e-01
+ <_>
+
+ 0 -1 1660 5.5587692186236382e-03
+
+ 5.2572208642959595e-01 3.5506111383438110e-01
+ <_>
+
+ 0 -1 1661 -7.9851560294628143e-03
+
+ 6.0430181026458740e-01 4.6306359767913818e-01
+ <_>
+
+ 0 -1 1662 6.0594122624024749e-04
+
+ 4.5982548594474792e-01 5.5331951379776001e-01
+ <_>
+
+ 0 -1 1663 -2.2983040253166109e-04
+
+ 4.1307520866394043e-01 5.3224611282348633e-01
+ <_>
+
+ 0 -1 1664 4.3740210821852088e-04
+
+ 4.0430399775505066e-01 5.4092890024185181e-01
+ <_>
+
+ 0 -1 1665 2.9482020181603730e-04
+
+ 4.4949638843536377e-01 5.6288522481918335e-01
+ <_>
+
+ 0 -1 1666 1.0312659665942192e-02
+
+ 5.1775109767913818e-01 2.7043169736862183e-01
+ <_>
+
+ 0 -1 1667 -7.7241109684109688e-03
+
+ 1.9880190491676331e-01 4.9805539846420288e-01
+ <_>
+
+ 0 -1 1668 -4.6797208487987518e-03
+
+ 6.6447502374649048e-01 5.0182962417602539e-01
+ <_>
+
+ 0 -1 1669 -5.0755459815263748e-03
+
+ 3.8983049988746643e-01 5.1852691173553467e-01
+ <_>
+
+ 0 -1 1670 2.2479740437120199e-03
+
+ 4.8018088936805725e-01 5.6603360176086426e-01
+ <_>
+
+ 0 -1 1671 8.3327008178457618e-04
+
+ 5.2109199762344360e-01 3.9571881294250488e-01
+ <_>
+
+ 0 -1 1672 -4.1279330849647522e-02
+
+ 6.1545419692993164e-01 5.0070542097091675e-01
+ <_>
+
+ 0 -1 1673 -5.0930189900100231e-04
+
+ 3.9759421348571777e-01 5.2284038066864014e-01
+ <_>
+
+ 0 -1 1674 1.2568780221045017e-03
+
+ 4.9791380763053894e-01 5.9391832351684570e-01
+ <_>
+
+ 0 -1 1675 8.0048497766256332e-03
+
+ 4.9844971299171448e-01 1.6333660483360291e-01
+ <_>
+
+ 0 -1 1676 -1.1879300000146031e-03
+
+ 5.9049648046493530e-01 4.9426248669624329e-01
+ <_>
+
+ 0 -1 1677 6.1948952497914433e-04
+
+ 4.1995579004287720e-01 5.3287261724472046e-01
+ <_>
+
+ 0 -1 1678 6.6829859279096127e-03
+
+ 5.4186028242111206e-01 4.9058890342712402e-01
+ <_>
+
+ 0 -1 1679 -3.7062340416014194e-03
+
+ 3.7259390950202942e-01 5.1380002498626709e-01
+ <_>
+
+ 0 -1 1680 -3.9739411324262619e-02
+
+ 6.4789611101150513e-01 5.0503468513488770e-01
+ <_>
+
+ 0 -1 1681 1.4085009461268783e-03
+
+ 4.6823391318321228e-01 6.3778841495513916e-01
+ <_>
+
+ 0 -1 1682 3.9322688826359808e-04
+
+ 5.4585301876068115e-01 4.1504821181297302e-01
+ <_>
+
+ 0 -1 1683 -1.8979819724336267e-03
+
+ 3.6901599168777466e-01 5.1497042179107666e-01
+ <_>
+
+ 0 -1 1684 -1.3970440253615379e-02
+
+ 6.0505628585815430e-01 4.8113578557968140e-01
+ <_>
+
+ 0 -1 1685 -1.0100819915533066e-01
+
+ 2.0170800387859344e-01 4.9923619627952576e-01
+ <_>
+
+ 0 -1 1686 -1.7346920445561409e-02
+
+ 5.7131487131118774e-01 4.8994860053062439e-01
+ <_>
+
+ 0 -1 1687 1.5619759506080300e-04
+
+ 4.2153888940811157e-01 5.3926420211791992e-01
+ <_>
+
+ 0 -1 1688 1.3438929617404938e-01
+
+ 5.1361519098281860e-01 3.7676128745079041e-01
+ <_>
+
+ 0 -1 1689 -2.4582240730524063e-02
+
+ 7.0273578166961670e-01 4.7479069232940674e-01
+ <_>
+
+ 0 -1 1690 -3.8553720805794001e-03
+
+ 4.3174090981483459e-01 5.4277169704437256e-01
+ <_>
+
+ 0 -1 1691 -2.3165249731391668e-03
+
+ 5.9426987171173096e-01 4.6186479926109314e-01
+ <_>
+
+ 0 -1 1692 -4.8518120311200619e-03
+
+ 6.1915689706802368e-01 4.8848950862884521e-01
+ <_>
+
+ 0 -1 1693 2.4699938949197531e-03
+
+ 5.2566647529602051e-01 4.0171998739242554e-01
+ <_>
+
+ 0 -1 1694 4.5496959239244461e-02
+
+ 5.2378678321838379e-01 2.6857739686965942e-01
+ <_>
+
+ 0 -1 1695 -2.0319599658250809e-02
+
+ 2.1304459869861603e-01 4.9797388911247253e-01
+ <_>
+
+ 0 -1 1696 2.6994998916052282e-04
+
+ 4.8140418529510498e-01 5.5431222915649414e-01
+ <_>
+
+ 0 -1 1697 -1.8232699949294329e-03
+
+ 6.4825797080993652e-01 4.7099891304969788e-01
+ <_>
+
+ 0 -1 1698 -6.3015790656208992e-03
+
+ 4.5819279551506042e-01 5.3062361478805542e-01
+ <_>
+
+ 0 -1 1699 -2.4139499873854220e-04
+
+ 5.2320867776870728e-01 4.0517631173133850e-01
+ <_>
+
+ 0 -1 1700 -1.0330369696021080e-03
+
+ 5.5562019348144531e-01 4.7891938686370850e-01
+ <_>
+
+ 0 -1 1701 1.8041160365100950e-04
+
+ 5.2294427156448364e-01 4.0118101239204407e-01
+ <_>
+
+ 0 -1 1702 -6.1407860368490219e-02
+
+ 6.2986820936203003e-01 5.0107032060623169e-01
+ <_>
+
+ 0 -1 1703 -6.9543913006782532e-02
+
+ 7.2282809019088745e-01 4.7731840610504150e-01
+ <_>
+
+ 0 -1 1704 -7.0542663335800171e-02
+
+ 2.2695130109786987e-01 5.1825290918350220e-01
+ <_>
+
+ 0 -1 1705 2.4423799477517605e-03
+
+ 5.2370971441268921e-01 4.0981510281562805e-01
+ <_>
+
+ 0 -1 1706 1.5494349645450711e-03
+
+ 4.7737509012222290e-01 5.4680430889129639e-01
+ <_>
+
+ 0 -1 1707 -2.3914219811558723e-02
+
+ 7.1469759941101074e-01 4.7838249802589417e-01
+ <_>
+
+ 0 -1 1708 -1.2453690171241760e-02
+
+ 2.6352968811988831e-01 5.2411228418350220e-01
+ <_>
+
+ 0 -1 1709 -2.0760179904755205e-04
+
+ 3.6237570643424988e-01 5.1136088371276855e-01
+ <_>
+
+ 0 -1 1710 2.9781080229440704e-05
+
+ 4.7059321403503418e-01 5.4328018426895142e-01
+ <_>
+ 211
+ 1.0474919891357422e+02
+
+ <_>
+
+ 0 -1 1711 1.1772749945521355e-02
+
+ 3.8605189323425293e-01 6.4211672544479370e-01
+ <_>
+
+ 0 -1 1712 2.7037570253014565e-02
+
+ 4.3856549263000488e-01 6.7540389299392700e-01
+ <_>
+
+ 0 -1 1713 -3.6419500247575343e-05
+
+ 5.4871010780334473e-01 3.4233158826828003e-01
+ <_>
+
+ 0 -1 1714 1.9995409529656172e-03
+
+ 3.2305321097373962e-01 5.4003179073333740e-01
+ <_>
+
+ 0 -1 1715 4.5278300531208515e-03
+
+ 5.0916397571563721e-01 2.9350438714027405e-01
+ <_>
+
+ 0 -1 1716 4.7890920541249216e-04
+
+ 4.1781538724899292e-01 5.3440642356872559e-01
+ <_>
+
+ 0 -1 1717 1.1720920447260141e-03
+
+ 2.8991821408271790e-01 5.1320707798004150e-01
+ <_>
+
+ 0 -1 1718 9.5305702416226268e-04
+
+ 4.2801249027252197e-01 5.5608451366424561e-01
+ <_>
+
+ 0 -1 1719 1.5099150004971307e-05
+
+ 4.0448719263076782e-01 5.4047602415084839e-01
+ <_>
+
+ 0 -1 1720 -6.0817901976406574e-04
+
+ 4.2717689275741577e-01 5.5034661293029785e-01
+ <_>
+
+ 0 -1 1721 3.3224520739167929e-03
+
+ 3.9627239108085632e-01 5.3697347640991211e-01
+ <_>
+
+ 0 -1 1722 -1.1037490330636501e-03
+
+ 4.7271779179573059e-01 5.2377498149871826e-01
+ <_>
+
+ 0 -1 1723 -1.4350269921123981e-03
+
+ 5.6030082702636719e-01 4.2235091328620911e-01
+ <_>
+
+ 0 -1 1724 2.0767399109899998e-03
+
+ 5.2259171009063721e-01 4.7327259182929993e-01
+ <_>
+
+ 0 -1 1725 -1.6412809782195836e-04
+
+ 3.9990758895874023e-01 5.4327398538589478e-01
+ <_>
+
+ 0 -1 1726 8.8302437216043472e-03
+
+ 4.6783858537673950e-01 6.0273271799087524e-01
+ <_>
+
+ 0 -1 1727 -1.0552070103585720e-02
+
+ 3.4939670562744141e-01 5.2139747142791748e-01
+ <_>
+
+ 0 -1 1728 -2.2731600329279900e-03
+
+ 6.1858189105987549e-01 4.7490629553794861e-01
+ <_>
+
+ 0 -1 1729 -8.4786332445219159e-04
+
+ 5.2853411436080933e-01 3.8434821367263794e-01
+ <_>
+
+ 0 -1 1730 1.2081359745934606e-03
+
+ 5.3606408834457397e-01 3.4473359584808350e-01
+ <_>
+
+ 0 -1 1731 2.6512730401009321e-03
+
+ 4.5582920312881470e-01 6.1939620971679688e-01
+ <_>
+
+ 0 -1 1732 -1.1012479662895203e-03
+
+ 3.6802300810813904e-01 5.3276282548904419e-01
+ <_>
+
+ 0 -1 1733 4.9561518244445324e-04
+
+ 3.9605951309204102e-01 5.2749407291412354e-01
+ <_>
+
+ 0 -1 1734 -4.3901771306991577e-02
+
+ 7.0204448699951172e-01 4.9928390979766846e-01
+ <_>
+
+ 0 -1 1735 3.4690350294113159e-02
+
+ 5.0491642951965332e-01 2.7666029334068298e-01
+ <_>
+
+ 0 -1 1736 -2.7442190330475569e-03
+
+ 2.6726329326629639e-01 5.2749711275100708e-01
+ <_>
+
+ 0 -1 1737 3.3316588960587978e-03
+
+ 4.5794829726219177e-01 6.0011017322540283e-01
+ <_>
+
+ 0 -1 1738 -2.0044570788741112e-02
+
+ 3.1715941429138184e-01 5.2357178926467896e-01
+ <_>
+
+ 0 -1 1739 1.3492030557245016e-03
+
+ 5.2653628587722778e-01 4.0343248844146729e-01
+ <_>
+
+ 0 -1 1740 2.9702018946409225e-03
+
+ 5.3324568271636963e-01 4.5719841122627258e-01
+ <_>
+
+ 0 -1 1741 6.3039981760084629e-03
+
+ 4.5933109521865845e-01 6.0346359014511108e-01
+ <_>
+
+ 0 -1 1742 -1.2936590239405632e-02
+
+ 4.4379639625549316e-01 5.3729712963104248e-01
+ <_>
+
+ 0 -1 1743 4.0148729458451271e-03
+
+ 4.6803238987922668e-01 6.4378339052200317e-01
+ <_>
+
+ 0 -1 1744 -2.6401679497212172e-03
+
+ 3.7096318602561951e-01 5.3143328428268433e-01
+ <_>
+
+ 0 -1 1745 1.3918439857661724e-02
+
+ 4.7235551476478577e-01 7.1308088302612305e-01
+ <_>
+
+ 0 -1 1746 -4.5087869511917233e-04
+
+ 4.4923940300941467e-01 5.3704041242599487e-01
+ <_>
+
+ 0 -1 1747 2.5384349282830954e-04
+
+ 4.4068640470504761e-01 5.5144029855728149e-01
+ <_>
+
+ 0 -1 1748 2.2710000630468130e-03
+
+ 4.6824169158935547e-01 5.9679841995239258e-01
+ <_>
+
+ 0 -1 1749 2.4120779708027840e-03
+
+ 5.0793921947479248e-01 3.0185988545417786e-01
+ <_>
+
+ 0 -1 1750 -3.6025670851813629e-05
+
+ 5.6010371446609497e-01 4.4710969924926758e-01
+ <_>
+
+ 0 -1 1751 -7.4905529618263245e-03
+
+ 2.2075350582599640e-01 4.9899441003799438e-01
+ <_>
+
+ 0 -1 1752 -1.7513120546936989e-02
+
+ 6.5312159061431885e-01 5.0176489353179932e-01
+ <_>
+
+ 0 -1 1753 1.4281630516052246e-01
+
+ 4.9679630994796753e-01 1.4820620417594910e-01
+ <_>
+
+ 0 -1 1754 5.5345268920063972e-03
+
+ 4.8989468812942505e-01 5.9542238712310791e-01
+ <_>
+
+ 0 -1 1755 -9.6323591424152255e-04
+
+ 3.9271169900894165e-01 5.1960742473602295e-01
+ <_>
+
+ 0 -1 1756 -2.0370010752230883e-03
+
+ 5.6133252382278442e-01 4.8848581314086914e-01
+ <_>
+
+ 0 -1 1757 1.6614829655736685e-03
+
+ 4.4728800654411316e-01 5.5788809061050415e-01
+ <_>
+
+ 0 -1 1758 -3.1188090797513723e-03
+
+ 3.8405328989028931e-01 5.3974777460098267e-01
+ <_>
+
+ 0 -1 1759 -6.4000617712736130e-03
+
+ 5.8439838886260986e-01 4.5332181453704834e-01
+ <_>
+
+ 0 -1 1760 3.1319601112045348e-04
+
+ 5.4392218589782715e-01 4.2347279191017151e-01
+ <_>
+
+ 0 -1 1761 -1.8222099170088768e-02
+
+ 1.2884649634361267e-01 4.9584048986434937e-01
+ <_>
+
+ 0 -1 1762 8.7969247251749039e-03
+
+ 4.9512979388237000e-01 7.1534800529479980e-01
+ <_>
+
+ 0 -1 1763 -4.2395070195198059e-03
+
+ 3.9465999603271484e-01 5.1949369907379150e-01
+ <_>
+
+ 0 -1 1764 9.7086271271109581e-03
+
+ 4.8975038528442383e-01 6.0649001598358154e-01
+ <_>
+
+ 0 -1 1765 -3.9934171363711357e-03
+
+ 3.2454401254653931e-01 5.0608289241790771e-01
+ <_>
+
+ 0 -1 1766 -1.6785059124231339e-02
+
+ 1.5819530189037323e-01 5.2037787437438965e-01
+ <_>
+
+ 0 -1 1767 1.8272090703248978e-02
+
+ 4.6809351444244385e-01 6.6269791126251221e-01
+ <_>
+
+ 0 -1 1768 5.6872838176786900e-03
+
+ 5.2116978168487549e-01 3.5121849179267883e-01
+ <_>
+
+ 0 -1 1769 -1.0739039862528443e-03
+
+ 5.7683861255645752e-01 4.5298451185226440e-01
+ <_>
+
+ 0 -1 1770 -3.7093870341777802e-03
+
+ 4.5077630877494812e-01 5.3135812282562256e-01
+ <_>
+
+ 0 -1 1771 -2.1110709349159151e-04
+
+ 5.4608201980590820e-01 4.3333768844604492e-01
+ <_>
+
+ 0 -1 1772 1.0670139454305172e-03
+
+ 5.3718560934066772e-01 4.0783908963203430e-01
+ <_>
+
+ 0 -1 1773 3.5943021066486835e-03
+
+ 4.4712871313095093e-01 5.6438362598419189e-01
+ <_>
+
+ 0 -1 1774 -5.1776031032204628e-03
+
+ 4.4993931055068970e-01 5.2803301811218262e-01
+ <_>
+
+ 0 -1 1775 -2.5414369883947074e-04
+
+ 5.5161732435226440e-01 4.4077080488204956e-01
+ <_>
+
+ 0 -1 1776 6.3522560521960258e-03
+
+ 5.1941901445388794e-01 2.4652279913425446e-01
+ <_>
+
+ 0 -1 1777 -4.4205080484971404e-04
+
+ 3.8307058811187744e-01 5.1396822929382324e-01
+ <_>
+
+ 0 -1 1778 7.4488727841526270e-04
+
+ 4.8910909891128540e-01 5.9747868776321411e-01
+ <_>
+
+ 0 -1 1779 -3.5116379149258137e-03
+
+ 7.4136817455291748e-01 4.7687649726867676e-01
+ <_>
+
+ 0 -1 1780 -1.2540910392999649e-02
+
+ 3.6488190293312073e-01 5.2528268098831177e-01
+ <_>
+
+ 0 -1 1781 9.4931852072477341e-03
+
+ 5.1004928350448608e-01 3.6295869946479797e-01
+ <_>
+
+ 0 -1 1782 1.2961150147020817e-02
+
+ 5.2324420213699341e-01 4.3335610628128052e-01
+ <_>
+
+ 0 -1 1783 4.7209449112415314e-03
+
+ 4.6481490135192871e-01 6.3310527801513672e-01
+ <_>
+
+ 0 -1 1784 -2.3119079414755106e-03
+
+ 5.9303098917007446e-01 4.5310580730438232e-01
+ <_>
+
+ 0 -1 1785 -2.8262299019843340e-03
+
+ 3.8704779744148254e-01 5.2571010589599609e-01
+ <_>
+
+ 0 -1 1786 -1.4311339473351836e-03
+
+ 5.5225032567977905e-01 4.5618548989295959e-01
+ <_>
+
+ 0 -1 1787 1.9378310535103083e-03
+
+ 4.5462208986282349e-01 5.7369667291641235e-01
+ <_>
+
+ 0 -1 1788 2.6343559147790074e-04
+
+ 5.3457391262054443e-01 4.5718750357627869e-01
+ <_>
+
+ 0 -1 1789 7.8257522545754910e-04
+
+ 3.9678159356117249e-01 5.2201879024505615e-01
+ <_>
+
+ 0 -1 1790 -1.9550440832972527e-02
+
+ 2.8296428918838501e-01 5.2435082197189331e-01
+ <_>
+
+ 0 -1 1791 4.3914958951063454e-04
+
+ 4.5900669693946838e-01 5.8990901708602905e-01
+ <_>
+
+ 0 -1 1792 2.1452000364661217e-02
+
+ 5.2314108610153198e-01 2.8553789854049683e-01
+ <_>
+
+ 0 -1 1793 5.8973580598831177e-04
+
+ 4.3972569704055786e-01 5.5064219236373901e-01
+ <_>
+
+ 0 -1 1794 -2.6157610118389130e-02
+
+ 3.1350791454315186e-01 5.1891750097274780e-01
+ <_>
+
+ 0 -1 1795 -1.3959860429167747e-02
+
+ 3.2132729887962341e-01 5.0407177209854126e-01
+ <_>
+
+ 0 -1 1796 -6.3699018210172653e-03
+
+ 6.3875448703765869e-01 4.8495069146156311e-01
+ <_>
+
+ 0 -1 1797 -8.5613820701837540e-03
+
+ 2.7591320872306824e-01 5.0320190191268921e-01
+ <_>
+
+ 0 -1 1798 9.6622901037335396e-04
+
+ 4.6856409311294556e-01 5.8348792791366577e-01
+ <_>
+
+ 0 -1 1799 7.6550268568098545e-04
+
+ 5.1752072572708130e-01 3.8964220881462097e-01
+ <_>
+
+ 0 -1 1800 -8.1833340227603912e-03
+
+ 2.0691369473934174e-01 5.2081221342086792e-01
+ <_>
+
+ 0 -1 1801 -9.3976939097046852e-03
+
+ 6.1340910196304321e-01 4.6412229537963867e-01
+ <_>
+
+ 0 -1 1802 4.8028980381786823e-03
+
+ 5.4541081190109253e-01 4.3952199816703796e-01
+ <_>
+
+ 0 -1 1803 -3.5680569708347321e-03
+
+ 6.3444852828979492e-01 4.6810939908027649e-01
+ <_>
+
+ 0 -1 1804 4.0733120404183865e-03
+
+ 5.2926832437515259e-01 4.0156200528144836e-01
+ <_>
+
+ 0 -1 1805 1.2568129459396005e-03
+
+ 4.3929880857467651e-01 5.4528248310089111e-01
+ <_>
+
+ 0 -1 1806 -2.9065010603517294e-03
+
+ 5.8988320827484131e-01 4.8633798956871033e-01
+ <_>
+
+ 0 -1 1807 -2.4409340694546700e-03
+
+ 4.0693649649620056e-01 5.2474218606948853e-01
+ <_>
+
+ 0 -1 1808 2.4830700829625130e-02
+
+ 5.1827257871627808e-01 3.6825248599052429e-01
+ <_>
+
+ 0 -1 1809 -4.8854008316993713e-02
+
+ 1.3075779378414154e-01 4.9612811207771301e-01
+ <_>
+
+ 0 -1 1810 -1.6110379947349429e-03
+
+ 6.4210057258605957e-01 4.8726621270179749e-01
+ <_>
+
+ 0 -1 1811 -9.7009479999542236e-02
+
+ 4.7769349068403244e-02 4.9509888887405396e-01
+ <_>
+
+ 0 -1 1812 1.1209240183234215e-03
+
+ 4.6162670850753784e-01 5.3547459840774536e-01
+ <_>
+
+ 0 -1 1813 -1.3064090162515640e-03
+
+ 6.2618541717529297e-01 4.6388059854507446e-01
+ <_>
+
+ 0 -1 1814 4.5771620352752507e-04
+
+ 5.3844177722930908e-01 4.6466401219367981e-01
+ <_>
+
+ 0 -1 1815 -6.3149951165542006e-04
+
+ 3.8040471076965332e-01 5.1302570104598999e-01
+ <_>
+
+ 0 -1 1816 1.4505970466416329e-04
+
+ 4.5543101429939270e-01 5.6644618511199951e-01
+ <_>
+
+ 0 -1 1817 -1.6474550589919090e-02
+
+ 6.5969580411911011e-01 4.7158598899841309e-01
+ <_>
+
+ 0 -1 1818 1.3369579799473286e-02
+
+ 5.1954662799835205e-01 3.0359649658203125e-01
+ <_>
+
+ 0 -1 1819 1.0271780047332868e-04
+
+ 5.2291762828826904e-01 4.1070660948753357e-01
+ <_>
+
+ 0 -1 1820 -5.5311559699475765e-03
+
+ 6.3528877496719360e-01 4.9609071016311646e-01
+ <_>
+
+ 0 -1 1821 -2.6187049224972725e-03
+
+ 3.8245460391044617e-01 5.1409840583801270e-01
+ <_>
+
+ 0 -1 1822 5.0834268331527710e-03
+
+ 4.9504399299621582e-01 6.2208187580108643e-01
+ <_>
+
+ 0 -1 1823 7.9818159341812134e-02
+
+ 4.9523359537124634e-01 1.3224759697914124e-01
+ <_>
+
+ 0 -1 1824 -9.9226586520671844e-02
+
+ 7.5427287817001343e-01 5.0084167718887329e-01
+ <_>
+
+ 0 -1 1825 -6.5174017800018191e-04
+
+ 3.6993029713630676e-01 5.1301211118698120e-01
+ <_>
+
+ 0 -1 1826 -1.8996849656105042e-02
+
+ 6.6891789436340332e-01 4.9212029576301575e-01
+ <_>
+
+ 0 -1 1827 1.7346899956464767e-02
+
+ 4.9833008646965027e-01 1.8591980636119843e-01
+ <_>
+
+ 0 -1 1828 5.5082101607695222e-04
+
+ 4.5744240283966064e-01 5.5221217870712280e-01
+ <_>
+
+ 0 -1 1829 2.0056050270795822e-03
+
+ 5.1317447423934937e-01 3.8564699888229370e-01
+ <_>
+
+ 0 -1 1830 -7.7688191086053848e-03
+
+ 4.3617001175880432e-01 5.4343092441558838e-01
+ <_>
+
+ 0 -1 1831 5.0878278911113739e-02
+
+ 4.6827208995819092e-01 6.8406397104263306e-01
+ <_>
+
+ 0 -1 1832 -2.2901780903339386e-03
+
+ 4.3292450904846191e-01 5.3060990571975708e-01
+ <_>
+
+ 0 -1 1833 -1.5715380141045898e-04
+
+ 5.3700572252273560e-01 4.3781641125679016e-01
+ <_>
+
+ 0 -1 1834 1.0519240051507950e-01
+
+ 5.1372742652893066e-01 6.7361466586589813e-02
+ <_>
+
+ 0 -1 1835 2.7198919560760260e-03
+
+ 4.1120609641075134e-01 5.2556651830673218e-01
+ <_>
+
+ 0 -1 1836 4.8337779939174652e-02
+
+ 5.4046237468719482e-01 4.4389671087265015e-01
+ <_>
+
+ 0 -1 1837 9.5703761326149106e-04
+
+ 4.3559691309928894e-01 5.3995108604431152e-01
+ <_>
+
+ 0 -1 1838 -2.5371259078383446e-02
+
+ 5.9951752424240112e-01 5.0310248136520386e-01
+ <_>
+
+ 0 -1 1839 5.2457951009273529e-02
+
+ 4.9502879381179810e-01 1.3983510434627533e-01
+ <_>
+
+ 0 -1 1840 -1.2365629896521568e-02
+
+ 6.3972991704940796e-01 4.9641060829162598e-01
+ <_>
+
+ 0 -1 1841 -1.4589719474315643e-01
+
+ 1.0016699880361557e-01 4.9463221430778503e-01
+ <_>
+
+ 0 -1 1842 -1.5908600762486458e-02
+
+ 3.3123299479484558e-01 5.2083408832550049e-01
+ <_>
+
+ 0 -1 1843 3.9486068999394774e-04
+
+ 4.4063639640808105e-01 5.4261028766632080e-01
+ <_>
+
+ 0 -1 1844 -5.2454001270234585e-03
+
+ 2.7995899319648743e-01 5.1899671554565430e-01
+ <_>
+
+ 0 -1 1845 -5.0421799533069134e-03
+
+ 6.9875800609588623e-01 4.7521421313285828e-01
+ <_>
+
+ 0 -1 1846 2.9812189750373363e-03
+
+ 4.9832889437675476e-01 6.3074797391891479e-01
+ <_>
+
+ 0 -1 1847 -7.2884308174252510e-03
+
+ 2.9823330044746399e-01 5.0268697738647461e-01
+ <_>
+
+ 0 -1 1848 1.5094350092113018e-03
+
+ 5.3084421157836914e-01 3.8329708576202393e-01
+ <_>
+
+ 0 -1 1849 -9.3340799212455750e-03
+
+ 2.0379640161991119e-01 4.9698171019554138e-01
+ <_>
+
+ 0 -1 1850 2.8667140752077103e-02
+
+ 5.0256967544555664e-01 6.9280272722244263e-01
+ <_>
+
+ 0 -1 1851 1.7019680142402649e-01
+
+ 4.9600529670715332e-01 1.4764429628849030e-01
+ <_>
+
+ 0 -1 1852 -3.2614478841423988e-03
+
+ 5.6030637025833130e-01 4.8260560631752014e-01
+ <_>
+
+ 0 -1 1853 5.5769277969375253e-04
+
+ 5.2055621147155762e-01 4.1296330094337463e-01
+ <_>
+
+ 0 -1 1854 3.6258339881896973e-01
+
+ 5.2216529846191406e-01 3.7686121463775635e-01
+ <_>
+
+ 0 -1 1855 -1.1615130119025707e-02
+
+ 6.0226827859878540e-01 4.6374899148941040e-01
+ <_>
+
+ 0 -1 1856 -4.0795197710394859e-03
+
+ 4.0704470872879028e-01 5.3374791145324707e-01
+ <_>
+
+ 0 -1 1857 5.7204300537705421e-04
+
+ 4.6018350124359131e-01 5.9003931283950806e-01
+ <_>
+
+ 0 -1 1858 6.7543348995968699e-04
+
+ 5.3982520103454590e-01 4.3454289436340332e-01
+ <_>
+
+ 0 -1 1859 6.3295697327703238e-04
+
+ 5.2015632390975952e-01 4.0513589978218079e-01
+ <_>
+
+ 0 -1 1860 1.2435320531949401e-03
+
+ 4.6423879265785217e-01 5.5474412441253662e-01
+ <_>
+
+ 0 -1 1861 -4.7363857738673687e-03
+
+ 6.1985671520233154e-01 4.6725520491600037e-01
+ <_>
+
+ 0 -1 1862 -6.4658462069928646e-03
+
+ 6.8373328447341919e-01 5.0190007686614990e-01
+ <_>
+
+ 0 -1 1863 3.5017321351915598e-04
+
+ 4.3448030948638916e-01 5.3636229038238525e-01
+ <_>
+
+ 0 -1 1864 1.5754920605104417e-04
+
+ 4.7600790858268738e-01 5.7320207357406616e-01
+ <_>
+
+ 0 -1 1865 9.9774366244673729e-03
+
+ 5.0909858942031860e-01 3.6350399255752563e-01
+ <_>
+
+ 0 -1 1866 -4.1464529931545258e-04
+
+ 5.5700647830963135e-01 4.5938020944595337e-01
+ <_>
+
+ 0 -1 1867 -3.5888899583369493e-04
+
+ 5.3568458557128906e-01 4.3391349911689758e-01
+ <_>
+
+ 0 -1 1868 4.0463250479660928e-04
+
+ 4.4398030638694763e-01 5.4367768764495850e-01
+ <_>
+
+ 0 -1 1869 -8.2184787606820464e-04
+
+ 4.0422949194908142e-01 5.1762992143630981e-01
+ <_>
+
+ 0 -1 1870 5.9467419050633907e-03
+
+ 4.9276518821716309e-01 5.6337797641754150e-01
+ <_>
+
+ 0 -1 1871 -2.1753389388322830e-02
+
+ 8.0062937736511230e-01 4.8008409142494202e-01
+ <_>
+
+ 0 -1 1872 -1.4540379866957664e-02
+
+ 3.9460548758506775e-01 5.1822227239608765e-01
+ <_>
+
+ 0 -1 1873 -4.0510769933462143e-02
+
+ 2.1324990317225456e-02 4.9357929825782776e-01
+ <_>
+
+ 0 -1 1874 -5.8458268176764250e-04
+
+ 4.0127959847450256e-01 5.3140252828598022e-01
+ <_>
+
+ 0 -1 1875 5.5151800625026226e-03
+
+ 4.6424189209938049e-01 5.8962607383728027e-01
+ <_>
+
+ 0 -1 1876 -6.0626221820712090e-03
+
+ 6.5021592378616333e-01 5.0164777040481567e-01
+ <_>
+
+ 0 -1 1877 9.4535842537879944e-02
+
+ 5.2647089958190918e-01 4.1268271207809448e-01
+ <_>
+
+ 0 -1 1878 4.7315051779150963e-03
+
+ 4.8791998624801636e-01 5.8924478292465210e-01
+ <_>
+
+ 0 -1 1879 -5.2571471314877272e-04
+
+ 3.9172801375389099e-01 5.1894128322601318e-01
+ <_>
+
+ 0 -1 1880 -2.5464049540460110e-03
+
+ 5.8375990390777588e-01 4.9857059121131897e-01
+ <_>
+
+ 0 -1 1881 -2.6075689122080803e-02
+
+ 1.2619839608669281e-01 4.9558219313621521e-01
+ <_>
+
+ 0 -1 1882 -5.4779709316790104e-03
+
+ 5.7225137948989868e-01 5.0102657079696655e-01
+ <_>
+
+ 0 -1 1883 5.1337741315364838e-03
+
+ 5.2732622623443604e-01 4.2263761162757874e-01
+ <_>
+
+ 0 -1 1884 4.7944980906322598e-04
+
+ 4.4500669836997986e-01 5.8195871114730835e-01
+ <_>
+
+ 0 -1 1885 -2.1114079281687737e-03
+
+ 5.7576531171798706e-01 4.5117148756980896e-01
+ <_>
+
+ 0 -1 1886 -1.3179990462958813e-02
+
+ 1.8843810260295868e-01 5.1607340574264526e-01
+ <_>
+
+ 0 -1 1887 -4.7968099825084209e-03
+
+ 6.5897899866104126e-01 4.7361189126968384e-01
+ <_>
+
+ 0 -1 1888 6.7483168095350266e-03
+
+ 5.2594298124313354e-01 3.3563950657844543e-01
+ <_>
+
+ 0 -1 1889 1.4623369788751006e-03
+
+ 5.3552711009979248e-01 4.2640921473503113e-01
+ <_>
+
+ 0 -1 1890 4.7645159065723419e-03
+
+ 5.0344067811965942e-01 5.7868278026580811e-01
+ <_>
+
+ 0 -1 1891 6.8066660314798355e-03
+
+ 4.7566050291061401e-01 6.6778290271759033e-01
+ <_>
+
+ 0 -1 1892 3.6608621012419462e-03
+
+ 5.3696119785308838e-01 4.3115469813346863e-01
+ <_>
+
+ 0 -1 1893 2.1449640393257141e-02
+
+ 4.9686419963836670e-01 1.8888160586357117e-01
+ <_>
+
+ 0 -1 1894 4.1678901761770248e-03
+
+ 4.9307331442832947e-01 5.8153688907623291e-01
+ <_>
+
+ 0 -1 1895 8.6467564105987549e-03
+
+ 5.2052050828933716e-01 4.1325950622558594e-01
+ <_>
+
+ 0 -1 1896 -3.6114078829996288e-04
+
+ 5.4835551977157593e-01 4.8009279370307922e-01
+ <_>
+
+ 0 -1 1897 1.0808729566633701e-03
+
+ 4.6899020671844482e-01 6.0414212942123413e-01
+ <_>
+
+ 0 -1 1898 5.7719959877431393e-03
+
+ 5.1711422204971313e-01 3.0532771348953247e-01
+ <_>
+
+ 0 -1 1899 1.5720770461484790e-03
+
+ 5.2199780941009521e-01 4.1788038611412048e-01
+ <_>
+
+ 0 -1 1900 -1.9307859474793077e-03
+
+ 5.8603698015213013e-01 4.8129200935363770e-01
+ <_>
+
+ 0 -1 1901 -7.8926272690296173e-03
+
+ 1.7492769658565521e-01 4.9717339873313904e-01
+ <_>
+
+ 0 -1 1902 -2.2224679123610258e-03
+
+ 4.3425890803337097e-01 5.2128481864929199e-01
+ <_>
+
+ 0 -1 1903 1.9011989934369922e-03
+
+ 4.7651869058609009e-01 6.8920552730560303e-01
+ <_>
+
+ 0 -1 1904 2.7576119173318148e-03
+
+ 5.2621912956237793e-01 4.3374860286712646e-01
+ <_>
+
+ 0 -1 1905 5.1787449046969414e-03
+
+ 4.8040691018104553e-01 7.8437292575836182e-01
+ <_>
+
+ 0 -1 1906 -9.0273341629654169e-04
+
+ 4.1208469867706299e-01 5.3534239530563354e-01
+ <_>
+
+ 0 -1 1907 5.1797959022223949e-03
+
+ 4.7403728961944580e-01 6.4259600639343262e-01
+ <_>
+
+ 0 -1 1908 -1.0114000178873539e-02
+
+ 2.4687920510768890e-01 5.1750177145004272e-01
+ <_>
+
+ 0 -1 1909 -1.8617060035467148e-02
+
+ 5.7562941312789917e-01 4.6289789676666260e-01
+ <_>
+
+ 0 -1 1910 5.9225959703326225e-03
+
+ 5.1696258783340454e-01 3.2142710685729980e-01
+ <_>
+
+ 0 -1 1911 -6.2945079989731312e-03
+
+ 3.8720148801803589e-01 5.1416367292404175e-01
+ <_>
+
+ 0 -1 1912 6.5353019163012505e-03
+
+ 4.8530489206314087e-01 6.3104897737503052e-01
+ <_>
+
+ 0 -1 1913 1.0878399480134249e-03
+
+ 5.1173150539398193e-01 3.7232589721679688e-01
+ <_>
+
+ 0 -1 1914 -2.2542240098118782e-02
+
+ 5.6927400827407837e-01 4.8871129751205444e-01
+ <_>
+
+ 0 -1 1915 -3.0065660830587149e-03
+
+ 2.5560128688812256e-01 5.0039929151535034e-01
+ <_>
+
+ 0 -1 1916 7.4741272255778313e-03
+
+ 4.8108729720115662e-01 5.6759268045425415e-01
+ <_>
+
+ 0 -1 1917 2.6162320747971535e-02
+
+ 4.9711948633193970e-01 1.7772370576858521e-01
+ <_>
+
+ 0 -1 1918 9.4352738233283162e-04
+
+ 4.9400109052658081e-01 5.4912507534027100e-01
+ <_>
+
+ 0 -1 1919 3.3363241702318192e-02
+
+ 5.0076121091842651e-01 2.7907240390777588e-01
+ <_>
+
+ 0 -1 1920 -1.5118650160729885e-02
+
+ 7.0595788955688477e-01 4.9730318784713745e-01
+ <_>
+
+ 0 -1 1921 9.8648946732282639e-04
+
+ 5.1286202669143677e-01 3.7767618894577026e-01
+ <_>
+ 213
+ 1.0576110076904297e+02
+
+ <_>
+
+ 0 -1 1922 -9.5150798559188843e-02
+
+ 6.4707571268081665e-01 4.0172868967056274e-01
+ <_>
+
+ 0 -1 1923 6.2702340073883533e-03
+
+ 3.9998221397399902e-01 5.7464492321014404e-01
+ <_>
+
+ 0 -1 1924 3.0018089455552399e-04
+
+ 3.5587701201438904e-01 5.5388098955154419e-01
+ <_>
+
+ 0 -1 1925 1.1757409665733576e-03
+
+ 4.2565348744392395e-01 5.3826177120208740e-01
+ <_>
+
+ 0 -1 1926 4.4235268433112651e-05
+
+ 3.6829081177711487e-01 5.5899268388748169e-01
+ <_>
+
+ 0 -1 1927 -2.9936920327600092e-05
+
+ 5.4524701833724976e-01 4.0203678607940674e-01
+ <_>
+
+ 0 -1 1928 3.0073199886828661e-03
+
+ 5.2390581369400024e-01 3.3178439736366272e-01
+ <_>
+
+ 0 -1 1929 -1.0513889603316784e-02
+
+ 4.3206891417503357e-01 5.3079837560653687e-01
+ <_>
+
+ 0 -1 1930 8.3476826548576355e-03
+
+ 4.5046371221542358e-01 6.4532989263534546e-01
+ <_>
+
+ 0 -1 1931 -3.1492270063608885e-03
+
+ 4.3134251236915588e-01 5.3705251216888428e-01
+ <_>
+
+ 0 -1 1932 -1.4435649973165710e-05
+
+ 5.3266030550003052e-01 3.8179719448089600e-01
+ <_>
+
+ 0 -1 1933 -4.2855090578086674e-04
+
+ 4.3051639199256897e-01 5.3820097446441650e-01
+ <_>
+
+ 0 -1 1934 1.5062429883982986e-04
+
+ 4.2359709739685059e-01 5.5449652671813965e-01
+ <_>
+
+ 0 -1 1935 7.1559831500053406e-02
+
+ 5.3030598163604736e-01 2.6788029074668884e-01
+ <_>
+
+ 0 -1 1936 8.4095180500298738e-04
+
+ 3.5571089386940002e-01 5.2054339647293091e-01
+ <_>
+
+ 0 -1 1937 6.2986500561237335e-02
+
+ 5.2253627777099609e-01 2.8613761067390442e-01
+ <_>
+
+ 0 -1 1938 -3.3798629883676767e-03
+
+ 3.6241859197616577e-01 5.2016979455947876e-01
+ <_>
+
+ 0 -1 1939 -1.1810739670181647e-04
+
+ 5.4744768142700195e-01 3.9598938822746277e-01
+ <_>
+
+ 0 -1 1940 -5.4505601292476058e-04
+
+ 3.7404221296310425e-01 5.2157157659530640e-01
+ <_>
+
+ 0 -1 1941 -1.8454910023137927e-03
+
+ 5.8930522203445435e-01 4.5844489336013794e-01
+ <_>
+
+ 0 -1 1942 -4.3832371011376381e-04
+
+ 4.0845820307731628e-01 5.3853511810302734e-01
+ <_>
+
+ 0 -1 1943 -2.4000830017030239e-03
+
+ 3.7774550914764404e-01 5.2935802936553955e-01
+ <_>
+
+ 0 -1 1944 -9.8795741796493530e-02
+
+ 2.9636120796203613e-01 5.0700891017913818e-01
+ <_>
+
+ 0 -1 1945 3.1798239797353745e-03
+
+ 4.8776328563690186e-01 6.7264437675476074e-01
+ <_>
+
+ 0 -1 1946 3.2406419632025063e-04
+
+ 4.3669110536575317e-01 5.5611097812652588e-01
+ <_>
+
+ 0 -1 1947 -3.2547250390052795e-02
+
+ 3.1281578540802002e-01 5.3086161613464355e-01
+ <_>
+
+ 0 -1 1948 -7.7561130747199059e-03
+
+ 6.5602248907089233e-01 4.6398720145225525e-01
+ <_>
+
+ 0 -1 1949 1.6027249395847321e-02
+
+ 5.1726800203323364e-01 3.1418979167938232e-01
+ <_>
+
+ 0 -1 1950 7.1002350523485802e-06
+
+ 4.0844461321830750e-01 5.3362947702407837e-01
+ <_>
+
+ 0 -1 1951 7.3422808200120926e-03
+
+ 4.9669221043586731e-01 6.6034650802612305e-01
+ <_>
+
+ 0 -1 1952 -1.6970280557870865e-03
+
+ 5.9082370996475220e-01 4.5001828670501709e-01
+ <_>
+
+ 0 -1 1953 2.4118260480463505e-03
+
+ 5.3151607513427734e-01 3.5997208952903748e-01
+ <_>
+
+ 0 -1 1954 -5.5300937965512276e-03
+
+ 2.3340409994125366e-01 4.9968141317367554e-01
+ <_>
+
+ 0 -1 1955 -2.6478730142116547e-03
+
+ 5.8809357881546021e-01 4.6847340464591980e-01
+ <_>
+
+ 0 -1 1956 1.1295629665255547e-02
+
+ 4.9837771058082581e-01 1.8845909833908081e-01
+ <_>
+
+ 0 -1 1957 -6.6952878842130303e-04
+
+ 5.8721381425857544e-01 4.7990199923515320e-01
+ <_>
+
+ 0 -1 1958 1.4410680159926414e-03
+
+ 5.1311892271041870e-01 3.5010111331939697e-01
+ <_>
+
+ 0 -1 1959 2.4637870956212282e-03
+
+ 5.3393721580505371e-01 4.1176390647888184e-01
+ <_>
+
+ 0 -1 1960 3.3114518737420440e-04
+
+ 4.3133831024169922e-01 5.3982460498809814e-01
+ <_>
+
+ 0 -1 1961 -3.3557269722223282e-02
+
+ 2.6753368973731995e-01 5.1791548728942871e-01
+ <_>
+
+ 0 -1 1962 1.8539419397711754e-02
+
+ 4.9738699197769165e-01 2.3171770572662354e-01
+ <_>
+
+ 0 -1 1963 -2.9698139405809343e-04
+
+ 5.5297082662582397e-01 4.6436640620231628e-01
+ <_>
+
+ 0 -1 1964 -4.5577259152196348e-04
+
+ 5.6295841932296753e-01 4.4691911339759827e-01
+ <_>
+
+ 0 -1 1965 -1.0158980265259743e-02
+
+ 6.7062127590179443e-01 4.9259188771247864e-01
+ <_>
+
+ 0 -1 1966 -2.2413829356082715e-05
+
+ 5.2394217252731323e-01 3.9129018783569336e-01
+ <_>
+
+ 0 -1 1967 7.2034963523037732e-05
+
+ 4.7994381189346313e-01 5.5017888545989990e-01
+ <_>
+
+ 0 -1 1968 -6.9267209619283676e-03
+
+ 6.9300097227096558e-01 4.6980848908424377e-01
+ <_>
+
+ 0 -1 1969 -7.6997838914394379e-03
+
+ 4.0996238589286804e-01 5.4808831214904785e-01
+ <_>
+
+ 0 -1 1970 -7.3130549862980843e-03
+
+ 3.2834759354591370e-01 5.0578862428665161e-01
+ <_>
+
+ 0 -1 1971 1.9650589674711227e-03
+
+ 4.9780470132827759e-01 6.3982498645782471e-01
+ <_>
+
+ 0 -1 1972 7.1647600270807743e-03
+
+ 4.6611601114273071e-01 6.2221372127532959e-01
+ <_>
+
+ 0 -1 1973 -2.4078639224171638e-02
+
+ 2.3346449434757233e-01 5.2221620082855225e-01
+ <_>
+
+ 0 -1 1974 -2.1027969196438789e-02
+
+ 1.1836539953947067e-01 4.9382260441780090e-01
+ <_>
+
+ 0 -1 1975 3.6017020465806127e-04
+
+ 5.3250199556350708e-01 4.1167110204696655e-01
+ <_>
+
+ 0 -1 1976 -1.7219729721546173e-02
+
+ 6.2787622213363647e-01 4.6642690896987915e-01
+ <_>
+
+ 0 -1 1977 -7.8672142699360847e-03
+
+ 3.4034150838851929e-01 5.2497369050979614e-01
+ <_>
+
+ 0 -1 1978 -4.4777389848604798e-04
+
+ 3.6104118824005127e-01 5.0862592458724976e-01
+ <_>
+
+ 0 -1 1979 5.5486010387539864e-03
+
+ 4.8842659592628479e-01 6.2034982442855835e-01
+ <_>
+
+ 0 -1 1980 -6.9461148232221603e-03
+
+ 2.6259300112724304e-01 5.0110971927642822e-01
+ <_>
+
+ 0 -1 1981 1.3569870498031378e-04
+
+ 4.3407949805259705e-01 5.6283122301101685e-01
+ <_>
+
+ 0 -1 1982 -4.5880250632762909e-02
+
+ 6.5079987049102783e-01 4.6962749958038330e-01
+ <_>
+
+ 0 -1 1983 -2.1582560613751411e-02
+
+ 3.8265028595924377e-01 5.2876168489456177e-01
+ <_>
+
+ 0 -1 1984 -2.0209539681673050e-02
+
+ 3.2333680987358093e-01 5.0744771957397461e-01
+ <_>
+
+ 0 -1 1985 5.8496710844337940e-03
+
+ 5.1776039600372314e-01 4.4896709918975830e-01
+ <_>
+
+ 0 -1 1986 -5.7476379879517481e-05
+
+ 4.0208509564399719e-01 5.2463638782501221e-01
+ <_>
+
+ 0 -1 1987 -1.1513100471347570e-03
+
+ 6.3150721788406372e-01 4.9051541090011597e-01
+ <_>
+
+ 0 -1 1988 1.9862831104546785e-03
+
+ 4.7024598717689514e-01 6.4971512556076050e-01
+ <_>
+
+ 0 -1 1989 -5.2719512023031712e-03
+
+ 3.6503839492797852e-01 5.2276527881622314e-01
+ <_>
+
+ 0 -1 1990 1.2662699446082115e-03
+
+ 5.1661008596420288e-01 3.8776180148124695e-01
+ <_>
+
+ 0 -1 1991 -6.2919440679252148e-03
+
+ 7.3758941888809204e-01 5.0238478183746338e-01
+ <_>
+
+ 0 -1 1992 6.7360111279413104e-04
+
+ 4.4232261180877686e-01 5.4955857992172241e-01
+ <_>
+
+ 0 -1 1993 -1.0523450328037143e-03
+
+ 5.9763962030410767e-01 4.8595830798149109e-01
+ <_>
+
+ 0 -1 1994 -4.4216238893568516e-04
+
+ 5.9559392929077148e-01 4.3989309668540955e-01
+ <_>
+
+ 0 -1 1995 1.1747940443456173e-03
+
+ 5.3498882055282593e-01 4.6050581336021423e-01
+ <_>
+
+ 0 -1 1996 5.2457437850534916e-03
+
+ 5.0491911172866821e-01 2.9415771365165710e-01
+ <_>
+
+ 0 -1 1997 -2.4539720267057419e-02
+
+ 2.5501778721809387e-01 5.2185869216918945e-01
+ <_>
+
+ 0 -1 1998 7.3793041519820690e-04
+
+ 4.4248610734939575e-01 5.4908162355422974e-01
+ <_>
+
+ 0 -1 1999 1.4233799884095788e-03
+
+ 5.3195142745971680e-01 4.0813559293746948e-01
+ <_>
+
+ 0 -1 2000 -2.4149110540747643e-03
+
+ 4.0876591205596924e-01 5.2389502525329590e-01
+ <_>
+
+ 0 -1 2001 -1.2165299849584699e-03
+
+ 5.6745791435241699e-01 4.9080529808998108e-01
+ <_>
+
+ 0 -1 2002 -1.2438809499144554e-03
+
+ 4.1294258832931519e-01 5.2561181783676147e-01
+ <_>
+
+ 0 -1 2003 6.1942739412188530e-03
+
+ 5.0601941347122192e-01 7.3136532306671143e-01
+ <_>
+
+ 0 -1 2004 -1.6607169527560472e-03
+
+ 5.9796321392059326e-01 4.5963698625564575e-01
+ <_>
+
+ 0 -1 2005 -2.7316259220242500e-02
+
+ 4.1743651032447815e-01 5.3088420629501343e-01
+ <_>
+
+ 0 -1 2006 -1.5845570014789701e-03
+
+ 5.6158047914505005e-01 4.5194861292839050e-01
+ <_>
+
+ 0 -1 2007 -1.5514739789068699e-03
+
+ 4.0761870145797729e-01 5.3607851266860962e-01
+ <_>
+
+ 0 -1 2008 3.8446558755822480e-04
+
+ 4.3472939729690552e-01 5.4304420948028564e-01
+ <_>
+
+ 0 -1 2009 -1.4672259800136089e-02
+
+ 1.6593049466609955e-01 5.1460939645767212e-01
+ <_>
+
+ 0 -1 2010 8.1608882173895836e-03
+
+ 4.9618190526962280e-01 1.8847459554672241e-01
+ <_>
+
+ 0 -1 2011 1.1121659772470593e-03
+
+ 4.8682639002799988e-01 6.0938161611557007e-01
+ <_>
+
+ 0 -1 2012 -7.2603770531713963e-03
+
+ 6.2843251228332520e-01 4.6903759241104126e-01
+ <_>
+
+ 0 -1 2013 -2.4046430189628154e-04
+
+ 5.5750000476837158e-01 4.0460440516471863e-01
+ <_>
+
+ 0 -1 2014 -2.3348190006799996e-04
+
+ 4.1157621145248413e-01 5.2528482675552368e-01
+ <_>
+
+ 0 -1 2015 5.5736480280756950e-03
+
+ 4.7300729155540466e-01 5.6901007890701294e-01
+ <_>
+
+ 0 -1 2016 3.0623769387602806e-02
+
+ 4.9718868732452393e-01 1.7400950193405151e-01
+ <_>
+
+ 0 -1 2017 9.2074798885732889e-04
+
+ 5.3721177577972412e-01 4.3548721075057983e-01
+ <_>
+
+ 0 -1 2018 -4.3550739064812660e-05
+
+ 5.3668838739395142e-01 4.3473169207572937e-01
+ <_>
+
+ 0 -1 2019 -6.6452710889279842e-03
+
+ 3.4355181455612183e-01 5.1605331897735596e-01
+ <_>
+
+ 0 -1 2020 4.3221998959779739e-02
+
+ 4.7667920589447021e-01 7.2936528921127319e-01
+ <_>
+
+ 0 -1 2021 2.2331769578158855e-03
+
+ 5.0293159484863281e-01 5.6331712007522583e-01
+ <_>
+
+ 0 -1 2022 3.1829739455133677e-03
+
+ 4.0160921216011047e-01 5.1921367645263672e-01
+ <_>
+
+ 0 -1 2023 -1.8027749320026487e-04
+
+ 4.0883159637451172e-01 5.4179197549819946e-01
+ <_>
+
+ 0 -1 2024 -5.2934689447283745e-03
+
+ 4.0756770968437195e-01 5.2435618638992310e-01
+ <_>
+
+ 0 -1 2025 1.2750959722325206e-03
+
+ 4.9132829904556274e-01 6.3870108127593994e-01
+ <_>
+
+ 0 -1 2026 4.3385322205722332e-03
+
+ 5.0316721200942993e-01 2.9473468661308289e-01
+ <_>
+
+ 0 -1 2027 8.5250744596123695e-03
+
+ 4.9497890472412109e-01 6.3088691234588623e-01
+ <_>
+
+ 0 -1 2028 -9.4266352243721485e-04
+
+ 5.3283667564392090e-01 4.2856499552726746e-01
+ <_>
+
+ 0 -1 2029 1.3609660090878606e-03
+
+ 4.9915251135826111e-01 5.9415012598037720e-01
+ <_>
+
+ 0 -1 2030 4.4782509212382138e-04
+
+ 4.5735040307044983e-01 5.8544808626174927e-01
+ <_>
+
+ 0 -1 2031 1.3360050506889820e-03
+
+ 4.6043589711189270e-01 5.8490520715713501e-01
+ <_>
+
+ 0 -1 2032 -6.0967548051849008e-04
+
+ 3.9693889021873474e-01 5.2294230461120605e-01
+ <_>
+
+ 0 -1 2033 -2.3656780831515789e-03
+
+ 5.8083200454711914e-01 4.8983570933341980e-01
+ <_>
+
+ 0 -1 2034 1.0734340175986290e-03
+
+ 4.3512108922004700e-01 5.4700392484664917e-01
+ <_>
+
+ 0 -1 2035 2.1923359017819166e-03
+
+ 5.3550601005554199e-01 3.8429039716720581e-01
+ <_>
+
+ 0 -1 2036 5.4968618787825108e-03
+
+ 5.0181388854980469e-01 2.8271919488906860e-01
+ <_>
+
+ 0 -1 2037 -7.5368821620941162e-02
+
+ 1.2250760197639465e-01 5.1488268375396729e-01
+ <_>
+
+ 0 -1 2038 2.5134470313787460e-02
+
+ 4.7317668795585632e-01 7.0254462957382202e-01
+ <_>
+
+ 0 -1 2039 -2.9358599931583740e-05
+
+ 5.4305320978164673e-01 4.6560868620872498e-01
+ <_>
+
+ 0 -1 2040 -5.8355910005047917e-04
+
+ 4.0310400724411011e-01 5.1901197433471680e-01
+ <_>
+
+ 0 -1 2041 -2.6639450807124376e-03
+
+ 4.3081268668174744e-01 5.1617711782455444e-01
+ <_>
+
+ 0 -1 2042 -1.3804089976474643e-03
+
+ 6.2198299169540405e-01 4.6955159306526184e-01
+ <_>
+
+ 0 -1 2043 1.2313219485804439e-03
+
+ 5.3793638944625854e-01 4.4258311390876770e-01
+ <_>
+
+ 0 -1 2044 -1.4644179827882908e-05
+
+ 5.2816402912139893e-01 4.2225030064582825e-01
+ <_>
+
+ 0 -1 2045 -1.2818809598684311e-02
+
+ 2.5820928812026978e-01 5.1799327135086060e-01
+ <_>
+
+ 0 -1 2046 2.2852189838886261e-02
+
+ 4.7786930203437805e-01 7.6092642545700073e-01
+ <_>
+
+ 0 -1 2047 8.2305970136076212e-04
+
+ 5.3409922122955322e-01 4.6717241406440735e-01
+ <_>
+
+ 0 -1 2048 1.2770120054483414e-02
+
+ 4.9657610058784485e-01 1.4723660051822662e-01
+ <_>
+
+ 0 -1 2049 -5.0051510334014893e-02
+
+ 6.4149940013885498e-01 5.0165921449661255e-01
+ <_>
+
+ 0 -1 2050 1.5775270760059357e-02
+
+ 4.5223200321197510e-01 5.6853622198104858e-01
+ <_>
+
+ 0 -1 2051 -1.8501620739698410e-02
+
+ 2.7647489309310913e-01 5.1379591226577759e-01
+ <_>
+
+ 0 -1 2052 2.4626250378787518e-03
+
+ 5.1419419050216675e-01 3.7954080104827881e-01
+ <_>
+
+ 0 -1 2053 6.2916167080402374e-02
+
+ 5.0606489181518555e-01 6.5804338455200195e-01
+ <_>
+
+ 0 -1 2054 -2.1648500478477217e-05
+
+ 5.1953881978988647e-01 4.0198868513107300e-01
+ <_>
+
+ 0 -1 2055 2.1180990152060986e-03
+
+ 4.9623650312423706e-01 5.9544587135314941e-01
+ <_>
+
+ 0 -1 2056 -1.6634890809655190e-02
+
+ 3.7579330801963806e-01 5.1754468679428101e-01
+ <_>
+
+ 0 -1 2057 -2.8899470344185829e-03
+
+ 6.6240137815475464e-01 5.0571787357330322e-01
+ <_>
+
+ 0 -1 2058 7.6783262193202972e-02
+
+ 4.7957968711853027e-01 8.0477148294448853e-01
+ <_>
+
+ 0 -1 2059 3.9170677773654461e-03
+
+ 4.9378821253776550e-01 5.7199418544769287e-01
+ <_>
+
+ 0 -1 2060 -7.2670601308345795e-02
+
+ 5.3894560784101486e-02 4.9439039826393127e-01
+ <_>
+
+ 0 -1 2061 5.4039502143859863e-01
+
+ 5.1297742128372192e-01 1.1433389782905579e-01
+ <_>
+
+ 0 -1 2062 2.9510019812732935e-03
+
+ 4.5283439755439758e-01 5.6985741853713989e-01
+ <_>
+
+ 0 -1 2063 3.4508369863033295e-03
+
+ 5.3577268123626709e-01 4.2187309265136719e-01
+ <_>
+
+ 0 -1 2064 -4.2077939724549651e-04
+
+ 5.9161728620529175e-01 4.6379259228706360e-01
+ <_>
+
+ 0 -1 2065 3.3051050268113613e-03
+
+ 5.2733850479125977e-01 4.3820428848266602e-01
+ <_>
+
+ 0 -1 2066 4.7735060798004270e-04
+
+ 4.0465280413627625e-01 5.1818847656250000e-01
+ <_>
+
+ 0 -1 2067 -2.5928510352969170e-02
+
+ 7.4522358179092407e-01 5.0893861055374146e-01
+ <_>
+
+ 0 -1 2068 -2.9729790985584259e-03
+
+ 3.2954359054565430e-01 5.0587952136993408e-01
+ <_>
+
+ 0 -1 2069 5.8508329093456268e-03
+
+ 4.8571440577507019e-01 5.7930248975753784e-01
+ <_>
+
+ 0 -1 2070 -4.5967519283294678e-02
+
+ 4.3127310276031494e-01 5.3806531429290771e-01
+ <_>
+
+ 0 -1 2071 1.5585960447788239e-01
+
+ 5.1961702108383179e-01 1.6847139596939087e-01
+ <_>
+
+ 0 -1 2072 1.5164829790592194e-02
+
+ 4.7357571125030518e-01 6.7350268363952637e-01
+ <_>
+
+ 0 -1 2073 -1.0604249546304345e-03
+
+ 5.8229267597198486e-01 4.7757029533386230e-01
+ <_>
+
+ 0 -1 2074 6.6476291976869106e-03
+
+ 4.9991989135742188e-01 2.3195350170135498e-01
+ <_>
+
+ 0 -1 2075 -1.2231130152940750e-02
+
+ 4.7508931159973145e-01 5.2629822492599487e-01
+ <_>
+
+ 0 -1 2076 5.6528882123529911e-03
+
+ 5.0697678327560425e-01 3.5618188977241516e-01
+ <_>
+
+ 0 -1 2077 1.2977829901501536e-03
+
+ 4.8756939172744751e-01 5.6190627813339233e-01
+ <_>
+
+ 0 -1 2078 1.0781589895486832e-02
+
+ 4.7507700324058533e-01 6.7823082208633423e-01
+ <_>
+
+ 0 -1 2079 2.8654779307544231e-03
+
+ 5.3054618835449219e-01 4.2907360196113586e-01
+ <_>
+
+ 0 -1 2080 2.8663428965955973e-03
+
+ 4.5184791088104248e-01 5.5393511056900024e-01
+ <_>
+
+ 0 -1 2081 -5.1983320154249668e-03
+
+ 4.1491198539733887e-01 5.4341888427734375e-01
+ <_>
+
+ 0 -1 2082 5.3739990107715130e-03
+
+ 4.7178968787193298e-01 6.5076571702957153e-01
+ <_>
+
+ 0 -1 2083 -1.4641529880464077e-02
+
+ 2.1721640229225159e-01 5.1617771387100220e-01
+ <_>
+
+ 0 -1 2084 -1.5042580344015732e-05
+
+ 5.3373837471008301e-01 4.2988368868827820e-01
+ <_>
+
+ 0 -1 2085 -1.1875660129589960e-04
+
+ 4.6045941114425659e-01 5.5824470520019531e-01
+ <_>
+
+ 0 -1 2086 1.6995530575513840e-02
+
+ 4.9458950757980347e-01 7.3880076408386230e-02
+ <_>
+
+ 0 -1 2087 -3.5095941275358200e-02
+
+ 7.0055091381072998e-01 4.9775910377502441e-01
+ <_>
+
+ 0 -1 2088 2.4217350874096155e-03
+
+ 4.4662651419639587e-01 5.4776942729949951e-01
+ <_>
+
+ 0 -1 2089 -9.6340337768197060e-04
+
+ 4.7140988707542419e-01 5.3133380413055420e-01
+ <_>
+
+ 0 -1 2090 1.6391130338888615e-04
+
+ 4.3315461277961731e-01 5.3422421216964722e-01
+ <_>
+
+ 0 -1 2091 -2.1141460165381432e-02
+
+ 2.6447001099586487e-01 5.2044987678527832e-01
+ <_>
+
+ 0 -1 2092 8.7775202700868249e-04
+
+ 5.2083498239517212e-01 4.1527429223060608e-01
+ <_>
+
+ 0 -1 2093 -2.7943920344114304e-02
+
+ 6.3441252708435059e-01 5.0188118219375610e-01
+ <_>
+
+ 0 -1 2094 6.7297378554940224e-03
+
+ 5.0504380464553833e-01 3.5008639097213745e-01
+ <_>
+
+ 0 -1 2095 2.3281039670109749e-02
+
+ 4.9663180112838745e-01 6.9686770439147949e-01
+ <_>
+
+ 0 -1 2096 -1.1644979938864708e-02
+
+ 3.3002600073814392e-01 5.0496298074722290e-01
+ <_>
+
+ 0 -1 2097 1.5764309093356133e-02
+
+ 4.9915981292724609e-01 7.3211538791656494e-01
+ <_>
+
+ 0 -1 2098 -1.3611479662358761e-03
+
+ 3.9117351174354553e-01 5.1606708765029907e-01
+ <_>
+
+ 0 -1 2099 -8.1522337859496474e-04
+
+ 5.6289112567901611e-01 4.9497190117835999e-01
+ <_>
+
+ 0 -1 2100 -6.0066272271797061e-04
+
+ 5.8535951375961304e-01 4.5505958795547485e-01
+ <_>
+
+ 0 -1 2101 4.9715518252924085e-04
+
+ 4.2714700102806091e-01 5.4435992240905762e-01
+ <_>
+
+ 0 -1 2102 2.3475370835512877e-03
+
+ 5.1431107521057129e-01 3.8876569271087646e-01
+ <_>
+
+ 0 -1 2103 -8.9261569082736969e-03
+
+ 6.0445022583007812e-01 4.9717208743095398e-01
+ <_>
+
+ 0 -1 2104 -1.3919910416007042e-02
+
+ 2.5831609964370728e-01 5.0003677606582642e-01
+ <_>
+
+ 0 -1 2105 1.0209949687123299e-03
+
+ 4.8573741316795349e-01 5.5603581666946411e-01
+ <_>
+
+ 0 -1 2106 -2.7441629208624363e-03
+
+ 5.9368848800659180e-01 4.6457770466804504e-01
+ <_>
+
+ 0 -1 2107 -1.6200130805373192e-02
+
+ 3.1630149483680725e-01 5.1934951543807983e-01
+ <_>
+
+ 0 -1 2108 4.3331980705261230e-03
+
+ 5.0612241029739380e-01 3.4588789939880371e-01
+ <_>
+
+ 0 -1 2109 5.8497930876910686e-04
+
+ 4.7790178656578064e-01 5.8701777458190918e-01
+ <_>
+
+ 0 -1 2110 -2.2466450463980436e-03
+
+ 4.2978510260581970e-01 5.3747731447219849e-01
+ <_>
+
+ 0 -1 2111 2.3146099410951138e-03
+
+ 5.4386717081069946e-01 4.6409699320793152e-01
+ <_>
+
+ 0 -1 2112 8.7679121643304825e-03
+
+ 4.7268930077552795e-01 6.7717897891998291e-01
+ <_>
+
+ 0 -1 2113 -2.2448020172305405e-04
+
+ 4.2291730642318726e-01 5.4280489683151245e-01
+ <_>
+
+ 0 -1 2114 -7.4336021207273006e-03
+
+ 6.0988807678222656e-01 4.6836739778518677e-01
+ <_>
+
+ 0 -1 2115 -2.3189240600913763e-03
+
+ 5.6894367933273315e-01 4.4242420792579651e-01
+ <_>
+
+ 0 -1 2116 -2.1042178850620985e-03
+
+ 3.7622210383415222e-01 5.1870870590209961e-01
+ <_>
+
+ 0 -1 2117 4.6034841216169298e-04
+
+ 4.6994051337242126e-01 5.7712072134017944e-01
+ <_>
+
+ 0 -1 2118 1.0547629790380597e-03
+
+ 4.4652169942855835e-01 5.6017017364501953e-01
+ <_>
+
+ 0 -1 2119 8.7148818420246243e-04
+
+ 5.4498052597045898e-01 3.9147090911865234e-01
+ <_>
+
+ 0 -1 2120 3.3364820410497487e-04
+
+ 4.5640090107917786e-01 5.6457388401031494e-01
+ <_>
+
+ 0 -1 2121 -1.4853250468149781e-03
+
+ 5.7473778724670410e-01 4.6927788853645325e-01
+ <_>
+
+ 0 -1 2122 3.0251620337367058e-03
+
+ 5.1661968231201172e-01 3.7628141045570374e-01
+ <_>
+
+ 0 -1 2123 5.0280741415917873e-03
+
+ 5.0021117925643921e-01 6.1515271663665771e-01
+ <_>
+
+ 0 -1 2124 -5.8164511574432254e-04
+
+ 5.3945982456207275e-01 4.3907511234283447e-01
+ <_>
+
+ 0 -1 2125 4.5141529291868210e-02
+
+ 5.1883268356323242e-01 2.0630359649658203e-01
+ <_>
+
+ 0 -1 2126 -1.0795620037242770e-03
+
+ 3.9046850800514221e-01 5.1379072666168213e-01
+ <_>
+
+ 0 -1 2127 1.5995999274309725e-04
+
+ 4.8953229188919067e-01 5.4275041818618774e-01
+ <_>
+
+ 0 -1 2128 -1.9359270110726357e-02
+
+ 6.9752287864685059e-01 4.7735071182250977e-01
+ <_>
+
+ 0 -1 2129 2.0725509524345398e-01
+
+ 5.2336359024047852e-01 3.0349919199943542e-01
+ <_>
+
+ 0 -1 2130 -4.1953290929086506e-04
+
+ 5.4193967580795288e-01 4.4601860642433167e-01
+ <_>
+
+ 0 -1 2131 2.2582069505006075e-03
+
+ 4.8157641291618347e-01 6.0274088382720947e-01
+ <_>
+
+ 0 -1 2132 -6.7811207845807076e-03
+
+ 3.9802789688110352e-01 5.1833057403564453e-01
+ <_>
+
+ 0 -1 2133 1.1154309846460819e-02
+
+ 5.4312318563461304e-01 4.1887599229812622e-01
+ <_>
+
+ 0 -1 2134 4.3162431567907333e-02
+
+ 4.7382280230522156e-01 6.5229612588882446e-01
+
+ <_>
+
+ <_>
+ 3 7 14 4 -1.
+ <_>
+ 3 9 14 2 2.
+ <_>
+
+ <_>
+ 1 2 18 4 -1.
+ <_>
+ 7 2 6 4 3.
+ <_>
+
+ <_>
+ 1 7 15 9 -1.
+ <_>
+ 1 10 15 3 3.
+ <_>
+
+ <_>
+ 5 6 2 6 -1.
+ <_>
+ 5 9 2 3 2.
+ <_>
+
+ <_>
+ 7 5 6 3 -1.
+ <_>
+ 9 5 2 3 3.
+ <_>
+
+ <_>
+ 4 0 12 9 -1.
+ <_>
+ 4 3 12 3 3.
+ <_>
+
+ <_>
+ 6 9 10 8 -1.
+ <_>
+ 6 13 10 4 2.
+ <_>
+
+ <_>
+ 3 6 14 8 -1.
+ <_>
+ 3 10 14 4 2.
+ <_>
+
+ <_>
+ 14 1 6 10 -1.
+ <_>
+ 14 1 3 10 2.
+ <_>
+
+ <_>
+ 7 8 5 12 -1.
+ <_>
+ 7 12 5 4 3.
+ <_>
+
+ <_>
+ 1 1 18 3 -1.
+ <_>
+ 7 1 6 3 3.
+ <_>
+
+ <_>
+ 1 8 17 2 -1.
+ <_>
+ 1 9 17 1 2.
+ <_>
+
+ <_>
+ 16 6 4 2 -1.
+ <_>
+ 16 7 4 1 2.
+ <_>
+
+ <_>
+ 5 17 2 2 -1.
+ <_>
+ 5 18 2 1 2.
+ <_>
+
+ <_>
+ 14 2 6 12 -1.
+ <_>
+ 14 2 3 12 2.
+ <_>
+
+ <_>
+ 4 0 4 12 -1.
+ <_>
+ 4 0 2 6 2.
+ <_>
+ 6 6 2 6 2.
+ <_>
+
+ <_>
+ 2 11 18 8 -1.
+ <_>
+ 8 11 6 8 3.
+ <_>
+
+ <_>
+ 5 7 10 2 -1.
+ <_>
+ 5 8 10 1 2.
+ <_>
+
+ <_>
+ 15 11 5 3 -1.
+ <_>
+ 15 12 5 1 3.
+ <_>
+
+ <_>
+ 5 3 10 9 -1.
+ <_>
+ 5 6 10 3 3.
+ <_>
+
+ <_>
+ 9 4 2 14 -1.
+ <_>
+ 9 11 2 7 2.
+ <_>
+
+ <_>
+ 3 5 4 12 -1.
+ <_>
+ 3 9 4 4 3.
+ <_>
+
+ <_>
+ 4 5 12 5 -1.
+ <_>
+ 8 5 4 5 3.
+ <_>
+
+ <_>
+ 5 6 10 8 -1.
+ <_>
+ 5 10 10 4 2.
+ <_>
+
+ <_>
+ 8 0 6 9 -1.
+ <_>
+ 8 3 6 3 3.
+ <_>
+
+ <_>
+ 9 12 1 8 -1.
+ <_>
+ 9 16 1 4 2.
+ <_>
+
+ <_>
+ 0 7 20 6 -1.
+ <_>
+ 0 9 20 2 3.
+ <_>
+
+ <_>
+ 7 0 6 17 -1.
+ <_>
+ 9 0 2 17 3.
+ <_>
+
+ <_>
+ 9 0 6 4 -1.
+ <_>
+ 11 0 2 4 3.
+ <_>
+
+ <_>
+ 5 1 6 4 -1.
+ <_>
+ 7 1 2 4 3.
+ <_>
+
+ <_>
+ 12 1 6 16 -1.
+ <_>
+ 14 1 2 16 3.
+ <_>
+
+ <_>
+ 0 5 18 8 -1.
+ <_>
+ 0 5 9 4 2.
+ <_>
+ 9 9 9 4 2.
+ <_>
+
+ <_>
+ 8 15 10 4 -1.
+ <_>
+ 13 15 5 2 2.
+ <_>
+ 8 17 5 2 2.
+ <_>
+
+ <_>
+ 3 1 4 8 -1.
+ <_>
+ 3 1 2 4 2.
+ <_>
+ 5 5 2 4 2.
+ <_>
+
+ <_>
+ 3 6 14 10 -1.
+ <_>
+ 10 6 7 5 2.
+ <_>
+ 3 11 7 5 2.
+ <_>
+
+ <_>
+ 2 1 6 16 -1.
+ <_>
+ 4 1 2 16 3.
+ <_>
+
+ <_>
+ 0 18 20 2 -1.
+ <_>
+ 0 19 20 1 2.
+ <_>
+
+ <_>
+ 8 13 4 3 -1.
+ <_>
+ 8 14 4 1 3.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 0 12 9 6 -1.
+ <_>
+ 0 14 9 2 3.
+ <_>
+
+ <_>
+ 5 7 3 4 -1.
+ <_>
+ 5 9 3 2 2.
+ <_>
+
+ <_>
+ 9 3 2 16 -1.
+ <_>
+ 9 11 2 8 2.
+ <_>
+
+ <_>
+ 3 6 13 8 -1.
+ <_>
+ 3 10 13 4 2.
+ <_>
+
+ <_>
+ 12 3 8 2 -1.
+ <_>
+ 12 3 4 2 2.
+ <_>
+
+ <_>
+ 8 8 4 12 -1.
+ <_>
+ 8 12 4 4 3.
+ <_>
+
+ <_>
+ 11 3 8 6 -1.
+ <_>
+ 15 3 4 3 2.
+ <_>
+ 11 6 4 3 2.
+ <_>
+
+ <_>
+ 7 1 6 19 -1.
+ <_>
+ 9 1 2 19 3.
+ <_>
+
+ <_>
+ 9 0 6 4 -1.
+ <_>
+ 11 0 2 4 3.
+ <_>
+
+ <_>
+ 3 1 9 3 -1.
+ <_>
+ 6 1 3 3 3.
+ <_>
+
+ <_>
+ 8 15 10 4 -1.
+ <_>
+ 13 15 5 2 2.
+ <_>
+ 8 17 5 2 2.
+ <_>
+
+ <_>
+ 0 3 6 10 -1.
+ <_>
+ 3 3 3 10 2.
+ <_>
+
+ <_>
+ 3 4 15 15 -1.
+ <_>
+ 3 9 15 5 3.
+ <_>
+
+ <_>
+ 6 5 8 6 -1.
+ <_>
+ 6 7 8 2 3.
+ <_>
+
+ <_>
+ 4 4 12 10 -1.
+ <_>
+ 10 4 6 5 2.
+ <_>
+ 4 9 6 5 2.
+ <_>
+
+ <_>
+ 6 4 4 4 -1.
+ <_>
+ 8 4 2 4 2.
+ <_>
+
+ <_>
+ 15 11 1 2 -1.
+ <_>
+ 15 12 1 1 2.
+ <_>
+
+ <_>
+ 3 11 2 2 -1.
+ <_>
+ 3 12 2 1 2.
+ <_>
+
+ <_>
+ 16 11 1 3 -1.
+ <_>
+ 16 12 1 1 3.
+ <_>
+
+ <_>
+ 3 15 6 4 -1.
+ <_>
+ 3 15 3 2 2.
+ <_>
+ 6 17 3 2 2.
+ <_>
+
+ <_>
+ 6 7 8 2 -1.
+ <_>
+ 6 8 8 1 2.
+ <_>
+
+ <_>
+ 3 11 1 3 -1.
+ <_>
+ 3 12 1 1 3.
+ <_>
+
+ <_>
+ 6 0 12 2 -1.
+ <_>
+ 6 1 12 1 2.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 7 15 6 2 -1.
+ <_>
+ 7 16 6 1 2.
+ <_>
+
+ <_>
+ 0 5 4 6 -1.
+ <_>
+ 0 7 4 2 3.
+ <_>
+
+ <_>
+ 4 12 12 2 -1.
+ <_>
+ 8 12 4 2 3.
+ <_>
+
+ <_>
+ 6 3 1 9 -1.
+ <_>
+ 6 6 1 3 3.
+ <_>
+
+ <_>
+ 10 17 3 2 -1.
+ <_>
+ 11 17 1 2 3.
+ <_>
+
+ <_>
+ 9 9 2 2 -1.
+ <_>
+ 9 10 2 1 2.
+ <_>
+
+ <_>
+ 7 6 6 4 -1.
+ <_>
+ 9 6 2 4 3.
+ <_>
+
+ <_>
+ 7 17 3 2 -1.
+ <_>
+ 8 17 1 2 3.
+ <_>
+
+ <_>
+ 10 17 3 3 -1.
+ <_>
+ 11 17 1 3 3.
+ <_>
+
+ <_>
+ 8 12 3 2 -1.
+ <_>
+ 8 13 3 1 2.
+ <_>
+
+ <_>
+ 9 3 6 2 -1.
+ <_>
+ 11 3 2 2 3.
+ <_>
+
+ <_>
+ 3 11 14 4 -1.
+ <_>
+ 3 13 14 2 2.
+ <_>
+
+ <_>
+ 1 10 18 4 -1.
+ <_>
+ 10 10 9 2 2.
+ <_>
+ 1 12 9 2 2.
+ <_>
+
+ <_>
+ 0 10 3 3 -1.
+ <_>
+ 0 11 3 1 3.
+ <_>
+
+ <_>
+ 9 1 6 6 -1.
+ <_>
+ 11 1 2 6 3.
+ <_>
+
+ <_>
+ 8 7 3 6 -1.
+ <_>
+ 9 7 1 6 3.
+ <_>
+
+ <_>
+ 1 0 18 9 -1.
+ <_>
+ 1 3 18 3 3.
+ <_>
+
+ <_>
+ 12 10 2 6 -1.
+ <_>
+ 12 13 2 3 2.
+ <_>
+
+ <_>
+ 0 5 19 8 -1.
+ <_>
+ 0 9 19 4 2.
+ <_>
+
+ <_>
+ 7 0 6 9 -1.
+ <_>
+ 9 0 2 9 3.
+ <_>
+
+ <_>
+ 5 3 6 1 -1.
+ <_>
+ 7 3 2 1 3.
+ <_>
+
+ <_>
+ 11 3 6 1 -1.
+ <_>
+ 13 3 2 1 3.
+ <_>
+
+ <_>
+ 5 10 4 6 -1.
+ <_>
+ 5 13 4 3 2.
+ <_>
+
+ <_>
+ 11 3 6 1 -1.
+ <_>
+ 13 3 2 1 3.
+ <_>
+
+ <_>
+ 4 4 12 6 -1.
+ <_>
+ 4 6 12 2 3.
+ <_>
+
+ <_>
+ 15 12 2 6 -1.
+ <_>
+ 15 14 2 2 3.
+ <_>
+
+ <_>
+ 9 3 2 2 -1.
+ <_>
+ 10 3 1 2 2.
+ <_>
+
+ <_>
+ 9 3 3 1 -1.
+ <_>
+ 10 3 1 1 3.
+ <_>
+
+ <_>
+ 1 1 4 14 -1.
+ <_>
+ 3 1 2 14 2.
+ <_>
+
+ <_>
+ 9 0 4 4 -1.
+ <_>
+ 11 0 2 2 2.
+ <_>
+ 9 2 2 2 2.
+ <_>
+
+ <_>
+ 7 5 1 14 -1.
+ <_>
+ 7 12 1 7 2.
+ <_>
+
+ <_>
+ 19 0 1 4 -1.
+ <_>
+ 19 2 1 2 2.
+ <_>
+
+ <_>
+ 5 5 6 4 -1.
+ <_>
+ 8 5 3 4 2.
+ <_>
+
+ <_>
+ 9 18 3 2 -1.
+ <_>
+ 10 18 1 2 3.
+ <_>
+
+ <_>
+ 8 18 3 2 -1.
+ <_>
+ 9 18 1 2 3.
+ <_>
+
+ <_>
+ 4 5 12 6 -1.
+ <_>
+ 4 7 12 2 3.
+ <_>
+
+ <_>
+ 3 12 2 6 -1.
+ <_>
+ 3 14 2 2 3.
+ <_>
+
+ <_>
+ 10 8 2 12 -1.
+ <_>
+ 10 12 2 4 3.
+ <_>
+
+ <_>
+ 7 18 3 2 -1.
+ <_>
+ 8 18 1 2 3.
+ <_>
+
+ <_>
+ 9 0 6 2 -1.
+ <_>
+ 11 0 2 2 3.
+ <_>
+
+ <_>
+ 5 11 9 3 -1.
+ <_>
+ 5 12 9 1 3.
+ <_>
+
+ <_>
+ 9 0 6 2 -1.
+ <_>
+ 11 0 2 2 3.
+ <_>
+
+ <_>
+ 1 1 18 5 -1.
+ <_>
+ 7 1 6 5 3.
+ <_>
+
+ <_>
+ 8 0 4 4 -1.
+ <_>
+ 10 0 2 2 2.
+ <_>
+ 8 2 2 2 2.
+ <_>
+
+ <_>
+ 3 12 1 3 -1.
+ <_>
+ 3 13 1 1 3.
+ <_>
+
+ <_>
+ 8 14 5 3 -1.
+ <_>
+ 8 15 5 1 3.
+ <_>
+
+ <_>
+ 5 4 10 12 -1.
+ <_>
+ 5 4 5 6 2.
+ <_>
+ 10 10 5 6 2.
+ <_>
+
+ <_>
+ 9 6 9 12 -1.
+ <_>
+ 9 10 9 4 3.
+ <_>
+
+ <_>
+ 2 2 12 14 -1.
+ <_>
+ 2 2 6 7 2.
+ <_>
+ 8 9 6 7 2.
+ <_>
+
+ <_>
+ 4 7 12 2 -1.
+ <_>
+ 8 7 4 2 3.
+ <_>
+
+ <_>
+ 7 4 6 4 -1.
+ <_>
+ 7 6 6 2 2.
+ <_>
+
+ <_>
+ 4 5 11 8 -1.
+ <_>
+ 4 9 11 4 2.
+ <_>
+
+ <_>
+ 3 10 16 4 -1.
+ <_>
+ 3 12 16 2 2.
+ <_>
+
+ <_>
+ 0 0 16 2 -1.
+ <_>
+ 0 1 16 1 2.
+ <_>
+
+ <_>
+ 7 5 6 2 -1.
+ <_>
+ 9 5 2 2 3.
+ <_>
+
+ <_>
+ 3 2 6 10 -1.
+ <_>
+ 3 2 3 5 2.
+ <_>
+ 6 7 3 5 2.
+ <_>
+
+ <_>
+ 10 5 8 15 -1.
+ <_>
+ 10 10 8 5 3.
+ <_>
+
+ <_>
+ 3 14 8 6 -1.
+ <_>
+ 3 14 4 3 2.
+ <_>
+ 7 17 4 3 2.
+ <_>
+
+ <_>
+ 14 2 2 2 -1.
+ <_>
+ 14 3 2 1 2.
+ <_>
+
+ <_>
+ 1 10 7 6 -1.
+ <_>
+ 1 13 7 3 2.
+ <_>
+
+ <_>
+ 15 4 4 3 -1.
+ <_>
+ 15 4 2 3 2.
+ <_>
+
+ <_>
+ 2 9 14 6 -1.
+ <_>
+ 2 9 7 3 2.
+ <_>
+ 9 12 7 3 2.
+ <_>
+
+ <_>
+ 5 7 10 4 -1.
+ <_>
+ 5 9 10 2 2.
+ <_>
+
+ <_>
+ 6 9 8 8 -1.
+ <_>
+ 6 9 4 4 2.
+ <_>
+ 10 13 4 4 2.
+ <_>
+
+ <_>
+ 14 1 3 2 -1.
+ <_>
+ 14 2 3 1 2.
+ <_>
+
+ <_>
+ 1 4 4 2 -1.
+ <_>
+ 3 4 2 2 2.
+ <_>
+
+ <_>
+ 11 10 2 8 -1.
+ <_>
+ 11 14 2 4 2.
+ <_>
+
+ <_>
+ 0 0 5 3 -1.
+ <_>
+ 0 1 5 1 3.
+ <_>
+
+ <_>
+ 2 5 18 8 -1.
+ <_>
+ 11 5 9 4 2.
+ <_>
+ 2 9 9 4 2.
+ <_>
+
+ <_>
+ 6 6 1 6 -1.
+ <_>
+ 6 9 1 3 2.
+ <_>
+
+ <_>
+ 19 1 1 3 -1.
+ <_>
+ 19 2 1 1 3.
+ <_>
+
+ <_>
+ 7 6 6 6 -1.
+ <_>
+ 9 6 2 6 3.
+ <_>
+
+ <_>
+ 19 1 1 3 -1.
+ <_>
+ 19 2 1 1 3.
+ <_>
+
+ <_>
+ 3 13 2 3 -1.
+ <_>
+ 3 14 2 1 3.
+ <_>
+
+ <_>
+ 8 4 8 12 -1.
+ <_>
+ 12 4 4 6 2.
+ <_>
+ 8 10 4 6 2.
+ <_>
+
+ <_>
+ 5 2 6 3 -1.
+ <_>
+ 7 2 2 3 3.
+ <_>
+
+ <_>
+ 6 1 9 10 -1.
+ <_>
+ 6 6 9 5 2.
+ <_>
+
+ <_>
+ 0 4 6 12 -1.
+ <_>
+ 2 4 2 12 3.
+ <_>
+
+ <_>
+ 15 13 2 3 -1.
+ <_>
+ 15 14 2 1 3.
+ <_>
+
+ <_>
+ 7 14 5 3 -1.
+ <_>
+ 7 15 5 1 3.
+ <_>
+
+ <_>
+ 15 13 3 3 -1.
+ <_>
+ 15 14 3 1 3.
+ <_>
+
+ <_>
+ 6 14 8 3 -1.
+ <_>
+ 6 15 8 1 3.
+ <_>
+
+ <_>
+ 15 13 3 3 -1.
+ <_>
+ 15 14 3 1 3.
+ <_>
+
+ <_>
+ 2 13 3 3 -1.
+ <_>
+ 2 14 3 1 3.
+ <_>
+
+ <_>
+ 4 7 12 12 -1.
+ <_>
+ 10 7 6 6 2.
+ <_>
+ 4 13 6 6 2.
+ <_>
+
+ <_>
+ 9 7 2 6 -1.
+ <_>
+ 10 7 1 6 2.
+ <_>
+
+ <_>
+ 8 9 5 2 -1.
+ <_>
+ 8 10 5 1 2.
+ <_>
+
+ <_>
+ 8 6 3 4 -1.
+ <_>
+ 9 6 1 4 3.
+ <_>
+
+ <_>
+ 9 6 2 8 -1.
+ <_>
+ 9 10 2 4 2.
+ <_>
+
+ <_>
+ 7 7 3 6 -1.
+ <_>
+ 8 7 1 6 3.
+ <_>
+
+ <_>
+ 11 3 3 3 -1.
+ <_>
+ 12 3 1 3 3.
+ <_>
+
+ <_>
+ 5 4 6 1 -1.
+ <_>
+ 7 4 2 1 3.
+ <_>
+
+ <_>
+ 5 6 10 3 -1.
+ <_>
+ 5 7 10 1 3.
+ <_>
+
+ <_>
+ 7 3 6 9 -1.
+ <_>
+ 7 6 6 3 3.
+ <_>
+
+ <_>
+ 6 7 9 1 -1.
+ <_>
+ 9 7 3 1 3.
+ <_>
+
+ <_>
+ 2 8 16 8 -1.
+ <_>
+ 2 12 16 4 2.
+ <_>
+
+ <_>
+ 14 6 2 6 -1.
+ <_>
+ 14 9 2 3 2.
+ <_>
+
+ <_>
+ 1 5 6 15 -1.
+ <_>
+ 1 10 6 5 3.
+ <_>
+
+ <_>
+ 10 0 6 9 -1.
+ <_>
+ 10 3 6 3 3.
+ <_>
+
+ <_>
+ 6 6 7 14 -1.
+ <_>
+ 6 13 7 7 2.
+ <_>
+
+ <_>
+ 13 7 3 6 -1.
+ <_>
+ 13 9 3 2 3.
+ <_>
+
+ <_>
+ 1 8 15 4 -1.
+ <_>
+ 6 8 5 4 3.
+ <_>
+
+ <_>
+ 11 2 3 10 -1.
+ <_>
+ 11 7 3 5 2.
+ <_>
+
+ <_>
+ 3 7 4 6 -1.
+ <_>
+ 3 9 4 2 3.
+ <_>
+
+ <_>
+ 13 3 6 10 -1.
+ <_>
+ 15 3 2 10 3.
+ <_>
+
+ <_>
+ 5 7 8 10 -1.
+ <_>
+ 5 7 4 5 2.
+ <_>
+ 9 12 4 5 2.
+ <_>
+
+ <_>
+ 4 4 12 12 -1.
+ <_>
+ 10 4 6 6 2.
+ <_>
+ 4 10 6 6 2.
+ <_>
+
+ <_>
+ 1 4 6 9 -1.
+ <_>
+ 3 4 2 9 3.
+ <_>
+
+ <_>
+ 11 3 2 5 -1.
+ <_>
+ 11 3 1 5 2.
+ <_>
+
+ <_>
+ 7 3 2 5 -1.
+ <_>
+ 8 3 1 5 2.
+ <_>
+
+ <_>
+ 10 14 2 3 -1.
+ <_>
+ 10 15 2 1 3.
+ <_>
+
+ <_>
+ 5 12 6 2 -1.
+ <_>
+ 8 12 3 2 2.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 4 11 12 6 -1.
+ <_>
+ 4 14 12 3 2.
+ <_>
+
+ <_>
+ 11 11 5 9 -1.
+ <_>
+ 11 14 5 3 3.
+ <_>
+
+ <_>
+ 6 15 3 2 -1.
+ <_>
+ 6 16 3 1 2.
+ <_>
+
+ <_>
+ 11 0 3 5 -1.
+ <_>
+ 12 0 1 5 3.
+ <_>
+
+ <_>
+ 5 5 6 7 -1.
+ <_>
+ 8 5 3 7 2.
+ <_>
+
+ <_>
+ 13 0 1 9 -1.
+ <_>
+ 13 3 1 3 3.
+ <_>
+
+ <_>
+ 3 2 4 8 -1.
+ <_>
+ 3 2 2 4 2.
+ <_>
+ 5 6 2 4 2.
+ <_>
+
+ <_>
+ 13 12 4 6 -1.
+ <_>
+ 13 14 4 2 3.
+ <_>
+
+ <_>
+ 3 12 4 6 -1.
+ <_>
+ 3 14 4 2 3.
+ <_>
+
+ <_>
+ 13 11 3 4 -1.
+ <_>
+ 13 13 3 2 2.
+ <_>
+
+ <_>
+ 4 4 4 3 -1.
+ <_>
+ 4 5 4 1 3.
+ <_>
+
+ <_>
+ 7 5 11 8 -1.
+ <_>
+ 7 9 11 4 2.
+ <_>
+
+ <_>
+ 7 8 3 4 -1.
+ <_>
+ 8 8 1 4 3.
+ <_>
+
+ <_>
+ 9 1 6 1 -1.
+ <_>
+ 11 1 2 1 3.
+ <_>
+
+ <_>
+ 5 5 3 3 -1.
+ <_>
+ 5 6 3 1 3.
+ <_>
+
+ <_>
+ 0 9 20 6 -1.
+ <_>
+ 10 9 10 3 2.
+ <_>
+ 0 12 10 3 2.
+ <_>
+
+ <_>
+ 8 6 3 5 -1.
+ <_>
+ 9 6 1 5 3.
+ <_>
+
+ <_>
+ 11 0 1 3 -1.
+ <_>
+ 11 1 1 1 3.
+ <_>
+
+ <_>
+ 4 2 4 2 -1.
+ <_>
+ 4 3 4 1 2.
+ <_>
+
+ <_>
+ 12 6 4 3 -1.
+ <_>
+ 12 7 4 1 3.
+ <_>
+
+ <_>
+ 5 0 6 4 -1.
+ <_>
+ 7 0 2 4 3.
+ <_>
+
+ <_>
+ 9 7 3 8 -1.
+ <_>
+ 10 7 1 8 3.
+ <_>
+
+ <_>
+ 9 7 2 2 -1.
+ <_>
+ 10 7 1 2 2.
+ <_>
+
+ <_>
+ 6 7 14 4 -1.
+ <_>
+ 13 7 7 2 2.
+ <_>
+ 6 9 7 2 2.
+ <_>
+
+ <_>
+ 0 5 3 6 -1.
+ <_>
+ 0 7 3 2 3.
+ <_>
+
+ <_>
+ 13 11 3 4 -1.
+ <_>
+ 13 13 3 2 2.
+ <_>
+
+ <_>
+ 4 11 3 4 -1.
+ <_>
+ 4 13 3 2 2.
+ <_>
+
+ <_>
+ 5 9 12 8 -1.
+ <_>
+ 11 9 6 4 2.
+ <_>
+ 5 13 6 4 2.
+ <_>
+
+ <_>
+ 9 12 1 3 -1.
+ <_>
+ 9 13 1 1 3.
+ <_>
+
+ <_>
+ 10 15 2 4 -1.
+ <_>
+ 10 17 2 2 2.
+ <_>
+
+ <_>
+ 7 7 6 1 -1.
+ <_>
+ 9 7 2 1 3.
+ <_>
+
+ <_>
+ 12 3 6 6 -1.
+ <_>
+ 15 3 3 3 2.
+ <_>
+ 12 6 3 3 2.
+ <_>
+
+ <_>
+ 0 4 10 6 -1.
+ <_>
+ 0 6 10 2 3.
+ <_>
+
+ <_>
+ 8 3 8 14 -1.
+ <_>
+ 12 3 4 7 2.
+ <_>
+ 8 10 4 7 2.
+ <_>
+
+ <_>
+ 4 4 7 15 -1.
+ <_>
+ 4 9 7 5 3.
+ <_>
+
+ <_>
+ 12 2 6 8 -1.
+ <_>
+ 15 2 3 4 2.
+ <_>
+ 12 6 3 4 2.
+ <_>
+
+ <_>
+ 2 2 6 8 -1.
+ <_>
+ 2 2 3 4 2.
+ <_>
+ 5 6 3 4 2.
+ <_>
+
+ <_>
+ 2 13 18 7 -1.
+ <_>
+ 8 13 6 7 3.
+ <_>
+
+ <_>
+ 4 3 8 14 -1.
+ <_>
+ 4 3 4 7 2.
+ <_>
+ 8 10 4 7 2.
+ <_>
+
+ <_>
+ 18 1 2 6 -1.
+ <_>
+ 18 3 2 2 3.
+ <_>
+
+ <_>
+ 9 11 2 3 -1.
+ <_>
+ 9 12 2 1 3.
+ <_>
+
+ <_>
+ 18 1 2 6 -1.
+ <_>
+ 18 3 2 2 3.
+ <_>
+
+ <_>
+ 0 1 2 6 -1.
+ <_>
+ 0 3 2 2 3.
+ <_>
+
+ <_>
+ 1 5 18 6 -1.
+ <_>
+ 1 7 18 2 3.
+ <_>
+
+ <_>
+ 0 2 6 7 -1.
+ <_>
+ 3 2 3 7 2.
+ <_>
+
+ <_>
+ 7 3 6 14 -1.
+ <_>
+ 7 10 6 7 2.
+ <_>
+
+ <_>
+ 3 7 13 10 -1.
+ <_>
+ 3 12 13 5 2.
+ <_>
+
+ <_>
+ 11 15 2 2 -1.
+ <_>
+ 11 16 2 1 2.
+ <_>
+
+ <_>
+ 2 11 16 4 -1.
+ <_>
+ 2 11 8 2 2.
+ <_>
+ 10 13 8 2 2.
+ <_>
+
+ <_>
+ 13 7 6 4 -1.
+ <_>
+ 16 7 3 2 2.
+ <_>
+ 13 9 3 2 2.
+ <_>
+
+ <_>
+ 6 10 3 9 -1.
+ <_>
+ 6 13 3 3 3.
+ <_>
+
+ <_>
+ 14 6 1 6 -1.
+ <_>
+ 14 9 1 3 2.
+ <_>
+
+ <_>
+ 5 10 4 1 -1.
+ <_>
+ 7 10 2 1 2.
+ <_>
+
+ <_>
+ 3 8 15 5 -1.
+ <_>
+ 8 8 5 5 3.
+ <_>
+
+ <_>
+ 1 6 5 4 -1.
+ <_>
+ 1 8 5 2 2.
+ <_>
+
+ <_>
+ 3 1 17 6 -1.
+ <_>
+ 3 3 17 2 3.
+ <_>
+
+ <_>
+ 6 7 8 2 -1.
+ <_>
+ 10 7 4 2 2.
+ <_>
+
+ <_>
+ 9 7 3 2 -1.
+ <_>
+ 10 7 1 2 3.
+ <_>
+
+ <_>
+ 8 7 3 2 -1.
+ <_>
+ 9 7 1 2 3.
+ <_>
+
+ <_>
+ 8 9 4 2 -1.
+ <_>
+ 8 10 4 1 2.
+ <_>
+
+ <_>
+ 8 8 4 3 -1.
+ <_>
+ 8 9 4 1 3.
+ <_>
+
+ <_>
+ 9 5 6 4 -1.
+ <_>
+ 9 5 3 4 2.
+ <_>
+
+ <_>
+ 8 13 4 3 -1.
+ <_>
+ 8 14 4 1 3.
+ <_>
+
+ <_>
+ 4 7 12 6 -1.
+ <_>
+ 10 7 6 3 2.
+ <_>
+ 4 10 6 3 2.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 9 7 3 3 -1.
+ <_>
+ 9 8 3 1 3.
+ <_>
+
+ <_>
+ 7 4 3 8 -1.
+ <_>
+ 8 4 1 8 3.
+ <_>
+
+ <_>
+ 10 0 3 6 -1.
+ <_>
+ 11 0 1 6 3.
+ <_>
+
+ <_>
+ 6 3 4 8 -1.
+ <_>
+ 8 3 2 8 2.
+ <_>
+
+ <_>
+ 14 3 6 13 -1.
+ <_>
+ 14 3 3 13 2.
+ <_>
+
+ <_>
+ 8 13 3 6 -1.
+ <_>
+ 8 16 3 3 2.
+ <_>
+
+ <_>
+ 14 3 6 13 -1.
+ <_>
+ 14 3 3 13 2.
+ <_>
+
+ <_>
+ 0 7 10 4 -1.
+ <_>
+ 0 7 5 2 2.
+ <_>
+ 5 9 5 2 2.
+ <_>
+
+ <_>
+ 14 3 6 13 -1.
+ <_>
+ 14 3 3 13 2.
+ <_>
+
+ <_>
+ 0 3 6 13 -1.
+ <_>
+ 3 3 3 13 2.
+ <_>
+
+ <_>
+ 9 1 4 1 -1.
+ <_>
+ 9 1 2 1 2.
+ <_>
+
+ <_>
+ 8 0 2 1 -1.
+ <_>
+ 9 0 1 1 2.
+ <_>
+
+ <_>
+ 10 16 4 4 -1.
+ <_>
+ 12 16 2 2 2.
+ <_>
+ 10 18 2 2 2.
+ <_>
+
+ <_>
+ 9 6 2 3 -1.
+ <_>
+ 10 6 1 3 2.
+ <_>
+
+ <_>
+ 4 5 12 2 -1.
+ <_>
+ 8 5 4 2 3.
+ <_>
+
+ <_>
+ 8 7 3 5 -1.
+ <_>
+ 9 7 1 5 3.
+ <_>
+
+ <_>
+ 6 4 8 6 -1.
+ <_>
+ 6 6 8 2 3.
+ <_>
+
+ <_>
+ 9 5 2 12 -1.
+ <_>
+ 9 11 2 6 2.
+ <_>
+
+ <_>
+ 4 6 6 8 -1.
+ <_>
+ 4 10 6 4 2.
+ <_>
+
+ <_>
+ 12 2 8 5 -1.
+ <_>
+ 12 2 4 5 2.
+ <_>
+
+ <_>
+ 0 8 18 3 -1.
+ <_>
+ 0 9 18 1 3.
+ <_>
+
+ <_>
+ 8 12 4 8 -1.
+ <_>
+ 8 16 4 4 2.
+ <_>
+
+ <_>
+ 0 2 8 5 -1.
+ <_>
+ 4 2 4 5 2.
+ <_>
+
+ <_>
+ 13 11 3 4 -1.
+ <_>
+ 13 13 3 2 2.
+ <_>
+
+ <_>
+ 5 11 6 1 -1.
+ <_>
+ 7 11 2 1 3.
+ <_>
+
+ <_>
+ 11 3 3 1 -1.
+ <_>
+ 12 3 1 1 3.
+ <_>
+
+ <_>
+ 7 13 5 3 -1.
+ <_>
+ 7 14 5 1 3.
+ <_>
+
+ <_>
+ 11 11 7 6 -1.
+ <_>
+ 11 14 7 3 2.
+ <_>
+
+ <_>
+ 2 11 7 6 -1.
+ <_>
+ 2 14 7 3 2.
+ <_>
+
+ <_>
+ 12 14 2 6 -1.
+ <_>
+ 12 16 2 2 3.
+ <_>
+
+ <_>
+ 8 14 3 3 -1.
+ <_>
+ 8 15 3 1 3.
+ <_>
+
+ <_>
+ 11 0 3 5 -1.
+ <_>
+ 12 0 1 5 3.
+ <_>
+
+ <_>
+ 6 1 4 9 -1.
+ <_>
+ 8 1 2 9 2.
+ <_>
+
+ <_>
+ 10 3 6 1 -1.
+ <_>
+ 12 3 2 1 3.
+ <_>
+
+ <_>
+ 8 8 3 4 -1.
+ <_>
+ 8 10 3 2 2.
+ <_>
+
+ <_>
+ 8 12 4 2 -1.
+ <_>
+ 8 13 4 1 2.
+ <_>
+
+ <_>
+ 5 18 4 2 -1.
+ <_>
+ 5 19 4 1 2.
+ <_>
+
+ <_>
+ 2 1 18 6 -1.
+ <_>
+ 2 3 18 2 3.
+ <_>
+
+ <_>
+ 6 0 3 2 -1.
+ <_>
+ 7 0 1 2 3.
+ <_>
+
+ <_>
+ 13 8 6 2 -1.
+ <_>
+ 16 8 3 1 2.
+ <_>
+ 13 9 3 1 2.
+ <_>
+
+ <_>
+ 6 10 3 6 -1.
+ <_>
+ 6 13 3 3 2.
+ <_>
+
+ <_>
+ 0 13 20 4 -1.
+ <_>
+ 10 13 10 2 2.
+ <_>
+ 0 15 10 2 2.
+ <_>
+
+ <_>
+ 7 7 6 5 -1.
+ <_>
+ 9 7 2 5 3.
+ <_>
+
+ <_>
+ 11 0 2 2 -1.
+ <_>
+ 11 1 2 1 2.
+ <_>
+
+ <_>
+ 1 8 6 2 -1.
+ <_>
+ 1 8 3 1 2.
+ <_>
+ 4 9 3 1 2.
+ <_>
+
+ <_>
+ 0 2 20 2 -1.
+ <_>
+ 10 2 10 1 2.
+ <_>
+ 0 3 10 1 2.
+ <_>
+
+ <_>
+ 7 14 5 3 -1.
+ <_>
+ 7 15 5 1 3.
+ <_>
+
+ <_>
+ 7 13 6 6 -1.
+ <_>
+ 10 13 3 3 2.
+ <_>
+ 7 16 3 3 2.
+ <_>
+
+ <_>
+ 9 12 2 3 -1.
+ <_>
+ 9 13 2 1 3.
+ <_>
+
+ <_>
+ 16 11 1 6 -1.
+ <_>
+ 16 13 1 2 3.
+ <_>
+
+ <_>
+ 3 11 1 6 -1.
+ <_>
+ 3 13 1 2 3.
+ <_>
+
+ <_>
+ 4 4 14 12 -1.
+ <_>
+ 11 4 7 6 2.
+ <_>
+ 4 10 7 6 2.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 12 3 3 3 -1.
+ <_>
+ 13 3 1 3 3.
+ <_>
+
+ <_>
+ 6 6 8 3 -1.
+ <_>
+ 6 7 8 1 3.
+ <_>
+
+ <_>
+ 12 3 3 3 -1.
+ <_>
+ 13 3 1 3 3.
+ <_>
+
+ <_>
+ 3 1 4 10 -1.
+ <_>
+ 3 1 2 5 2.
+ <_>
+ 5 6 2 5 2.
+ <_>
+
+ <_>
+ 5 7 10 2 -1.
+ <_>
+ 5 7 5 2 2.
+ <_>
+
+ <_>
+ 8 7 3 3 -1.
+ <_>
+ 9 7 1 3 3.
+ <_>
+
+ <_>
+ 15 12 2 3 -1.
+ <_>
+ 15 13 2 1 3.
+ <_>
+
+ <_>
+ 7 8 3 4 -1.
+ <_>
+ 8 8 1 4 3.
+ <_>
+
+ <_>
+ 13 4 1 12 -1.
+ <_>
+ 13 10 1 6 2.
+ <_>
+
+ <_>
+ 4 5 12 12 -1.
+ <_>
+ 4 5 6 6 2.
+ <_>
+ 10 11 6 6 2.
+ <_>
+
+ <_>
+ 7 14 7 3 -1.
+ <_>
+ 7 15 7 1 3.
+ <_>
+
+ <_>
+ 3 12 2 3 -1.
+ <_>
+ 3 13 2 1 3.
+ <_>
+
+ <_>
+ 3 2 14 2 -1.
+ <_>
+ 10 2 7 1 2.
+ <_>
+ 3 3 7 1 2.
+ <_>
+
+ <_>
+ 0 1 3 10 -1.
+ <_>
+ 1 1 1 10 3.
+ <_>
+
+ <_>
+ 9 0 6 5 -1.
+ <_>
+ 11 0 2 5 3.
+ <_>
+
+ <_>
+ 5 7 6 2 -1.
+ <_>
+ 8 7 3 2 2.
+ <_>
+
+ <_>
+ 7 1 6 10 -1.
+ <_>
+ 7 6 6 5 2.
+ <_>
+
+ <_>
+ 1 1 18 3 -1.
+ <_>
+ 7 1 6 3 3.
+ <_>
+
+ <_>
+ 16 3 3 6 -1.
+ <_>
+ 16 5 3 2 3.
+ <_>
+
+ <_>
+ 6 3 7 6 -1.
+ <_>
+ 6 6 7 3 2.
+ <_>
+
+ <_>
+ 4 7 12 2 -1.
+ <_>
+ 8 7 4 2 3.
+ <_>
+
+ <_>
+ 0 4 17 10 -1.
+ <_>
+ 0 9 17 5 2.
+ <_>
+
+ <_>
+ 3 4 15 16 -1.
+ <_>
+ 3 12 15 8 2.
+ <_>
+
+ <_>
+ 7 15 6 4 -1.
+ <_>
+ 7 17 6 2 2.
+ <_>
+
+ <_>
+ 15 2 4 9 -1.
+ <_>
+ 15 2 2 9 2.
+ <_>
+
+ <_>
+ 2 3 3 2 -1.
+ <_>
+ 2 4 3 1 2.
+ <_>
+
+ <_>
+ 13 6 7 9 -1.
+ <_>
+ 13 9 7 3 3.
+ <_>
+
+ <_>
+ 8 11 4 3 -1.
+ <_>
+ 8 12 4 1 3.
+ <_>
+
+ <_>
+ 0 2 20 6 -1.
+ <_>
+ 10 2 10 3 2.
+ <_>
+ 0 5 10 3 2.
+ <_>
+
+ <_>
+ 3 2 6 10 -1.
+ <_>
+ 3 2 3 5 2.
+ <_>
+ 6 7 3 5 2.
+ <_>
+
+ <_>
+ 13 10 3 4 -1.
+ <_>
+ 13 12 3 2 2.
+ <_>
+
+ <_>
+ 4 10 3 4 -1.
+ <_>
+ 4 12 3 2 2.
+ <_>
+
+ <_>
+ 7 5 6 3 -1.
+ <_>
+ 9 5 2 3 3.
+ <_>
+
+ <_>
+ 7 6 6 8 -1.
+ <_>
+ 7 10 6 4 2.
+ <_>
+
+ <_>
+ 0 11 20 6 -1.
+ <_>
+ 0 14 20 3 2.
+ <_>
+
+ <_>
+ 4 13 4 6 -1.
+ <_>
+ 4 13 2 3 2.
+ <_>
+ 6 16 2 3 2.
+ <_>
+
+ <_>
+ 6 0 8 12 -1.
+ <_>
+ 10 0 4 6 2.
+ <_>
+ 6 6 4 6 2.
+ <_>
+
+ <_>
+ 2 0 15 2 -1.
+ <_>
+ 2 1 15 1 2.
+ <_>
+
+ <_>
+ 9 12 2 3 -1.
+ <_>
+ 9 13 2 1 3.
+ <_>
+
+ <_>
+ 3 12 1 2 -1.
+ <_>
+ 3 13 1 1 2.
+ <_>
+
+ <_>
+ 9 11 2 3 -1.
+ <_>
+ 9 12 2 1 3.
+ <_>
+
+ <_>
+ 7 3 3 1 -1.
+ <_>
+ 8 3 1 1 3.
+ <_>
+
+ <_>
+ 17 7 3 6 -1.
+ <_>
+ 17 9 3 2 3.
+ <_>
+
+ <_>
+ 7 2 3 2 -1.
+ <_>
+ 8 2 1 2 3.
+ <_>
+
+ <_>
+ 11 4 5 3 -1.
+ <_>
+ 11 5 5 1 3.
+ <_>
+
+ <_>
+ 4 4 5 3 -1.
+ <_>
+ 4 5 5 1 3.
+ <_>
+
+ <_>
+ 19 3 1 2 -1.
+ <_>
+ 19 4 1 1 2.
+ <_>
+
+ <_>
+ 5 5 4 3 -1.
+ <_>
+ 5 6 4 1 3.
+ <_>
+
+ <_>
+ 17 7 3 6 -1.
+ <_>
+ 17 9 3 2 3.
+ <_>
+
+ <_>
+ 0 7 3 6 -1.
+ <_>
+ 0 9 3 2 3.
+ <_>
+
+ <_>
+ 14 2 6 9 -1.
+ <_>
+ 14 5 6 3 3.
+ <_>
+
+ <_>
+ 0 4 5 6 -1.
+ <_>
+ 0 6 5 2 3.
+ <_>
+
+ <_>
+ 10 5 6 2 -1.
+ <_>
+ 12 5 2 2 3.
+ <_>
+
+ <_>
+ 4 5 6 2 -1.
+ <_>
+ 6 5 2 2 3.
+ <_>
+
+ <_>
+ 8 1 4 6 -1.
+ <_>
+ 8 3 4 2 3.
+ <_>
+
+ <_>
+ 0 2 3 6 -1.
+ <_>
+ 0 4 3 2 3.
+ <_>
+
+ <_>
+ 6 6 8 3 -1.
+ <_>
+ 6 7 8 1 3.
+ <_>
+
+ <_>
+ 0 1 5 9 -1.
+ <_>
+ 0 4 5 3 3.
+ <_>
+
+ <_>
+ 16 0 4 15 -1.
+ <_>
+ 16 0 2 15 2.
+ <_>
+
+ <_>
+ 1 10 3 2 -1.
+ <_>
+ 1 11 3 1 2.
+ <_>
+
+ <_>
+ 14 4 1 10 -1.
+ <_>
+ 14 9 1 5 2.
+ <_>
+
+ <_>
+ 0 1 4 12 -1.
+ <_>
+ 2 1 2 12 2.
+ <_>
+
+ <_>
+ 11 11 4 2 -1.
+ <_>
+ 11 11 2 2 2.
+ <_>
+
+ <_>
+ 5 11 4 2 -1.
+ <_>
+ 7 11 2 2 2.
+ <_>
+
+ <_>
+ 3 8 15 5 -1.
+ <_>
+ 8 8 5 5 3.
+ <_>
+
+ <_>
+ 0 0 6 10 -1.
+ <_>
+ 3 0 3 10 2.
+ <_>
+
+ <_>
+ 11 4 3 2 -1.
+ <_>
+ 12 4 1 2 3.
+ <_>
+
+ <_>
+ 8 12 3 8 -1.
+ <_>
+ 8 16 3 4 2.
+ <_>
+
+ <_>
+ 8 14 5 3 -1.
+ <_>
+ 8 15 5 1 3.
+ <_>
+
+ <_>
+ 7 14 4 3 -1.
+ <_>
+ 7 15 4 1 3.
+ <_>
+
+ <_>
+ 11 4 3 2 -1.
+ <_>
+ 12 4 1 2 3.
+ <_>
+
+ <_>
+ 3 15 14 4 -1.
+ <_>
+ 3 15 7 2 2.
+ <_>
+ 10 17 7 2 2.
+ <_>
+
+ <_>
+ 2 2 16 4 -1.
+ <_>
+ 10 2 8 2 2.
+ <_>
+ 2 4 8 2 2.
+ <_>
+
+ <_>
+ 0 8 6 12 -1.
+ <_>
+ 3 8 3 12 2.
+ <_>
+
+ <_>
+ 5 7 10 2 -1.
+ <_>
+ 5 7 5 2 2.
+ <_>
+
+ <_>
+ 9 7 2 5 -1.
+ <_>
+ 10 7 1 5 2.
+ <_>
+
+ <_>
+ 13 7 6 4 -1.
+ <_>
+ 16 7 3 2 2.
+ <_>
+ 13 9 3 2 2.
+ <_>
+
+ <_>
+ 0 13 8 2 -1.
+ <_>
+ 0 14 8 1 2.
+ <_>
+
+ <_>
+ 13 7 6 4 -1.
+ <_>
+ 16 7 3 2 2.
+ <_>
+ 13 9 3 2 2.
+ <_>
+
+ <_>
+ 1 7 6 4 -1.
+ <_>
+ 1 7 3 2 2.
+ <_>
+ 4 9 3 2 2.
+ <_>
+
+ <_>
+ 12 6 1 12 -1.
+ <_>
+ 12 12 1 6 2.
+ <_>
+
+ <_>
+ 9 5 2 6 -1.
+ <_>
+ 10 5 1 6 2.
+ <_>
+
+ <_>
+ 14 12 2 3 -1.
+ <_>
+ 14 13 2 1 3.
+ <_>
+
+ <_>
+ 4 12 2 3 -1.
+ <_>
+ 4 13 2 1 3.
+ <_>
+
+ <_>
+ 8 12 4 3 -1.
+ <_>
+ 8 13 4 1 3.
+ <_>
+
+ <_>
+ 5 2 2 4 -1.
+ <_>
+ 5 2 1 2 2.
+ <_>
+ 6 4 1 2 2.
+ <_>
+
+ <_>
+ 5 5 11 3 -1.
+ <_>
+ 5 6 11 1 3.
+ <_>
+
+ <_>
+ 7 6 4 12 -1.
+ <_>
+ 7 12 4 6 2.
+ <_>
+
+ <_>
+ 12 13 8 5 -1.
+ <_>
+ 12 13 4 5 2.
+ <_>
+
+ <_>
+ 7 6 1 12 -1.
+ <_>
+ 7 12 1 6 2.
+ <_>
+
+ <_>
+ 1 2 6 3 -1.
+ <_>
+ 4 2 3 3 2.
+ <_>
+
+ <_>
+ 9 5 6 10 -1.
+ <_>
+ 12 5 3 5 2.
+ <_>
+ 9 10 3 5 2.
+ <_>
+
+ <_>
+ 5 5 8 12 -1.
+ <_>
+ 5 5 4 6 2.
+ <_>
+ 9 11 4 6 2.
+ <_>
+
+ <_>
+ 0 7 20 6 -1.
+ <_>
+ 0 9 20 2 3.
+ <_>
+
+ <_>
+ 4 2 2 2 -1.
+ <_>
+ 4 3 2 1 2.
+ <_>
+
+ <_>
+ 4 18 12 2 -1.
+ <_>
+ 8 18 4 2 3.
+ <_>
+
+ <_>
+ 7 4 4 16 -1.
+ <_>
+ 7 12 4 8 2.
+ <_>
+
+ <_>
+ 7 6 7 8 -1.
+ <_>
+ 7 10 7 4 2.
+ <_>
+
+ <_>
+ 6 3 3 1 -1.
+ <_>
+ 7 3 1 1 3.
+ <_>
+
+ <_>
+ 11 15 2 4 -1.
+ <_>
+ 11 17 2 2 2.
+ <_>
+
+ <_>
+ 3 5 4 8 -1.
+ <_>
+ 3 9 4 4 2.
+ <_>
+
+ <_>
+ 7 1 6 12 -1.
+ <_>
+ 7 7 6 6 2.
+ <_>
+
+ <_>
+ 4 6 6 2 -1.
+ <_>
+ 6 6 2 2 3.
+ <_>
+
+ <_>
+ 16 4 4 6 -1.
+ <_>
+ 16 6 4 2 3.
+ <_>
+
+ <_>
+ 3 3 5 2 -1.
+ <_>
+ 3 4 5 1 2.
+ <_>
+
+ <_>
+ 9 11 2 3 -1.
+ <_>
+ 9 12 2 1 3.
+ <_>
+
+ <_>
+ 2 16 4 2 -1.
+ <_>
+ 2 17 4 1 2.
+ <_>
+
+ <_>
+ 7 13 6 6 -1.
+ <_>
+ 10 13 3 3 2.
+ <_>
+ 7 16 3 3 2.
+ <_>
+
+ <_>
+ 7 0 3 4 -1.
+ <_>
+ 8 0 1 4 3.
+ <_>
+
+ <_>
+ 8 15 4 3 -1.
+ <_>
+ 8 16 4 1 3.
+ <_>
+
+ <_>
+ 0 4 4 6 -1.
+ <_>
+ 0 6 4 2 3.
+ <_>
+
+ <_>
+ 5 6 12 3 -1.
+ <_>
+ 9 6 4 3 3.
+ <_>
+
+ <_>
+ 7 6 6 14 -1.
+ <_>
+ 9 6 2 14 3.
+ <_>
+
+ <_>
+ 9 7 3 3 -1.
+ <_>
+ 10 7 1 3 3.
+ <_>
+
+ <_>
+ 6 12 2 4 -1.
+ <_>
+ 6 14 2 2 2.
+ <_>
+
+ <_>
+ 10 12 7 6 -1.
+ <_>
+ 10 14 7 2 3.
+ <_>
+
+ <_>
+ 1 0 15 2 -1.
+ <_>
+ 1 1 15 1 2.
+ <_>
+
+ <_>
+ 14 0 6 6 -1.
+ <_>
+ 14 0 3 6 2.
+ <_>
+
+ <_>
+ 5 3 3 1 -1.
+ <_>
+ 6 3 1 1 3.
+ <_>
+
+ <_>
+ 14 0 6 6 -1.
+ <_>
+ 14 0 3 6 2.
+ <_>
+
+ <_>
+ 0 3 20 10 -1.
+ <_>
+ 0 8 20 5 2.
+ <_>
+
+ <_>
+ 14 0 6 6 -1.
+ <_>
+ 14 0 3 6 2.
+ <_>
+
+ <_>
+ 0 0 6 6 -1.
+ <_>
+ 3 0 3 6 2.
+ <_>
+
+ <_>
+ 19 15 1 2 -1.
+ <_>
+ 19 16 1 1 2.
+ <_>
+
+ <_>
+ 0 2 4 8 -1.
+ <_>
+ 2 2 2 8 2.
+ <_>
+
+ <_>
+ 2 1 18 4 -1.
+ <_>
+ 11 1 9 2 2.
+ <_>
+ 2 3 9 2 2.
+ <_>
+
+ <_>
+ 8 12 1 2 -1.
+ <_>
+ 8 13 1 1 2.
+ <_>
+
+ <_>
+ 5 2 10 6 -1.
+ <_>
+ 10 2 5 3 2.
+ <_>
+ 5 5 5 3 2.
+ <_>
+
+ <_>
+ 9 7 2 4 -1.
+ <_>
+ 10 7 1 4 2.
+ <_>
+
+ <_>
+ 9 7 3 3 -1.
+ <_>
+ 10 7 1 3 3.
+ <_>
+
+ <_>
+ 4 5 12 8 -1.
+ <_>
+ 8 5 4 8 3.
+ <_>
+
+ <_>
+ 15 15 4 3 -1.
+ <_>
+ 15 16 4 1 3.
+ <_>
+
+ <_>
+ 8 18 3 1 -1.
+ <_>
+ 9 18 1 1 3.
+ <_>
+
+ <_>
+ 9 13 4 3 -1.
+ <_>
+ 9 14 4 1 3.
+ <_>
+
+ <_>
+ 7 13 4 3 -1.
+ <_>
+ 7 14 4 1 3.
+ <_>
+
+ <_>
+ 19 15 1 2 -1.
+ <_>
+ 19 16 1 1 2.
+ <_>
+
+ <_>
+ 0 15 8 4 -1.
+ <_>
+ 0 17 8 2 2.
+ <_>
+
+ <_>
+ 9 3 6 4 -1.
+ <_>
+ 11 3 2 4 3.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 3 14 14 6 -1.
+ <_>
+ 3 16 14 2 3.
+ <_>
+
+ <_>
+ 6 3 6 6 -1.
+ <_>
+ 6 6 6 3 2.
+ <_>
+
+ <_>
+ 5 11 10 6 -1.
+ <_>
+ 5 14 10 3 2.
+ <_>
+
+ <_>
+ 3 10 3 4 -1.
+ <_>
+ 4 10 1 4 3.
+ <_>
+
+ <_>
+ 13 9 2 2 -1.
+ <_>
+ 13 9 1 2 2.
+ <_>
+
+ <_>
+ 5 3 6 4 -1.
+ <_>
+ 7 3 2 4 3.
+ <_>
+
+ <_>
+ 9 7 3 3 -1.
+ <_>
+ 10 7 1 3 3.
+ <_>
+
+ <_>
+ 2 12 2 3 -1.
+ <_>
+ 2 13 2 1 3.
+ <_>
+
+ <_>
+ 9 8 3 12 -1.
+ <_>
+ 9 12 3 4 3.
+ <_>
+
+ <_>
+ 3 14 4 6 -1.
+ <_>
+ 3 14 2 3 2.
+ <_>
+ 5 17 2 3 2.
+ <_>
+
+ <_>
+ 16 15 2 2 -1.
+ <_>
+ 16 16 2 1 2.
+ <_>
+
+ <_>
+ 2 15 2 2 -1.
+ <_>
+ 2 16 2 1 2.
+ <_>
+
+ <_>
+ 8 12 4 3 -1.
+ <_>
+ 8 13 4 1 3.
+ <_>
+
+ <_>
+ 0 7 20 1 -1.
+ <_>
+ 10 7 10 1 2.
+ <_>
+
+ <_>
+ 7 6 8 3 -1.
+ <_>
+ 7 6 4 3 2.
+ <_>
+
+ <_>
+ 5 7 8 2 -1.
+ <_>
+ 9 7 4 2 2.
+ <_>
+
+ <_>
+ 9 7 3 5 -1.
+ <_>
+ 10 7 1 5 3.
+ <_>
+
+ <_>
+ 8 7 3 5 -1.
+ <_>
+ 9 7 1 5 3.
+ <_>
+
+ <_>
+ 11 1 3 5 -1.
+ <_>
+ 12 1 1 5 3.
+ <_>
+
+ <_>
+ 6 2 3 6 -1.
+ <_>
+ 7 2 1 6 3.
+ <_>
+
+ <_>
+ 14 14 6 5 -1.
+ <_>
+ 14 14 3 5 2.
+ <_>
+
+ <_>
+ 9 8 2 2 -1.
+ <_>
+ 9 9 2 1 2.
+ <_>
+
+ <_>
+ 10 7 1 3 -1.
+ <_>
+ 10 8 1 1 3.
+ <_>
+
+ <_>
+ 6 6 2 2 -1.
+ <_>
+ 6 6 1 1 2.
+ <_>
+ 7 7 1 1 2.
+ <_>
+
+ <_>
+ 2 11 18 4 -1.
+ <_>
+ 11 11 9 2 2.
+ <_>
+ 2 13 9 2 2.
+ <_>
+
+ <_>
+ 6 6 2 2 -1.
+ <_>
+ 6 6 1 1 2.
+ <_>
+ 7 7 1 1 2.
+ <_>
+
+ <_>
+ 0 15 20 2 -1.
+ <_>
+ 0 16 20 1 2.
+ <_>
+
+ <_>
+ 4 14 2 3 -1.
+ <_>
+ 4 15 2 1 3.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 8 7 2 3 -1.
+ <_>
+ 8 8 2 1 3.
+ <_>
+
+ <_>
+ 9 10 2 3 -1.
+ <_>
+ 9 11 2 1 3.
+ <_>
+
+ <_>
+ 5 4 10 4 -1.
+ <_>
+ 5 6 10 2 2.
+ <_>
+
+ <_>
+ 9 7 6 4 -1.
+ <_>
+ 12 7 3 2 2.
+ <_>
+ 9 9 3 2 2.
+ <_>
+
+ <_>
+ 4 7 3 6 -1.
+ <_>
+ 4 9 3 2 3.
+ <_>
+
+ <_>
+ 11 15 4 4 -1.
+ <_>
+ 13 15 2 2 2.
+ <_>
+ 11 17 2 2 2.
+ <_>
+
+ <_>
+ 7 8 4 2 -1.
+ <_>
+ 7 9 4 1 2.
+ <_>
+
+ <_>
+ 13 1 4 3 -1.
+ <_>
+ 13 1 2 3 2.
+ <_>
+
+ <_>
+ 5 15 4 4 -1.
+ <_>
+ 5 15 2 2 2.
+ <_>
+ 7 17 2 2 2.
+ <_>
+
+ <_>
+ 9 5 4 7 -1.
+ <_>
+ 9 5 2 7 2.
+ <_>
+
+ <_>
+ 5 6 8 3 -1.
+ <_>
+ 9 6 4 3 2.
+ <_>
+
+ <_>
+ 9 9 2 2 -1.
+ <_>
+ 9 10 2 1 2.
+ <_>
+
+ <_>
+ 7 15 5 3 -1.
+ <_>
+ 7 16 5 1 3.
+ <_>
+
+ <_>
+ 11 10 4 3 -1.
+ <_>
+ 11 10 2 3 2.
+ <_>
+
+ <_>
+ 6 9 8 10 -1.
+ <_>
+ 6 14 8 5 2.
+ <_>
+
+ <_>
+ 10 11 6 2 -1.
+ <_>
+ 10 11 3 2 2.
+ <_>
+
+ <_>
+ 4 11 6 2 -1.
+ <_>
+ 7 11 3 2 2.
+ <_>
+
+ <_>
+ 11 3 8 1 -1.
+ <_>
+ 11 3 4 1 2.
+ <_>
+
+ <_>
+ 6 3 3 2 -1.
+ <_>
+ 7 3 1 2 3.
+ <_>
+
+ <_>
+ 14 5 6 5 -1.
+ <_>
+ 14 5 3 5 2.
+ <_>
+
+ <_>
+ 7 5 2 12 -1.
+ <_>
+ 7 11 2 6 2.
+ <_>
+
+ <_>
+ 8 11 4 3 -1.
+ <_>
+ 8 12 4 1 3.
+ <_>
+
+ <_>
+ 4 1 2 3 -1.
+ <_>
+ 5 1 1 3 2.
+ <_>
+
+ <_>
+ 18 3 2 6 -1.
+ <_>
+ 18 5 2 2 3.
+ <_>
+
+ <_>
+ 0 3 2 6 -1.
+ <_>
+ 0 5 2 2 3.
+ <_>
+
+ <_>
+ 9 12 2 3 -1.
+ <_>
+ 9 13 2 1 3.
+ <_>
+
+ <_>
+ 7 13 4 3 -1.
+ <_>
+ 7 14 4 1 3.
+ <_>
+
+ <_>
+ 18 0 2 6 -1.
+ <_>
+ 18 2 2 2 3.
+ <_>
+
+ <_>
+ 0 0 2 6 -1.
+ <_>
+ 0 2 2 2 3.
+ <_>
+
+ <_>
+ 8 14 6 3 -1.
+ <_>
+ 8 15 6 1 3.
+ <_>
+
+ <_>
+ 7 4 2 4 -1.
+ <_>
+ 8 4 1 4 2.
+ <_>
+
+ <_>
+ 8 5 4 6 -1.
+ <_>
+ 8 7 4 2 3.
+ <_>
+
+ <_>
+ 6 4 2 2 -1.
+ <_>
+ 7 4 1 2 2.
+ <_>
+
+ <_>
+ 3 14 14 4 -1.
+ <_>
+ 10 14 7 2 2.
+ <_>
+ 3 16 7 2 2.
+ <_>
+
+ <_>
+ 6 15 6 2 -1.
+ <_>
+ 6 15 3 1 2.
+ <_>
+ 9 16 3 1 2.
+ <_>
+
+ <_>
+ 14 15 6 2 -1.
+ <_>
+ 14 16 6 1 2.
+ <_>
+
+ <_>
+ 2 12 12 8 -1.
+ <_>
+ 2 16 12 4 2.
+ <_>
+
+ <_>
+ 7 7 7 2 -1.
+ <_>
+ 7 8 7 1 2.
+ <_>
+
+ <_>
+ 0 2 18 2 -1.
+ <_>
+ 0 3 18 1 2.
+ <_>
+
+ <_>
+ 9 6 2 5 -1.
+ <_>
+ 9 6 1 5 2.
+ <_>
+
+ <_>
+ 7 5 3 8 -1.
+ <_>
+ 8 5 1 8 3.
+ <_>
+
+ <_>
+ 9 6 3 4 -1.
+ <_>
+ 10 6 1 4 3.
+ <_>
+
+ <_>
+ 4 13 3 2 -1.
+ <_>
+ 4 14 3 1 2.
+ <_>
+
+ <_>
+ 9 4 6 3 -1.
+ <_>
+ 11 4 2 3 3.
+ <_>
+
+ <_>
+ 5 4 6 3 -1.
+ <_>
+ 7 4 2 3 3.
+ <_>
+
+ <_>
+ 14 11 5 2 -1.
+ <_>
+ 14 12 5 1 2.
+ <_>
+
+ <_>
+ 1 2 6 9 -1.
+ <_>
+ 3 2 2 9 3.
+ <_>
+
+ <_>
+ 14 6 6 13 -1.
+ <_>
+ 14 6 3 13 2.
+ <_>
+
+ <_>
+ 3 6 14 8 -1.
+ <_>
+ 3 6 7 4 2.
+ <_>
+ 10 10 7 4 2.
+ <_>
+
+ <_>
+ 16 0 4 11 -1.
+ <_>
+ 16 0 2 11 2.
+ <_>
+
+ <_>
+ 3 4 12 12 -1.
+ <_>
+ 3 4 6 6 2.
+ <_>
+ 9 10 6 6 2.
+ <_>
+
+ <_>
+ 11 4 5 3 -1.
+ <_>
+ 11 5 5 1 3.
+ <_>
+
+ <_>
+ 4 11 4 2 -1.
+ <_>
+ 4 12 4 1 2.
+ <_>
+
+ <_>
+ 10 7 2 2 -1.
+ <_>
+ 10 7 1 2 2.
+ <_>
+
+ <_>
+ 8 7 2 2 -1.
+ <_>
+ 9 7 1 2 2.
+ <_>
+
+ <_>
+ 9 17 3 2 -1.
+ <_>
+ 10 17 1 2 3.
+ <_>
+
+ <_>
+ 5 6 3 3 -1.
+ <_>
+ 5 7 3 1 3.
+ <_>
+
+ <_>
+ 10 0 3 3 -1.
+ <_>
+ 11 0 1 3 3.
+ <_>
+
+ <_>
+ 5 6 6 2 -1.
+ <_>
+ 5 6 3 1 2.
+ <_>
+ 8 7 3 1 2.
+ <_>
+
+ <_>
+ 12 16 4 3 -1.
+ <_>
+ 12 17 4 1 3.
+ <_>
+
+ <_>
+ 3 12 3 2 -1.
+ <_>
+ 3 13 3 1 2.
+ <_>
+
+ <_>
+ 9 12 3 2 -1.
+ <_>
+ 9 13 3 1 2.
+ <_>
+
+ <_>
+ 1 11 16 4 -1.
+ <_>
+ 1 11 8 2 2.
+ <_>
+ 9 13 8 2 2.
+ <_>
+
+ <_>
+ 12 4 3 3 -1.
+ <_>
+ 12 5 3 1 3.
+ <_>
+
+ <_>
+ 4 4 5 3 -1.
+ <_>
+ 4 5 5 1 3.
+ <_>
+
+ <_>
+ 12 16 4 3 -1.
+ <_>
+ 12 17 4 1 3.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 9 0 2 2 -1.
+ <_>
+ 9 1 2 1 2.
+ <_>
+
+ <_>
+ 8 9 4 2 -1.
+ <_>
+ 8 10 4 1 2.
+ <_>
+
+ <_>
+ 8 8 4 3 -1.
+ <_>
+ 8 9 4 1 3.
+ <_>
+
+ <_>
+ 0 13 6 3 -1.
+ <_>
+ 2 13 2 3 3.
+ <_>
+
+ <_>
+ 16 14 3 2 -1.
+ <_>
+ 16 15 3 1 2.
+ <_>
+
+ <_>
+ 1 18 18 2 -1.
+ <_>
+ 7 18 6 2 3.
+ <_>
+
+ <_>
+ 16 14 3 2 -1.
+ <_>
+ 16 15 3 1 2.
+ <_>
+
+ <_>
+ 1 14 3 2 -1.
+ <_>
+ 1 15 3 1 2.
+ <_>
+
+ <_>
+ 7 14 6 3 -1.
+ <_>
+ 7 15 6 1 3.
+ <_>
+
+ <_>
+ 5 14 8 3 -1.
+ <_>
+ 5 15 8 1 3.
+ <_>
+
+ <_>
+ 10 6 4 14 -1.
+ <_>
+ 10 6 2 14 2.
+ <_>
+
+ <_>
+ 6 6 4 14 -1.
+ <_>
+ 8 6 2 14 2.
+ <_>
+
+ <_>
+ 13 5 2 3 -1.
+ <_>
+ 13 6 2 1 3.
+ <_>
+
+ <_>
+ 7 16 6 1 -1.
+ <_>
+ 9 16 2 1 3.
+ <_>
+
+ <_>
+ 9 12 3 3 -1.
+ <_>
+ 9 13 3 1 3.
+ <_>
+
+ <_>
+ 7 0 3 3 -1.
+ <_>
+ 8 0 1 3 3.
+ <_>
+
+ <_>
+ 4 0 16 18 -1.
+ <_>
+ 4 9 16 9 2.
+ <_>
+
+ <_>
+ 1 1 16 14 -1.
+ <_>
+ 1 8 16 7 2.
+ <_>
+
+ <_>
+ 3 9 15 4 -1.
+ <_>
+ 8 9 5 4 3.
+ <_>
+
+ <_>
+ 6 12 7 3 -1.
+ <_>
+ 6 13 7 1 3.
+ <_>
+
+ <_>
+ 14 15 2 3 -1.
+ <_>
+ 14 16 2 1 3.
+ <_>
+
+ <_>
+ 2 3 16 14 -1.
+ <_>
+ 2 3 8 7 2.
+ <_>
+ 10 10 8 7 2.
+ <_>
+
+ <_>
+ 16 2 4 18 -1.
+ <_>
+ 18 2 2 9 2.
+ <_>
+ 16 11 2 9 2.
+ <_>
+
+ <_>
+ 4 15 2 3 -1.
+ <_>
+ 4 16 2 1 3.
+ <_>
+
+ <_>
+ 16 2 4 18 -1.
+ <_>
+ 18 2 2 9 2.
+ <_>
+ 16 11 2 9 2.
+ <_>
+
+ <_>
+ 1 1 8 3 -1.
+ <_>
+ 1 2 8 1 3.
+ <_>
+
+ <_>
+ 8 11 4 3 -1.
+ <_>
+ 8 12 4 1 3.
+ <_>
+
+ <_>
+ 5 11 5 9 -1.
+ <_>
+ 5 14 5 3 3.
+ <_>
+
+ <_>
+ 16 0 4 11 -1.
+ <_>
+ 16 0 2 11 2.
+ <_>
+
+ <_>
+ 7 0 6 1 -1.
+ <_>
+ 9 0 2 1 3.
+ <_>
+
+ <_>
+ 16 3 3 7 -1.
+ <_>
+ 17 3 1 7 3.
+ <_>
+
+ <_>
+ 1 3 3 7 -1.
+ <_>
+ 2 3 1 7 3.
+ <_>
+
+ <_>
+ 7 8 6 12 -1.
+ <_>
+ 7 12 6 4 3.
+ <_>
+
+ <_>
+ 0 0 4 11 -1.
+ <_>
+ 2 0 2 11 2.
+ <_>
+
+ <_>
+ 14 0 6 20 -1.
+ <_>
+ 14 0 3 20 2.
+ <_>
+
+ <_>
+ 0 3 1 2 -1.
+ <_>
+ 0 4 1 1 2.
+ <_>
+
+ <_>
+ 5 5 10 8 -1.
+ <_>
+ 10 5 5 4 2.
+ <_>
+ 5 9 5 4 2.
+ <_>
+
+ <_>
+ 4 7 12 4 -1.
+ <_>
+ 4 7 6 2 2.
+ <_>
+ 10 9 6 2 2.
+ <_>
+
+ <_>
+ 2 1 6 4 -1.
+ <_>
+ 5 1 3 4 2.
+ <_>
+
+ <_>
+ 9 7 6 4 -1.
+ <_>
+ 12 7 3 2 2.
+ <_>
+ 9 9 3 2 2.
+ <_>
+
+ <_>
+ 5 6 2 6 -1.
+ <_>
+ 5 9 2 3 2.
+ <_>
+
+ <_>
+ 9 16 6 4 -1.
+ <_>
+ 12 16 3 2 2.
+ <_>
+ 9 18 3 2 2.
+ <_>
+
+ <_>
+ 9 4 2 12 -1.
+ <_>
+ 9 10 2 6 2.
+ <_>
+
+ <_>
+ 7 1 6 18 -1.
+ <_>
+ 9 1 2 18 3.
+ <_>
+
+ <_>
+ 4 12 12 2 -1.
+ <_>
+ 8 12 4 2 3.
+ <_>
+
+ <_>
+ 8 8 6 2 -1.
+ <_>
+ 8 9 6 1 2.
+ <_>
+
+ <_>
+ 8 0 3 6 -1.
+ <_>
+ 9 0 1 6 3.
+ <_>
+
+ <_>
+ 11 18 3 2 -1.
+ <_>
+ 11 19 3 1 2.
+ <_>
+
+ <_>
+ 1 1 17 4 -1.
+ <_>
+ 1 3 17 2 2.
+ <_>
+
+ <_>
+ 11 8 4 12 -1.
+ <_>
+ 11 8 2 12 2.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 12 3 2 17 -1.
+ <_>
+ 12 3 1 17 2.
+ <_>
+
+ <_>
+ 4 7 6 1 -1.
+ <_>
+ 6 7 2 1 3.
+ <_>
+
+ <_>
+ 18 3 2 3 -1.
+ <_>
+ 18 4 2 1 3.
+ <_>
+
+ <_>
+ 8 4 3 4 -1.
+ <_>
+ 8 6 3 2 2.
+ <_>
+
+ <_>
+ 4 5 12 10 -1.
+ <_>
+ 4 10 12 5 2.
+ <_>
+
+ <_>
+ 5 18 4 2 -1.
+ <_>
+ 7 18 2 2 2.
+ <_>
+
+ <_>
+ 17 2 3 6 -1.
+ <_>
+ 17 4 3 2 3.
+ <_>
+
+ <_>
+ 7 7 6 6 -1.
+ <_>
+ 9 7 2 6 3.
+ <_>
+
+ <_>
+ 17 2 3 6 -1.
+ <_>
+ 17 4 3 2 3.
+ <_>
+
+ <_>
+ 8 0 3 4 -1.
+ <_>
+ 9 0 1 4 3.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 0 12 6 3 -1.
+ <_>
+ 0 13 6 1 3.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 3 12 2 3 -1.
+ <_>
+ 3 13 2 1 3.
+ <_>
+
+ <_>
+ 5 6 12 7 -1.
+ <_>
+ 9 6 4 7 3.
+ <_>
+
+ <_>
+ 0 2 3 6 -1.
+ <_>
+ 0 4 3 2 3.
+ <_>
+
+ <_>
+ 14 6 1 3 -1.
+ <_>
+ 14 7 1 1 3.
+ <_>
+
+ <_>
+ 2 0 3 14 -1.
+ <_>
+ 3 0 1 14 3.
+ <_>
+
+ <_>
+ 12 14 5 6 -1.
+ <_>
+ 12 16 5 2 3.
+ <_>
+
+ <_>
+ 4 14 5 6 -1.
+ <_>
+ 4 16 5 2 3.
+ <_>
+
+ <_>
+ 11 10 2 2 -1.
+ <_>
+ 12 10 1 1 2.
+ <_>
+ 11 11 1 1 2.
+ <_>
+
+ <_>
+ 5 0 3 14 -1.
+ <_>
+ 6 0 1 14 3.
+ <_>
+
+ <_>
+ 10 15 2 3 -1.
+ <_>
+ 10 16 2 1 3.
+ <_>
+
+ <_>
+ 0 2 2 3 -1.
+ <_>
+ 0 3 2 1 3.
+ <_>
+
+ <_>
+ 5 11 12 6 -1.
+ <_>
+ 5 14 12 3 2.
+ <_>
+
+ <_>
+ 6 11 3 9 -1.
+ <_>
+ 6 14 3 3 3.
+ <_>
+
+ <_>
+ 11 10 2 2 -1.
+ <_>
+ 12 10 1 1 2.
+ <_>
+ 11 11 1 1 2.
+ <_>
+
+ <_>
+ 5 6 1 3 -1.
+ <_>
+ 5 7 1 1 3.
+ <_>
+
+ <_>
+ 4 9 13 3 -1.
+ <_>
+ 4 10 13 1 3.
+ <_>
+
+ <_>
+ 1 7 15 6 -1.
+ <_>
+ 6 7 5 6 3.
+ <_>
+
+ <_>
+ 4 5 12 6 -1.
+ <_>
+ 8 5 4 6 3.
+ <_>
+
+ <_>
+ 8 10 4 3 -1.
+ <_>
+ 8 11 4 1 3.
+ <_>
+
+ <_>
+ 15 14 1 3 -1.
+ <_>
+ 15 15 1 1 3.
+ <_>
+
+ <_>
+ 1 11 5 3 -1.
+ <_>
+ 1 12 5 1 3.
+ <_>
+
+ <_>
+ 7 1 7 12 -1.
+ <_>
+ 7 7 7 6 2.
+ <_>
+
+ <_>
+ 0 1 6 10 -1.
+ <_>
+ 0 1 3 5 2.
+ <_>
+ 3 6 3 5 2.
+ <_>
+
+ <_>
+ 16 1 4 3 -1.
+ <_>
+ 16 2 4 1 3.
+ <_>
+
+ <_>
+ 5 5 2 3 -1.
+ <_>
+ 5 6 2 1 3.
+ <_>
+
+ <_>
+ 12 2 3 5 -1.
+ <_>
+ 13 2 1 5 3.
+ <_>
+
+ <_>
+ 0 3 4 6 -1.
+ <_>
+ 0 5 4 2 3.
+ <_>
+
+ <_>
+ 8 12 4 2 -1.
+ <_>
+ 8 13 4 1 2.
+ <_>
+
+ <_>
+ 8 18 3 1 -1.
+ <_>
+ 9 18 1 1 3.
+ <_>
+
+ <_>
+ 11 10 2 2 -1.
+ <_>
+ 12 10 1 1 2.
+ <_>
+ 11 11 1 1 2.
+ <_>
+
+ <_>
+ 7 10 2 2 -1.
+ <_>
+ 7 10 1 1 2.
+ <_>
+ 8 11 1 1 2.
+ <_>
+
+ <_>
+ 11 11 4 4 -1.
+ <_>
+ 11 13 4 2 2.
+ <_>
+
+ <_>
+ 8 12 3 8 -1.
+ <_>
+ 9 12 1 8 3.
+ <_>
+
+ <_>
+ 13 0 6 3 -1.
+ <_>
+ 13 1 6 1 3.
+ <_>
+
+ <_>
+ 8 8 3 4 -1.
+ <_>
+ 9 8 1 4 3.
+ <_>
+
+ <_>
+ 5 7 10 10 -1.
+ <_>
+ 10 7 5 5 2.
+ <_>
+ 5 12 5 5 2.
+ <_>
+
+ <_>
+ 3 18 8 2 -1.
+ <_>
+ 3 18 4 1 2.
+ <_>
+ 7 19 4 1 2.
+ <_>
+
+ <_>
+ 10 2 6 8 -1.
+ <_>
+ 12 2 2 8 3.
+ <_>
+
+ <_>
+ 4 2 6 8 -1.
+ <_>
+ 6 2 2 8 3.
+ <_>
+
+ <_>
+ 11 0 3 7 -1.
+ <_>
+ 12 0 1 7 3.
+ <_>
+
+ <_>
+ 7 11 2 1 -1.
+ <_>
+ 8 11 1 1 2.
+ <_>
+
+ <_>
+ 15 14 1 3 -1.
+ <_>
+ 15 15 1 1 3.
+ <_>
+
+ <_>
+ 7 15 2 2 -1.
+ <_>
+ 7 15 1 1 2.
+ <_>
+ 8 16 1 1 2.
+ <_>
+
+ <_>
+ 15 14 1 3 -1.
+ <_>
+ 15 15 1 1 3.
+ <_>
+
+ <_>
+ 6 0 3 7 -1.
+ <_>
+ 7 0 1 7 3.
+ <_>
+
+ <_>
+ 18 1 2 7 -1.
+ <_>
+ 18 1 1 7 2.
+ <_>
+
+ <_>
+ 2 0 8 20 -1.
+ <_>
+ 2 10 8 10 2.
+ <_>
+
+ <_>
+ 3 0 15 6 -1.
+ <_>
+ 3 2 15 2 3.
+ <_>
+
+ <_>
+ 4 3 12 2 -1.
+ <_>
+ 4 4 12 1 2.
+ <_>
+
+ <_>
+ 16 0 4 5 -1.
+ <_>
+ 16 0 2 5 2.
+ <_>
+
+ <_>
+ 7 0 3 4 -1.
+ <_>
+ 8 0 1 4 3.
+ <_>
+
+ <_>
+ 16 0 4 5 -1.
+ <_>
+ 16 0 2 5 2.
+ <_>
+
+ <_>
+ 1 7 6 13 -1.
+ <_>
+ 3 7 2 13 3.
+ <_>
+
+ <_>
+ 16 0 4 5 -1.
+ <_>
+ 16 0 2 5 2.
+ <_>
+
+ <_>
+ 0 0 4 5 -1.
+ <_>
+ 2 0 2 5 2.
+ <_>
+
+ <_>
+ 14 12 3 6 -1.
+ <_>
+ 14 14 3 2 3.
+ <_>
+
+ <_>
+ 3 12 3 6 -1.
+ <_>
+ 3 14 3 2 3.
+ <_>
+
+ <_>
+ 16 1 4 3 -1.
+ <_>
+ 16 2 4 1 3.
+ <_>
+
+ <_>
+ 8 7 2 10 -1.
+ <_>
+ 8 7 1 5 2.
+ <_>
+ 9 12 1 5 2.
+ <_>
+
+ <_>
+ 11 11 4 4 -1.
+ <_>
+ 11 13 4 2 2.
+ <_>
+
+ <_>
+ 0 1 4 3 -1.
+ <_>
+ 0 2 4 1 3.
+ <_>
+
+ <_>
+ 13 4 1 3 -1.
+ <_>
+ 13 5 1 1 3.
+ <_>
+
+ <_>
+ 7 15 3 5 -1.
+ <_>
+ 8 15 1 5 3.
+ <_>
+
+ <_>
+ 9 7 3 5 -1.
+ <_>
+ 10 7 1 5 3.
+ <_>
+
+ <_>
+ 8 7 3 5 -1.
+ <_>
+ 9 7 1 5 3.
+ <_>
+
+ <_>
+ 10 6 4 14 -1.
+ <_>
+ 10 6 2 14 2.
+ <_>
+
+ <_>
+ 0 5 5 6 -1.
+ <_>
+ 0 7 5 2 3.
+ <_>
+
+ <_>
+ 9 5 6 4 -1.
+ <_>
+ 9 5 3 4 2.
+ <_>
+
+ <_>
+ 0 0 18 10 -1.
+ <_>
+ 6 0 6 10 3.
+ <_>
+
+ <_>
+ 10 6 4 14 -1.
+ <_>
+ 10 6 2 14 2.
+ <_>
+
+ <_>
+ 6 6 4 14 -1.
+ <_>
+ 8 6 2 14 2.
+ <_>
+
+ <_>
+ 13 4 1 3 -1.
+ <_>
+ 13 5 1 1 3.
+ <_>
+
+ <_>
+ 5 1 2 3 -1.
+ <_>
+ 6 1 1 3 2.
+ <_>
+
+ <_>
+ 18 1 2 18 -1.
+ <_>
+ 19 1 1 9 2.
+ <_>
+ 18 10 1 9 2.
+ <_>
+
+ <_>
+ 2 1 4 3 -1.
+ <_>
+ 2 2 4 1 3.
+ <_>
+
+ <_>
+ 18 1 2 18 -1.
+ <_>
+ 19 1 1 9 2.
+ <_>
+ 18 10 1 9 2.
+ <_>
+
+ <_>
+ 1 14 4 6 -1.
+ <_>
+ 1 14 2 3 2.
+ <_>
+ 3 17 2 3 2.
+ <_>
+
+ <_>
+ 10 11 7 6 -1.
+ <_>
+ 10 13 7 2 3.
+ <_>
+
+ <_>
+ 0 10 6 10 -1.
+ <_>
+ 0 10 3 5 2.
+ <_>
+ 3 15 3 5 2.
+ <_>
+
+ <_>
+ 11 0 3 4 -1.
+ <_>
+ 12 0 1 4 3.
+ <_>
+
+ <_>
+ 5 10 5 6 -1.
+ <_>
+ 5 13 5 3 2.
+ <_>
+
+ <_>
+ 14 6 1 8 -1.
+ <_>
+ 14 10 1 4 2.
+ <_>
+
+ <_>
+ 1 7 18 6 -1.
+ <_>
+ 1 7 9 3 2.
+ <_>
+ 10 10 9 3 2.
+ <_>
+
+ <_>
+ 9 7 2 2 -1.
+ <_>
+ 9 7 1 2 2.
+ <_>
+
+ <_>
+ 5 9 4 5 -1.
+ <_>
+ 7 9 2 5 2.
+ <_>
+
+ <_>
+ 7 6 6 3 -1.
+ <_>
+ 9 6 2 3 3.
+ <_>
+
+ <_>
+ 1 0 18 4 -1.
+ <_>
+ 7 0 6 4 3.
+ <_>
+
+ <_>
+ 7 15 2 4 -1.
+ <_>
+ 7 17 2 2 2.
+ <_>
+
+ <_>
+ 1 0 19 9 -1.
+ <_>
+ 1 3 19 3 3.
+ <_>
+
+ <_>
+ 3 7 3 6 -1.
+ <_>
+ 3 9 3 2 3.
+ <_>
+
+ <_>
+ 13 7 4 4 -1.
+ <_>
+ 15 7 2 2 2.
+ <_>
+ 13 9 2 2 2.
+ <_>
+
+ <_>
+ 3 7 4 4 -1.
+ <_>
+ 3 7 2 2 2.
+ <_>
+ 5 9 2 2 2.
+ <_>
+
+ <_>
+ 9 6 10 8 -1.
+ <_>
+ 9 10 10 4 2.
+ <_>
+
+ <_>
+ 3 8 14 12 -1.
+ <_>
+ 3 14 14 6 2.
+ <_>
+
+ <_>
+ 6 5 10 12 -1.
+ <_>
+ 11 5 5 6 2.
+ <_>
+ 6 11 5 6 2.
+ <_>
+
+ <_>
+ 9 11 2 3 -1.
+ <_>
+ 9 12 2 1 3.
+ <_>
+
+ <_>
+ 9 5 6 5 -1.
+ <_>
+ 9 5 3 5 2.
+ <_>
+
+ <_>
+ 9 4 2 4 -1.
+ <_>
+ 9 6 2 2 2.
+ <_>
+
+ <_>
+ 9 5 6 5 -1.
+ <_>
+ 9 5 3 5 2.
+ <_>
+
+ <_>
+ 5 5 6 5 -1.
+ <_>
+ 8 5 3 5 2.
+ <_>
+
+ <_>
+ 11 2 6 1 -1.
+ <_>
+ 13 2 2 1 3.
+ <_>
+
+ <_>
+ 3 2 6 1 -1.
+ <_>
+ 5 2 2 1 3.
+ <_>
+
+ <_>
+ 13 5 2 3 -1.
+ <_>
+ 13 6 2 1 3.
+ <_>
+
+ <_>
+ 0 10 1 4 -1.
+ <_>
+ 0 12 1 2 2.
+ <_>
+
+ <_>
+ 13 5 2 3 -1.
+ <_>
+ 13 6 2 1 3.
+ <_>
+
+ <_>
+ 8 18 3 2 -1.
+ <_>
+ 9 18 1 2 3.
+ <_>
+
+ <_>
+ 6 15 9 2 -1.
+ <_>
+ 6 16 9 1 2.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 18 4 2 4 -1.
+ <_>
+ 18 6 2 2 2.
+ <_>
+
+ <_>
+ 5 5 2 3 -1.
+ <_>
+ 5 6 2 1 3.
+ <_>
+
+ <_>
+ 15 16 3 2 -1.
+ <_>
+ 15 17 3 1 2.
+ <_>
+
+ <_>
+ 0 0 3 9 -1.
+ <_>
+ 0 3 3 3 3.
+ <_>
+
+ <_>
+ 9 7 3 3 -1.
+ <_>
+ 9 8 3 1 3.
+ <_>
+
+ <_>
+ 8 7 3 3 -1.
+ <_>
+ 8 8 3 1 3.
+ <_>
+
+ <_>
+ 9 5 2 6 -1.
+ <_>
+ 9 5 1 6 2.
+ <_>
+
+ <_>
+ 8 6 3 4 -1.
+ <_>
+ 9 6 1 4 3.
+ <_>
+
+ <_>
+ 7 6 8 12 -1.
+ <_>
+ 11 6 4 6 2.
+ <_>
+ 7 12 4 6 2.
+ <_>
+
+ <_>
+ 5 6 8 12 -1.
+ <_>
+ 5 6 4 6 2.
+ <_>
+ 9 12 4 6 2.
+ <_>
+
+ <_>
+ 12 4 3 3 -1.
+ <_>
+ 12 5 3 1 3.
+ <_>
+
+ <_>
+ 2 16 3 2 -1.
+ <_>
+ 2 17 3 1 2.
+ <_>
+
+ <_>
+ 12 4 3 3 -1.
+ <_>
+ 12 5 3 1 3.
+ <_>
+
+ <_>
+ 2 12 6 6 -1.
+ <_>
+ 2 14 6 2 3.
+ <_>
+
+ <_>
+ 7 13 6 3 -1.
+ <_>
+ 7 14 6 1 3.
+ <_>
+
+ <_>
+ 6 14 6 3 -1.
+ <_>
+ 6 15 6 1 3.
+ <_>
+
+ <_>
+ 14 15 5 3 -1.
+ <_>
+ 14 16 5 1 3.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 14 15 5 3 -1.
+ <_>
+ 14 16 5 1 3.
+ <_>
+
+ <_>
+ 5 3 6 2 -1.
+ <_>
+ 7 3 2 2 3.
+ <_>
+
+ <_>
+ 8 15 4 3 -1.
+ <_>
+ 8 16 4 1 3.
+ <_>
+
+ <_>
+ 1 15 5 3 -1.
+ <_>
+ 1 16 5 1 3.
+ <_>
+
+ <_>
+ 8 13 4 6 -1.
+ <_>
+ 10 13 2 3 2.
+ <_>
+ 8 16 2 3 2.
+ <_>
+
+ <_>
+ 7 8 3 3 -1.
+ <_>
+ 8 8 1 3 3.
+ <_>
+
+ <_>
+ 12 0 5 4 -1.
+ <_>
+ 12 2 5 2 2.
+ <_>
+
+ <_>
+ 0 2 20 2 -1.
+ <_>
+ 0 2 10 1 2.
+ <_>
+ 10 3 10 1 2.
+ <_>
+
+ <_>
+ 1 0 18 4 -1.
+ <_>
+ 7 0 6 4 3.
+ <_>
+
+ <_>
+ 4 3 6 1 -1.
+ <_>
+ 6 3 2 1 3.
+ <_>
+
+ <_>
+ 4 18 13 2 -1.
+ <_>
+ 4 19 13 1 2.
+ <_>
+
+ <_>
+ 2 10 3 6 -1.
+ <_>
+ 2 12 3 2 3.
+ <_>
+
+ <_>
+ 14 12 6 8 -1.
+ <_>
+ 17 12 3 4 2.
+ <_>
+ 14 16 3 4 2.
+ <_>
+
+ <_>
+ 4 13 10 6 -1.
+ <_>
+ 4 13 5 3 2.
+ <_>
+ 9 16 5 3 2.
+ <_>
+
+ <_>
+ 14 12 1 2 -1.
+ <_>
+ 14 13 1 1 2.
+ <_>
+
+ <_>
+ 8 13 4 3 -1.
+ <_>
+ 8 14 4 1 3.
+ <_>
+
+ <_>
+ 14 12 2 2 -1.
+ <_>
+ 14 13 2 1 2.
+ <_>
+
+ <_>
+ 4 12 2 2 -1.
+ <_>
+ 4 13 2 1 2.
+ <_>
+
+ <_>
+ 8 12 9 2 -1.
+ <_>
+ 8 13 9 1 2.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 11 10 3 6 -1.
+ <_>
+ 11 13 3 3 2.
+ <_>
+
+ <_>
+ 5 6 9 12 -1.
+ <_>
+ 5 12 9 6 2.
+ <_>
+
+ <_>
+ 11 10 3 6 -1.
+ <_>
+ 11 13 3 3 2.
+ <_>
+
+ <_>
+ 6 10 3 6 -1.
+ <_>
+ 6 13 3 3 2.
+ <_>
+
+ <_>
+ 5 4 11 3 -1.
+ <_>
+ 5 5 11 1 3.
+ <_>
+
+ <_>
+ 7 1 5 10 -1.
+ <_>
+ 7 6 5 5 2.
+ <_>
+
+ <_>
+ 2 8 18 2 -1.
+ <_>
+ 2 9 18 1 2.
+ <_>
+
+ <_>
+ 7 17 5 3 -1.
+ <_>
+ 7 18 5 1 3.
+ <_>
+
+ <_>
+ 5 9 12 1 -1.
+ <_>
+ 9 9 4 1 3.
+ <_>
+
+ <_>
+ 0 14 6 6 -1.
+ <_>
+ 0 14 3 3 2.
+ <_>
+ 3 17 3 3 2.
+ <_>
+
+ <_>
+ 5 9 12 1 -1.
+ <_>
+ 9 9 4 1 3.
+ <_>
+
+ <_>
+ 3 9 12 1 -1.
+ <_>
+ 7 9 4 1 3.
+ <_>
+
+ <_>
+ 14 10 6 7 -1.
+ <_>
+ 14 10 3 7 2.
+ <_>
+
+ <_>
+ 1 0 16 2 -1.
+ <_>
+ 1 1 16 1 2.
+ <_>
+
+ <_>
+ 10 9 10 9 -1.
+ <_>
+ 10 12 10 3 3.
+ <_>
+
+ <_>
+ 0 1 10 2 -1.
+ <_>
+ 5 1 5 2 2.
+ <_>
+
+ <_>
+ 17 3 2 3 -1.
+ <_>
+ 17 4 2 1 3.
+ <_>
+
+ <_>
+ 1 3 2 3 -1.
+ <_>
+ 1 4 2 1 3.
+ <_>
+
+ <_>
+ 9 7 3 6 -1.
+ <_>
+ 10 7 1 6 3.
+ <_>
+
+ <_>
+ 6 5 4 3 -1.
+ <_>
+ 8 5 2 3 2.
+ <_>
+
+ <_>
+ 7 5 6 6 -1.
+ <_>
+ 9 5 2 6 3.
+ <_>
+
+ <_>
+ 3 4 12 12 -1.
+ <_>
+ 3 4 6 6 2.
+ <_>
+ 9 10 6 6 2.
+ <_>
+
+ <_>
+ 9 2 6 15 -1.
+ <_>
+ 11 2 2 15 3.
+ <_>
+
+ <_>
+ 2 2 6 17 -1.
+ <_>
+ 4 2 2 17 3.
+ <_>
+
+ <_>
+ 14 10 6 7 -1.
+ <_>
+ 14 10 3 7 2.
+ <_>
+
+ <_>
+ 0 10 6 7 -1.
+ <_>
+ 3 10 3 7 2.
+ <_>
+
+ <_>
+ 9 2 6 15 -1.
+ <_>
+ 11 2 2 15 3.
+ <_>
+
+ <_>
+ 5 2 6 15 -1.
+ <_>
+ 7 2 2 15 3.
+ <_>
+
+ <_>
+ 17 9 3 6 -1.
+ <_>
+ 17 11 3 2 3.
+ <_>
+
+ <_>
+ 6 7 6 6 -1.
+ <_>
+ 8 7 2 6 3.
+ <_>
+
+ <_>
+ 1 10 18 6 -1.
+ <_>
+ 10 10 9 3 2.
+ <_>
+ 1 13 9 3 2.
+ <_>
+
+ <_>
+ 0 9 10 9 -1.
+ <_>
+ 0 12 10 3 3.
+ <_>
+
+ <_>
+ 8 15 4 3 -1.
+ <_>
+ 8 16 4 1 3.
+ <_>
+
+ <_>
+ 5 12 3 4 -1.
+ <_>
+ 5 14 3 2 2.
+ <_>
+
+ <_>
+ 3 3 16 12 -1.
+ <_>
+ 3 9 16 6 2.
+ <_>
+
+ <_>
+ 1 1 12 12 -1.
+ <_>
+ 1 1 6 6 2.
+ <_>
+ 7 7 6 6 2.
+ <_>
+
+ <_>
+ 10 4 2 4 -1.
+ <_>
+ 11 4 1 2 2.
+ <_>
+ 10 6 1 2 2.
+ <_>
+
+ <_>
+ 0 9 10 2 -1.
+ <_>
+ 0 9 5 1 2.
+ <_>
+ 5 10 5 1 2.
+ <_>
+
+ <_>
+ 9 11 3 3 -1.
+ <_>
+ 9 12 3 1 3.
+ <_>
+
+ <_>
+ 3 12 9 2 -1.
+ <_>
+ 3 13 9 1 2.
+ <_>
+
+ <_>
+ 9 9 2 2 -1.
+ <_>
+ 9 10 2 1 2.
+ <_>
+
+ <_>
+ 3 4 13 6 -1.
+ <_>
+ 3 6 13 2 3.
+ <_>
+
+ <_>
+ 9 7 6 4 -1.
+ <_>
+ 12 7 3 2 2.
+ <_>
+ 9 9 3 2 2.
+ <_>
+
+ <_>
+ 1 0 6 8 -1.
+ <_>
+ 4 0 3 8 2.
+ <_>
+
+ <_>
+ 9 5 2 12 -1.
+ <_>
+ 9 11 2 6 2.
+ <_>
+
+ <_>
+ 4 4 3 10 -1.
+ <_>
+ 4 9 3 5 2.
+ <_>
+
+ <_>
+ 6 17 8 3 -1.
+ <_>
+ 6 18 8 1 3.
+ <_>
+
+ <_>
+ 0 5 10 6 -1.
+ <_>
+ 0 7 10 2 3.
+ <_>
+
+ <_>
+ 13 2 3 2 -1.
+ <_>
+ 13 3 3 1 2.
+ <_>
+
+ <_>
+ 7 5 4 5 -1.
+ <_>
+ 9 5 2 5 2.
+ <_>
+
+ <_>
+ 12 14 3 6 -1.
+ <_>
+ 12 16 3 2 3.
+ <_>
+
+ <_>
+ 1 11 8 2 -1.
+ <_>
+ 1 12 8 1 2.
+ <_>
+
+ <_>
+ 7 13 6 3 -1.
+ <_>
+ 7 14 6 1 3.
+ <_>
+
+ <_>
+ 0 5 3 6 -1.
+ <_>
+ 0 7 3 2 3.
+ <_>
+
+ <_>
+ 13 2 3 2 -1.
+ <_>
+ 13 3 3 1 2.
+ <_>
+
+ <_>
+ 4 14 4 6 -1.
+ <_>
+ 4 14 2 3 2.
+ <_>
+ 6 17 2 3 2.
+ <_>
+
+ <_>
+ 13 2 3 2 -1.
+ <_>
+ 13 3 3 1 2.
+ <_>
+
+ <_>
+ 8 2 4 12 -1.
+ <_>
+ 8 6 4 4 3.
+ <_>
+
+ <_>
+ 14 0 6 8 -1.
+ <_>
+ 17 0 3 4 2.
+ <_>
+ 14 4 3 4 2.
+ <_>
+
+ <_>
+ 7 17 3 2 -1.
+ <_>
+ 8 17 1 2 3.
+ <_>
+
+ <_>
+ 8 12 4 2 -1.
+ <_>
+ 8 13 4 1 2.
+ <_>
+
+ <_>
+ 6 0 8 12 -1.
+ <_>
+ 6 0 4 6 2.
+ <_>
+ 10 6 4 6 2.
+ <_>
+
+ <_>
+ 14 0 2 10 -1.
+ <_>
+ 15 0 1 5 2.
+ <_>
+ 14 5 1 5 2.
+ <_>
+
+ <_>
+ 5 3 8 6 -1.
+ <_>
+ 5 3 4 3 2.
+ <_>
+ 9 6 4 3 2.
+ <_>
+
+ <_>
+ 14 0 6 10 -1.
+ <_>
+ 17 0 3 5 2.
+ <_>
+ 14 5 3 5 2.
+ <_>
+
+ <_>
+ 9 14 1 2 -1.
+ <_>
+ 9 15 1 1 2.
+ <_>
+
+ <_>
+ 15 10 4 3 -1.
+ <_>
+ 15 11 4 1 3.
+ <_>
+
+ <_>
+ 8 14 2 3 -1.
+ <_>
+ 8 15 2 1 3.
+ <_>
+
+ <_>
+ 3 13 14 4 -1.
+ <_>
+ 10 13 7 2 2.
+ <_>
+ 3 15 7 2 2.
+ <_>
+
+ <_>
+ 1 10 4 3 -1.
+ <_>
+ 1 11 4 1 3.
+ <_>
+
+ <_>
+ 9 11 6 1 -1.
+ <_>
+ 11 11 2 1 3.
+ <_>
+
+ <_>
+ 5 11 6 1 -1.
+ <_>
+ 7 11 2 1 3.
+ <_>
+
+ <_>
+ 3 5 16 15 -1.
+ <_>
+ 3 10 16 5 3.
+ <_>
+
+ <_>
+ 6 12 4 2 -1.
+ <_>
+ 8 12 2 2 2.
+ <_>
+
+ <_>
+ 4 4 12 10 -1.
+ <_>
+ 10 4 6 5 2.
+ <_>
+ 4 9 6 5 2.
+ <_>
+
+ <_>
+ 8 6 3 4 -1.
+ <_>
+ 9 6 1 4 3.
+ <_>
+
+ <_>
+ 8 12 4 8 -1.
+ <_>
+ 10 12 2 4 2.
+ <_>
+ 8 16 2 4 2.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 12 2 3 2 -1.
+ <_>
+ 13 2 1 2 3.
+ <_>
+
+ <_>
+ 8 15 3 2 -1.
+ <_>
+ 8 16 3 1 2.
+ <_>
+
+ <_>
+ 6 0 9 14 -1.
+ <_>
+ 9 0 3 14 3.
+ <_>
+
+ <_>
+ 9 6 2 3 -1.
+ <_>
+ 10 6 1 3 2.
+ <_>
+
+ <_>
+ 10 8 2 3 -1.
+ <_>
+ 10 9 2 1 3.
+ <_>
+
+ <_>
+ 0 9 4 6 -1.
+ <_>
+ 0 11 4 2 3.
+ <_>
+
+ <_>
+ 6 0 8 2 -1.
+ <_>
+ 6 1 8 1 2.
+ <_>
+
+ <_>
+ 6 14 7 3 -1.
+ <_>
+ 6 15 7 1 3.
+ <_>
+
+ <_>
+ 8 10 8 9 -1.
+ <_>
+ 8 13 8 3 3.
+ <_>
+
+ <_>
+ 5 2 3 2 -1.
+ <_>
+ 6 2 1 2 3.
+ <_>
+
+ <_>
+ 14 1 6 8 -1.
+ <_>
+ 17 1 3 4 2.
+ <_>
+ 14 5 3 4 2.
+ <_>
+
+ <_>
+ 0 1 6 8 -1.
+ <_>
+ 0 1 3 4 2.
+ <_>
+ 3 5 3 4 2.
+ <_>
+
+ <_>
+ 1 2 18 6 -1.
+ <_>
+ 10 2 9 3 2.
+ <_>
+ 1 5 9 3 2.
+ <_>
+
+ <_>
+ 9 3 2 1 -1.
+ <_>
+ 10 3 1 1 2.
+ <_>
+
+ <_>
+ 13 2 4 6 -1.
+ <_>
+ 15 2 2 3 2.
+ <_>
+ 13 5 2 3 2.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 13 5 1 3 -1.
+ <_>
+ 13 6 1 1 3.
+ <_>
+
+ <_>
+ 2 16 5 3 -1.
+ <_>
+ 2 17 5 1 3.
+ <_>
+
+ <_>
+ 13 2 4 6 -1.
+ <_>
+ 15 2 2 3 2.
+ <_>
+ 13 5 2 3 2.
+ <_>
+
+ <_>
+ 3 2 4 6 -1.
+ <_>
+ 3 2 2 3 2.
+ <_>
+ 5 5 2 3 2.
+ <_>
+
+ <_>
+ 13 5 1 2 -1.
+ <_>
+ 13 6 1 1 2.
+ <_>
+
+ <_>
+ 5 5 2 2 -1.
+ <_>
+ 5 6 2 1 2.
+ <_>
+
+ <_>
+ 13 9 2 2 -1.
+ <_>
+ 13 9 1 2 2.
+ <_>
+
+ <_>
+ 5 9 2 2 -1.
+ <_>
+ 6 9 1 2 2.
+ <_>
+
+ <_>
+ 13 17 3 2 -1.
+ <_>
+ 13 18 3 1 2.
+ <_>
+
+ <_>
+ 6 16 4 4 -1.
+ <_>
+ 6 16 2 2 2.
+ <_>
+ 8 18 2 2 2.
+ <_>
+
+ <_>
+ 9 16 2 3 -1.
+ <_>
+ 9 17 2 1 3.
+ <_>
+
+ <_>
+ 0 13 9 6 -1.
+ <_>
+ 0 15 9 2 3.
+ <_>
+
+ <_>
+ 9 14 2 6 -1.
+ <_>
+ 9 17 2 3 2.
+ <_>
+
+ <_>
+ 9 15 2 3 -1.
+ <_>
+ 9 16 2 1 3.
+ <_>
+
+ <_>
+ 1 10 18 6 -1.
+ <_>
+ 1 12 18 2 3.
+ <_>
+
+ <_>
+ 8 11 4 2 -1.
+ <_>
+ 8 12 4 1 2.
+ <_>
+
+ <_>
+ 7 9 6 2 -1.
+ <_>
+ 7 10 6 1 2.
+ <_>
+
+ <_>
+ 8 8 2 3 -1.
+ <_>
+ 8 9 2 1 3.
+ <_>
+
+ <_>
+ 17 5 3 4 -1.
+ <_>
+ 18 5 1 4 3.
+ <_>
+
+ <_>
+ 1 19 18 1 -1.
+ <_>
+ 7 19 6 1 3.
+ <_>
+
+ <_>
+ 9 0 3 2 -1.
+ <_>
+ 10 0 1 2 3.
+ <_>
+
+ <_>
+ 1 8 1 6 -1.
+ <_>
+ 1 10 1 2 3.
+ <_>
+
+ <_>
+ 12 17 8 3 -1.
+ <_>
+ 12 17 4 3 2.
+ <_>
+
+ <_>
+ 0 5 3 4 -1.
+ <_>
+ 1 5 1 4 3.
+ <_>
+
+ <_>
+ 9 7 2 3 -1.
+ <_>
+ 9 8 2 1 3.
+ <_>
+
+ <_>
+ 7 11 2 2 -1.
+ <_>
+ 7 11 1 1 2.
+ <_>
+ 8 12 1 1 2.
+ <_>
+
+ <_>
+ 11 3 2 5 -1.
+ <_>
+ 11 3 1 5 2.
+ <_>
+
+ <_>
+ 7 3 2 5 -1.
+ <_>
+ 8 3 1 5 2.
+ <_>
+
+ <_>
+ 15 13 2 3 -1.
+ <_>
+ 15 14 2 1 3.
+ <_>
+
+ <_>
+ 5 6 2 3 -1.
+ <_>
+ 5 7 2 1 3.
+ <_>
+
+ <_>
+ 4 19 15 1 -1.
+ <_>
+ 9 19 5 1 3.
+ <_>
+
+ <_>
+ 1 19 15 1 -1.
+ <_>
+ 6 19 5 1 3.
+ <_>
+
+ <_>
+ 15 13 2 3 -1.
+ <_>
+ 15 14 2 1 3.
+ <_>
+
+ <_>
+ 5 0 4 15 -1.
+ <_>
+ 7 0 2 15 2.
+ <_>
+
+ <_>
+ 9 6 2 5 -1.
+ <_>
+ 9 6 1 5 2.
+ <_>
+
+ <_>
+ 9 5 2 7 -1.
+ <_>
+ 10 5 1 7 2.
+ <_>
+
+ <_>
+ 16 11 3 3 -1.
+ <_>
+ 16 12 3 1 3.
+ <_>
+
+ <_>
+ 1 11 3 3 -1.
+ <_>
+ 1 12 3 1 3.
+ <_>
+
+ <_>
+ 6 6 8 3 -1.
+ <_>
+ 6 7 8 1 3.
+ <_>
+
+ <_>
+ 0 15 6 2 -1.
+ <_>
+ 0 16 6 1 2.
+ <_>
+
+ <_>
+ 1 0 18 6 -1.
+ <_>
+ 7 0 6 6 3.
+ <_>
+
+ <_>
+ 6 0 3 4 -1.
+ <_>
+ 7 0 1 4 3.
+ <_>
+
+ <_>
+ 14 10 4 10 -1.
+ <_>
+ 16 10 2 5 2.
+ <_>
+ 14 15 2 5 2.
+ <_>
+
+ <_>
+ 3 2 3 2 -1.
+ <_>
+ 4 2 1 2 3.
+ <_>
+
+ <_>
+ 11 2 2 2 -1.
+ <_>
+ 11 3 2 1 2.
+ <_>
+
+ <_>
+ 2 10 4 10 -1.
+ <_>
+ 2 10 2 5 2.
+ <_>
+ 4 15 2 5 2.
+ <_>
+
+ <_>
+ 0 13 20 6 -1.
+ <_>
+ 10 13 10 3 2.
+ <_>
+ 0 16 10 3 2.
+ <_>
+
+ <_>
+ 0 5 2 15 -1.
+ <_>
+ 1 5 1 15 2.
+ <_>
+
+ <_>
+ 1 7 18 4 -1.
+ <_>
+ 10 7 9 2 2.
+ <_>
+ 1 9 9 2 2.
+ <_>
+
+ <_>
+ 0 0 2 17 -1.
+ <_>
+ 1 0 1 17 2.
+ <_>
+
+ <_>
+ 2 6 16 6 -1.
+ <_>
+ 10 6 8 3 2.
+ <_>
+ 2 9 8 3 2.
+ <_>
+
+ <_>
+ 8 14 1 3 -1.
+ <_>
+ 8 15 1 1 3.
+ <_>
+
+ <_>
+ 8 15 4 2 -1.
+ <_>
+ 8 16 4 1 2.
+ <_>
+
+ <_>
+ 5 2 8 2 -1.
+ <_>
+ 5 2 4 1 2.
+ <_>
+ 9 3 4 1 2.
+ <_>
+
+ <_>
+ 6 11 8 6 -1.
+ <_>
+ 6 14 8 3 2.
+ <_>
+
+ <_>
+ 9 13 2 2 -1.
+ <_>
+ 9 14 2 1 2.
+ <_>
+
+ <_>
+ 18 4 2 6 -1.
+ <_>
+ 18 6 2 2 3.
+ <_>
+
+ <_>
+ 9 12 2 2 -1.
+ <_>
+ 9 13 2 1 2.
+ <_>
+
+ <_>
+ 18 4 2 6 -1.
+ <_>
+ 18 6 2 2 3.
+ <_>
+
+ <_>
+ 9 13 1 3 -1.
+ <_>
+ 9 14 1 1 3.
+ <_>
+
+ <_>
+ 18 4 2 6 -1.
+ <_>
+ 18 6 2 2 3.
+ <_>
+
+ <_>
+ 0 4 2 6 -1.
+ <_>
+ 0 6 2 2 3.
+ <_>
+
+ <_>
+ 9 12 3 3 -1.
+ <_>
+ 9 13 3 1 3.
+ <_>
+
+ <_>
+ 3 13 2 3 -1.
+ <_>
+ 3 14 2 1 3.
+ <_>
+
+ <_>
+ 13 13 4 3 -1.
+ <_>
+ 13 14 4 1 3.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 5 2 10 6 -1.
+ <_>
+ 5 4 10 2 3.
+ <_>
+
+ <_>
+ 3 13 4 3 -1.
+ <_>
+ 3 14 4 1 3.
+ <_>
+
+ <_>
+ 3 7 15 5 -1.
+ <_>
+ 8 7 5 5 3.
+ <_>
+
+ <_>
+ 3 7 12 2 -1.
+ <_>
+ 7 7 4 2 3.
+ <_>
+
+ <_>
+ 10 3 3 9 -1.
+ <_>
+ 11 3 1 9 3.
+ <_>
+
+ <_>
+ 8 6 4 6 -1.
+ <_>
+ 10 6 2 6 2.
+ <_>
+
+ <_>
+ 9 7 4 3 -1.
+ <_>
+ 9 8 4 1 3.
+ <_>
+
+ <_>
+ 0 9 4 9 -1.
+ <_>
+ 2 9 2 9 2.
+ <_>
+
+ <_>
+ 9 13 3 5 -1.
+ <_>
+ 10 13 1 5 3.
+ <_>
+
+ <_>
+ 7 7 6 3 -1.
+ <_>
+ 9 7 2 3 3.
+ <_>
+
+ <_>
+ 9 7 3 5 -1.
+ <_>
+ 10 7 1 5 3.
+ <_>
+
+ <_>
+ 5 7 8 2 -1.
+ <_>
+ 9 7 4 2 2.
+ <_>
+
+ <_>
+ 5 9 12 2 -1.
+ <_>
+ 9 9 4 2 3.
+ <_>
+
+ <_>
+ 5 6 10 3 -1.
+ <_>
+ 10 6 5 3 2.
+ <_>
+
+ <_>
+ 10 12 3 1 -1.
+ <_>
+ 11 12 1 1 3.
+ <_>
+
+ <_>
+ 0 1 11 15 -1.
+ <_>
+ 0 6 11 5 3.
+ <_>
+
+ <_>
+ 1 0 18 6 -1.
+ <_>
+ 7 0 6 6 3.
+ <_>
+
+ <_>
+ 7 7 6 1 -1.
+ <_>
+ 9 7 2 1 3.
+ <_>
+
+ <_>
+ 5 16 6 4 -1.
+ <_>
+ 5 16 3 2 2.
+ <_>
+ 8 18 3 2 2.
+ <_>
+
+ <_>
+ 6 5 9 8 -1.
+ <_>
+ 6 9 9 4 2.
+ <_>
+
+ <_>
+ 5 10 2 6 -1.
+ <_>
+ 5 13 2 3 2.
+ <_>
+
+ <_>
+ 7 6 8 10 -1.
+ <_>
+ 11 6 4 5 2.
+ <_>
+ 7 11 4 5 2.
+ <_>
+
+ <_>
+ 5 6 8 10 -1.
+ <_>
+ 5 6 4 5 2.
+ <_>
+ 9 11 4 5 2.
+ <_>
+
+ <_>
+ 9 5 2 2 -1.
+ <_>
+ 9 6 2 1 2.
+ <_>
+
+ <_>
+ 5 12 8 2 -1.
+ <_>
+ 5 13 8 1 2.
+ <_>
+
+ <_>
+ 10 2 8 2 -1.
+ <_>
+ 10 3 8 1 2.
+ <_>
+
+ <_>
+ 4 0 2 10 -1.
+ <_>
+ 4 0 1 5 2.
+ <_>
+ 5 5 1 5 2.
+ <_>
+
+ <_>
+ 9 10 2 2 -1.
+ <_>
+ 9 11 2 1 2.
+ <_>
+
+ <_>
+ 2 8 15 3 -1.
+ <_>
+ 2 9 15 1 3.
+ <_>
+
+ <_>
+ 8 13 4 3 -1.
+ <_>
+ 8 14 4 1 3.
+ <_>
+
+ <_>
+ 7 2 3 2 -1.
+ <_>
+ 8 2 1 2 3.
+ <_>
+
+ <_>
+ 7 13 6 3 -1.
+ <_>
+ 7 14 6 1 3.
+ <_>
+
+ <_>
+ 9 9 2 2 -1.
+ <_>
+ 9 10 2 1 2.
+ <_>
+
+ <_>
+ 17 2 3 6 -1.
+ <_>
+ 17 4 3 2 3.
+ <_>
+
+ <_>
+ 1 5 3 4 -1.
+ <_>
+ 2 5 1 4 3.
+ <_>
+
+ <_>
+ 14 8 4 6 -1.
+ <_>
+ 14 10 4 2 3.
+ <_>
+
+ <_>
+ 1 4 3 8 -1.
+ <_>
+ 2 4 1 8 3.
+ <_>
+
+ <_>
+ 8 13 4 6 -1.
+ <_>
+ 8 16 4 3 2.
+ <_>
+
+ <_>
+ 3 14 2 2 -1.
+ <_>
+ 3 15 2 1 2.
+ <_>
+
+ <_>
+ 14 8 4 6 -1.
+ <_>
+ 14 10 4 2 3.
+ <_>
+
+ <_>
+ 2 8 4 6 -1.
+ <_>
+ 2 10 4 2 3.
+ <_>
+
+ <_>
+ 10 14 1 6 -1.
+ <_>
+ 10 17 1 3 2.
+ <_>
+
+ <_>
+ 7 5 3 6 -1.
+ <_>
+ 8 5 1 6 3.
+ <_>
+
+ <_>
+ 11 2 2 6 -1.
+ <_>
+ 12 2 1 3 2.
+ <_>
+ 11 5 1 3 2.
+ <_>
+
+ <_>
+ 6 6 6 5 -1.
+ <_>
+ 8 6 2 5 3.
+ <_>
+
+ <_>
+ 17 1 3 6 -1.
+ <_>
+ 17 3 3 2 3.
+ <_>
+
+ <_>
+ 8 7 3 5 -1.
+ <_>
+ 9 7 1 5 3.
+ <_>
+
+ <_>
+ 9 18 3 2 -1.
+ <_>
+ 10 18 1 2 3.
+ <_>
+
+ <_>
+ 8 18 3 2 -1.
+ <_>
+ 9 18 1 2 3.
+ <_>
+
+ <_>
+ 12 3 5 2 -1.
+ <_>
+ 12 4 5 1 2.
+ <_>
+
+ <_>
+ 7 1 5 12 -1.
+ <_>
+ 7 7 5 6 2.
+ <_>
+
+ <_>
+ 1 0 18 4 -1.
+ <_>
+ 7 0 6 4 3.
+ <_>
+
+ <_>
+ 4 2 2 2 -1.
+ <_>
+ 4 3 2 1 2.
+ <_>
+
+ <_>
+ 11 14 4 2 -1.
+ <_>
+ 13 14 2 1 2.
+ <_>
+ 11 15 2 1 2.
+ <_>
+
+ <_>
+ 0 2 3 6 -1.
+ <_>
+ 0 4 3 2 3.
+ <_>
+
+ <_>
+ 9 7 2 3 -1.
+ <_>
+ 9 8 2 1 3.
+ <_>
+
+ <_>
+ 5 5 1 3 -1.
+ <_>
+ 5 6 1 1 3.
+ <_>
+
+ <_>
+ 10 10 6 1 -1.
+ <_>
+ 10 10 3 1 2.
+ <_>
+
+ <_>
+ 4 10 6 1 -1.
+ <_>
+ 7 10 3 1 2.
+ <_>
+
+ <_>
+ 9 17 3 3 -1.
+ <_>
+ 9 18 3 1 3.
+ <_>
+
+ <_>
+ 4 14 1 3 -1.
+ <_>
+ 4 15 1 1 3.
+ <_>
+
+ <_>
+ 12 5 3 3 -1.
+ <_>
+ 12 6 3 1 3.
+ <_>
+
+ <_>
+ 4 5 12 3 -1.
+ <_>
+ 4 6 12 1 3.
+ <_>
+
+ <_>
+ 9 8 2 3 -1.
+ <_>
+ 9 9 2 1 3.
+ <_>
+
+ <_>
+ 4 9 3 3 -1.
+ <_>
+ 5 9 1 3 3.
+ <_>
+
+ <_>
+ 6 0 9 17 -1.
+ <_>
+ 9 0 3 17 3.
+ <_>
+
+ <_>
+ 9 12 1 3 -1.
+ <_>
+ 9 13 1 1 3.
+ <_>
+
+ <_>
+ 9 5 2 15 -1.
+ <_>
+ 9 10 2 5 3.
+ <_>
+
+ <_>
+ 8 14 2 3 -1.
+ <_>
+ 8 15 2 1 3.
+ <_>
+
+ <_>
+ 10 14 1 3 -1.
+ <_>
+ 10 15 1 1 3.
+ <_>
+
+ <_>
+ 7 1 6 5 -1.
+ <_>
+ 9 1 2 5 3.
+ <_>
+
+ <_>
+ 0 0 20 2 -1.
+ <_>
+ 0 0 10 2 2.
+ <_>
+
+ <_>
+ 2 13 5 3 -1.
+ <_>
+ 2 14 5 1 3.
+ <_>
+
+ <_>
+ 9 11 2 3 -1.
+ <_>
+ 9 12 2 1 3.
+ <_>
+
+ <_>
+ 2 5 9 15 -1.
+ <_>
+ 2 10 9 5 3.
+ <_>
+
+ <_>
+ 5 0 12 10 -1.
+ <_>
+ 11 0 6 5 2.
+ <_>
+ 5 5 6 5 2.
+ <_>
+
+ <_>
+ 5 1 2 3 -1.
+ <_>
+ 6 1 1 3 2.
+ <_>
+
+ <_>
+ 10 7 6 1 -1.
+ <_>
+ 12 7 2 1 3.
+ <_>
+
+ <_>
+ 3 1 2 10 -1.
+ <_>
+ 3 1 1 5 2.
+ <_>
+ 4 6 1 5 2.
+ <_>
+
+ <_>
+ 13 7 2 1 -1.
+ <_>
+ 13 7 1 1 2.
+ <_>
+
+ <_>
+ 4 13 4 6 -1.
+ <_>
+ 4 15 4 2 3.
+ <_>
+
+ <_>
+ 13 7 2 1 -1.
+ <_>
+ 13 7 1 1 2.
+ <_>
+
+ <_>
+ 5 7 2 1 -1.
+ <_>
+ 6 7 1 1 2.
+ <_>
+
+ <_>
+ 2 12 18 4 -1.
+ <_>
+ 11 12 9 2 2.
+ <_>
+ 2 14 9 2 2.
+ <_>
+
+ <_>
+ 5 7 2 2 -1.
+ <_>
+ 5 7 1 1 2.
+ <_>
+ 6 8 1 1 2.
+ <_>
+
+ <_>
+ 16 3 4 2 -1.
+ <_>
+ 16 4 4 1 2.
+ <_>
+
+ <_>
+ 0 2 2 18 -1.
+ <_>
+ 0 2 1 9 2.
+ <_>
+ 1 11 1 9 2.
+ <_>
+
+ <_>
+ 1 2 18 4 -1.
+ <_>
+ 10 2 9 2 2.
+ <_>
+ 1 4 9 2 2.
+ <_>
+
+ <_>
+ 9 14 1 3 -1.
+ <_>
+ 9 15 1 1 3.
+ <_>
+
+ <_>
+ 2 12 18 4 -1.
+ <_>
+ 11 12 9 2 2.
+ <_>
+ 2 14 9 2 2.
+ <_>
+
+ <_>
+ 0 12 18 4 -1.
+ <_>
+ 0 12 9 2 2.
+ <_>
+ 9 14 9 2 2.
+ <_>
+
+ <_>
+ 11 4 5 3 -1.
+ <_>
+ 11 5 5 1 3.
+ <_>
+
+ <_>
+ 6 4 7 3 -1.
+ <_>
+ 6 5 7 1 3.
+ <_>
+
+ <_>
+ 13 17 3 3 -1.
+ <_>
+ 13 18 3 1 3.
+ <_>
+
+ <_>
+ 8 1 3 4 -1.
+ <_>
+ 9 1 1 4 3.
+ <_>
+
+ <_>
+ 11 4 2 4 -1.
+ <_>
+ 11 4 1 4 2.
+ <_>
+
+ <_>
+ 0 17 9 3 -1.
+ <_>
+ 3 17 3 3 3.
+ <_>
+
+ <_>
+ 11 0 2 8 -1.
+ <_>
+ 12 0 1 4 2.
+ <_>
+ 11 4 1 4 2.
+ <_>
+
+ <_>
+ 0 8 6 12 -1.
+ <_>
+ 0 8 3 6 2.
+ <_>
+ 3 14 3 6 2.
+ <_>
+
+ <_>
+ 10 7 4 12 -1.
+ <_>
+ 10 13 4 6 2.
+ <_>
+
+ <_>
+ 5 3 8 14 -1.
+ <_>
+ 5 10 8 7 2.
+ <_>
+
+ <_>
+ 14 10 6 1 -1.
+ <_>
+ 14 10 3 1 2.
+ <_>
+
+ <_>
+ 0 4 10 4 -1.
+ <_>
+ 0 6 10 2 2.
+ <_>
+
+ <_>
+ 10 0 5 8 -1.
+ <_>
+ 10 4 5 4 2.
+ <_>
+
+ <_>
+ 8 1 4 8 -1.
+ <_>
+ 8 1 2 4 2.
+ <_>
+ 10 5 2 4 2.
+ <_>
+
+ <_>
+ 9 11 6 1 -1.
+ <_>
+ 11 11 2 1 3.
+ <_>
+
+ <_>
+ 8 9 3 4 -1.
+ <_>
+ 9 9 1 4 3.
+ <_>
+
+ <_>
+ 18 4 2 6 -1.
+ <_>
+ 18 6 2 2 3.
+ <_>
+
+ <_>
+ 8 8 3 4 -1.
+ <_>
+ 9 8 1 4 3.
+ <_>
+
+ <_>
+ 7 1 13 3 -1.
+ <_>
+ 7 2 13 1 3.
+ <_>
+
+ <_>
+ 7 13 6 1 -1.
+ <_>
+ 9 13 2 1 3.
+ <_>
+
+ <_>
+ 12 11 3 6 -1.
+ <_>
+ 12 13 3 2 3.
+ <_>
+
+ <_>
+ 5 11 6 1 -1.
+ <_>
+ 7 11 2 1 3.
+ <_>
+
+ <_>
+ 1 4 18 10 -1.
+ <_>
+ 10 4 9 5 2.
+ <_>
+ 1 9 9 5 2.
+ <_>
+
+ <_>
+ 8 6 4 9 -1.
+ <_>
+ 8 9 4 3 3.
+ <_>
+
+ <_>
+ 8 6 4 3 -1.
+ <_>
+ 8 7 4 1 3.
+ <_>
+
+ <_>
+ 8 7 3 3 -1.
+ <_>
+ 9 7 1 3 3.
+ <_>
+
+ <_>
+ 14 15 4 3 -1.
+ <_>
+ 14 16 4 1 3.
+ <_>
+
+ <_>
+ 5 10 3 10 -1.
+ <_>
+ 6 10 1 10 3.
+ <_>
+
+ <_>
+ 8 15 4 3 -1.
+ <_>
+ 8 16 4 1 3.
+ <_>
+
+ <_>
+ 0 8 1 6 -1.
+ <_>
+ 0 10 1 2 3.
+ <_>
+
+ <_>
+ 10 15 1 3 -1.
+ <_>
+ 10 16 1 1 3.
+ <_>
+
+ <_>
+ 2 15 4 3 -1.
+ <_>
+ 2 16 4 1 3.
+ <_>
+
+ <_>
+ 18 3 2 8 -1.
+ <_>
+ 19 3 1 4 2.
+ <_>
+ 18 7 1 4 2.
+ <_>
+
+ <_>
+ 0 3 2 8 -1.
+ <_>
+ 0 3 1 4 2.
+ <_>
+ 1 7 1 4 2.
+ <_>
+
+ <_>
+ 3 7 14 10 -1.
+ <_>
+ 10 7 7 5 2.
+ <_>
+ 3 12 7 5 2.
+ <_>
+
+ <_>
+ 0 7 19 3 -1.
+ <_>
+ 0 8 19 1 3.
+ <_>
+
+ <_>
+ 12 6 3 3 -1.
+ <_>
+ 12 7 3 1 3.
+ <_>
+
+ <_>
+ 0 6 1 3 -1.
+ <_>
+ 0 7 1 1 3.
+ <_>
+
+ <_>
+ 12 6 3 3 -1.
+ <_>
+ 12 7 3 1 3.
+ <_>
+
+ <_>
+ 5 6 3 3 -1.
+ <_>
+ 5 7 3 1 3.
+ <_>
+
+ <_>
+ 8 2 4 2 -1.
+ <_>
+ 8 3 4 1 2.
+ <_>
+
+ <_>
+ 6 3 4 12 -1.
+ <_>
+ 8 3 2 12 2.
+ <_>
+
+ <_>
+ 13 6 2 3 -1.
+ <_>
+ 13 7 2 1 3.
+ <_>
+
+ <_>
+ 0 10 20 4 -1.
+ <_>
+ 0 12 20 2 2.
+ <_>
+
+ <_>
+ 2 0 17 14 -1.
+ <_>
+ 2 7 17 7 2.
+ <_>
+
+ <_>
+ 0 0 6 10 -1.
+ <_>
+ 0 0 3 5 2.
+ <_>
+ 3 5 3 5 2.
+ <_>
+
+ <_>
+ 14 6 6 4 -1.
+ <_>
+ 14 6 3 4 2.
+ <_>
+
+ <_>
+ 0 6 6 4 -1.
+ <_>
+ 3 6 3 4 2.
+ <_>
+
+ <_>
+ 13 2 7 2 -1.
+ <_>
+ 13 3 7 1 2.
+ <_>
+
+ <_>
+ 0 2 7 2 -1.
+ <_>
+ 0 3 7 1 2.
+ <_>
+
+ <_>
+ 6 11 14 2 -1.
+ <_>
+ 13 11 7 1 2.
+ <_>
+ 6 12 7 1 2.
+ <_>
+
+ <_>
+ 8 5 2 2 -1.
+ <_>
+ 8 5 1 1 2.
+ <_>
+ 9 6 1 1 2.
+ <_>
+
+ <_>
+ 13 9 2 3 -1.
+ <_>
+ 13 9 1 3 2.
+ <_>
+
+ <_>
+ 1 1 3 12 -1.
+ <_>
+ 2 1 1 12 3.
+ <_>
+
+ <_>
+ 17 4 1 3 -1.
+ <_>
+ 17 5 1 1 3.
+ <_>
+
+ <_>
+ 2 4 1 3 -1.
+ <_>
+ 2 5 1 1 3.
+ <_>
+
+ <_>
+ 14 5 1 3 -1.
+ <_>
+ 14 6 1 1 3.
+ <_>
+
+ <_>
+ 7 16 2 3 -1.
+ <_>
+ 7 17 2 1 3.
+ <_>
+
+ <_>
+ 8 13 4 6 -1.
+ <_>
+ 10 13 2 3 2.
+ <_>
+ 8 16 2 3 2.
+ <_>
+
+ <_>
+ 5 5 1 3 -1.
+ <_>
+ 5 6 1 1 3.
+ <_>
+
+ <_>
+ 16 0 4 20 -1.
+ <_>
+ 16 0 2 20 2.
+ <_>
+
+ <_>
+ 5 1 2 6 -1.
+ <_>
+ 5 1 1 3 2.
+ <_>
+ 6 4 1 3 2.
+ <_>
+
+ <_>
+ 5 4 10 4 -1.
+ <_>
+ 5 6 10 2 2.
+ <_>
+
+ <_>
+ 15 2 4 12 -1.
+ <_>
+ 15 2 2 12 2.
+ <_>
+
+ <_>
+ 7 6 4 12 -1.
+ <_>
+ 7 12 4 6 2.
+ <_>
+
+ <_>
+ 14 5 1 8 -1.
+ <_>
+ 14 9 1 4 2.
+ <_>
+
+ <_>
+ 1 4 14 10 -1.
+ <_>
+ 1 4 7 5 2.
+ <_>
+ 8 9 7 5 2.
+ <_>
+
+ <_>
+ 11 6 6 14 -1.
+ <_>
+ 14 6 3 7 2.
+ <_>
+ 11 13 3 7 2.
+ <_>
+
+ <_>
+ 3 6 6 14 -1.
+ <_>
+ 3 6 3 7 2.
+ <_>
+ 6 13 3 7 2.
+ <_>
+
+ <_>
+ 4 9 15 2 -1.
+ <_>
+ 9 9 5 2 3.
+ <_>
+
+ <_>
+ 7 14 6 3 -1.
+ <_>
+ 7 15 6 1 3.
+ <_>
+
+ <_>
+ 6 3 14 4 -1.
+ <_>
+ 13 3 7 2 2.
+ <_>
+ 6 5 7 2 2.
+ <_>
+
+ <_>
+ 1 9 15 2 -1.
+ <_>
+ 6 9 5 2 3.
+ <_>
+
+ <_>
+ 6 11 8 9 -1.
+ <_>
+ 6 14 8 3 3.
+ <_>
+
+ <_>
+ 7 4 3 8 -1.
+ <_>
+ 8 4 1 8 3.
+ <_>
+
+ <_>
+ 14 6 2 6 -1.
+ <_>
+ 14 9 2 3 2.
+ <_>
+
+ <_>
+ 5 7 6 4 -1.
+ <_>
+ 5 7 3 2 2.
+ <_>
+ 8 9 3 2 2.
+ <_>
+
+ <_>
+ 1 1 18 19 -1.
+ <_>
+ 7 1 6 19 3.
+ <_>
+
+ <_>
+ 1 2 6 5 -1.
+ <_>
+ 4 2 3 5 2.
+ <_>
+
+ <_>
+ 12 17 6 2 -1.
+ <_>
+ 12 18 6 1 2.
+ <_>
+
+ <_>
+ 2 17 6 2 -1.
+ <_>
+ 2 18 6 1 2.
+ <_>
+
+ <_>
+ 17 3 3 6 -1.
+ <_>
+ 17 5 3 2 3.
+ <_>
+
+ <_>
+ 8 17 3 3 -1.
+ <_>
+ 8 18 3 1 3.
+ <_>
+
+ <_>
+ 10 13 2 6 -1.
+ <_>
+ 10 16 2 3 2.
+ <_>
+
+ <_>
+ 7 13 6 3 -1.
+ <_>
+ 7 14 6 1 3.
+ <_>
+
+ <_>
+ 17 3 3 6 -1.
+ <_>
+ 17 5 3 2 3.
+ <_>
+
+ <_>
+ 8 13 2 3 -1.
+ <_>
+ 8 14 2 1 3.
+ <_>
+
+ <_>
+ 9 3 6 2 -1.
+ <_>
+ 11 3 2 2 3.
+ <_>
+
+ <_>
+ 0 3 3 6 -1.
+ <_>
+ 0 5 3 2 3.
+ <_>
+
+ <_>
+ 8 5 4 6 -1.
+ <_>
+ 8 7 4 2 3.
+ <_>
+
+ <_>
+ 5 5 3 2 -1.
+ <_>
+ 5 6 3 1 2.
+ <_>
+
+ <_>
+ 10 1 3 4 -1.
+ <_>
+ 11 1 1 4 3.
+ <_>
+
+ <_>
+ 1 2 5 9 -1.
+ <_>
+ 1 5 5 3 3.
+ <_>
+
+ <_>
+ 13 6 2 3 -1.
+ <_>
+ 13 7 2 1 3.
+ <_>
+
+ <_>
+ 0 6 14 3 -1.
+ <_>
+ 7 6 7 3 2.
+ <_>
+
+ <_>
+ 2 11 18 8 -1.
+ <_>
+ 2 15 18 4 2.
+ <_>
+
+ <_>
+ 5 6 2 3 -1.
+ <_>
+ 5 7 2 1 3.
+ <_>
+
+ <_>
+ 10 6 4 2 -1.
+ <_>
+ 12 6 2 1 2.
+ <_>
+ 10 7 2 1 2.
+ <_>
+
+ <_>
+ 6 6 4 2 -1.
+ <_>
+ 6 6 2 1 2.
+ <_>
+ 8 7 2 1 2.
+ <_>
+
+ <_>
+ 10 1 3 4 -1.
+ <_>
+ 11 1 1 4 3.
+ <_>
+
+ <_>
+ 7 1 2 7 -1.
+ <_>
+ 8 1 1 7 2.
+ <_>
+
+ <_>
+ 4 2 15 14 -1.
+ <_>
+ 4 9 15 7 2.
+ <_>
+
+ <_>
+ 8 7 3 2 -1.
+ <_>
+ 9 7 1 2 3.
+ <_>
+
+ <_>
+ 2 3 18 4 -1.
+ <_>
+ 11 3 9 2 2.
+ <_>
+ 2 5 9 2 2.
+ <_>
+
+ <_>
+ 9 7 2 2 -1.
+ <_>
+ 10 7 1 2 2.
+ <_>
+
+ <_>
+ 13 9 2 3 -1.
+ <_>
+ 13 9 1 3 2.
+ <_>
+
+ <_>
+ 5 2 6 2 -1.
+ <_>
+ 7 2 2 2 3.
+ <_>
+
+ <_>
+ 9 5 2 7 -1.
+ <_>
+ 9 5 1 7 2.
+ <_>
+
+ <_>
+ 5 9 2 3 -1.
+ <_>
+ 6 9 1 3 2.
+ <_>
+
+ <_>
+ 6 0 14 18 -1.
+ <_>
+ 6 9 14 9 2.
+ <_>
+
+ <_>
+ 2 16 6 3 -1.
+ <_>
+ 2 17 6 1 3.
+ <_>
+
+ <_>
+ 9 7 3 6 -1.
+ <_>
+ 10 7 1 6 3.
+ <_>
+
+ <_>
+ 7 8 4 3 -1.
+ <_>
+ 7 9 4 1 3.
+ <_>
+
+ <_>
+ 7 12 6 3 -1.
+ <_>
+ 7 13 6 1 3.
+ <_>
+
+ <_>
+ 9 12 2 3 -1.
+ <_>
+ 9 13 2 1 3.
+ <_>
+
+ <_>
+ 7 12 6 2 -1.
+ <_>
+ 9 12 2 2 3.
+ <_>
+
+ <_>
+ 5 11 4 6 -1.
+ <_>
+ 5 14 4 3 2.
+ <_>
+
+ <_>
+ 11 12 7 2 -1.
+ <_>
+ 11 13 7 1 2.
+ <_>
+
+ <_>
+ 6 10 8 6 -1.
+ <_>
+ 6 10 4 3 2.
+ <_>
+ 10 13 4 3 2.
+ <_>
+
+ <_>
+ 11 10 3 4 -1.
+ <_>
+ 11 12 3 2 2.
+ <_>
+
+ <_>
+ 9 16 2 3 -1.
+ <_>
+ 9 17 2 1 3.
+ <_>
+
+ <_>
+ 13 3 1 9 -1.
+ <_>
+ 13 6 1 3 3.
+ <_>
+
+ <_>
+ 1 13 14 6 -1.
+ <_>
+ 1 15 14 2 3.
+ <_>
+
+ <_>
+ 13 6 1 6 -1.
+ <_>
+ 13 9 1 3 2.
+ <_>
+
+ <_>
+ 0 4 3 8 -1.
+ <_>
+ 1 4 1 8 3.
+ <_>
+
+ <_>
+ 18 0 2 18 -1.
+ <_>
+ 18 0 1 18 2.
+ <_>
+
+ <_>
+ 2 3 6 2 -1.
+ <_>
+ 2 4 6 1 2.
+ <_>
+
+ <_>
+ 9 0 8 6 -1.
+ <_>
+ 9 2 8 2 3.
+ <_>
+
+ <_>
+ 6 6 1 6 -1.
+ <_>
+ 6 9 1 3 2.
+ <_>
+
+ <_>
+ 14 8 6 3 -1.
+ <_>
+ 14 9 6 1 3.
+ <_>
+
+ <_>
+ 0 0 2 18 -1.
+ <_>
+ 1 0 1 18 2.
+ <_>
+
+ <_>
+ 1 18 18 2 -1.
+ <_>
+ 10 18 9 1 2.
+ <_>
+ 1 19 9 1 2.
+ <_>
+
+ <_>
+ 3 15 2 2 -1.
+ <_>
+ 3 16 2 1 2.
+ <_>
+
+ <_>
+ 8 14 5 3 -1.
+ <_>
+ 8 15 5 1 3.
+ <_>
+
+ <_>
+ 8 14 2 3 -1.
+ <_>
+ 8 15 2 1 3.
+ <_>
+
+ <_>
+ 12 3 3 3 -1.
+ <_>
+ 13 3 1 3 3.
+ <_>
+
+ <_>
+ 7 5 6 2 -1.
+ <_>
+ 9 5 2 2 3.
+ <_>
+
+ <_>
+ 15 5 5 2 -1.
+ <_>
+ 15 6 5 1 2.
+ <_>
+
+ <_>
+ 0 5 5 2 -1.
+ <_>
+ 0 6 5 1 2.
+ <_>
+
+ <_>
+ 17 14 1 6 -1.
+ <_>
+ 17 17 1 3 2.
+ <_>
+
+ <_>
+ 2 9 9 3 -1.
+ <_>
+ 5 9 3 3 3.
+ <_>
+
+ <_>
+ 12 3 3 3 -1.
+ <_>
+ 13 3 1 3 3.
+ <_>
+
+ <_>
+ 0 0 4 18 -1.
+ <_>
+ 2 0 2 18 2.
+ <_>
+
+ <_>
+ 17 6 1 3 -1.
+ <_>
+ 17 7 1 1 3.
+ <_>
+
+ <_>
+ 2 14 1 6 -1.
+ <_>
+ 2 17 1 3 2.
+ <_>
+
+ <_>
+ 19 8 1 2 -1.
+ <_>
+ 19 9 1 1 2.
+ <_>
+
+ <_>
+ 5 3 3 3 -1.
+ <_>
+ 6 3 1 3 3.
+ <_>
+
+ <_>
+ 9 16 2 3 -1.
+ <_>
+ 9 17 2 1 3.
+ <_>
+
+ <_>
+ 2 6 1 3 -1.
+ <_>
+ 2 7 1 1 3.
+ <_>
+
+ <_>
+ 12 4 8 2 -1.
+ <_>
+ 16 4 4 1 2.
+ <_>
+ 12 5 4 1 2.
+ <_>
+
+ <_>
+ 0 4 8 2 -1.
+ <_>
+ 0 4 4 1 2.
+ <_>
+ 4 5 4 1 2.
+ <_>
+
+ <_>
+ 2 16 18 4 -1.
+ <_>
+ 2 18 18 2 2.
+ <_>
+
+ <_>
+ 7 15 2 4 -1.
+ <_>
+ 7 17 2 2 2.
+ <_>
+
+ <_>
+ 4 0 14 3 -1.
+ <_>
+ 4 1 14 1 3.
+ <_>
+
+ <_>
+ 0 0 4 20 -1.
+ <_>
+ 2 0 2 20 2.
+ <_>
+
+ <_>
+ 12 4 4 8 -1.
+ <_>
+ 14 4 2 4 2.
+ <_>
+ 12 8 2 4 2.
+ <_>
+
+ <_>
+ 6 7 2 2 -1.
+ <_>
+ 6 7 1 1 2.
+ <_>
+ 7 8 1 1 2.
+ <_>
+
+ <_>
+ 10 6 2 3 -1.
+ <_>
+ 10 7 2 1 3.
+ <_>
+
+ <_>
+ 8 7 3 2 -1.
+ <_>
+ 8 8 3 1 2.
+ <_>
+
+ <_>
+ 8 2 6 12 -1.
+ <_>
+ 8 8 6 6 2.
+ <_>
+
+ <_>
+ 4 0 11 12 -1.
+ <_>
+ 4 4 11 4 3.
+ <_>
+
+ <_>
+ 14 9 6 11 -1.
+ <_>
+ 16 9 2 11 3.
+ <_>
+
+ <_>
+ 0 14 4 3 -1.
+ <_>
+ 0 15 4 1 3.
+ <_>
+
+ <_>
+ 9 10 2 3 -1.
+ <_>
+ 9 11 2 1 3.
+ <_>
+
+ <_>
+ 5 11 3 2 -1.
+ <_>
+ 5 12 3 1 2.
+ <_>
+
+ <_>
+ 9 15 3 3 -1.
+ <_>
+ 10 15 1 3 3.
+ <_>
+
+ <_>
+ 8 8 3 4 -1.
+ <_>
+ 9 8 1 4 3.
+ <_>
+
+ <_>
+ 9 15 3 3 -1.
+ <_>
+ 10 15 1 3 3.
+ <_>
+
+ <_>
+ 7 7 3 2 -1.
+ <_>
+ 8 7 1 2 3.
+ <_>
+
+ <_>
+ 2 10 16 4 -1.
+ <_>
+ 10 10 8 2 2.
+ <_>
+ 2 12 8 2 2.
+ <_>
+
+ <_>
+ 2 3 4 17 -1.
+ <_>
+ 4 3 2 17 2.
+ <_>
+
+ <_>
+ 15 13 2 7 -1.
+ <_>
+ 15 13 1 7 2.
+ <_>
+
+ <_>
+ 2 2 6 1 -1.
+ <_>
+ 5 2 3 1 2.
+ <_>
+
+ <_>
+ 5 2 12 4 -1.
+ <_>
+ 9 2 4 4 3.
+ <_>
+
+ <_>
+ 6 0 8 12 -1.
+ <_>
+ 6 0 4 6 2.
+ <_>
+ 10 6 4 6 2.
+ <_>
+
+ <_>
+ 13 7 2 2 -1.
+ <_>
+ 14 7 1 1 2.
+ <_>
+ 13 8 1 1 2.
+ <_>
+
+ <_>
+ 0 12 20 6 -1.
+ <_>
+ 0 14 20 2 3.
+ <_>
+
+ <_>
+ 14 7 2 3 -1.
+ <_>
+ 14 7 1 3 2.
+ <_>
+
+ <_>
+ 0 8 9 12 -1.
+ <_>
+ 3 8 3 12 3.
+ <_>
+
+ <_>
+ 3 0 16 2 -1.
+ <_>
+ 3 0 8 2 2.
+ <_>
+
+ <_>
+ 6 15 3 3 -1.
+ <_>
+ 6 16 3 1 3.
+ <_>
+
+ <_>
+ 8 15 6 3 -1.
+ <_>
+ 8 16 6 1 3.
+ <_>
+
+ <_>
+ 0 10 1 6 -1.
+ <_>
+ 0 12 1 2 3.
+ <_>
+
+ <_>
+ 10 9 4 3 -1.
+ <_>
+ 10 10 4 1 3.
+ <_>
+
+ <_>
+ 9 15 2 3 -1.
+ <_>
+ 9 16 2 1 3.
+ <_>
+
+ <_>
+ 5 7 10 1 -1.
+ <_>
+ 5 7 5 1 2.
+ <_>
+
+ <_>
+ 4 0 12 19 -1.
+ <_>
+ 10 0 6 19 2.
+ <_>
+
+ <_>
+ 0 6 20 6 -1.
+ <_>
+ 10 6 10 3 2.
+ <_>
+ 0 9 10 3 2.
+ <_>
+
+ <_>
+ 3 6 2 2 -1.
+ <_>
+ 3 6 1 1 2.
+ <_>
+ 4 7 1 1 2.
+ <_>
+
+ <_>
+ 15 6 2 2 -1.
+ <_>
+ 16 6 1 1 2.
+ <_>
+ 15 7 1 1 2.
+ <_>
+
+ <_>
+ 3 6 2 2 -1.
+ <_>
+ 3 6 1 1 2.
+ <_>
+ 4 7 1 1 2.
+ <_>
+
+ <_>
+ 14 4 1 12 -1.
+ <_>
+ 14 10 1 6 2.
+ <_>
+
+ <_>
+ 2 5 16 10 -1.
+ <_>
+ 2 5 8 5 2.
+ <_>
+ 10 10 8 5 2.
+ <_>
+
+ <_>
+ 9 17 3 2 -1.
+ <_>
+ 10 17 1 2 3.
+ <_>
+
+ <_>
+ 1 4 2 2 -1.
+ <_>
+ 1 5 2 1 2.
+ <_>
+
+ <_>
+ 5 0 15 5 -1.
+ <_>
+ 10 0 5 5 3.
+ <_>
+
+ <_>
+ 0 0 15 5 -1.
+ <_>
+ 5 0 5 5 3.
+ <_>
+
+ <_>
+ 11 2 2 17 -1.
+ <_>
+ 11 2 1 17 2.
+ <_>
+
+ <_>
+ 7 2 2 17 -1.
+ <_>
+ 8 2 1 17 2.
+ <_>
+
+ <_>
+ 15 11 2 9 -1.
+ <_>
+ 15 11 1 9 2.
+ <_>
+
+ <_>
+ 3 11 2 9 -1.
+ <_>
+ 4 11 1 9 2.
+ <_>
+
+ <_>
+ 5 16 14 4 -1.
+ <_>
+ 5 16 7 4 2.
+ <_>
+
+ <_>
+ 1 4 18 1 -1.
+ <_>
+ 7 4 6 1 3.
+ <_>
+
+ <_>
+ 13 7 6 4 -1.
+ <_>
+ 16 7 3 2 2.
+ <_>
+ 13 9 3 2 2.
+ <_>
+
+ <_>
+ 9 8 2 12 -1.
+ <_>
+ 9 12 2 4 3.
+ <_>
+
+ <_>
+ 12 1 6 6 -1.
+ <_>
+ 12 3 6 2 3.
+ <_>
+
+ <_>
+ 5 2 6 6 -1.
+ <_>
+ 5 2 3 3 2.
+ <_>
+ 8 5 3 3 2.
+ <_>
+
+ <_>
+ 9 16 6 4 -1.
+ <_>
+ 12 16 3 2 2.
+ <_>
+ 9 18 3 2 2.
+ <_>
+
+ <_>
+ 1 2 18 3 -1.
+ <_>
+ 7 2 6 3 3.
+ <_>
+
+ <_>
+ 7 4 9 10 -1.
+ <_>
+ 7 9 9 5 2.
+ <_>
+
+ <_>
+ 5 9 4 4 -1.
+ <_>
+ 7 9 2 4 2.
+ <_>
+
+ <_>
+ 11 10 3 6 -1.
+ <_>
+ 11 13 3 3 2.
+ <_>
+
+ <_>
+ 7 11 5 3 -1.
+ <_>
+ 7 12 5 1 3.
+ <_>
+
+ <_>
+ 7 11 6 6 -1.
+ <_>
+ 10 11 3 3 2.
+ <_>
+ 7 14 3 3 2.
+ <_>
+
+ <_>
+ 0 0 10 9 -1.
+ <_>
+ 0 3 10 3 3.
+ <_>
+
+ <_>
+ 13 14 1 6 -1.
+ <_>
+ 13 16 1 2 3.
+ <_>
+
+ <_>
+ 0 2 3 6 -1.
+ <_>
+ 0 4 3 2 3.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 6 14 1 6 -1.
+ <_>
+ 6 16 1 2 3.
+ <_>
+
+ <_>
+ 9 15 2 3 -1.
+ <_>
+ 9 16 2 1 3.
+ <_>
+
+ <_>
+ 6 4 3 3 -1.
+ <_>
+ 7 4 1 3 3.
+ <_>
+
+ <_>
+ 9 0 11 3 -1.
+ <_>
+ 9 1 11 1 3.
+ <_>
+
+ <_>
+ 0 6 20 3 -1.
+ <_>
+ 0 7 20 1 3.
+ <_>
+
+ <_>
+ 10 1 1 2 -1.
+ <_>
+ 10 2 1 1 2.
+ <_>
+
+ <_>
+ 9 6 2 6 -1.
+ <_>
+ 10 6 1 6 2.
+ <_>
+
+ <_>
+ 5 8 12 1 -1.
+ <_>
+ 9 8 4 1 3.
+ <_>
+
+ <_>
+ 3 8 12 1 -1.
+ <_>
+ 7 8 4 1 3.
+ <_>
+
+ <_>
+ 9 7 3 5 -1.
+ <_>
+ 10 7 1 5 3.
+ <_>
+
+ <_>
+ 3 9 6 2 -1.
+ <_>
+ 6 9 3 2 2.
+ <_>
+
+ <_>
+ 12 9 3 3 -1.
+ <_>
+ 12 10 3 1 3.
+ <_>
+
+ <_>
+ 7 0 6 1 -1.
+ <_>
+ 9 0 2 1 3.
+ <_>
+
+ <_>
+ 12 9 3 3 -1.
+ <_>
+ 12 10 3 1 3.
+ <_>
+
+ <_>
+ 7 10 2 1 -1.
+ <_>
+ 8 10 1 1 2.
+ <_>
+
+ <_>
+ 6 4 9 13 -1.
+ <_>
+ 9 4 3 13 3.
+ <_>
+
+ <_>
+ 6 8 4 2 -1.
+ <_>
+ 6 9 4 1 2.
+ <_>
+
+ <_>
+ 16 2 4 6 -1.
+ <_>
+ 16 2 2 6 2.
+ <_>
+
+ <_>
+ 0 17 6 3 -1.
+ <_>
+ 0 18 6 1 3.
+ <_>
+
+ <_>
+ 10 10 3 10 -1.
+ <_>
+ 10 15 3 5 2.
+ <_>
+
+ <_>
+ 8 7 3 5 -1.
+ <_>
+ 9 7 1 5 3.
+ <_>
+
+ <_>
+ 10 4 4 3 -1.
+ <_>
+ 10 4 2 3 2.
+ <_>
+
+ <_>
+ 8 4 3 8 -1.
+ <_>
+ 9 4 1 8 3.
+ <_>
+
+ <_>
+ 6 6 9 13 -1.
+ <_>
+ 9 6 3 13 3.
+ <_>
+
+ <_>
+ 6 0 8 12 -1.
+ <_>
+ 6 0 4 6 2.
+ <_>
+ 10 6 4 6 2.
+ <_>
+
+ <_>
+ 14 2 6 8 -1.
+ <_>
+ 16 2 2 8 3.
+ <_>
+
+ <_>
+ 6 0 3 6 -1.
+ <_>
+ 7 0 1 6 3.
+ <_>
+
+ <_>
+ 14 2 6 8 -1.
+ <_>
+ 16 2 2 8 3.
+ <_>
+
+ <_>
+ 0 5 6 6 -1.
+ <_>
+ 0 8 6 3 2.
+ <_>
+
+ <_>
+ 9 12 6 2 -1.
+ <_>
+ 12 12 3 1 2.
+ <_>
+ 9 13 3 1 2.
+ <_>
+
+ <_>
+ 8 17 3 2 -1.
+ <_>
+ 9 17 1 2 3.
+ <_>
+
+ <_>
+ 11 6 2 2 -1.
+ <_>
+ 12 6 1 1 2.
+ <_>
+ 11 7 1 1 2.
+ <_>
+
+ <_>
+ 1 9 18 2 -1.
+ <_>
+ 7 9 6 2 3.
+ <_>
+
+ <_>
+ 11 6 2 2 -1.
+ <_>
+ 12 6 1 1 2.
+ <_>
+ 11 7 1 1 2.
+ <_>
+
+ <_>
+ 3 4 12 8 -1.
+ <_>
+ 7 4 4 8 3.
+ <_>
+
+ <_>
+ 13 11 5 3 -1.
+ <_>
+ 13 12 5 1 3.
+ <_>
+
+ <_>
+ 9 10 2 3 -1.
+ <_>
+ 9 11 2 1 3.
+ <_>
+
+ <_>
+ 14 7 2 3 -1.
+ <_>
+ 14 7 1 3 2.
+ <_>
+
+ <_>
+ 5 4 1 3 -1.
+ <_>
+ 5 5 1 1 3.
+ <_>
+
+ <_>
+ 13 4 2 3 -1.
+ <_>
+ 13 5 2 1 3.
+ <_>
+
+ <_>
+ 5 4 2 3 -1.
+ <_>
+ 5 5 2 1 3.
+ <_>
+
+ <_>
+ 9 8 2 3 -1.
+ <_>
+ 9 9 2 1 3.
+ <_>
+
+ <_>
+ 8 9 2 2 -1.
+ <_>
+ 8 10 2 1 2.
+ <_>
+
+ <_>
+ 15 14 1 4 -1.
+ <_>
+ 15 16 1 2 2.
+ <_>
+
+ <_>
+ 3 12 2 2 -1.
+ <_>
+ 3 13 2 1 2.
+ <_>
+
+ <_>
+ 12 15 2 2 -1.
+ <_>
+ 13 15 1 1 2.
+ <_>
+ 12 16 1 1 2.
+ <_>
+
+ <_>
+ 9 13 2 2 -1.
+ <_>
+ 9 14 2 1 2.
+ <_>
+
+ <_>
+ 4 11 14 9 -1.
+ <_>
+ 4 14 14 3 3.
+ <_>
+
+ <_>
+ 7 13 4 3 -1.
+ <_>
+ 7 14 4 1 3.
+ <_>
+
+ <_>
+ 15 14 1 4 -1.
+ <_>
+ 15 16 1 2 2.
+ <_>
+
+ <_>
+ 4 14 1 4 -1.
+ <_>
+ 4 16 1 2 2.
+ <_>
+
+ <_>
+ 14 0 6 13 -1.
+ <_>
+ 16 0 2 13 3.
+ <_>
+
+ <_>
+ 4 1 2 12 -1.
+ <_>
+ 4 1 1 6 2.
+ <_>
+ 5 7 1 6 2.
+ <_>
+
+ <_>
+ 11 14 6 6 -1.
+ <_>
+ 14 14 3 3 2.
+ <_>
+ 11 17 3 3 2.
+ <_>
+
+ <_>
+ 3 14 6 6 -1.
+ <_>
+ 3 14 3 3 2.
+ <_>
+ 6 17 3 3 2.
+ <_>
+
+ <_>
+ 14 17 3 2 -1.
+ <_>
+ 14 18 3 1 2.
+ <_>
+
+ <_>
+ 3 17 3 2 -1.
+ <_>
+ 3 18 3 1 2.
+ <_>
+
+ <_>
+ 14 0 6 13 -1.
+ <_>
+ 16 0 2 13 3.
+ <_>
+
+ <_>
+ 0 0 6 13 -1.
+ <_>
+ 2 0 2 13 3.
+ <_>
+
+ <_>
+ 10 10 7 6 -1.
+ <_>
+ 10 12 7 2 3.
+ <_>
+
+ <_>
+ 6 15 2 2 -1.
+ <_>
+ 6 15 1 1 2.
+ <_>
+ 7 16 1 1 2.
+ <_>
+
+ <_>
+ 6 11 8 6 -1.
+ <_>
+ 10 11 4 3 2.
+ <_>
+ 6 14 4 3 2.
+ <_>
+
+ <_>
+ 7 6 2 2 -1.
+ <_>
+ 7 6 1 1 2.
+ <_>
+ 8 7 1 1 2.
+ <_>
+
+ <_>
+ 2 2 16 6 -1.
+ <_>
+ 10 2 8 3 2.
+ <_>
+ 2 5 8 3 2.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 11 7 3 10 -1.
+ <_>
+ 11 12 3 5 2.
+ <_>
+
+ <_>
+ 6 7 3 10 -1.
+ <_>
+ 6 12 3 5 2.
+ <_>
+
+ <_>
+ 10 7 3 2 -1.
+ <_>
+ 11 7 1 2 3.
+ <_>
+
+ <_>
+ 8 12 4 2 -1.
+ <_>
+ 8 13 4 1 2.
+ <_>
+
+ <_>
+ 10 1 1 3 -1.
+ <_>
+ 10 2 1 1 3.
+ <_>
+
+ <_>
+ 1 2 4 18 -1.
+ <_>
+ 1 2 2 9 2.
+ <_>
+ 3 11 2 9 2.
+ <_>
+
+ <_>
+ 12 4 4 12 -1.
+ <_>
+ 12 10 4 6 2.
+ <_>
+
+ <_>
+ 0 0 1 6 -1.
+ <_>
+ 0 2 1 2 3.
+ <_>
+
+ <_>
+ 9 11 2 3 -1.
+ <_>
+ 9 12 2 1 3.
+ <_>
+
+ <_>
+ 8 7 4 3 -1.
+ <_>
+ 8 8 4 1 3.
+ <_>
+
+ <_>
+ 10 7 3 2 -1.
+ <_>
+ 11 7 1 2 3.
+ <_>
+
+ <_>
+ 7 7 3 2 -1.
+ <_>
+ 8 7 1 2 3.
+ <_>
+
+ <_>
+ 9 4 6 1 -1.
+ <_>
+ 11 4 2 1 3.
+ <_>
+
+ <_>
+ 8 7 2 3 -1.
+ <_>
+ 9 7 1 3 2.
+ <_>
+
+ <_>
+ 12 7 8 6 -1.
+ <_>
+ 16 7 4 3 2.
+ <_>
+ 12 10 4 3 2.
+ <_>
+
+ <_>
+ 0 7 8 6 -1.
+ <_>
+ 0 7 4 3 2.
+ <_>
+ 4 10 4 3 2.
+ <_>
+
+ <_>
+ 18 2 2 10 -1.
+ <_>
+ 19 2 1 5 2.
+ <_>
+ 18 7 1 5 2.
+ <_>
+
+ <_>
+ 0 2 6 4 -1.
+ <_>
+ 3 2 3 4 2.
+ <_>
+
+ <_>
+ 9 4 6 1 -1.
+ <_>
+ 11 4 2 1 3.
+ <_>
+
+ <_>
+ 7 15 2 2 -1.
+ <_>
+ 7 15 1 1 2.
+ <_>
+ 8 16 1 1 2.
+ <_>
+
+ <_>
+ 11 13 1 6 -1.
+ <_>
+ 11 16 1 3 2.
+ <_>
+
+ <_>
+ 8 13 1 6 -1.
+ <_>
+ 8 16 1 3 2.
+ <_>
+
+ <_>
+ 14 3 2 1 -1.
+ <_>
+ 14 3 1 1 2.
+ <_>
+
+ <_>
+ 8 15 2 3 -1.
+ <_>
+ 8 16 2 1 3.
+ <_>
+
+ <_>
+ 12 15 7 4 -1.
+ <_>
+ 12 17 7 2 2.
+ <_>
+
+ <_>
+ 4 14 12 3 -1.
+ <_>
+ 4 15 12 1 3.
+ <_>
+
+ <_>
+ 10 3 3 2 -1.
+ <_>
+ 11 3 1 2 3.
+ <_>
+
+ <_>
+ 4 12 2 2 -1.
+ <_>
+ 4 13 2 1 2.
+ <_>
+
+ <_>
+ 10 11 4 6 -1.
+ <_>
+ 10 14 4 3 2.
+ <_>
+
+ <_>
+ 7 13 2 2 -1.
+ <_>
+ 7 13 1 1 2.
+ <_>
+ 8 14 1 1 2.
+ <_>
+
+ <_>
+ 4 11 14 4 -1.
+ <_>
+ 11 11 7 2 2.
+ <_>
+ 4 13 7 2 2.
+ <_>
+
+ <_>
+ 1 18 18 2 -1.
+ <_>
+ 7 18 6 2 3.
+ <_>
+
+ <_>
+ 11 18 2 2 -1.
+ <_>
+ 12 18 1 1 2.
+ <_>
+ 11 19 1 1 2.
+ <_>
+
+ <_>
+ 7 18 2 2 -1.
+ <_>
+ 7 18 1 1 2.
+ <_>
+ 8 19 1 1 2.
+ <_>
+
+ <_>
+ 12 18 8 2 -1.
+ <_>
+ 12 19 8 1 2.
+ <_>
+
+ <_>
+ 7 14 6 2 -1.
+ <_>
+ 7 15 6 1 2.
+ <_>
+
+ <_>
+ 8 12 4 8 -1.
+ <_>
+ 10 12 2 4 2.
+ <_>
+ 8 16 2 4 2.
+ <_>
+
+ <_>
+ 4 9 3 3 -1.
+ <_>
+ 4 10 3 1 3.
+ <_>
+
+ <_>
+ 7 10 6 2 -1.
+ <_>
+ 9 10 2 2 3.
+ <_>
+
+ <_>
+ 5 0 4 15 -1.
+ <_>
+ 7 0 2 15 2.
+ <_>
+
+ <_>
+ 8 6 12 14 -1.
+ <_>
+ 12 6 4 14 3.
+ <_>
+
+ <_>
+ 5 16 3 3 -1.
+ <_>
+ 5 17 3 1 3.
+ <_>
+
+ <_>
+ 8 1 12 19 -1.
+ <_>
+ 12 1 4 19 3.
+ <_>
+
+ <_>
+ 3 0 3 2 -1.
+ <_>
+ 3 1 3 1 2.
+ <_>
+
+ <_>
+ 10 12 4 5 -1.
+ <_>
+ 10 12 2 5 2.
+ <_>
+
+ <_>
+ 6 12 4 5 -1.
+ <_>
+ 8 12 2 5 2.
+ <_>
+
+ <_>
+ 11 11 2 2 -1.
+ <_>
+ 12 11 1 1 2.
+ <_>
+ 11 12 1 1 2.
+ <_>
+
+ <_>
+ 0 2 3 6 -1.
+ <_>
+ 0 4 3 2 3.
+ <_>
+
+ <_>
+ 11 11 2 2 -1.
+ <_>
+ 12 11 1 1 2.
+ <_>
+ 11 12 1 1 2.
+ <_>
+
+ <_>
+ 7 6 4 10 -1.
+ <_>
+ 7 11 4 5 2.
+ <_>
+
+ <_>
+ 11 11 2 2 -1.
+ <_>
+ 12 11 1 1 2.
+ <_>
+ 11 12 1 1 2.
+ <_>
+
+ <_>
+ 2 13 5 2 -1.
+ <_>
+ 2 14 5 1 2.
+ <_>
+
+ <_>
+ 11 11 2 2 -1.
+ <_>
+ 12 11 1 1 2.
+ <_>
+ 11 12 1 1 2.
+ <_>
+
+ <_>
+ 7 11 2 2 -1.
+ <_>
+ 7 11 1 1 2.
+ <_>
+ 8 12 1 1 2.
+ <_>
+
+ <_>
+ 14 13 3 3 -1.
+ <_>
+ 14 14 3 1 3.
+ <_>
+
+ <_>
+ 3 13 3 3 -1.
+ <_>
+ 3 14 3 1 3.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 8 7 3 3 -1.
+ <_>
+ 8 8 3 1 3.
+ <_>
+
+ <_>
+ 13 5 3 3 -1.
+ <_>
+ 13 6 3 1 3.
+ <_>
+
+ <_>
+ 0 9 5 3 -1.
+ <_>
+ 0 10 5 1 3.
+ <_>
+
+ <_>
+ 13 5 3 3 -1.
+ <_>
+ 13 6 3 1 3.
+ <_>
+
+ <_>
+ 9 12 2 8 -1.
+ <_>
+ 9 12 1 4 2.
+ <_>
+ 10 16 1 4 2.
+ <_>
+
+ <_>
+ 11 7 2 2 -1.
+ <_>
+ 12 7 1 1 2.
+ <_>
+ 11 8 1 1 2.
+ <_>
+
+ <_>
+ 0 16 6 4 -1.
+ <_>
+ 3 16 3 4 2.
+ <_>
+
+ <_>
+ 10 6 2 3 -1.
+ <_>
+ 10 7 2 1 3.
+ <_>
+
+ <_>
+ 9 5 2 6 -1.
+ <_>
+ 9 7 2 2 3.
+ <_>
+
+ <_>
+ 12 15 8 4 -1.
+ <_>
+ 12 15 4 4 2.
+ <_>
+
+ <_>
+ 0 14 8 6 -1.
+ <_>
+ 4 14 4 6 2.
+ <_>
+
+ <_>
+ 9 0 3 2 -1.
+ <_>
+ 10 0 1 2 3.
+ <_>
+
+ <_>
+ 4 15 4 2 -1.
+ <_>
+ 6 15 2 2 2.
+ <_>
+
+ <_>
+ 12 7 3 13 -1.
+ <_>
+ 13 7 1 13 3.
+ <_>
+
+ <_>
+ 5 7 3 13 -1.
+ <_>
+ 6 7 1 13 3.
+ <_>
+
+ <_>
+ 9 6 3 9 -1.
+ <_>
+ 9 9 3 3 3.
+ <_>
+
+ <_>
+ 4 4 7 12 -1.
+ <_>
+ 4 10 7 6 2.
+ <_>
+
+ <_>
+ 12 12 2 2 -1.
+ <_>
+ 13 12 1 1 2.
+ <_>
+ 12 13 1 1 2.
+ <_>
+
+ <_>
+ 6 12 2 2 -1.
+ <_>
+ 6 12 1 1 2.
+ <_>
+ 7 13 1 1 2.
+ <_>
+
+ <_>
+ 8 9 4 2 -1.
+ <_>
+ 10 9 2 1 2.
+ <_>
+ 8 10 2 1 2.
+ <_>
+
+ <_>
+ 3 6 2 2 -1.
+ <_>
+ 3 6 1 1 2.
+ <_>
+ 4 7 1 1 2.
+ <_>
+
+ <_>
+ 16 6 3 2 -1.
+ <_>
+ 16 7 3 1 2.
+ <_>
+
+ <_>
+ 0 7 19 4 -1.
+ <_>
+ 0 9 19 2 2.
+ <_>
+
+ <_>
+ 10 2 10 1 -1.
+ <_>
+ 10 2 5 1 2.
+ <_>
+
+ <_>
+ 9 4 2 12 -1.
+ <_>
+ 9 10 2 6 2.
+ <_>
+
+ <_>
+ 12 18 4 1 -1.
+ <_>
+ 12 18 2 1 2.
+ <_>
+
+ <_>
+ 1 7 6 4 -1.
+ <_>
+ 1 7 3 2 2.
+ <_>
+ 4 9 3 2 2.
+ <_>
+
+ <_>
+ 12 0 6 13 -1.
+ <_>
+ 14 0 2 13 3.
+ <_>
+
+ <_>
+ 2 0 6 13 -1.
+ <_>
+ 4 0 2 13 3.
+ <_>
+
+ <_>
+ 10 5 8 8 -1.
+ <_>
+ 10 9 8 4 2.
+ <_>
+
+ <_>
+ 8 3 2 5 -1.
+ <_>
+ 9 3 1 5 2.
+ <_>
+
+ <_>
+ 8 4 9 1 -1.
+ <_>
+ 11 4 3 1 3.
+ <_>
+
+ <_>
+ 3 4 9 1 -1.
+ <_>
+ 6 4 3 1 3.
+ <_>
+
+ <_>
+ 1 0 18 10 -1.
+ <_>
+ 7 0 6 10 3.
+ <_>
+
+ <_>
+ 7 17 5 3 -1.
+ <_>
+ 7 18 5 1 3.
+ <_>
+
+ <_>
+ 7 11 6 1 -1.
+ <_>
+ 9 11 2 1 3.
+ <_>
+
+ <_>
+ 2 2 3 2 -1.
+ <_>
+ 2 3 3 1 2.
+ <_>
+
+ <_>
+ 8 12 4 2 -1.
+ <_>
+ 8 13 4 1 2.
+ <_>
+
+ <_>
+ 6 10 3 6 -1.
+ <_>
+ 6 13 3 3 2.
+ <_>
+
+ <_>
+ 11 4 2 4 -1.
+ <_>
+ 11 4 1 4 2.
+ <_>
+
+ <_>
+ 7 4 2 4 -1.
+ <_>
+ 8 4 1 4 2.
+ <_>
+
+ <_>
+ 9 6 2 4 -1.
+ <_>
+ 9 6 1 4 2.
+ <_>
+
+ <_>
+ 6 13 8 3 -1.
+ <_>
+ 6 14 8 1 3.
+ <_>
+
+ <_>
+ 9 15 3 4 -1.
+ <_>
+ 10 15 1 4 3.
+ <_>
+
+ <_>
+ 9 2 2 17 -1.
+ <_>
+ 10 2 1 17 2.
+ <_>
+
+ <_>
+ 7 0 6 1 -1.
+ <_>
+ 9 0 2 1 3.
+ <_>
+
+ <_>
+ 8 15 3 4 -1.
+ <_>
+ 9 15 1 4 3.
+ <_>
+
+ <_>
+ 7 13 7 3 -1.
+ <_>
+ 7 14 7 1 3.
+ <_>
+
+ <_>
+ 8 16 3 3 -1.
+ <_>
+ 9 16 1 3 3.
+ <_>
+
+ <_>
+ 6 2 8 10 -1.
+ <_>
+ 6 7 8 5 2.
+ <_>
+
+ <_>
+ 2 5 8 8 -1.
+ <_>
+ 2 9 8 4 2.
+ <_>
+
+ <_>
+ 14 16 2 2 -1.
+ <_>
+ 14 17 2 1 2.
+ <_>
+
+ <_>
+ 4 16 2 2 -1.
+ <_>
+ 4 17 2 1 2.
+ <_>
+
+ <_>
+ 10 11 4 6 -1.
+ <_>
+ 10 14 4 3 2.
+ <_>
+
+ <_>
+ 6 11 4 6 -1.
+ <_>
+ 6 14 4 3 2.
+ <_>
+
+ <_>
+ 10 14 1 3 -1.
+ <_>
+ 10 15 1 1 3.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 10 0 4 6 -1.
+ <_>
+ 12 0 2 3 2.
+ <_>
+ 10 3 2 3 2.
+ <_>
+
+ <_>
+ 0 3 20 2 -1.
+ <_>
+ 0 4 20 1 2.
+ <_>
+
+ <_>
+ 12 0 8 2 -1.
+ <_>
+ 16 0 4 1 2.
+ <_>
+ 12 1 4 1 2.
+ <_>
+
+ <_>
+ 2 12 10 8 -1.
+ <_>
+ 2 16 10 4 2.
+ <_>
+
+ <_>
+ 17 7 2 10 -1.
+ <_>
+ 18 7 1 5 2.
+ <_>
+ 17 12 1 5 2.
+ <_>
+
+ <_>
+ 1 7 2 10 -1.
+ <_>
+ 1 7 1 5 2.
+ <_>
+ 2 12 1 5 2.
+ <_>
+
+ <_>
+ 15 10 3 6 -1.
+ <_>
+ 15 12 3 2 3.
+ <_>
+
+ <_>
+ 4 4 6 2 -1.
+ <_>
+ 6 4 2 2 3.
+ <_>
+
+ <_>
+ 0 5 20 6 -1.
+ <_>
+ 0 7 20 2 3.
+ <_>
+
+ <_>
+ 0 0 8 2 -1.
+ <_>
+ 0 0 4 1 2.
+ <_>
+ 4 1 4 1 2.
+ <_>
+
+ <_>
+ 1 0 18 4 -1.
+ <_>
+ 7 0 6 4 3.
+ <_>
+
+ <_>
+ 1 13 6 2 -1.
+ <_>
+ 1 14 6 1 2.
+ <_>
+
+ <_>
+ 10 8 3 4 -1.
+ <_>
+ 11 8 1 4 3.
+ <_>
+
+ <_>
+ 6 1 6 1 -1.
+ <_>
+ 8 1 2 1 3.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 1 6 18 2 -1.
+ <_>
+ 10 6 9 2 2.
+ <_>
+
+ <_>
+ 15 11 1 2 -1.
+ <_>
+ 15 12 1 1 2.
+ <_>
+
+ <_>
+ 6 5 1 2 -1.
+ <_>
+ 6 6 1 1 2.
+ <_>
+
+ <_>
+ 13 4 1 3 -1.
+ <_>
+ 13 5 1 1 3.
+ <_>
+
+ <_>
+ 2 15 1 2 -1.
+ <_>
+ 2 16 1 1 2.
+ <_>
+
+ <_>
+ 12 4 4 3 -1.
+ <_>
+ 12 5 4 1 3.
+ <_>
+
+ <_>
+ 0 0 7 3 -1.
+ <_>
+ 0 1 7 1 3.
+ <_>
+
+ <_>
+ 9 12 6 2 -1.
+ <_>
+ 9 12 3 2 2.
+ <_>
+
+ <_>
+ 5 4 2 3 -1.
+ <_>
+ 5 5 2 1 3.
+ <_>
+
+ <_>
+ 18 4 2 3 -1.
+ <_>
+ 18 5 2 1 3.
+ <_>
+
+ <_>
+ 3 0 8 6 -1.
+ <_>
+ 3 2 8 2 3.
+ <_>
+
+ <_>
+ 0 2 20 6 -1.
+ <_>
+ 10 2 10 3 2.
+ <_>
+ 0 5 10 3 2.
+ <_>
+
+ <_>
+ 4 7 2 4 -1.
+ <_>
+ 5 7 1 4 2.
+ <_>
+
+ <_>
+ 3 10 15 2 -1.
+ <_>
+ 8 10 5 2 3.
+ <_>
+
+ <_>
+ 3 0 12 11 -1.
+ <_>
+ 9 0 6 11 2.
+ <_>
+
+ <_>
+ 13 0 2 6 -1.
+ <_>
+ 13 0 1 6 2.
+ <_>
+
+ <_>
+ 0 19 2 1 -1.
+ <_>
+ 1 19 1 1 2.
+ <_>
+
+ <_>
+ 16 10 4 10 -1.
+ <_>
+ 18 10 2 5 2.
+ <_>
+ 16 15 2 5 2.
+ <_>
+
+ <_>
+ 4 8 10 3 -1.
+ <_>
+ 4 9 10 1 3.
+ <_>
+
+ <_>
+ 14 12 3 3 -1.
+ <_>
+ 14 13 3 1 3.
+ <_>
+
+ <_>
+ 0 10 4 10 -1.
+ <_>
+ 0 10 2 5 2.
+ <_>
+ 2 15 2 5 2.
+ <_>
+
+ <_>
+ 18 3 2 6 -1.
+ <_>
+ 18 5 2 2 3.
+ <_>
+
+ <_>
+ 6 6 1 3 -1.
+ <_>
+ 6 7 1 1 3.
+ <_>
+
+ <_>
+ 7 7 7 2 -1.
+ <_>
+ 7 8 7 1 2.
+ <_>
+
+ <_>
+ 0 3 2 6 -1.
+ <_>
+ 0 5 2 2 3.
+ <_>
+
+ <_>
+ 11 1 3 1 -1.
+ <_>
+ 12 1 1 1 3.
+ <_>
+
+ <_>
+ 5 0 2 6 -1.
+ <_>
+ 6 0 1 6 2.
+ <_>
+
+ <_>
+ 1 1 18 14 -1.
+ <_>
+ 7 1 6 14 3.
+ <_>
+
+ <_>
+ 4 6 8 3 -1.
+ <_>
+ 8 6 4 3 2.
+ <_>
+
+ <_>
+ 9 12 6 2 -1.
+ <_>
+ 9 12 3 2 2.
+ <_>
+
+ <_>
+ 5 12 6 2 -1.
+ <_>
+ 8 12 3 2 2.
+ <_>
+
+ <_>
+ 10 7 3 5 -1.
+ <_>
+ 11 7 1 5 3.
+ <_>
+
+ <_>
+ 7 7 3 5 -1.
+ <_>
+ 8 7 1 5 3.
+ <_>
+
+ <_>
+ 13 0 3 10 -1.
+ <_>
+ 14 0 1 10 3.
+ <_>
+
+ <_>
+ 4 11 3 2 -1.
+ <_>
+ 4 12 3 1 2.
+ <_>
+
+ <_>
+ 17 3 3 6 -1.
+ <_>
+ 18 3 1 6 3.
+ <_>
+
+ <_>
+ 1 8 18 10 -1.
+ <_>
+ 1 13 18 5 2.
+ <_>
+
+ <_>
+ 13 0 3 10 -1.
+ <_>
+ 14 0 1 10 3.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 16 3 3 7 -1.
+ <_>
+ 17 3 1 7 3.
+ <_>
+
+ <_>
+ 4 0 3 10 -1.
+ <_>
+ 5 0 1 10 3.
+ <_>
+
+ <_>
+ 16 3 3 7 -1.
+ <_>
+ 17 3 1 7 3.
+ <_>
+
+ <_>
+ 0 9 1 2 -1.
+ <_>
+ 0 10 1 1 2.
+ <_>
+
+ <_>
+ 18 1 2 10 -1.
+ <_>
+ 18 1 1 10 2.
+ <_>
+
+ <_>
+ 0 1 2 10 -1.
+ <_>
+ 1 1 1 10 2.
+ <_>
+
+ <_>
+ 10 16 3 4 -1.
+ <_>
+ 11 16 1 4 3.
+ <_>
+
+ <_>
+ 2 8 3 3 -1.
+ <_>
+ 3 8 1 3 3.
+ <_>
+
+ <_>
+ 11 0 2 6 -1.
+ <_>
+ 12 0 1 3 2.
+ <_>
+ 11 3 1 3 2.
+ <_>
+
+ <_>
+ 7 0 2 6 -1.
+ <_>
+ 7 0 1 3 2.
+ <_>
+ 8 3 1 3 2.
+ <_>
+
+ <_>
+ 16 3 3 7 -1.
+ <_>
+ 17 3 1 7 3.
+ <_>
+
+ <_>
+ 1 3 3 7 -1.
+ <_>
+ 2 3 1 7 3.
+ <_>
+
+ <_>
+ 14 1 6 16 -1.
+ <_>
+ 16 1 2 16 3.
+ <_>
+
+ <_>
+ 0 1 6 16 -1.
+ <_>
+ 2 1 2 16 3.
+ <_>
+
+ <_>
+ 2 0 16 8 -1.
+ <_>
+ 10 0 8 4 2.
+ <_>
+ 2 4 8 4 2.
+ <_>
+
+ <_>
+ 6 8 5 3 -1.
+ <_>
+ 6 9 5 1 3.
+ <_>
+
+ <_>
+ 9 7 3 3 -1.
+ <_>
+ 10 7 1 3 3.
+ <_>
+
+ <_>
+ 8 8 4 3 -1.
+ <_>
+ 8 9 4 1 3.
+ <_>
+
+ <_>
+ 9 6 2 4 -1.
+ <_>
+ 9 6 1 4 2.
+ <_>
+
+ <_>
+ 0 7 15 1 -1.
+ <_>
+ 5 7 5 1 3.
+ <_>
+
+ <_>
+ 8 2 7 9 -1.
+ <_>
+ 8 5 7 3 3.
+ <_>
+
+ <_>
+ 1 7 16 4 -1.
+ <_>
+ 1 7 8 2 2.
+ <_>
+ 9 9 8 2 2.
+ <_>
+
+ <_>
+ 6 12 8 2 -1.
+ <_>
+ 6 13 8 1 2.
+ <_>
+
+ <_>
+ 8 11 3 3 -1.
+ <_>
+ 8 12 3 1 3.
+ <_>
+
+ <_>
+ 4 5 14 10 -1.
+ <_>
+ 11 5 7 5 2.
+ <_>
+ 4 10 7 5 2.
+ <_>
+
+ <_>
+ 4 12 3 2 -1.
+ <_>
+ 4 13 3 1 2.
+ <_>
+
+ <_>
+ 9 11 6 1 -1.
+ <_>
+ 11 11 2 1 3.
+ <_>
+
+ <_>
+ 4 9 7 6 -1.
+ <_>
+ 4 11 7 2 3.
+ <_>
+
+ <_>
+ 7 10 6 3 -1.
+ <_>
+ 7 11 6 1 3.
+ <_>
+
+ <_>
+ 9 11 2 2 -1.
+ <_>
+ 9 12 2 1 2.
+ <_>
+
+ <_>
+ 0 5 20 6 -1.
+ <_>
+ 0 7 20 2 3.
+ <_>
+
+ <_>
+ 6 4 6 1 -1.
+ <_>
+ 8 4 2 1 3.
+ <_>
+
+ <_>
+ 9 11 6 1 -1.
+ <_>
+ 11 11 2 1 3.
+ <_>
+
+ <_>
+ 5 11 6 1 -1.
+ <_>
+ 7 11 2 1 3.
+ <_>
+
+ <_>
+ 10 16 3 4 -1.
+ <_>
+ 11 16 1 4 3.
+ <_>
+
+ <_>
+ 8 7 3 3 -1.
+ <_>
+ 9 7 1 3 3.
+ <_>
+
+ <_>
+ 2 12 16 8 -1.
+ <_>
+ 2 16 16 4 2.
+ <_>
+
+ <_>
+ 0 15 15 2 -1.
+ <_>
+ 0 16 15 1 2.
+ <_>
+
+ <_>
+ 15 4 5 6 -1.
+ <_>
+ 15 6 5 2 3.
+ <_>
+
+ <_>
+ 9 5 2 4 -1.
+ <_>
+ 10 5 1 4 2.
+ <_>
+
+ <_>
+ 8 10 9 6 -1.
+ <_>
+ 8 12 9 2 3.
+ <_>
+
+ <_>
+ 2 19 15 1 -1.
+ <_>
+ 7 19 5 1 3.
+ <_>
+
+ <_>
+ 10 16 3 4 -1.
+ <_>
+ 11 16 1 4 3.
+ <_>
+
+ <_>
+ 0 15 20 4 -1.
+ <_>
+ 0 17 20 2 2.
+ <_>
+
+ <_>
+ 10 16 3 4 -1.
+ <_>
+ 11 16 1 4 3.
+ <_>
+
+ <_>
+ 7 16 3 4 -1.
+ <_>
+ 8 16 1 4 3.
+ <_>
+
+ <_>
+ 9 16 3 3 -1.
+ <_>
+ 9 17 3 1 3.
+ <_>
+
+ <_>
+ 8 11 4 6 -1.
+ <_>
+ 8 14 4 3 2.
+ <_>
+
+ <_>
+ 9 6 2 12 -1.
+ <_>
+ 9 10 2 4 3.
+ <_>
+
+ <_>
+ 8 17 4 3 -1.
+ <_>
+ 8 18 4 1 3.
+ <_>
+
+ <_>
+ 9 18 8 2 -1.
+ <_>
+ 13 18 4 1 2.
+ <_>
+ 9 19 4 1 2.
+ <_>
+
+ <_>
+ 1 18 8 2 -1.
+ <_>
+ 1 19 8 1 2.
+ <_>
+
+ <_>
+ 13 5 6 15 -1.
+ <_>
+ 15 5 2 15 3.
+ <_>
+
+ <_>
+ 9 8 2 2 -1.
+ <_>
+ 9 9 2 1 2.
+ <_>
+
+ <_>
+ 9 5 2 3 -1.
+ <_>
+ 9 5 1 3 2.
+ <_>
+
+ <_>
+ 1 5 6 15 -1.
+ <_>
+ 3 5 2 15 3.
+ <_>
+
+ <_>
+ 4 1 14 8 -1.
+ <_>
+ 11 1 7 4 2.
+ <_>
+ 4 5 7 4 2.
+ <_>
+
+ <_>
+ 2 4 4 16 -1.
+ <_>
+ 2 4 2 8 2.
+ <_>
+ 4 12 2 8 2.
+ <_>
+
+ <_>
+ 12 4 3 12 -1.
+ <_>
+ 12 10 3 6 2.
+ <_>
+
+ <_>
+ 4 5 10 12 -1.
+ <_>
+ 4 5 5 6 2.
+ <_>
+ 9 11 5 6 2.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 5 4 2 3 -1.
+ <_>
+ 5 5 2 1 3.
+ <_>
+
+ <_>
+ 12 2 4 10 -1.
+ <_>
+ 14 2 2 5 2.
+ <_>
+ 12 7 2 5 2.
+ <_>
+
+ <_>
+ 6 4 7 3 -1.
+ <_>
+ 6 5 7 1 3.
+ <_>
+
+ <_>
+ 2 0 18 2 -1.
+ <_>
+ 11 0 9 1 2.
+ <_>
+ 2 1 9 1 2.
+ <_>
+
+ <_>
+ 0 0 18 2 -1.
+ <_>
+ 0 0 9 1 2.
+ <_>
+ 9 1 9 1 2.
+ <_>
+
+ <_>
+ 13 13 4 6 -1.
+ <_>
+ 15 13 2 3 2.
+ <_>
+ 13 16 2 3 2.
+ <_>
+
+ <_>
+ 3 13 4 6 -1.
+ <_>
+ 3 13 2 3 2.
+ <_>
+ 5 16 2 3 2.
+ <_>
+
+ <_>
+ 10 12 2 6 -1.
+ <_>
+ 10 15 2 3 2.
+ <_>
+
+ <_>
+ 5 9 10 10 -1.
+ <_>
+ 5 9 5 5 2.
+ <_>
+ 10 14 5 5 2.
+ <_>
+
+ <_>
+ 11 4 4 2 -1.
+ <_>
+ 13 4 2 1 2.
+ <_>
+ 11 5 2 1 2.
+ <_>
+
+ <_>
+ 7 12 6 8 -1.
+ <_>
+ 10 12 3 8 2.
+ <_>
+
+ <_>
+ 12 2 4 10 -1.
+ <_>
+ 14 2 2 5 2.
+ <_>
+ 12 7 2 5 2.
+ <_>
+
+ <_>
+ 8 11 2 1 -1.
+ <_>
+ 9 11 1 1 2.
+ <_>
+
+ <_>
+ 10 5 1 12 -1.
+ <_>
+ 10 9 1 4 3.
+ <_>
+
+ <_>
+ 0 11 6 9 -1.
+ <_>
+ 3 11 3 9 2.
+ <_>
+
+ <_>
+ 12 2 4 10 -1.
+ <_>
+ 14 2 2 5 2.
+ <_>
+ 12 7 2 5 2.
+ <_>
+
+ <_>
+ 4 2 4 10 -1.
+ <_>
+ 4 2 2 5 2.
+ <_>
+ 6 7 2 5 2.
+ <_>
+
+ <_>
+ 11 4 4 2 -1.
+ <_>
+ 13 4 2 1 2.
+ <_>
+ 11 5 2 1 2.
+ <_>
+
+ <_>
+ 0 14 6 3 -1.
+ <_>
+ 0 15 6 1 3.
+ <_>
+
+ <_>
+ 11 4 4 2 -1.
+ <_>
+ 13 4 2 1 2.
+ <_>
+ 11 5 2 1 2.
+ <_>
+
+ <_>
+ 6 1 3 2 -1.
+ <_>
+ 7 1 1 2 3.
+ <_>
+
+ <_>
+ 11 4 4 2 -1.
+ <_>
+ 13 4 2 1 2.
+ <_>
+ 11 5 2 1 2.
+ <_>
+
+ <_>
+ 5 4 4 2 -1.
+ <_>
+ 5 4 2 1 2.
+ <_>
+ 7 5 2 1 2.
+ <_>
+
+ <_>
+ 13 0 2 12 -1.
+ <_>
+ 14 0 1 6 2.
+ <_>
+ 13 6 1 6 2.
+ <_>
+
+ <_>
+ 6 0 3 10 -1.
+ <_>
+ 7 0 1 10 3.
+ <_>
+
+ <_>
+ 3 0 17 8 -1.
+ <_>
+ 3 4 17 4 2.
+ <_>
+
+ <_>
+ 0 4 20 4 -1.
+ <_>
+ 0 6 20 2 2.
+ <_>
+
+ <_>
+ 0 3 8 2 -1.
+ <_>
+ 4 3 4 2 2.
+ <_>
+
+ <_>
+ 8 11 4 3 -1.
+ <_>
+ 8 12 4 1 3.
+ <_>
+
+ <_>
+ 5 7 6 4 -1.
+ <_>
+ 5 7 3 2 2.
+ <_>
+ 8 9 3 2 2.
+ <_>
+
+ <_>
+ 8 3 4 9 -1.
+ <_>
+ 8 6 4 3 3.
+ <_>
+
+ <_>
+ 8 15 1 4 -1.
+ <_>
+ 8 17 1 2 2.
+ <_>
+
+ <_>
+ 4 5 12 7 -1.
+ <_>
+ 8 5 4 7 3.
+ <_>
+
+ <_>
+ 4 2 4 10 -1.
+ <_>
+ 4 2 2 5 2.
+ <_>
+ 6 7 2 5 2.
+ <_>
+
+ <_>
+ 3 0 17 2 -1.
+ <_>
+ 3 1 17 1 2.
+ <_>
+
+ <_>
+ 2 2 16 15 -1.
+ <_>
+ 2 7 16 5 3.
+ <_>
+
+ <_>
+ 15 2 5 2 -1.
+ <_>
+ 15 3 5 1 2.
+ <_>
+
+ <_>
+ 9 3 2 2 -1.
+ <_>
+ 10 3 1 2 2.
+ <_>
+
+ <_>
+ 4 5 16 15 -1.
+ <_>
+ 4 10 16 5 3.
+ <_>
+
+ <_>
+ 7 13 5 6 -1.
+ <_>
+ 7 16 5 3 2.
+ <_>
+
+ <_>
+ 10 7 3 2 -1.
+ <_>
+ 11 7 1 2 3.
+ <_>
+
+ <_>
+ 8 3 3 1 -1.
+ <_>
+ 9 3 1 1 3.
+ <_>
+
+ <_>
+ 9 16 3 3 -1.
+ <_>
+ 9 17 3 1 3.
+ <_>
+
+ <_>
+ 0 2 5 2 -1.
+ <_>
+ 0 3 5 1 2.
+ <_>
+
+ <_>
+ 12 5 4 3 -1.
+ <_>
+ 12 6 4 1 3.
+ <_>
+
+ <_>
+ 1 7 12 1 -1.
+ <_>
+ 5 7 4 1 3.
+ <_>
+
+ <_>
+ 7 5 6 14 -1.
+ <_>
+ 7 12 6 7 2.
+ <_>
+
+ <_>
+ 0 0 8 10 -1.
+ <_>
+ 0 0 4 5 2.
+ <_>
+ 4 5 4 5 2.
+ <_>
+
+ <_>
+ 9 1 3 2 -1.
+ <_>
+ 10 1 1 2 3.
+ <_>
+
+ <_>
+ 8 1 3 2 -1.
+ <_>
+ 9 1 1 2 3.
+ <_>
+
+ <_>
+ 12 4 3 3 -1.
+ <_>
+ 12 5 3 1 3.
+ <_>
+
+ <_>
+ 7 4 6 16 -1.
+ <_>
+ 7 12 6 8 2.
+ <_>
+
+ <_>
+ 12 4 3 3 -1.
+ <_>
+ 12 5 3 1 3.
+ <_>
+
+ <_>
+ 2 3 2 6 -1.
+ <_>
+ 2 5 2 2 3.
+ <_>
+
+ <_>
+ 14 2 6 9 -1.
+ <_>
+ 14 5 6 3 3.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 9 17 3 2 -1.
+ <_>
+ 10 17 1 2 3.
+ <_>
+
+ <_>
+ 5 5 2 3 -1.
+ <_>
+ 5 6 2 1 3.
+ <_>
+
+ <_>
+ 13 11 3 6 -1.
+ <_>
+ 13 13 3 2 3.
+ <_>
+
+ <_>
+ 3 14 2 6 -1.
+ <_>
+ 3 17 2 3 2.
+ <_>
+
+ <_>
+ 14 3 6 2 -1.
+ <_>
+ 14 4 6 1 2.
+ <_>
+
+ <_>
+ 0 8 16 2 -1.
+ <_>
+ 0 9 16 1 2.
+ <_>
+
+ <_>
+ 14 3 6 2 -1.
+ <_>
+ 14 4 6 1 2.
+ <_>
+
+ <_>
+ 0 0 5 6 -1.
+ <_>
+ 0 2 5 2 3.
+ <_>
+
+ <_>
+ 12 5 4 3 -1.
+ <_>
+ 12 6 4 1 3.
+ <_>
+
+ <_>
+ 4 11 3 6 -1.
+ <_>
+ 4 13 3 2 3.
+ <_>
+
+ <_>
+ 12 5 4 3 -1.
+ <_>
+ 12 6 4 1 3.
+ <_>
+
+ <_>
+ 9 5 1 3 -1.
+ <_>
+ 9 6 1 1 3.
+ <_>
+
+ <_>
+ 12 5 4 3 -1.
+ <_>
+ 12 6 4 1 3.
+ <_>
+
+ <_>
+ 6 6 8 12 -1.
+ <_>
+ 6 12 8 6 2.
+ <_>
+
+ <_>
+ 12 5 4 3 -1.
+ <_>
+ 12 6 4 1 3.
+ <_>
+
+ <_>
+ 5 12 9 2 -1.
+ <_>
+ 8 12 3 2 3.
+ <_>
+
+ <_>
+ 12 5 4 3 -1.
+ <_>
+ 12 6 4 1 3.
+ <_>
+
+ <_>
+ 4 5 4 3 -1.
+ <_>
+ 4 6 4 1 3.
+ <_>
+
+ <_>
+ 6 6 9 2 -1.
+ <_>
+ 9 6 3 2 3.
+ <_>
+
+ <_>
+ 4 11 1 3 -1.
+ <_>
+ 4 12 1 1 3.
+ <_>
+
+ <_>
+ 14 12 6 6 -1.
+ <_>
+ 14 12 3 6 2.
+ <_>
+
+ <_>
+ 7 0 3 7 -1.
+ <_>
+ 8 0 1 7 3.
+ <_>
+
+ <_>
+ 9 8 3 3 -1.
+ <_>
+ 10 8 1 3 3.
+ <_>
+
+ <_>
+ 8 8 3 3 -1.
+ <_>
+ 9 8 1 3 3.
+ <_>
+
+ <_>
+ 5 10 11 3 -1.
+ <_>
+ 5 11 11 1 3.
+ <_>
+
+ <_>
+ 5 7 10 1 -1.
+ <_>
+ 10 7 5 1 2.
+ <_>
+
+ <_>
+ 9 7 3 2 -1.
+ <_>
+ 10 7 1 2 3.
+ <_>
+
+ <_>
+ 8 7 3 2 -1.
+ <_>
+ 9 7 1 2 3.
+ <_>
+
+ <_>
+ 11 9 4 2 -1.
+ <_>
+ 11 9 2 2 2.
+ <_>
+
+ <_>
+ 5 9 4 2 -1.
+ <_>
+ 7 9 2 2 2.
+ <_>
+
+ <_>
+ 14 10 2 4 -1.
+ <_>
+ 14 12 2 2 2.
+ <_>
+
+ <_>
+ 7 7 3 2 -1.
+ <_>
+ 8 7 1 2 3.
+ <_>
+
+ <_>
+ 14 17 6 3 -1.
+ <_>
+ 14 18 6 1 3.
+ <_>
+
+ <_>
+ 4 5 12 12 -1.
+ <_>
+ 4 5 6 6 2.
+ <_>
+ 10 11 6 6 2.
+ <_>
+
+ <_>
+ 6 9 8 8 -1.
+ <_>
+ 10 9 4 4 2.
+ <_>
+ 6 13 4 4 2.
+ <_>
+
+ <_>
+ 0 4 15 4 -1.
+ <_>
+ 5 4 5 4 3.
+ <_>
+
+ <_>
+ 13 2 4 1 -1.
+ <_>
+ 13 2 2 1 2.
+ <_>
+
+ <_>
+ 4 12 2 2 -1.
+ <_>
+ 4 13 2 1 2.
+ <_>
+
+ <_>
+ 8 13 4 3 -1.
+ <_>
+ 8 14 4 1 3.
+ <_>
+
+ <_>
+ 9 13 2 3 -1.
+ <_>
+ 9 14 2 1 3.
+ <_>
+
+ <_>
+ 13 11 2 3 -1.
+ <_>
+ 13 12 2 1 3.
+ <_>
+
+ <_>
+ 7 12 4 4 -1.
+ <_>
+ 7 12 2 2 2.
+ <_>
+ 9 14 2 2 2.
+ <_>
+
+ <_>
+ 10 11 2 2 -1.
+ <_>
+ 11 11 1 1 2.
+ <_>
+ 10 12 1 1 2.
+ <_>
+
+ <_>
+ 8 17 3 2 -1.
+ <_>
+ 9 17 1 2 3.
+ <_>
+
+ <_>
+ 10 11 2 2 -1.
+ <_>
+ 11 11 1 1 2.
+ <_>
+ 10 12 1 1 2.
+ <_>
+
+ <_>
+ 0 17 6 3 -1.
+ <_>
+ 0 18 6 1 3.
+ <_>
+
+ <_>
+ 10 11 2 2 -1.
+ <_>
+ 11 11 1 1 2.
+ <_>
+ 10 12 1 1 2.
+ <_>
+
+ <_>
+ 8 11 2 2 -1.
+ <_>
+ 8 11 1 1 2.
+ <_>
+ 9 12 1 1 2.
+ <_>
+
+ <_>
+ 12 5 8 4 -1.
+ <_>
+ 12 5 4 4 2.
+ <_>
+
+ <_>
+ 0 5 8 4 -1.
+ <_>
+ 4 5 4 4 2.
+ <_>
+
+ <_>
+ 13 2 4 1 -1.
+ <_>
+ 13 2 2 1 2.
+ <_>
+
+ <_>
+ 3 2 4 1 -1.
+ <_>
+ 5 2 2 1 2.
+ <_>
+
+ <_>
+ 10 0 4 2 -1.
+ <_>
+ 12 0 2 1 2.
+ <_>
+ 10 1 2 1 2.
+ <_>
+
+ <_>
+ 7 12 3 1 -1.
+ <_>
+ 8 12 1 1 3.
+ <_>
+
+ <_>
+ 8 11 4 8 -1.
+ <_>
+ 10 11 2 4 2.
+ <_>
+ 8 15 2 4 2.
+ <_>
+
+ <_>
+ 9 9 2 2 -1.
+ <_>
+ 9 10 2 1 2.
+ <_>
+
+ <_>
+ 3 18 15 2 -1.
+ <_>
+ 3 19 15 1 2.
+ <_>
+
+ <_>
+ 2 6 2 12 -1.
+ <_>
+ 2 6 1 6 2.
+ <_>
+ 3 12 1 6 2.
+ <_>
+
+ <_>
+ 9 8 2 3 -1.
+ <_>
+ 9 9 2 1 3.
+ <_>
+
+ <_>
+ 7 10 3 2 -1.
+ <_>
+ 8 10 1 2 3.
+ <_>
+
+ <_>
+ 11 11 3 1 -1.
+ <_>
+ 12 11 1 1 3.
+ <_>
+
+ <_>
+ 6 11 3 1 -1.
+ <_>
+ 7 11 1 1 3.
+ <_>
+
+ <_>
+ 9 2 4 2 -1.
+ <_>
+ 11 2 2 1 2.
+ <_>
+ 9 3 2 1 2.
+ <_>
+
+ <_>
+ 4 12 2 3 -1.
+ <_>
+ 4 13 2 1 3.
+ <_>
+
+ <_>
+ 2 1 18 3 -1.
+ <_>
+ 8 1 6 3 3.
+ <_>
+
+ <_>
+ 5 1 4 14 -1.
+ <_>
+ 7 1 2 14 2.
+ <_>
+
+ <_>
+ 8 16 12 3 -1.
+ <_>
+ 8 16 6 3 2.
+ <_>
+
+ <_>
+ 1 17 18 3 -1.
+ <_>
+ 7 17 6 3 3.
+ <_>
+
+ <_>
+ 9 14 2 6 -1.
+ <_>
+ 9 17 2 3 2.
+ <_>
+
+ <_>
+ 9 12 1 8 -1.
+ <_>
+ 9 16 1 4 2.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 9 6 2 12 -1.
+ <_>
+ 9 10 2 4 3.
+ <_>
+
+ <_>
+ 12 9 3 3 -1.
+ <_>
+ 12 10 3 1 3.
+ <_>
+
+ <_>
+ 0 1 4 8 -1.
+ <_>
+ 2 1 2 8 2.
+ <_>
+
+ <_>
+ 9 1 6 2 -1.
+ <_>
+ 12 1 3 1 2.
+ <_>
+ 9 2 3 1 2.
+ <_>
+
+ <_>
+ 1 3 12 14 -1.
+ <_>
+ 1 10 12 7 2.
+ <_>
+
+ <_>
+ 8 12 4 2 -1.
+ <_>
+ 10 12 2 1 2.
+ <_>
+ 8 13 2 1 2.
+ <_>
+
+ <_>
+ 1 9 10 2 -1.
+ <_>
+ 1 9 5 1 2.
+ <_>
+ 6 10 5 1 2.
+ <_>
+
+ <_>
+ 8 15 4 3 -1.
+ <_>
+ 8 16 4 1 3.
+ <_>
+
+ <_>
+ 6 8 8 3 -1.
+ <_>
+ 6 9 8 1 3.
+ <_>
+
+ <_>
+ 9 15 5 3 -1.
+ <_>
+ 9 16 5 1 3.
+ <_>
+
+ <_>
+ 8 7 4 3 -1.
+ <_>
+ 8 8 4 1 3.
+ <_>
+
+ <_>
+ 7 7 6 2 -1.
+ <_>
+ 7 8 6 1 2.
+ <_>
+
+ <_>
+ 5 7 8 2 -1.
+ <_>
+ 5 7 4 1 2.
+ <_>
+ 9 8 4 1 2.
+ <_>
+
+ <_>
+ 12 9 3 3 -1.
+ <_>
+ 12 10 3 1 3.
+ <_>
+
+ <_>
+ 4 7 4 2 -1.
+ <_>
+ 4 8 4 1 2.
+ <_>
+
+ <_>
+ 14 2 6 9 -1.
+ <_>
+ 14 5 6 3 3.
+ <_>
+
+ <_>
+ 4 9 3 3 -1.
+ <_>
+ 5 9 1 3 3.
+ <_>
+
+ <_>
+ 12 9 3 3 -1.
+ <_>
+ 12 10 3 1 3.
+ <_>
+
+ <_>
+ 0 2 6 9 -1.
+ <_>
+ 0 5 6 3 3.
+ <_>
+
+ <_>
+ 17 3 3 6 -1.
+ <_>
+ 18 3 1 6 3.
+ <_>
+
+ <_>
+ 0 3 3 6 -1.
+ <_>
+ 1 3 1 6 3.
+ <_>
+
+ <_>
+ 17 14 1 2 -1.
+ <_>
+ 17 15 1 1 2.
+ <_>
+
+ <_>
+ 4 9 4 3 -1.
+ <_>
+ 6 9 2 3 2.
+ <_>
+
+ <_>
+ 12 9 3 3 -1.
+ <_>
+ 12 10 3 1 3.
+ <_>
+
+ <_>
+ 5 9 3 3 -1.
+ <_>
+ 5 10 3 1 3.
+ <_>
+
+ <_>
+ 9 5 6 8 -1.
+ <_>
+ 12 5 3 4 2.
+ <_>
+ 9 9 3 4 2.
+ <_>
+
+ <_>
+ 5 5 6 8 -1.
+ <_>
+ 5 5 3 4 2.
+ <_>
+ 8 9 3 4 2.
+ <_>
+
+ <_>
+ 16 1 4 6 -1.
+ <_>
+ 16 4 4 3 2.
+ <_>
+
+ <_>
+ 1 0 6 20 -1.
+ <_>
+ 3 0 2 20 3.
+ <_>
+
+ <_>
+ 12 11 3 2 -1.
+ <_>
+ 13 11 1 2 3.
+ <_>
+
+ <_>
+ 5 11 3 2 -1.
+ <_>
+ 6 11 1 2 3.
+ <_>
+
+ <_>
+ 9 4 6 1 -1.
+ <_>
+ 11 4 2 1 3.
+ <_>
+
+ <_>
+ 0 0 8 3 -1.
+ <_>
+ 4 0 4 3 2.
+ <_>
+
+ <_>
+ 15 0 2 5 -1.
+ <_>
+ 15 0 1 5 2.
+ <_>
+
+ <_>
+ 4 1 3 2 -1.
+ <_>
+ 5 1 1 2 3.
+ <_>
+
+ <_>
+ 7 0 6 15 -1.
+ <_>
+ 9 0 2 15 3.
+ <_>
+
+ <_>
+ 6 11 3 1 -1.
+ <_>
+ 7 11 1 1 3.
+ <_>
+
+ <_>
+ 12 0 3 4 -1.
+ <_>
+ 13 0 1 4 3.
+ <_>
+
+ <_>
+ 5 4 6 1 -1.
+ <_>
+ 7 4 2 1 3.
+ <_>
+
+ <_>
+ 12 7 3 2 -1.
+ <_>
+ 12 8 3 1 2.
+ <_>
+
+ <_>
+ 0 1 4 6 -1.
+ <_>
+ 0 4 4 3 2.
+ <_>
+
+ <_>
+ 12 7 3 2 -1.
+ <_>
+ 12 8 3 1 2.
+ <_>
+
+ <_>
+ 2 16 3 3 -1.
+ <_>
+ 2 17 3 1 3.
+ <_>
+
+ <_>
+ 13 8 6 10 -1.
+ <_>
+ 16 8 3 5 2.
+ <_>
+ 13 13 3 5 2.
+ <_>
+
+ <_>
+ 0 9 5 2 -1.
+ <_>
+ 0 10 5 1 2.
+ <_>
+
+ <_>
+ 12 11 2 2 -1.
+ <_>
+ 13 11 1 1 2.
+ <_>
+ 12 12 1 1 2.
+ <_>
+
+ <_>
+ 3 15 3 3 -1.
+ <_>
+ 3 16 3 1 3.
+ <_>
+
+ <_>
+ 12 7 3 2 -1.
+ <_>
+ 12 8 3 1 2.
+ <_>
+
+ <_>
+ 5 7 3 2 -1.
+ <_>
+ 5 8 3 1 2.
+ <_>
+
+ <_>
+ 9 5 9 9 -1.
+ <_>
+ 9 8 9 3 3.
+ <_>
+
+ <_>
+ 5 0 3 7 -1.
+ <_>
+ 6 0 1 7 3.
+ <_>
+
+ <_>
+ 5 2 12 5 -1.
+ <_>
+ 9 2 4 5 3.
+ <_>
+
+ <_>
+ 6 11 2 2 -1.
+ <_>
+ 6 11 1 1 2.
+ <_>
+ 7 12 1 1 2.
+ <_>
+
+ <_>
+ 15 15 3 2 -1.
+ <_>
+ 15 16 3 1 2.
+ <_>
+
+ <_>
+ 2 15 3 2 -1.
+ <_>
+ 2 16 3 1 2.
+ <_>
+
+ <_>
+ 14 12 6 8 -1.
+ <_>
+ 17 12 3 4 2.
+ <_>
+ 14 16 3 4 2.
+ <_>
+
+ <_>
+ 2 8 15 6 -1.
+ <_>
+ 7 8 5 6 3.
+ <_>
+
+ <_>
+ 2 2 18 17 -1.
+ <_>
+ 8 2 6 17 3.
+ <_>
+
+ <_>
+ 5 1 4 1 -1.
+ <_>
+ 7 1 2 1 2.
+ <_>
+
+ <_>
+ 5 2 12 5 -1.
+ <_>
+ 9 2 4 5 3.
+ <_>
+
+ <_>
+ 3 2 12 5 -1.
+ <_>
+ 7 2 4 5 3.
+ <_>
+
+ <_>
+ 4 9 12 4 -1.
+ <_>
+ 10 9 6 2 2.
+ <_>
+ 4 11 6 2 2.
+ <_>
+
+ <_>
+ 5 15 6 2 -1.
+ <_>
+ 5 15 3 1 2.
+ <_>
+ 8 16 3 1 2.
+ <_>
+
+ <_>
+ 10 14 2 3 -1.
+ <_>
+ 10 15 2 1 3.
+ <_>
+
+ <_>
+ 0 13 20 2 -1.
+ <_>
+ 0 13 10 1 2.
+ <_>
+ 10 14 10 1 2.
+ <_>
+
+ <_>
+ 4 9 12 8 -1.
+ <_>
+ 10 9 6 4 2.
+ <_>
+ 4 13 6 4 2.
+ <_>
+
+ <_>
+ 8 13 3 6 -1.
+ <_>
+ 8 16 3 3 2.
+ <_>
+
+ <_>
+ 10 12 2 2 -1.
+ <_>
+ 10 13 2 1 2.
+ <_>
+
+ <_>
+ 9 12 2 2 -1.
+ <_>
+ 9 12 1 1 2.
+ <_>
+ 10 13 1 1 2.
+ <_>
+
+ <_>
+ 4 11 14 4 -1.
+ <_>
+ 11 11 7 2 2.
+ <_>
+ 4 13 7 2 2.
+ <_>
+
+ <_>
+ 8 5 4 2 -1.
+ <_>
+ 8 6 4 1 2.
+ <_>
+
+ <_>
+ 10 10 6 3 -1.
+ <_>
+ 12 10 2 3 3.
+ <_>
+
+ <_>
+ 2 14 1 2 -1.
+ <_>
+ 2 15 1 1 2.
+ <_>
+
+ <_>
+ 13 8 6 12 -1.
+ <_>
+ 16 8 3 6 2.
+ <_>
+ 13 14 3 6 2.
+ <_>
+
+ <_>
+ 1 8 6 12 -1.
+ <_>
+ 1 8 3 6 2.
+ <_>
+ 4 14 3 6 2.
+ <_>
+
+ <_>
+ 10 0 6 10 -1.
+ <_>
+ 12 0 2 10 3.
+ <_>
+
+ <_>
+ 5 11 8 4 -1.
+ <_>
+ 5 11 4 2 2.
+ <_>
+ 9 13 4 2 2.
+ <_>
+
+ <_>
+ 10 16 8 4 -1.
+ <_>
+ 14 16 4 2 2.
+ <_>
+ 10 18 4 2 2.
+ <_>
+
+ <_>
+ 7 7 6 6 -1.
+ <_>
+ 9 7 2 6 3.
+ <_>
+
+ <_>
+ 10 2 4 10 -1.
+ <_>
+ 10 2 2 10 2.
+ <_>
+
+ <_>
+ 6 1 4 9 -1.
+ <_>
+ 8 1 2 9 2.
+ <_>
+
+ <_>
+ 12 19 2 1 -1.
+ <_>
+ 12 19 1 1 2.
+ <_>
+
+ <_>
+ 1 2 4 9 -1.
+ <_>
+ 3 2 2 9 2.
+ <_>
+
+ <_>
+ 7 5 6 4 -1.
+ <_>
+ 9 5 2 4 3.
+ <_>
+
+ <_>
+ 9 4 2 4 -1.
+ <_>
+ 9 6 2 2 2.
+ <_>
+
+ <_>
+ 14 5 2 8 -1.
+ <_>
+ 14 9 2 4 2.
+ <_>
+
+ <_>
+ 7 6 5 12 -1.
+ <_>
+ 7 12 5 6 2.
+ <_>
+
+ <_>
+ 14 6 2 6 -1.
+ <_>
+ 14 9 2 3 2.
+ <_>
+
+ <_>
+ 4 6 2 6 -1.
+ <_>
+ 4 9 2 3 2.
+ <_>
+
+ <_>
+ 8 15 10 4 -1.
+ <_>
+ 13 15 5 2 2.
+ <_>
+ 8 17 5 2 2.
+ <_>
+
+ <_>
+ 6 18 2 2 -1.
+ <_>
+ 7 18 1 2 2.
+ <_>
+
+ <_>
+ 11 3 6 2 -1.
+ <_>
+ 11 4 6 1 2.
+ <_>
+
+ <_>
+ 2 0 16 6 -1.
+ <_>
+ 2 2 16 2 3.
+ <_>
+
+ <_>
+ 11 3 6 2 -1.
+ <_>
+ 11 4 6 1 2.
+ <_>
+
+ <_>
+ 4 11 10 3 -1.
+ <_>
+ 4 12 10 1 3.
+ <_>
+
+ <_>
+ 11 3 6 2 -1.
+ <_>
+ 11 4 6 1 2.
+ <_>
+
+ <_>
+ 3 3 6 2 -1.
+ <_>
+ 3 4 6 1 2.
+ <_>
+
+ <_>
+ 16 0 4 7 -1.
+ <_>
+ 16 0 2 7 2.
+ <_>
+
+ <_>
+ 0 14 9 6 -1.
+ <_>
+ 0 16 9 2 3.
+ <_>
+
+ <_>
+ 9 16 3 3 -1.
+ <_>
+ 9 17 3 1 3.
+ <_>
+
+ <_>
+ 4 6 6 2 -1.
+ <_>
+ 6 6 2 2 3.
+ <_>
+
+ <_>
+ 15 11 1 3 -1.
+ <_>
+ 15 12 1 1 3.
+ <_>
+
+ <_>
+ 5 5 2 3 -1.
+ <_>
+ 5 6 2 1 3.
+ <_>
+
+ <_>
+ 10 9 2 2 -1.
+ <_>
+ 10 10 2 1 2.
+ <_>
+
+ <_>
+ 3 1 4 3 -1.
+ <_>
+ 5 1 2 3 2.
+ <_>
+
+ <_>
+ 16 0 4 7 -1.
+ <_>
+ 16 0 2 7 2.
+ <_>
+
+ <_>
+ 0 0 20 1 -1.
+ <_>
+ 10 0 10 1 2.
+ <_>
+
+ <_>
+ 15 11 1 3 -1.
+ <_>
+ 15 12 1 1 3.
+ <_>
+
+ <_>
+ 0 4 3 4 -1.
+ <_>
+ 1 4 1 4 3.
+ <_>
+
+ <_>
+ 16 3 3 6 -1.
+ <_>
+ 16 5 3 2 3.
+ <_>
+
+ <_>
+ 1 3 3 6 -1.
+ <_>
+ 1 5 3 2 3.
+ <_>
+
+ <_>
+ 6 2 12 6 -1.
+ <_>
+ 12 2 6 3 2.
+ <_>
+ 6 5 6 3 2.
+ <_>
+
+ <_>
+ 8 10 4 3 -1.
+ <_>
+ 8 11 4 1 3.
+ <_>
+
+ <_>
+ 4 2 14 6 -1.
+ <_>
+ 11 2 7 3 2.
+ <_>
+ 4 5 7 3 2.
+ <_>
+
+ <_>
+ 9 11 2 3 -1.
+ <_>
+ 9 12 2 1 3.
+ <_>
+
+ <_>
+ 15 13 2 3 -1.
+ <_>
+ 15 14 2 1 3.
+ <_>
+
+ <_>
+ 8 12 4 3 -1.
+ <_>
+ 8 13 4 1 3.
+ <_>
+
+ <_>
+ 15 11 1 3 -1.
+ <_>
+ 15 12 1 1 3.
+ <_>
+
+ <_>
+ 7 13 5 2 -1.
+ <_>
+ 7 14 5 1 2.
+ <_>
+
+ <_>
+ 7 12 6 3 -1.
+ <_>
+ 7 13 6 1 3.
+ <_>
+
+ <_>
+ 5 11 4 4 -1.
+ <_>
+ 5 13 4 2 2.
+ <_>
+
+ <_>
+ 11 4 3 3 -1.
+ <_>
+ 12 4 1 3 3.
+ <_>
+
+ <_>
+ 6 4 3 3 -1.
+ <_>
+ 7 4 1 3 3.
+ <_>
+
+ <_>
+ 16 5 3 6 -1.
+ <_>
+ 17 5 1 6 3.
+ <_>
+
+ <_>
+ 3 6 12 7 -1.
+ <_>
+ 7 6 4 7 3.
+ <_>
+
+ <_>
+ 16 5 3 6 -1.
+ <_>
+ 17 5 1 6 3.
+ <_>
+
+ <_>
+ 3 13 2 3 -1.
+ <_>
+ 3 14 2 1 3.
+ <_>
+
+ <_>
+ 16 5 3 6 -1.
+ <_>
+ 17 5 1 6 3.
+ <_>
+
+ <_>
+ 1 5 3 6 -1.
+ <_>
+ 2 5 1 6 3.
+ <_>
+
+ <_>
+ 1 9 18 1 -1.
+ <_>
+ 7 9 6 1 3.
+ <_>
+
+ <_>
+ 0 9 8 7 -1.
+ <_>
+ 4 9 4 7 2.
+ <_>
+
+ <_>
+ 12 11 8 2 -1.
+ <_>
+ 12 12 8 1 2.
+ <_>
+
+ <_>
+ 0 11 8 2 -1.
+ <_>
+ 0 12 8 1 2.
+ <_>
+
+ <_>
+ 9 13 2 3 -1.
+ <_>
+ 9 14 2 1 3.
+ <_>
+
+ <_>
+ 4 10 12 4 -1.
+ <_>
+ 4 10 6 2 2.
+ <_>
+ 10 12 6 2 2.
+ <_>
+
+ <_>
+ 9 3 3 7 -1.
+ <_>
+ 10 3 1 7 3.
+ <_>
+
+ <_>
+ 7 2 3 5 -1.
+ <_>
+ 8 2 1 5 3.
+ <_>
+
+ <_>
+ 9 12 4 6 -1.
+ <_>
+ 11 12 2 3 2.
+ <_>
+ 9 15 2 3 2.
+ <_>
+
+ <_>
+ 8 7 3 6 -1.
+ <_>
+ 9 7 1 6 3.
+ <_>
+
+ <_>
+ 15 4 4 2 -1.
+ <_>
+ 15 5 4 1 2.
+ <_>
+
+ <_>
+ 8 7 3 3 -1.
+ <_>
+ 9 7 1 3 3.
+ <_>
+
+ <_>
+ 14 2 6 4 -1.
+ <_>
+ 14 4 6 2 2.
+ <_>
+
+ <_>
+ 7 16 6 1 -1.
+ <_>
+ 9 16 2 1 3.
+ <_>
+
+ <_>
+ 15 13 2 3 -1.
+ <_>
+ 15 14 2 1 3.
+ <_>
+
+ <_>
+ 8 7 3 10 -1.
+ <_>
+ 9 7 1 10 3.
+ <_>
+
+ <_>
+ 11 10 2 6 -1.
+ <_>
+ 11 12 2 2 3.
+ <_>
+
+ <_>
+ 6 10 4 1 -1.
+ <_>
+ 8 10 2 1 2.
+ <_>
+
+ <_>
+ 10 9 2 2 -1.
+ <_>
+ 10 10 2 1 2.
+ <_>
+
+ <_>
+ 8 9 2 2 -1.
+ <_>
+ 8 10 2 1 2.
+ <_>
+
+ <_>
+ 12 7 2 2 -1.
+ <_>
+ 13 7 1 1 2.
+ <_>
+ 12 8 1 1 2.
+ <_>
+
+ <_>
+ 5 7 2 2 -1.
+ <_>
+ 5 7 1 1 2.
+ <_>
+ 6 8 1 1 2.
+ <_>
+
+ <_>
+ 13 0 3 14 -1.
+ <_>
+ 14 0 1 14 3.
+ <_>
+
+ <_>
+ 4 0 3 14 -1.
+ <_>
+ 5 0 1 14 3.
+ <_>
+
+ <_>
+ 13 4 3 14 -1.
+ <_>
+ 14 4 1 14 3.
+ <_>
+
+ <_>
+ 9 14 2 3 -1.
+ <_>
+ 9 15 2 1 3.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 4 2 3 16 -1.
+ <_>
+ 5 2 1 16 3.
+ <_>
+
+ <_>
+ 7 2 8 10 -1.
+ <_>
+ 7 7 8 5 2.
+ <_>
+
+ <_>
+ 6 14 7 3 -1.
+ <_>
+ 6 15 7 1 3.
+ <_>
+
+ <_>
+ 9 2 10 12 -1.
+ <_>
+ 14 2 5 6 2.
+ <_>
+ 9 8 5 6 2.
+ <_>
+
+ <_>
+ 6 7 8 2 -1.
+ <_>
+ 6 8 8 1 2.
+ <_>
+
+ <_>
+ 8 13 4 6 -1.
+ <_>
+ 8 16 4 3 2.
+ <_>
+
+ <_>
+ 6 6 1 3 -1.
+ <_>
+ 6 7 1 1 3.
+ <_>
+
+ <_>
+ 16 2 4 6 -1.
+ <_>
+ 16 4 4 2 3.
+ <_>
+
+ <_>
+ 6 6 4 2 -1.
+ <_>
+ 6 6 2 1 2.
+ <_>
+ 8 7 2 1 2.
+ <_>
+
+ <_>
+ 16 2 4 6 -1.
+ <_>
+ 16 4 4 2 3.
+ <_>
+
+ <_>
+ 0 2 4 6 -1.
+ <_>
+ 0 4 4 2 3.
+ <_>
+
+ <_>
+ 9 6 2 6 -1.
+ <_>
+ 9 6 1 6 2.
+ <_>
+
+ <_>
+ 3 4 6 10 -1.
+ <_>
+ 3 9 6 5 2.
+ <_>
+
+ <_>
+ 9 5 2 6 -1.
+ <_>
+ 9 5 1 6 2.
+ <_>
+
+ <_>
+ 3 13 2 3 -1.
+ <_>
+ 3 14 2 1 3.
+ <_>
+
+ <_>
+ 13 13 3 2 -1.
+ <_>
+ 13 14 3 1 2.
+ <_>
+
+ <_>
+ 2 16 10 4 -1.
+ <_>
+ 2 16 5 2 2.
+ <_>
+ 7 18 5 2 2.
+ <_>
+
+ <_>
+ 5 6 10 6 -1.
+ <_>
+ 10 6 5 3 2.
+ <_>
+ 5 9 5 3 2.
+ <_>
+
+ <_>
+ 7 14 1 3 -1.
+ <_>
+ 7 15 1 1 3.
+ <_>
+
+ <_>
+ 14 16 6 3 -1.
+ <_>
+ 14 17 6 1 3.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 7 4 10 3 -1.
+ <_>
+ 7 5 10 1 3.
+ <_>
+
+ <_>
+ 0 4 5 4 -1.
+ <_>
+ 0 6 5 2 2.
+ <_>
+
+ <_>
+ 13 11 3 9 -1.
+ <_>
+ 13 14 3 3 3.
+ <_>
+
+ <_>
+ 4 11 3 9 -1.
+ <_>
+ 4 14 3 3 3.
+ <_>
+
+ <_>
+ 9 7 2 1 -1.
+ <_>
+ 9 7 1 1 2.
+ <_>
+
+ <_>
+ 5 0 6 17 -1.
+ <_>
+ 7 0 2 17 3.
+ <_>
+
+ <_>
+ 10 3 6 3 -1.
+ <_>
+ 10 3 3 3 2.
+ <_>
+
+ <_>
+ 2 2 15 4 -1.
+ <_>
+ 7 2 5 4 3.
+ <_>
+
+ <_>
+ 8 2 8 2 -1.
+ <_>
+ 12 2 4 1 2.
+ <_>
+ 8 3 4 1 2.
+ <_>
+
+ <_>
+ 8 1 3 6 -1.
+ <_>
+ 8 3 3 2 3.
+ <_>
+
+ <_>
+ 9 17 2 2 -1.
+ <_>
+ 9 18 2 1 2.
+ <_>
+
+ <_>
+ 0 0 2 14 -1.
+ <_>
+ 1 0 1 14 2.
+ <_>
+
+ <_>
+ 12 0 7 3 -1.
+ <_>
+ 12 1 7 1 3.
+ <_>
+
+ <_>
+ 1 14 1 2 -1.
+ <_>
+ 1 15 1 1 2.
+ <_>
+
+ <_>
+ 14 12 2 8 -1.
+ <_>
+ 15 12 1 4 2.
+ <_>
+ 14 16 1 4 2.
+ <_>
+
+ <_>
+ 1 0 7 3 -1.
+ <_>
+ 1 1 7 1 3.
+ <_>
+
+ <_>
+ 14 12 2 8 -1.
+ <_>
+ 15 12 1 4 2.
+ <_>
+ 14 16 1 4 2.
+ <_>
+
+ <_>
+ 6 0 8 12 -1.
+ <_>
+ 6 0 4 6 2.
+ <_>
+ 10 6 4 6 2.
+ <_>
+
+ <_>
+ 6 1 8 9 -1.
+ <_>
+ 6 4 8 3 3.
+ <_>
+
+ <_>
+ 5 2 2 2 -1.
+ <_>
+ 5 3 2 1 2.
+ <_>
+
+ <_>
+ 13 14 6 6 -1.
+ <_>
+ 16 14 3 3 2.
+ <_>
+ 13 17 3 3 2.
+ <_>
+
+ <_>
+ 0 17 20 2 -1.
+ <_>
+ 0 17 10 1 2.
+ <_>
+ 10 18 10 1 2.
+ <_>
+
+ <_>
+ 10 3 2 6 -1.
+ <_>
+ 11 3 1 3 2.
+ <_>
+ 10 6 1 3 2.
+ <_>
+
+ <_>
+ 5 12 6 2 -1.
+ <_>
+ 8 12 3 2 2.
+ <_>
+
+ <_>
+ 10 7 6 13 -1.
+ <_>
+ 10 7 3 13 2.
+ <_>
+
+ <_>
+ 5 15 10 5 -1.
+ <_>
+ 10 15 5 5 2.
+ <_>
+
+ <_>
+ 10 4 4 10 -1.
+ <_>
+ 10 4 2 10 2.
+ <_>
+
+ <_>
+ 5 7 2 1 -1.
+ <_>
+ 6 7 1 1 2.
+ <_>
+
+ <_>
+ 10 3 6 7 -1.
+ <_>
+ 10 3 3 7 2.
+ <_>
+
+ <_>
+ 4 3 6 7 -1.
+ <_>
+ 7 3 3 7 2.
+ <_>
+
+ <_>
+ 1 7 18 5 -1.
+ <_>
+ 7 7 6 5 3.
+ <_>
+
+ <_>
+ 3 17 4 3 -1.
+ <_>
+ 5 17 2 3 2.
+ <_>
+
+ <_>
+ 8 14 12 6 -1.
+ <_>
+ 14 14 6 3 2.
+ <_>
+ 8 17 6 3 2.
+ <_>
+
+ <_>
+ 0 13 20 4 -1.
+ <_>
+ 0 13 10 2 2.
+ <_>
+ 10 15 10 2 2.
+ <_>
+
+ <_>
+ 4 5 14 2 -1.
+ <_>
+ 11 5 7 1 2.
+ <_>
+ 4 6 7 1 2.
+ <_>
+
+ <_>
+ 1 2 10 12 -1.
+ <_>
+ 1 2 5 6 2.
+ <_>
+ 6 8 5 6 2.
+ <_>
+
+ <_>
+ 6 1 14 3 -1.
+ <_>
+ 6 2 14 1 3.
+ <_>
+
+ <_>
+ 8 16 2 3 -1.
+ <_>
+ 8 17 2 1 3.
+ <_>
+
+ <_>
+ 9 17 3 2 -1.
+ <_>
+ 10 17 1 2 3.
+ <_>
+
+ <_>
+ 5 15 4 2 -1.
+ <_>
+ 5 15 2 1 2.
+ <_>
+ 7 16 2 1 2.
+ <_>
+
+ <_>
+ 10 15 1 3 -1.
+ <_>
+ 10 16 1 1 3.
+ <_>
+
+ <_>
+ 8 16 4 4 -1.
+ <_>
+ 8 16 2 2 2.
+ <_>
+ 10 18 2 2 2.
+ <_>
+
+ <_>
+ 6 11 8 6 -1.
+ <_>
+ 6 14 8 3 2.
+ <_>
+
+ <_>
+ 2 13 5 2 -1.
+ <_>
+ 2 14 5 1 2.
+ <_>
+
+ <_>
+ 13 14 6 6 -1.
+ <_>
+ 16 14 3 3 2.
+ <_>
+ 13 17 3 3 2.
+ <_>
+
+ <_>
+ 1 9 18 4 -1.
+ <_>
+ 7 9 6 4 3.
+ <_>
+
+ <_>
+ 13 14 6 6 -1.
+ <_>
+ 16 14 3 3 2.
+ <_>
+ 13 17 3 3 2.
+ <_>
+
+ <_>
+ 0 2 1 6 -1.
+ <_>
+ 0 4 1 2 3.
+ <_>
+
+ <_>
+ 5 0 15 20 -1.
+ <_>
+ 5 10 15 10 2.
+ <_>
+
+ <_>
+ 1 14 6 6 -1.
+ <_>
+ 1 14 3 3 2.
+ <_>
+ 4 17 3 3 2.
+ <_>
+
+ <_>
+ 8 14 4 6 -1.
+ <_>
+ 10 14 2 3 2.
+ <_>
+ 8 17 2 3 2.
+ <_>
+
+ <_>
+ 7 11 2 1 -1.
+ <_>
+ 8 11 1 1 2.
+ <_>
+
+ <_>
+ 9 17 3 2 -1.
+ <_>
+ 10 17 1 2 3.
+ <_>
+
+ <_>
+ 8 17 3 2 -1.
+ <_>
+ 9 17 1 2 3.
+ <_>
+
+ <_>
+ 12 14 4 6 -1.
+ <_>
+ 14 14 2 3 2.
+ <_>
+ 12 17 2 3 2.
+ <_>
+
+ <_>
+ 4 14 4 6 -1.
+ <_>
+ 4 14 2 3 2.
+ <_>
+ 6 17 2 3 2.
+ <_>
+
+ <_>
+ 13 14 2 6 -1.
+ <_>
+ 14 14 1 3 2.
+ <_>
+ 13 17 1 3 2.
+ <_>
+
+ <_>
+ 5 14 2 6 -1.
+ <_>
+ 5 14 1 3 2.
+ <_>
+ 6 17 1 3 2.
+ <_>
+
+ <_>
+ 7 0 6 12 -1.
+ <_>
+ 7 4 6 4 3.
+ <_>
+
+ <_>
+ 0 7 12 2 -1.
+ <_>
+ 4 7 4 2 3.
+ <_>
+
+ <_>
+ 10 3 3 13 -1.
+ <_>
+ 11 3 1 13 3.
+ <_>
+
+ <_>
+ 7 3 3 13 -1.
+ <_>
+ 8 3 1 13 3.
+ <_>
+
+ <_>
+ 10 8 6 3 -1.
+ <_>
+ 10 9 6 1 3.
+ <_>
+
+ <_>
+ 3 11 3 2 -1.
+ <_>
+ 4 11 1 2 3.
+ <_>
+
+ <_>
+ 13 12 6 8 -1.
+ <_>
+ 16 12 3 4 2.
+ <_>
+ 13 16 3 4 2.
+ <_>
+
+ <_>
+ 7 6 6 5 -1.
+ <_>
+ 9 6 2 5 3.
+ <_>
+
+ <_>
+ 17 11 2 7 -1.
+ <_>
+ 17 11 1 7 2.
+ <_>
+
+ <_>
+ 3 13 8 2 -1.
+ <_>
+ 7 13 4 2 2.
+ <_>
+
+ <_>
+ 6 9 8 3 -1.
+ <_>
+ 6 10 8 1 3.
+ <_>
+
+ <_>
+ 4 3 4 3 -1.
+ <_>
+ 4 4 4 1 3.
+ <_>
+
+ <_>
+ 11 3 4 3 -1.
+ <_>
+ 11 4 4 1 3.
+ <_>
+
+ <_>
+ 1 4 17 12 -1.
+ <_>
+ 1 8 17 4 3.
+ <_>
+
+ <_>
+ 11 3 4 3 -1.
+ <_>
+ 11 4 4 1 3.
+ <_>
+
+ <_>
+ 4 8 6 3 -1.
+ <_>
+ 4 9 6 1 3.
+ <_>
+
+ <_>
+ 12 3 5 3 -1.
+ <_>
+ 12 4 5 1 3.
+ <_>
+
+ <_>
+ 1 11 2 7 -1.
+ <_>
+ 2 11 1 7 2.
+ <_>
+
+ <_>
+ 15 12 2 8 -1.
+ <_>
+ 16 12 1 4 2.
+ <_>
+ 15 16 1 4 2.
+ <_>
+
+ <_>
+ 4 8 11 3 -1.
+ <_>
+ 4 9 11 1 3.
+ <_>
+
+ <_>
+ 9 13 6 2 -1.
+ <_>
+ 12 13 3 1 2.
+ <_>
+ 9 14 3 1 2.
+ <_>
+
+ <_>
+ 6 13 4 3 -1.
+ <_>
+ 6 14 4 1 3.
+ <_>
+
+ <_>
+ 9 12 3 3 -1.
+ <_>
+ 10 12 1 3 3.
+ <_>
+
+ <_>
+ 5 3 3 3 -1.
+ <_>
+ 5 4 3 1 3.
+ <_>
+
+ <_>
+ 9 4 2 3 -1.
+ <_>
+ 9 5 2 1 3.
+ <_>
+
+ <_>
+ 0 2 16 3 -1.
+ <_>
+ 0 3 16 1 3.
+ <_>
+
+ <_>
+ 15 12 2 8 -1.
+ <_>
+ 16 12 1 4 2.
+ <_>
+ 15 16 1 4 2.
+ <_>
+
+ <_>
+ 3 12 2 8 -1.
+ <_>
+ 3 12 1 4 2.
+ <_>
+ 4 16 1 4 2.
+ <_>
+
+ <_>
+ 14 13 3 6 -1.
+ <_>
+ 14 15 3 2 3.
+ <_>
+
+ <_>
+ 3 13 3 6 -1.
+ <_>
+ 3 15 3 2 3.
+ <_>
+
+ <_>
+ 6 5 10 2 -1.
+ <_>
+ 11 5 5 1 2.
+ <_>
+ 6 6 5 1 2.
+ <_>
+
+ <_>
+ 2 14 14 6 -1.
+ <_>
+ 2 17 14 3 2.
+ <_>
+
+ <_>
+ 10 14 1 3 -1.
+ <_>
+ 10 15 1 1 3.
+ <_>
+
+ <_>
+ 4 16 2 2 -1.
+ <_>
+ 4 16 1 1 2.
+ <_>
+ 5 17 1 1 2.
+ <_>
+
+ <_>
+ 10 6 2 3 -1.
+ <_>
+ 10 7 2 1 3.
+ <_>
+
+ <_>
+ 0 17 20 2 -1.
+ <_>
+ 0 17 10 1 2.
+ <_>
+ 10 18 10 1 2.
+ <_>
+
+ <_>
+ 13 6 1 3 -1.
+ <_>
+ 13 7 1 1 3.
+ <_>
+
+ <_>
+ 8 13 3 2 -1.
+ <_>
+ 9 13 1 2 3.
+ <_>
+
+ <_>
+ 12 2 3 3 -1.
+ <_>
+ 13 2 1 3 3.
+ <_>
+
+ <_>
+ 3 18 2 2 -1.
+ <_>
+ 3 18 1 1 2.
+ <_>
+ 4 19 1 1 2.
+ <_>
+
+ <_>
+ 9 16 3 4 -1.
+ <_>
+ 10 16 1 4 3.
+ <_>
+
+ <_>
+ 6 6 1 3 -1.
+ <_>
+ 6 7 1 1 3.
+ <_>
+
+ <_>
+ 13 1 5 2 -1.
+ <_>
+ 13 2 5 1 2.
+ <_>
+
+ <_>
+ 7 14 6 2 -1.
+ <_>
+ 7 14 3 1 2.
+ <_>
+ 10 15 3 1 2.
+ <_>
+
+ <_>
+ 11 3 3 4 -1.
+ <_>
+ 12 3 1 4 3.
+ <_>
+
+ <_>
+ 1 13 12 6 -1.
+ <_>
+ 5 13 4 6 3.
+ <_>
+
+ <_>
+ 14 11 5 2 -1.
+ <_>
+ 14 12 5 1 2.
+ <_>
+
+ <_>
+ 2 15 14 4 -1.
+ <_>
+ 2 15 7 2 2.
+ <_>
+ 9 17 7 2 2.
+ <_>
+
+ <_>
+ 3 7 14 2 -1.
+ <_>
+ 10 7 7 1 2.
+ <_>
+ 3 8 7 1 2.
+ <_>
+
+ <_>
+ 1 11 4 2 -1.
+ <_>
+ 1 12 4 1 2.
+ <_>
+
+ <_>
+ 14 0 6 14 -1.
+ <_>
+ 16 0 2 14 3.
+ <_>
+
+ <_>
+ 4 11 1 3 -1.
+ <_>
+ 4 12 1 1 3.
+ <_>
+
+ <_>
+ 14 0 6 14 -1.
+ <_>
+ 16 0 2 14 3.
+ <_>
+
+ <_>
+ 1 10 3 7 -1.
+ <_>
+ 2 10 1 7 3.
+ <_>
+
+ <_>
+ 8 12 9 2 -1.
+ <_>
+ 8 13 9 1 2.
+ <_>
+
+ <_>
+ 0 6 20 1 -1.
+ <_>
+ 10 6 10 1 2.
+ <_>
+
+ <_>
+ 8 4 4 4 -1.
+ <_>
+ 8 4 2 4 2.
+ <_>
+
+ <_>
+ 0 0 2 2 -1.
+ <_>
+ 0 1 2 1 2.
+ <_>
+
+ <_>
+ 5 3 10 9 -1.
+ <_>
+ 5 6 10 3 3.
+ <_>
+
+ <_>
+ 15 2 4 10 -1.
+ <_>
+ 15 2 2 10 2.
+ <_>
+
+ <_>
+ 8 2 2 7 -1.
+ <_>
+ 9 2 1 7 2.
+ <_>
+
+ <_>
+ 7 4 12 1 -1.
+ <_>
+ 11 4 4 1 3.
+ <_>
+
+ <_>
+ 3 4 9 1 -1.
+ <_>
+ 6 4 3 1 3.
+ <_>
+
+ <_>
+ 15 10 1 4 -1.
+ <_>
+ 15 12 1 2 2.
+ <_>
+
+ <_>
+ 4 10 6 4 -1.
+ <_>
+ 7 10 3 4 2.
+ <_>
+
+ <_>
+ 15 9 1 6 -1.
+ <_>
+ 15 12 1 3 2.
+ <_>
+
+ <_>
+ 7 17 6 3 -1.
+ <_>
+ 7 18 6 1 3.
+ <_>
+
+ <_>
+ 14 3 2 16 -1.
+ <_>
+ 15 3 1 8 2.
+ <_>
+ 14 11 1 8 2.
+ <_>
+
+ <_>
+ 4 9 1 6 -1.
+ <_>
+ 4 12 1 3 2.
+ <_>
+
+ <_>
+ 12 1 5 2 -1.
+ <_>
+ 12 2 5 1 2.
+ <_>
+
+ <_>
+ 6 18 4 2 -1.
+ <_>
+ 6 18 2 1 2.
+ <_>
+ 8 19 2 1 2.
+ <_>
+
+ <_>
+ 2 4 16 10 -1.
+ <_>
+ 10 4 8 5 2.
+ <_>
+ 2 9 8 5 2.
+ <_>
+
+ <_>
+ 6 5 1 10 -1.
+ <_>
+ 6 10 1 5 2.
+ <_>
+
+ <_>
+ 4 8 15 2 -1.
+ <_>
+ 9 8 5 2 3.
+ <_>
+
+ <_>
+ 1 8 15 2 -1.
+ <_>
+ 6 8 5 2 3.
+ <_>
+
+ <_>
+ 9 5 3 6 -1.
+ <_>
+ 9 7 3 2 3.
+ <_>
+
+ <_>
+ 5 7 8 2 -1.
+ <_>
+ 9 7 4 2 2.
+ <_>
+
+ <_>
+ 9 11 2 3 -1.
+ <_>
+ 9 12 2 1 3.
+ <_>
+
+ <_>
+ 1 0 16 3 -1.
+ <_>
+ 1 1 16 1 3.
+ <_>
+
+ <_>
+ 11 2 7 2 -1.
+ <_>
+ 11 3 7 1 2.
+ <_>
+
+ <_>
+ 5 1 10 18 -1.
+ <_>
+ 5 7 10 6 3.
+ <_>
+
+ <_>
+ 17 4 3 2 -1.
+ <_>
+ 18 4 1 2 3.
+ <_>
+
+ <_>
+ 8 13 1 3 -1.
+ <_>
+ 8 14 1 1 3.
+ <_>
+
+ <_>
+ 3 14 14 6 -1.
+ <_>
+ 3 16 14 2 3.
+ <_>
+
+ <_>
+ 0 2 3 4 -1.
+ <_>
+ 1 2 1 4 3.
+ <_>
+
+ <_>
+ 12 1 5 2 -1.
+ <_>
+ 12 2 5 1 2.
+ <_>
+
+ <_>
+ 3 1 5 2 -1.
+ <_>
+ 3 2 5 1 2.
+ <_>
+
+ <_>
+ 10 13 2 3 -1.
+ <_>
+ 10 14 2 1 3.
+ <_>
+
+ <_>
+ 8 13 2 3 -1.
+ <_>
+ 8 14 2 1 3.
+ <_>
+
+ <_>
+ 14 12 2 3 -1.
+ <_>
+ 14 13 2 1 3.
+ <_>
+
+ <_>
+ 7 2 2 3 -1.
+ <_>
+ 7 3 2 1 3.
+ <_>
+
+ <_>
+ 5 6 10 4 -1.
+ <_>
+ 10 6 5 2 2.
+ <_>
+ 5 8 5 2 2.
+ <_>
+
+ <_>
+ 9 13 1 6 -1.
+ <_>
+ 9 16 1 3 2.
+ <_>
+
+ <_>
+ 10 12 2 2 -1.
+ <_>
+ 11 12 1 1 2.
+ <_>
+ 10 13 1 1 2.
+ <_>
+
+ <_>
+ 4 12 2 3 -1.
+ <_>
+ 4 13 2 1 3.
+ <_>
+
+ <_>
+ 14 4 6 6 -1.
+ <_>
+ 14 6 6 2 3.
+ <_>
+
+ <_>
+ 8 17 2 3 -1.
+ <_>
+ 8 18 2 1 3.
+ <_>
+
+ <_>
+ 16 4 4 6 -1.
+ <_>
+ 16 6 4 2 3.
+ <_>
+
+ <_>
+ 0 4 4 6 -1.
+ <_>
+ 0 6 4 2 3.
+ <_>
+
+ <_>
+ 14 6 2 3 -1.
+ <_>
+ 14 6 1 3 2.
+ <_>
+
+ <_>
+ 4 9 8 1 -1.
+ <_>
+ 8 9 4 1 2.
+ <_>
+
+ <_>
+ 8 12 4 3 -1.
+ <_>
+ 8 13 4 1 3.
+ <_>
+
+ <_>
+ 5 12 10 6 -1.
+ <_>
+ 5 14 10 2 3.
+ <_>
+
+ <_>
+ 11 12 1 2 -1.
+ <_>
+ 11 13 1 1 2.
+ <_>
+
+ <_>
+ 8 15 4 2 -1.
+ <_>
+ 8 16 4 1 2.
+ <_>
+
+ <_>
+ 6 9 8 8 -1.
+ <_>
+ 10 9 4 4 2.
+ <_>
+ 6 13 4 4 2.
+ <_>
+
+ <_>
+ 7 12 4 6 -1.
+ <_>
+ 7 12 2 3 2.
+ <_>
+ 9 15 2 3 2.
+ <_>
+
+ <_>
+ 10 11 3 1 -1.
+ <_>
+ 11 11 1 1 3.
+ <_>
+
+ <_>
+ 9 7 2 10 -1.
+ <_>
+ 9 7 1 5 2.
+ <_>
+ 10 12 1 5 2.
+ <_>
+
+ <_>
+ 8 0 6 6 -1.
+ <_>
+ 10 0 2 6 3.
+ <_>
+
+ <_>
+ 3 11 2 6 -1.
+ <_>
+ 3 13 2 2 3.
+ <_>
+
+ <_>
+ 16 12 1 2 -1.
+ <_>
+ 16 13 1 1 2.
+ <_>
+
+ <_>
+ 1 14 6 6 -1.
+ <_>
+ 1 14 3 3 2.
+ <_>
+ 4 17 3 3 2.
+ <_>
+
+ <_>
+ 13 1 3 6 -1.
+ <_>
+ 14 1 1 6 3.
+ <_>
+
+ <_>
+ 8 8 2 2 -1.
+ <_>
+ 8 9 2 1 2.
+ <_>
+
+ <_>
+ 9 9 3 3 -1.
+ <_>
+ 10 9 1 3 3.
+ <_>
+
+ <_>
+ 8 7 3 3 -1.
+ <_>
+ 8 8 3 1 3.
+ <_>
+
+ <_>
+ 14 0 2 3 -1.
+ <_>
+ 14 0 1 3 2.
+ <_>
+
+ <_>
+ 1 0 18 9 -1.
+ <_>
+ 7 0 6 9 3.
+ <_>
+
+ <_>
+ 11 5 4 15 -1.
+ <_>
+ 11 5 2 15 2.
+ <_>
+
+ <_>
+ 5 5 4 15 -1.
+ <_>
+ 7 5 2 15 2.
+ <_>
+
+ <_>
+ 14 0 2 3 -1.
+ <_>
+ 14 0 1 3 2.
+ <_>
+
+ <_>
+ 4 0 2 3 -1.
+ <_>
+ 5 0 1 3 2.
+ <_>
+
+ <_>
+ 11 12 2 2 -1.
+ <_>
+ 12 12 1 1 2.
+ <_>
+ 11 13 1 1 2.
+ <_>
+
+ <_>
+ 7 12 2 2 -1.
+ <_>
+ 7 12 1 1 2.
+ <_>
+ 8 13 1 1 2.
+ <_>
+
+ <_>
+ 12 0 3 4 -1.
+ <_>
+ 13 0 1 4 3.
+ <_>
+
+ <_>
+ 4 11 3 3 -1.
+ <_>
+ 4 12 3 1 3.
+ <_>
+
+ <_>
+ 12 7 4 2 -1.
+ <_>
+ 12 8 4 1 2.
+ <_>
+
+ <_>
+ 8 10 3 2 -1.
+ <_>
+ 9 10 1 2 3.
+ <_>
+
+ <_>
+ 9 9 3 2 -1.
+ <_>
+ 10 9 1 2 3.
+ <_>
+
+ <_>
+ 8 9 3 2 -1.
+ <_>
+ 9 9 1 2 3.
+ <_>
+
+ <_>
+ 12 0 3 4 -1.
+ <_>
+ 13 0 1 4 3.
+ <_>
+
+ <_>
+ 5 0 3 4 -1.
+ <_>
+ 6 0 1 4 3.
+ <_>
+
+ <_>
+ 4 14 12 4 -1.
+ <_>
+ 10 14 6 2 2.
+ <_>
+ 4 16 6 2 2.
+ <_>
+
+ <_>
+ 8 13 2 3 -1.
+ <_>
+ 8 14 2 1 3.
+ <_>
+
+ <_>
+ 10 10 3 8 -1.
+ <_>
+ 10 14 3 4 2.
+ <_>
+
+ <_>
+ 8 10 4 8 -1.
+ <_>
+ 8 10 2 4 2.
+ <_>
+ 10 14 2 4 2.
+ <_>
+
+ <_>
+ 10 8 3 1 -1.
+ <_>
+ 11 8 1 1 3.
+ <_>
+
+ <_>
+ 9 12 1 6 -1.
+ <_>
+ 9 15 1 3 2.
+ <_>
+
+ <_>
+ 10 8 3 1 -1.
+ <_>
+ 11 8 1 1 3.
+ <_>
+
+ <_>
+ 7 8 3 1 -1.
+ <_>
+ 8 8 1 1 3.
+ <_>
+
+ <_>
+ 5 2 15 14 -1.
+ <_>
+ 5 9 15 7 2.
+ <_>
+
+ <_>
+ 2 1 2 10 -1.
+ <_>
+ 2 1 1 5 2.
+ <_>
+ 3 6 1 5 2.
+ <_>
+
+ <_>
+ 14 14 2 3 -1.
+ <_>
+ 14 15 2 1 3.
+ <_>
+
+ <_>
+ 2 7 3 3 -1.
+ <_>
+ 3 7 1 3 3.
+ <_>
+
+ <_>
+ 17 4 3 3 -1.
+ <_>
+ 17 5 3 1 3.
+ <_>
+
+ <_>
+ 0 4 3 3 -1.
+ <_>
+ 0 5 3 1 3.
+ <_>
+
+ <_>
+ 13 5 6 2 -1.
+ <_>
+ 16 5 3 1 2.
+ <_>
+ 13 6 3 1 2.
+ <_>
+
+ <_>
+ 4 19 12 1 -1.
+ <_>
+ 8 19 4 1 3.
+ <_>
+
+ <_>
+ 12 12 2 4 -1.
+ <_>
+ 12 14 2 2 2.
+ <_>
+
+ <_>
+ 3 15 1 3 -1.
+ <_>
+ 3 16 1 1 3.
+ <_>
+
+ <_>
+ 11 16 6 4 -1.
+ <_>
+ 11 16 3 4 2.
+ <_>
+
+ <_>
+ 2 10 3 10 -1.
+ <_>
+ 3 10 1 10 3.
+ <_>
+
+ <_>
+ 12 8 2 4 -1.
+ <_>
+ 12 8 1 4 2.
+ <_>
+
+ <_>
+ 6 8 2 4 -1.
+ <_>
+ 7 8 1 4 2.
+ <_>
+
+ <_>
+ 10 14 2 3 -1.
+ <_>
+ 10 14 1 3 2.
+ <_>
+
+ <_>
+ 5 1 10 3 -1.
+ <_>
+ 10 1 5 3 2.
+ <_>
+
+ <_>
+ 10 7 3 2 -1.
+ <_>
+ 11 7 1 2 3.
+ <_>
+
+ <_>
+ 5 6 9 2 -1.
+ <_>
+ 8 6 3 2 3.
+ <_>
+
+ <_>
+ 9 8 2 2 -1.
+ <_>
+ 9 9 2 1 2.
+ <_>
+
+ <_>
+ 2 11 16 6 -1.
+ <_>
+ 2 11 8 3 2.
+ <_>
+ 10 14 8 3 2.
+ <_>
+
+ <_>
+ 12 7 2 2 -1.
+ <_>
+ 13 7 1 1 2.
+ <_>
+ 12 8 1 1 2.
+ <_>
+
+ <_>
+ 9 5 2 3 -1.
+ <_>
+ 9 6 2 1 3.
+ <_>
+
+ <_>
+ 9 7 3 2 -1.
+ <_>
+ 10 7 1 2 3.
+ <_>
+
+ <_>
+ 5 1 8 12 -1.
+ <_>
+ 5 7 8 6 2.
+ <_>
+
+ <_>
+ 13 5 2 2 -1.
+ <_>
+ 13 6 2 1 2.
+ <_>
+
+ <_>
+ 5 5 2 2 -1.
+ <_>
+ 5 6 2 1 2.
+ <_>
+
+ <_>
+ 12 4 3 3 -1.
+ <_>
+ 12 5 3 1 3.
+ <_>
+
+ <_>
+ 4 14 2 3 -1.
+ <_>
+ 4 15 2 1 3.
+ <_>
+
+ <_>
+ 12 4 3 3 -1.
+ <_>
+ 12 5 3 1 3.
+ <_>
+
+ <_>
+ 5 4 3 3 -1.
+ <_>
+ 5 5 3 1 3.
+ <_>
+
+ <_>
+ 9 14 2 6 -1.
+ <_>
+ 10 14 1 3 2.
+ <_>
+ 9 17 1 3 2.
+ <_>
+
+ <_>
+ 8 14 3 2 -1.
+ <_>
+ 9 14 1 2 3.
+ <_>
+
+ <_>
+ 9 5 6 6 -1.
+ <_>
+ 11 5 2 6 3.
+ <_>
+
+ <_>
+ 5 5 6 6 -1.
+ <_>
+ 7 5 2 6 3.
+ <_>
+
+ <_>
+ 13 13 1 2 -1.
+ <_>
+ 13 14 1 1 2.
+ <_>
+
+ <_>
+ 0 2 10 2 -1.
+ <_>
+ 0 3 10 1 2.
+ <_>
+
+ <_>
+ 13 13 1 2 -1.
+ <_>
+ 13 14 1 1 2.
+ <_>
+
+ <_>
+ 5 7 2 2 -1.
+ <_>
+ 5 7 1 1 2.
+ <_>
+ 6 8 1 1 2.
+ <_>
+
+ <_>
+ 13 5 2 7 -1.
+ <_>
+ 13 5 1 7 2.
+ <_>
+
+ <_>
+ 6 13 1 2 -1.
+ <_>
+ 6 14 1 1 2.
+ <_>
+
+ <_>
+ 11 0 3 7 -1.
+ <_>
+ 12 0 1 7 3.
+ <_>
+
+ <_>
+ 0 3 2 16 -1.
+ <_>
+ 0 3 1 8 2.
+ <_>
+ 1 11 1 8 2.
+ <_>
+
+ <_>
+ 11 0 3 7 -1.
+ <_>
+ 12 0 1 7 3.
+ <_>
+
+ <_>
+ 6 0 3 7 -1.
+ <_>
+ 7 0 1 7 3.
+ <_>
+
+ <_>
+ 11 16 8 4 -1.
+ <_>
+ 11 16 4 4 2.
+ <_>
+
+ <_>
+ 1 16 8 4 -1.
+ <_>
+ 5 16 4 4 2.
+ <_>
+
+ <_>
+ 13 5 2 7 -1.
+ <_>
+ 13 5 1 7 2.
+ <_>
+
+ <_>
+ 5 5 2 7 -1.
+ <_>
+ 6 5 1 7 2.
+ <_>
+
+ <_>
+ 18 6 2 14 -1.
+ <_>
+ 18 13 2 7 2.
+ <_>
+
+ <_>
+ 6 10 3 4 -1.
+ <_>
+ 6 12 3 2 2.
+ <_>
+
+ <_>
+ 14 7 1 2 -1.
+ <_>
+ 14 8 1 1 2.
+ <_>
+
+ <_>
+ 0 1 18 6 -1.
+ <_>
+ 0 1 9 3 2.
+ <_>
+ 9 4 9 3 2.
+ <_>
+
+ <_>
+ 14 7 1 2 -1.
+ <_>
+ 14 8 1 1 2.
+ <_>
+
+ <_>
+ 0 6 2 14 -1.
+ <_>
+ 0 13 2 7 2.
+ <_>
+
+ <_>
+ 17 0 3 12 -1.
+ <_>
+ 18 0 1 12 3.
+ <_>
+
+ <_>
+ 0 6 18 3 -1.
+ <_>
+ 0 7 18 1 3.
+ <_>
+
+ <_>
+ 6 0 14 16 -1.
+ <_>
+ 6 8 14 8 2.
+ <_>
+
+ <_>
+ 0 0 3 12 -1.
+ <_>
+ 1 0 1 12 3.
+ <_>
+
+ <_>
+ 13 0 3 7 -1.
+ <_>
+ 14 0 1 7 3.
+ <_>
+
+ <_>
+ 5 7 1 2 -1.
+ <_>
+ 5 8 1 1 2.
+ <_>
+
+ <_>
+ 14 4 6 6 -1.
+ <_>
+ 14 6 6 2 3.
+ <_>
+
+ <_>
+ 5 7 7 2 -1.
+ <_>
+ 5 8 7 1 2.
+ <_>
+
+ <_>
+ 8 6 6 9 -1.
+ <_>
+ 8 9 6 3 3.
+ <_>
+
+ <_>
+ 5 4 6 1 -1.
+ <_>
+ 7 4 2 1 3.
+ <_>
+
+ <_>
+ 13 0 6 4 -1.
+ <_>
+ 16 0 3 2 2.
+ <_>
+ 13 2 3 2 2.
+ <_>
+
+ <_>
+ 1 2 18 12 -1.
+ <_>
+ 1 6 18 4 3.
+ <_>
+
+ <_>
+ 3 2 17 12 -1.
+ <_>
+ 3 6 17 4 3.
+ <_>
+
+ <_>
+ 5 14 7 3 -1.
+ <_>
+ 5 15 7 1 3.
+ <_>
+
+ <_>
+ 10 14 1 3 -1.
+ <_>
+ 10 15 1 1 3.
+ <_>
+
+ <_>
+ 3 14 3 3 -1.
+ <_>
+ 3 15 3 1 3.
+ <_>
+
+ <_>
+ 14 4 6 6 -1.
+ <_>
+ 14 6 6 2 3.
+ <_>
+
+ <_>
+ 0 4 6 6 -1.
+ <_>
+ 0 6 6 2 3.
+ <_>
+
+ <_>
+ 12 5 4 3 -1.
+ <_>
+ 12 6 4 1 3.
+ <_>
+
+ <_>
+ 4 5 4 3 -1.
+ <_>
+ 4 6 4 1 3.
+ <_>
+
+ <_>
+ 18 0 2 6 -1.
+ <_>
+ 18 2 2 2 3.
+ <_>
+
+ <_>
+ 8 1 4 9 -1.
+ <_>
+ 10 1 2 9 2.
+ <_>
+
+ <_>
+ 6 6 8 2 -1.
+ <_>
+ 6 6 4 2 2.
+ <_>
+
+ <_>
+ 6 5 4 2 -1.
+ <_>
+ 6 5 2 1 2.
+ <_>
+ 8 6 2 1 2.
+ <_>
+
+ <_>
+ 10 5 2 3 -1.
+ <_>
+ 10 6 2 1 3.
+ <_>
+
+ <_>
+ 9 5 1 3 -1.
+ <_>
+ 9 6 1 1 3.
+ <_>
+
+ <_>
+ 9 10 2 2 -1.
+ <_>
+ 9 11 2 1 2.
+ <_>
+
+ <_>
+ 0 8 4 3 -1.
+ <_>
+ 0 9 4 1 3.
+ <_>
+
+ <_>
+ 6 0 8 6 -1.
+ <_>
+ 6 3 8 3 2.
+ <_>
+
+ <_>
+ 1 0 6 4 -1.
+ <_>
+ 1 0 3 2 2.
+ <_>
+ 4 2 3 2 2.
+ <_>
+
+ <_>
+ 13 0 3 7 -1.
+ <_>
+ 14 0 1 7 3.
+ <_>
+
+ <_>
+ 9 16 2 2 -1.
+ <_>
+ 9 17 2 1 2.
+ <_>
+
+ <_>
+ 11 4 6 10 -1.
+ <_>
+ 11 9 6 5 2.
+ <_>
+
+ <_>
+ 0 10 19 2 -1.
+ <_>
+ 0 11 19 1 2.
+ <_>
+
+ <_>
+ 9 5 8 9 -1.
+ <_>
+ 9 8 8 3 3.
+ <_>
+
+ <_>
+ 4 0 3 7 -1.
+ <_>
+ 5 0 1 7 3.
+ <_>
+
+ <_>
+ 8 6 4 12 -1.
+ <_>
+ 10 6 2 6 2.
+ <_>
+ 8 12 2 6 2.
+ <_>
+
+ <_>
+ 0 2 6 4 -1.
+ <_>
+ 0 4 6 2 2.
+ <_>
+
+ <_>
+ 8 15 4 3 -1.
+ <_>
+ 8 16 4 1 3.
+ <_>
+
+ <_>
+ 8 0 3 7 -1.
+ <_>
+ 9 0 1 7 3.
+ <_>
+
+ <_>
+ 9 5 3 4 -1.
+ <_>
+ 10 5 1 4 3.
+ <_>
+
+ <_>
+ 8 5 3 4 -1.
+ <_>
+ 9 5 1 4 3.
+ <_>
+
+ <_>
+ 7 6 6 1 -1.
+ <_>
+ 9 6 2 1 3.
+ <_>
+
+ <_>
+ 7 14 4 4 -1.
+ <_>
+ 7 14 2 2 2.
+ <_>
+ 9 16 2 2 2.
+ <_>
+
+ <_>
+ 13 14 4 6 -1.
+ <_>
+ 15 14 2 3 2.
+ <_>
+ 13 17 2 3 2.
+ <_>
+
+ <_>
+ 7 8 1 8 -1.
+ <_>
+ 7 12 1 4 2.
+ <_>
+
+ <_>
+ 16 0 2 8 -1.
+ <_>
+ 17 0 1 4 2.
+ <_>
+ 16 4 1 4 2.
+ <_>
+
+ <_>
+ 2 0 2 8 -1.
+ <_>
+ 2 0 1 4 2.
+ <_>
+ 3 4 1 4 2.
+ <_>
+
+ <_>
+ 6 1 14 3 -1.
+ <_>
+ 6 2 14 1 3.
+ <_>
+
+ <_>
+ 7 9 3 10 -1.
+ <_>
+ 7 14 3 5 2.
+ <_>
+
+ <_>
+ 9 14 2 2 -1.
+ <_>
+ 9 15 2 1 2.
+ <_>
+
+ <_>
+ 7 7 6 8 -1.
+ <_>
+ 7 11 6 4 2.
+ <_>
+
+ <_>
+ 9 7 3 6 -1.
+ <_>
+ 9 10 3 3 2.
+ <_>
+
+ <_>
+ 7 13 3 3 -1.
+ <_>
+ 7 14 3 1 3.
+ <_>
+
+ <_>
+ 9 9 2 2 -1.
+ <_>
+ 9 10 2 1 2.
+ <_>
+
+ <_>
+ 0 1 18 2 -1.
+ <_>
+ 6 1 6 2 3.
+ <_>
+
+ <_>
+ 7 1 6 14 -1.
+ <_>
+ 7 8 6 7 2.
+ <_>
+
+ <_>
+ 1 9 18 1 -1.
+ <_>
+ 7 9 6 1 3.
+ <_>
+
+ <_>
+ 9 7 2 2 -1.
+ <_>
+ 9 7 1 2 2.
+ <_>
+
+ <_>
+ 9 3 2 9 -1.
+ <_>
+ 10 3 1 9 2.
+ <_>
+
+ <_>
+ 18 14 2 3 -1.
+ <_>
+ 18 15 2 1 3.
+ <_>
+
+ <_>
+ 7 11 3 1 -1.
+ <_>
+ 8 11 1 1 3.
+ <_>
+
+ <_>
+ 10 8 3 4 -1.
+ <_>
+ 11 8 1 4 3.
+ <_>
+
+ <_>
+ 7 14 3 6 -1.
+ <_>
+ 8 14 1 6 3.
+ <_>
+
+ <_>
+ 10 8 3 4 -1.
+ <_>
+ 11 8 1 4 3.
+ <_>
+
+ <_>
+ 7 8 3 4 -1.
+ <_>
+ 8 8 1 4 3.
+ <_>
+
+ <_>
+ 7 9 6 9 -1.
+ <_>
+ 7 12 6 3 3.
+ <_>
+
+ <_>
+ 0 14 2 3 -1.
+ <_>
+ 0 15 2 1 3.
+ <_>
+
+ <_>
+ 11 12 1 2 -1.
+ <_>
+ 11 13 1 1 2.
+ <_>
+
+ <_>
+ 4 3 8 3 -1.
+ <_>
+ 8 3 4 3 2.
+ <_>
+
+ <_>
+ 0 4 20 6 -1.
+ <_>
+ 0 4 10 6 2.
+ <_>
+
+ <_>
+ 9 14 1 3 -1.
+ <_>
+ 9 15 1 1 3.
+ <_>
+
+ <_>
+ 8 14 4 3 -1.
+ <_>
+ 8 15 4 1 3.
+ <_>
+
+ <_>
+ 0 15 14 4 -1.
+ <_>
+ 0 17 14 2 2.
+ <_>
+
+ <_>
+ 1 14 18 6 -1.
+ <_>
+ 1 17 18 3 2.
+ <_>
+
+ <_>
+ 0 0 10 6 -1.
+ <_>
+ 0 0 5 3 2.
+ <_>
+ 5 3 5 3 2.
+
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_lefteye_2splits.xml b/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_lefteye_2splits.xml
new file mode 100644
index 00000000..9a9ef58f
--- /dev/null
+++ b/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_lefteye_2splits.xml
@@ -0,0 +1,7390 @@
+
+
+
+BOOST
+ HAAR
+ 20
+ 20
+
+ 33
+
+ 0
+ 20
+
+ <_>
+ 5
+ -2.3924100399017334e+00
+
+ <_>
+
+ 0 1 0 2.7325989678502083e-02 -1 -2 1 -7.0568458177149296e-03
+
+ -9.0600621700286865e-01 9.3385708332061768e-01
+ -4.5859959721565247e-01
+ <_>
+
+ 0 1 2 -1.2538699805736542e-01 -1 -2 3
+ -1.1487299948930740e-01
+
+ 7.2463721036911011e-01 5.3034168481826782e-01
+ -8.3221220970153809e-01
+ <_>
+
+ 0 1 4 -5.8309938758611679e-02 -1 -2 5
+ -1.7684370279312134e-02
+
+ 6.5408891439437866e-01 2.9482871294021606e-01
+ -7.4809581041336060e-01
+ <_>
+
+ 0 1 6 3.5937170032411814e-03 -1 -2 7 -1.3436110457405448e-03
+
+ -5.0303918123245239e-01 6.5995341539382935e-01
+ -5.5740857124328613e-01
+ <_>
+
+ 1 0 8 -2.1795940119773149e-03 -1 -2 9 1.1514870449900627e-02
+
+ -4.2016351222991943e-01 5.9694331884384155e-01
+ -8.0508047342300415e-01
+ <_>
+ 7
+ -2.6498730182647705e+00
+
+ <_>
+
+ 1 0 10 -2.2485560178756714e-01 -1 -2 11
+ -9.6008004620671272e-03
+
+ -8.1363201141357422e-01 9.0863138437271118e-01
+ -3.2208970189094543e-01
+ <_>
+
+ 0 1 12 7.4219167232513428e-02 -1 -2 13
+ -5.3165741264820099e-03
+
+ -7.5329452753067017e-01 8.6339497566223145e-01
+ -3.3463571220636368e-02
+ <_>
+
+ 1 0 14 -2.1913449745625257e-03 -1 -2 15
+ 1.1800959706306458e-02
+
+ -5.5720347166061401e-01 -3.2359680533409119e-01
+ 6.4163821935653687e-01
+ <_>
+
+ 1 0 16 -7.6179709285497665e-03 -1 -2 17
+ -9.0587511658668518e-03
+
+ -5.3167867660522461e-01 -7.3611450195312500e-01
+ 5.5660772323608398e-01
+ <_>
+
+ 1 0 18 -4.9959779717028141e-03 -1 -2 19
+ 8.0803930759429932e-03
+
+ -4.1476911306381226e-01 5.9278357028961182e-01
+ -6.7384922504425049e-01
+ <_>
+
+ 0 1 20 1.9909010734409094e-03 -1 -2 21
+ 1.6845749923959374e-03
+
+ -4.2145928740501404e-01 5.4679220914840698e-01
+ -7.5099450349807739e-01
+ <_>
+
+ 1 0 22 -5.0781872123479843e-03 -1 -2 23
+ 2.6645609177649021e-03
+
+ -3.9899548888206482e-01 5.8940601348876953e-01
+ -4.6778041124343872e-01
+ <_>
+ 8
+ -2.3828399181365967e+00
+
+ <_>
+
+ 1 0 24 -2.5301438570022583e-01 -1 -2 25
+ 2.9663778841495514e-03
+
+ -7.5402587652206421e-01 -3.5279649496078491e-01
+ 8.7992298603057861e-01
+ <_>
+
+ 1 0 26 -4.7127649188041687e-02 -1 -2 27
+ 1.9500750349834561e-03
+
+ -5.2234899997711182e-01 -3.0379909276962280e-01
+ 7.5204378366470337e-01
+ <_>
+
+ 0 1 28 -7.1481026709079742e-02 -1 -2 29
+ 2.2189730405807495e-01
+
+ 6.5841901302337646e-01 -6.0907202959060669e-01
+ 5.6842160224914551e-01
+ <_>
+
+ 0 1 30 3.3842820674180984e-02 -1 -2 31
+ -5.1714561413973570e-04
+
+ -6.4311647415161133e-01 5.4620361328125000e-01
+ -3.9984148740768433e-01
+ <_>
+
+ 1 0 32 -3.4458211157470942e-03 -1 -2 33
+ 2.4395729415118694e-03
+
+ -4.5636838674545288e-01 4.7798189520835876e-01
+ -9.1247087717056274e-01
+ <_>
+
+ 1 0 34 2.1385070867836475e-03 -1 -2 35
+ 1.8324409611523151e-03
+
+ -8.3617758750915527e-01 3.3462798595428467e-01
+ -7.5008547306060791e-01
+ <_>
+
+ 1 0 36 1.1167610064148903e-03 -1 -2 37
+ 9.9106997367925942e-05
+
+ -6.9083797931671143e-01 -3.4561330080032349e-01
+ 4.1183179616928101e-01
+ <_>
+
+ 1 0 38 1.5447770245373249e-02 -1 -2 39
+ -3.2244939357042313e-02
+
+ 3.6980190873146057e-01 6.1112838983535767e-01
+ -5.5685341358184814e-01
+ <_>
+ 9
+ -2.1312201023101807e+00
+
+ <_>
+
+ 1 0 40 -1.2251129746437073e-01 -1 -2 41
+ -1.4230609871447086e-02
+
+ -6.7026627063751221e-01 8.7802392244338989e-01
+ -1.8784180283546448e-01
+ <_>
+
+ 1 0 42 -5.9833219274878502e-03 -1 -2 43
+ 7.7085137367248535e-02
+
+ -5.8122849464416504e-01 -5.0395351648330688e-01
+ 6.7387360334396362e-01
+ <_>
+
+ 0 1 44 -1.1086189746856689e-01 -1 -2 45
+ 9.4604760408401489e-02
+
+ 6.3432037830352783e-01 -4.9726390838623047e-01
+ 3.8787439465522766e-01
+ <_>
+
+ 0 1 46 1.7696130089461803e-04 -1 -2 47
+ 2.0120320841670036e-03
+
+ -6.3938802480697632e-01 -3.5313910245895386e-01
+ 5.1538437604904175e-01
+ <_>
+
+ 1 0 48 -1.6102839726954699e-03 -1 -2 49
+ 1.6666069859638810e-03
+
+ -5.1915901899337769e-01 4.0478190779685974e-01
+ -6.9496357440948486e-01
+ <_>
+
+ 1 0 50 -7.1480998303741217e-04 -1 -2 51
+ -4.7647571191191673e-03
+
+ -4.8945188522338867e-01 -5.0037759542465210e-01
+ 4.0796059370040894e-01
+ <_>
+
+ 0 1 52 7.8659597784280777e-03 -1 -2 53
+ -1.2938310392200947e-03
+
+ -3.3636429905891418e-01 -6.7621380090713501e-01
+ 4.7010248899459839e-01
+ <_>
+
+ 1 0 54 -3.6533139063976705e-04 -1 -2 55
+ 2.0565679296851158e-03
+
+ -4.7071608901023865e-01 4.1323411464691162e-01
+ -5.5526417493820190e-01
+ <_>
+
+ 0 1 56 7.8385717642959207e-05 -1 -2 57
+ 1.7511800397187471e-03
+
+ -5.1521158218383789e-01 3.3417248725891113e-01
+ -7.9558157920837402e-01
+ <_>
+ 9
+ -2.0176210403442383e+00
+
+ <_>
+
+ 1 0 58 -6.4695239067077637e-02 -1 -2 59
+ 9.5212170854210854e-03
+
+ -6.1326402425765991e-01 -5.4831558465957642e-01
+ 7.8652447462081909e-01
+ <_>
+
+ 0 1 60 -9.8109766840934753e-02 -1 -2 61
+ -8.5938459634780884e-01
+
+ 6.9113308191299438e-01 4.5364680886268616e-01
+ -5.0026148557662964e-01
+ <_>
+
+ 1 0 62 -8.9836172759532928e-02 -1 -2 63
+ 2.6945930439978838e-03
+
+ -5.2928781509399414e-01 -3.8199779391288757e-01
+ 5.7821297645568848e-01
+ <_>
+
+ 1 0 64 2.5973599404096603e-03 -1 -2 65
+ -3.0058110132813454e-03
+
+ -9.1928368806838989e-01 -8.0213797092437744e-01
+ 2.9259279370307922e-01
+ <_>
+
+ 1 0 66 -4.5496290549635887e-03 -1 -2 67
+ 4.7376728616654873e-03
+
+ -4.3678951263427734e-01 4.1010880470275879e-01
+ -7.2692811489105225e-01
+ <_>
+
+ 1 0 68 4.6190437860786915e-03 -1 -2 69
+ 4.5377281494438648e-03
+
+ -8.4895151853561401e-01 3.0124679207801819e-01
+ -7.0301771163940430e-01
+ <_>
+
+ 1 0 70 -2.4952790699899197e-03 -1 -2 71
+ -5.1753767766058445e-03
+
+ -4.6784749627113342e-01 -7.4530351161956787e-01
+ 4.0011820197105408e-01
+ <_>
+
+ 0 1 72 -5.2049742080271244e-03 -1 -2 73
+ -8.7892003357410431e-02
+
+ 4.8669269680976868e-01 8.3493947982788086e-01
+ -3.3827719092369080e-01
+ <_>
+
+ 0 1 74 6.9997250102460384e-03 -1 -2 75
+ -9.0990252792835236e-03
+
+ -2.9039889574050903e-01 6.2315821647644043e-01
+ -3.5424730181694031e-01
+ <_>
+ 11
+ -2.2212049961090088e+00
+
+ <_>
+
+ 1 0 76 -5.5702101439237595e-02 -1 -2 77
+ 3.4033291041851044e-02
+
+ -6.9841581583023071e-01 -3.9509189128875732e-01
+ 8.0313128232955933e-01
+ <_>
+
+ 1 0 78 -4.6199060976505280e-02 -1 -2 79
+ -4.8061669804155827e-03
+
+ -4.8860380053520203e-01 8.0775612592697144e-01
+ -7.4490822851657867e-02
+ <_>
+
+ 0 1 80 1.8170489929616451e-03 -1 -2 81
+ -3.6162370815873146e-03
+
+ -3.8043528795242310e-01 6.0451722145080566e-01
+ -2.2582240402698517e-01
+ <_>
+
+ 1 0 82 -1.5706950798630714e-02 -1 -2 83
+ 4.3929950334131718e-03
+
+ -3.7577998638153076e-01 5.4214221239089966e-01
+ -3.7388241291046143e-01
+ <_>
+
+ 1 0 84 -1.0047219984699041e-04 -1 -2 85
+ -8.6475118994712830e-02
+
+ -4.7433409094810486e-01 5.0186318159103394e-01
+ -2.1136230230331421e-01
+ <_>
+
+ 0 1 86 -7.7960766851902008e-02 -1 -2 87
+ 9.8561286926269531e-02
+
+ 5.7337349653244019e-01 -3.2515558600425720e-01
+ 5.3035980463027954e-01
+ <_>
+
+ 0 1 88 -5.4359167814254761e-01 -1 -2 89
+ -4.4177699834108353e-02
+
+ 5.9464299678802490e-01 2.9671078920364380e-01
+ -3.8474830985069275e-01
+ <_>
+
+ 1 0 90 -8.8016409426927567e-04 -1 -2 91
+ 2.6359390467405319e-03
+
+ -3.2000589370727539e-01 -1.7586140334606171e-01
+ 4.8360350728034973e-01
+ <_>
+
+ 0 1 92 -1.4203689992427826e-02 -1 -2 93
+ -7.3902818257920444e-05
+
+ -7.7882087230682373e-01 3.0619418621063232e-01
+ -3.3196049928665161e-01
+ <_>
+
+ 1 0 94 4.6157240867614746e-03 -1 -2 95
+ 1.1152310296893120e-02
+
+ 4.9689778685569763e-01 -5.3435891866683960e-01
+ 9.7229443490505219e-02
+ <_>
+
+ 0 1 96 -6.0547702014446259e-03 -1 -2 97
+ -2.1118740551173687e-03
+
+ -8.3811217546463013e-01 6.3617032766342163e-01
+ -4.8299189656972885e-02
+ <_>
+ 13
+ -2.1328830718994141e+00
+
+ <_>
+
+ 1 0 98 -1.2956829741597176e-02 -1 -2 99
+ -2.7141019701957703e-02
+
+ -6.4874732494354248e-01 7.6293057203292847e-01
+ -3.3947870135307312e-01
+ <_>
+
+ 0 1 100 4.5119998976588249e-03 -1 -2 101
+ 1.2516690418124199e-02
+
+ -5.0059837102890015e-01 -3.6873328685760498e-01
+ 5.9888631105422974e-01
+ <_>
+
+ 1 0 102 -6.0557941906154156e-03 -1 -2 103
+ -4.6923749148845673e-02
+
+ -3.8940930366516113e-01 6.3268911838531494e-01
+ -2.6270028948783875e-01
+ <_>
+
+ 1 0 104 -2.4018269032239914e-03 -1 -2 105
+ -1.5936089679598808e-02
+
+ -5.0517928600311279e-01 6.5526002645492554e-01
+ -1.7308109998703003e-01
+ <_>
+
+ 0 1 106 1.4000290073454380e-02 -1 -2 107
+ 1.3202779926359653e-02
+
+ -4.1653230786323547e-01 -4.9121969938278198e-01
+ 3.7397938966751099e-01
+ <_>
+
+ 1 0 108 -2.7658580802381039e-04 -1 -2 109
+ -4.8634149134159088e-03
+
+ -4.5382869243621826e-01 -5.9796881675720215e-01
+ 3.1217721104621887e-01
+ <_>
+
+ 1 0 110 2.7654920704662800e-03 -1 -2 111
+ 2.5534769892692566e-01
+
+ -7.6476567983627319e-01 -3.4267220646142960e-02
+ 7.0786577463150024e-01
+ <_>
+
+ 1 0 112 4.6812961809337139e-03 -1 -2 113
+ 6.5162130631506443e-03
+
+ -7.8790861368179321e-01 1.8877579271793365e-01
+ -7.9132258892059326e-01
+ <_>
+
+ 1 0 114 5.7325329631567001e-02 -1 -2 115
+ -1.2718330137431622e-02
+
+ 6.2349188327789307e-01 3.0860608816146851e-01
+ -3.2784330844879150e-01
+ <_>
+
+ 1 0 116 -6.7374261561781168e-04 -1 -2 117
+ 5.6564649567008018e-03
+
+ -4.5451548695564270e-01 2.7431339025497437e-01
+ -7.8447937965393066e-01
+ <_>
+
+ 1 0 118 3.1134090386331081e-03 -1 -2 119
+ 2.4249779526144266e-03
+
+ 3.9738771319389343e-01 -3.5198271274566650e-01
+ 3.0490091443061829e-01
+ <_>
+
+ 0 1 120 -5.5641461163759232e-02 -1 -2 121
+ 4.3548129498958588e-02
+
+ 4.5575490593910217e-01 -3.3370929956436157e-01
+ 2.9501429200172424e-01
+ <_>
+
+ 1 0 122 8.0783379962667823e-04 -1 -2 123
+ 1.8713270546868443e-03
+
+ 2.2460040450096130e-01 -6.6048407554626465e-01
+ 1.5031670033931732e-01
+ <_>
+ 13
+ -1.9884539842605591e+00
+
+ <_>
+
+ 1 0 124 -4.3516629934310913e-01 -1 -2 125
+ 6.2595037743449211e-03
+
+ -4.9959290027618408e-01 -2.3639589548110962e-01
+ 7.9975378513336182e-01
+ <_>
+
+ 1 0 126 -6.6518150269985199e-03 -1 -2 127
+ -5.7092090137302876e-03
+
+ -5.4752808809280396e-01 6.4273327589035034e-01
+ -2.1511809527873993e-01
+ <_>
+
+ 0 1 128 1.9450180232524872e-02 -1 -2 129
+ -5.4476498626172543e-03
+
+ -5.3605002164840698e-01 5.5794501304626465e-01
+ -2.1474960446357727e-01
+ <_>
+
+ 1 0 130 -1.6347589553333819e-04 -1 -2 131
+ 7.1614650078117847e-03
+
+ -5.5962842702865601e-01 -1.6604369878768921e-01
+ 4.6805259585380554e-01
+ <_>
+
+ 1 0 132 -1.3145170174539089e-02 -1 -2 133
+ -1.1436809785664082e-02
+
+ -4.1279909014701843e-01 3.7901800870895386e-01
+ -4.1791579127311707e-01
+ <_>
+
+ 0 1 134 -7.2912001051008701e-03 -1 -2 135
+ -5.2170921117067337e-04
+
+ -7.6089668273925781e-01 3.2527619600296021e-01
+ -3.0110970139503479e-01
+ <_>
+
+ 1 0 136 3.3754010219126940e-03 -1 -2 137
+ 2.5100160855799913e-03
+
+ -7.8373962640762329e-01 1.8525449931621552e-01
+ -5.8084958791732788e-01
+ <_>
+
+ 0 1 138 -1.2884209863841534e-03 -1 -2 139
+ -1.8726480193436146e-03
+
+ 2.7339500188827515e-01 1.6819879412651062e-01
+ -5.1986902952194214e-01
+ <_>
+
+ 1 0 140 2.4010189808905125e-03 -1 -2 141
+ 4.8938081599771976e-03
+
+ -8.2964670658111572e-01 1.6796599328517914e-01
+ -6.5530872344970703e-01
+ <_>
+
+ 0 1 142 3.1223020050674677e-03 -1 -2 143
+ 5.0366491079330444e-02
+
+ -4.3521308898925781e-01 -5.8327801525592804e-03
+ 7.0878309011459351e-01
+ <_>
+
+ 1 0 144 3.6151800304651260e-02 -1 -2 145
+ -1.3426589965820312e-01
+
+ 4.4979161024093628e-01 3.9472430944442749e-01
+ -3.7588629126548767e-01
+ <_>
+
+ 1 0 146 -2.7791369706392288e-02 -1 -2 147
+ -1.2712170369923115e-02
+
+ -2.9488721489906311e-01 -7.2011739015579224e-01
+ 3.6595028638839722e-01
+ <_>
+
+ 1 0 148 -3.8276749546639621e-04 -1 -2 149
+ -6.1330529861152172e-03
+
+ -4.0581339597702026e-01 -5.2725958824157715e-01
+ 3.6040499806404114e-01
+ <_>
+ 16
+ -2.0902318954467773e+00
+
+ <_>
+
+ 1 0 150 -4.7748669981956482e-02 -1 -2 151
+ 4.6201851218938828e-03
+
+ -5.9902387857437134e-01 -2.4887490272521973e-01
+ 6.9201582670211792e-01
+ <_>
+
+ 1 0 152 -8.5353456437587738e-02 -1 -2 153
+ -7.0110969245433807e-03
+
+ -5.1715832948684692e-01 5.6950652599334717e-01
+ -2.4749420583248138e-01
+ <_>
+
+ 1 0 154 -7.6567470096051693e-03 -1 -2 155
+ -3.5919491201639175e-02
+
+ -3.7316519021987915e-01 4.9438580870628357e-01
+ -3.9586681127548218e-01
+ <_>
+
+ 0 1 156 -7.4326626956462860e-02 -1 -2 157
+ 9.0118587017059326e-02
+
+ 5.6755977869033813e-01 -3.8921171426773071e-01
+ 3.1079098582267761e-01
+ <_>
+
+ 0 1 158 1.6736460849642754e-02 -1 -2 159
+ 1.8592580454424024e-03
+
+ -3.6674138903617859e-01 3.4875720739364624e-01
+ -5.7483112812042236e-01
+ <_>
+
+ 1 0 160 7.5264140032231808e-03 -1 -2 161
+ -3.5309391096234322e-03
+
+ 6.7878991365432739e-01 4.8617920279502869e-01
+ -2.5660640001296997e-01
+ <_>
+
+ 1 0 162 -4.9510748795000836e-05 -1 -2 163
+ -6.8923248909413815e-03
+
+ -4.5661240816116333e-01 -5.7134729623794556e-01
+ 3.2921048998832703e-01
+ <_>
+
+ 1 0 164 6.1156069859862328e-03 -1 -2 165
+ -5.5014882236719131e-03
+
+ -7.1315360069274902e-01 -5.9139078855514526e-01
+ 1.9805949926376343e-01
+ <_>
+
+ 1 0 166 -4.2378060519695282e-02 -1 -2 167
+ 2.2011259570717812e-03
+
+ -3.8239300251007080e-01 3.3457010984420776e-01
+ -4.3032339215278625e-01
+ <_>
+
+ 1 0 168 2.1217379253357649e-03 -1 -2 169
+ 6.4385468140244484e-03
+
+ -6.8310022354125977e-01 2.0478610694408417e-01
+ -6.1793941259384155e-01
+ <_>
+
+ 1 0 170 3.1177410855889320e-03 -1 -2 171
+ 4.2230269173160195e-04
+
+ 5.1137161254882812e-01 -3.6440208554267883e-01
+ 2.1073049306869507e-01
+ <_>
+
+ 0 1 172 -6.5657291561365128e-03 -1 -2 173
+ 2.5686610024422407e-03
+
+ -6.4581501483917236e-01 2.7643561363220215e-01
+ -3.4198498725891113e-01
+ <_>
+
+ 1 0 174 -6.2437567976303399e-05 -1 -2 175
+ -3.6269261036068201e-03
+
+ -3.1758078932762146e-01 -8.1051957607269287e-01
+ 2.7218630909919739e-01
+ <_>
+
+ 1 0 176 -3.4638389479368925e-03 -1 -2 177
+ -7.4930191040039062e-02
+
+ -3.9515769481658936e-01 -5.4353868961334229e-01
+ 2.6106119155883789e-01
+ <_>
+
+ 0 1 178 -9.7247250378131866e-03 -1 -2 179
+ 4.5450199395418167e-03
+
+ 4.1124871373176575e-01 -3.1576550006866455e-01
+ 3.9046970009803772e-01
+ <_>
+
+ 0 1 180 -2.7354240883141756e-03 -1 -2 181
+ -1.6969470307230949e-02
+
+ -7.4906748533248901e-01 -6.2437218427658081e-01
+ 1.8387380242347717e-01
+ <_>
+ 15
+ -1.9407310485839844e+00
+
+ <_>
+
+ 1 0 182 -2.4978699162602425e-02 -1 -2 183
+ -5.8007869869470596e-02
+
+ -6.0697889328002930e-01 7.1478021144866943e-01
+ -2.9943239688873291e-01
+ <_>
+
+ 1 0 184 -5.1753749139606953e-03 -1 -2 185
+ -8.9618662605062127e-04
+
+ -3.5297989845275879e-01 5.4417461156845093e-01
+ -3.9789950847625732e-01
+ <_>
+
+ 1 0 186 -2.8718139219563454e-05 -1 -2 187
+ 4.7620530240237713e-03
+
+ -4.8898181319236755e-01 -3.1144559383392334e-01
+ 4.6786791086196899e-01
+ <_>
+
+ 0 1 188 1.9751280546188354e-02 -1 -2 189
+ -1.2683609966188669e-03
+
+ -4.3020489811897278e-01 -5.4090851545333862e-01
+ 3.9797520637512207e-01
+ <_>
+
+ 1 0 190 -4.5749718992738053e-05 -1 -2 191
+ 2.4090509396046400e-03
+
+ -4.4518938660621643e-01 2.8822308778762817e-01
+ -5.4514312744140625e-01
+ <_>
+
+ 0 1 192 -4.5728669501841068e-03 -1 -2 193
+ 8.9018214493989944e-03
+
+ 5.5039870738983154e-01 -4.1598889231681824e-01
+ 1.7468899488449097e-01
+ <_>
+
+ 0 1 194 -1.2056449800729752e-01 -1 -2 195
+ 4.6919930726289749e-02
+
+ 6.8890577554702759e-01 -4.2266309261322021e-01
+ 1.7010940611362457e-01
+ <_>
+
+ 0 1 196 -4.2390259914100170e-03 -1 -2 197
+ 3.2174249645322561e-03
+
+ -6.3045340776443481e-01 -3.6097949743270874e-01
+ 2.4933730065822601e-01
+ <_>
+
+ 0 1 198 -8.5738790221512318e-04 -1 -2 199
+ -1.8432449549436569e-02
+
+ 3.0993479490280151e-01 9.7758449614048004e-02
+ -5.0742352008819580e-01
+ <_>
+
+ 1 0 200 5.8692828752100468e-03 -1 -2 201
+ -6.8751699291169643e-03
+
+ -7.4556058645248413e-01 -6.7458391189575195e-01
+ 1.5918810665607452e-01
+ <_>
+
+ 1 0 202 -6.8542227381840348e-05 -1 -2 203
+ -1.0658579878509045e-02
+
+ -4.1279420256614685e-01 3.7002709507942200e-01
+ -2.1731729805469513e-01
+ <_>
+
+ 0 1 204 -1.8811509944498539e-03 -1 -2 205
+ -2.2309130057692528e-02
+
+ 5.7902830839157104e-01 1.9725680351257324e-01
+ -3.2475191354751587e-01
+ <_>
+
+ 1 0 206 6.5826578065752983e-04 -1 -2 207
+ -5.0781588070094585e-03
+
+ -6.0630238056182861e-01 -7.7123302221298218e-01
+ 1.8186129629611969e-01
+ <_>
+
+ 1 0 208 5.6215081363916397e-02 -1 -2 209
+ -3.7720590829849243e-02
+
+ 5.0561398267745972e-01 3.6052110791206360e-01
+ -3.2743760943412781e-01
+ <_>
+
+ 1 0 210 3.9480631239712238e-03 -1 -2 211
+ -2.4269670248031616e-03
+
+ -7.5788182020187378e-01 5.2076101303100586e-01
+ -6.1021361500024796e-02
+ <_>
+ 19
+ -2.1061589717864990e+00
+
+ <_>
+
+ 1 0 212 -1.6906699165701866e-02 -1 -2 213
+ 2.5327840819954872e-02
+
+ -4.7501268982887268e-01 -4.4016760587692261e-01
+ 6.0885351896286011e-01
+ <_>
+
+ 0 1 214 -1.5663320198655128e-02 -1 -2 215
+ -1.6101899743080139e-01
+
+ 5.7100051641464233e-01 4.0989148616790771e-01
+ -3.8142371177673340e-01
+ <_>
+
+ 0 1 216 1.6885380318854004e-04 -1 -2 217
+ -3.0552360694855452e-03
+
+ -4.7958490252494812e-01 4.2852300405502319e-01
+ -2.8252631425857544e-01
+ <_>
+
+ 1 0 218 4.8042940907180309e-03 -1 -2 219
+ -5.0092511810362339e-03
+
+ -6.8659138679504395e-01 -5.9033542871475220e-01
+ 1.9732500612735748e-01
+ <_>
+
+ 1 0 220 -3.7119518965482712e-02 -1 -2 221
+ 3.7857799325138330e-03
+
+ -4.3130961060523987e-01 3.3596190810203552e-01
+ -3.7401720881462097e-01
+ <_>
+
+ 0 1 222 -1.0869850404560566e-02 -1 -2 223
+ 4.0577541221864522e-04
+
+ 5.4841208457946777e-01 -5.0022697448730469e-01
+ 5.1423858851194382e-02
+ <_>
+
+ 1 0 224 5.0201490521430969e-03 -1 -2 225
+ 2.5601210072636604e-03
+
+ -5.9016227722167969e-01 1.9469800591468811e-01
+ -6.4648360013961792e-01
+ <_>
+
+ 1 0 226 -1.2395749799907207e-03 -1 -2 227
+ -5.1075750961899757e-03
+
+ -2.7762159705162048e-01 -6.1149162054061890e-01
+ 3.5250389575958252e-01
+ <_>
+
+ 1 0 228 -6.4853738876990974e-05 -1 -2 229
+ 2.3282810579985380e-03
+
+ -3.4008860588073730e-01 2.7134749293327332e-01
+ -6.6915398836135864e-01
+ <_>
+
+ 1 0 230 -1.5571110416203737e-03 -1 -2 231
+ 2.3992219939827919e-03
+
+ -4.1144248843193054e-01 2.5939700007438660e-01
+ -4.0380299091339111e-01
+ <_>
+
+ 1 0 232 7.7784422319382429e-04 -1 -2 233
+ 3.2334199640899897e-03
+
+ 2.9523921012878418e-01 -5.8436852693557739e-01
+ -1.7936639487743378e-02
+ <_>
+
+ 1 0 234 -5.6113858590833843e-05 -1 -2 235
+ 1.9111000001430511e-03
+
+ -3.5021650791168213e-01 2.6312610507011414e-01
+ -6.1549347639083862e-01
+ <_>
+
+ 0 1 236 -3.4321150742471218e-03 -1 -2 237
+ -1.4541969634592533e-02
+
+ 3.7493300437927246e-01 4.3788930773735046e-01
+ -3.0131611227989197e-01
+ <_>
+
+ 0 1 238 -2.5027070194482803e-02 -1 -2 239
+ -3.1183639075607061e-03
+
+ -5.2829748392105103e-01 -8.1336849927902222e-01
+ 1.7928420007228851e-01
+ <_>
+
+ 1 0 240 2.9415208846330643e-03 -1 -2 241
+ -2.4807679001241922e-03
+
+ -4.7243058681488037e-01 -6.0058331489562988e-01
+ 2.1497109532356262e-01
+ <_>
+
+ 1 0 242 -4.2498838156461716e-03 -1 -2 243
+ 7.6959328725934029e-03
+
+ -3.3230608701705933e-01 2.1247069537639618e-01
+ -8.1967252492904663e-01
+ <_>
+
+ 0 1 244 -6.1426039785146713e-02 -1 -2 245
+ 5.3176790475845337e-02
+
+ 5.2200448513031006e-01 -2.9851761460304260e-01
+ 2.8654190897941589e-01
+ <_>
+
+ 0 1 246 2.5695779186207801e-05 -1 -2 247
+ 2.4311970919370651e-03
+
+ -3.4719291329383850e-01 -1.2133490294218063e-01
+ 3.8965350389480591e-01
+ <_>
+
+ 1 0 248 5.6956289336085320e-03 -1 -2 249
+ -6.6630227956920862e-04
+
+ -6.6364032030105591e-01 2.7921909093856812e-01
+ -2.1624849736690521e-01
+ <_>
+ 20
+ -2.0051579475402832e+00
+
+ <_>
+
+ 1 0 250 -2.8509549796581268e-02 -1 -2 251
+ -1.6429109498858452e-02
+
+ -5.5133241415023804e-01 6.0328769683837891e-01
+ -3.0009600520133972e-01
+ <_>
+
+ 1 0 252 -5.8078952133655548e-03 -1 -2 253
+ -1.4670349657535553e-02
+
+ -4.8640519380569458e-01 4.4786658883094788e-01
+ -3.5448360443115234e-01
+ <_>
+
+ 1 0 254 -1.0694459779188037e-03 -1 -2 255
+ -5.0697539001703262e-02
+
+ -3.8593119382858276e-01 4.3865600228309631e-01
+ -3.1134051084518433e-01
+ <_>
+
+ 0 1 256 -7.2318017482757568e-02 -1 -2 257
+ -1.6740759834647179e-02
+
+ 5.5695492029190063e-01 3.4036931395530701e-01
+ -3.7713068723678589e-01
+ <_>
+
+ 1 0 258 1.2923260219395161e-02 -1 -2 259
+ -2.0832989830523729e-03
+
+ 2.6987180113792419e-01 7.2217263281345367e-02
+ -5.0617259740829468e-01
+ <_>
+
+ 0 1 260 2.9217539122328162e-04 -1 -2 261
+ 4.6477448195219040e-03
+
+ -4.7199469804763794e-01 -2.0233640074729919e-01
+ 3.6684620380401611e-01
+ <_>
+
+ 0 1 262 1.6355320112779737e-03 -1 -2 263
+ 6.0143060982227325e-03
+
+ -3.3369150757789612e-01 2.6335370540618896e-01
+ -7.5315129756927490e-01
+ <_>
+
+ 0 1 264 -1.9768040627241135e-02 -1 -2 265
+ 5.0995801575481892e-03
+
+ -7.3396641016006470e-01 -1.0626330226659775e-01
+ 3.7877479195594788e-01
+ <_>
+
+ 1 0 266 2.1737320348620415e-03 -1 -2 267
+ 2.3621059954166412e-02
+
+ -4.5873621106147766e-01 -3.7341989576816559e-02
+ 5.0312960147857666e-01
+ <_>
+
+ 1 0 268 4.7070439904928207e-02 -1 -2 269
+ 4.8429161310195923e-02
+
+ 3.9159670472145081e-01 -2.7507638931274414e-01
+ 3.6923450231552124e-01
+ <_>
+
+ 0 1 270 7.1763257437851280e-05 -1 -2 271
+ -4.0031517855823040e-03
+
+ -2.6133701205253601e-01 -4.6118479967117310e-01
+ 3.4101578593254089e-01
+ <_>
+
+ 1 0 272 2.5536299217492342e-03 -1 -2 273
+ -2.5720898993313313e-03
+
+ 4.4237849116325378e-01 4.3066531419754028e-01
+ -2.8360688686370850e-01
+ <_>
+
+ 1 0 274 8.7512210011482239e-03 -1 -2 275
+ 5.7346918620169163e-03
+
+ -7.7647632360458374e-01 1.4551159739494324e-01
+ -7.5074160099029541e-01
+ <_>
+
+ 0 1 276 -6.6438838839530945e-03 -1 -2 277
+ -3.4590701106935740e-03
+
+ 4.0350550413131714e-01 2.8769719600677490e-01
+ -2.8021600842475891e-01
+ <_>
+
+ 1 0 278 9.9742468446493149e-03 -1 -2 279
+ 1.3233659788966179e-02
+
+ -6.0677021741867065e-01 1.5478080511093140e-01
+ -7.0759147405624390e-01
+ <_>
+
+ 0 1 280 -5.0271311774849892e-03 -1 -2 281
+ -1.2092100223526359e-04
+
+ -7.3897778987884521e-01 2.3473000526428223e-01
+ -2.4400579929351807e-01
+ <_>
+
+ 1 0 282 -1.2881499715149403e-03 -1 -2 283
+ 6.2854858115315437e-03
+
+ -2.8901669383049011e-01 2.8100869059562683e-01
+ -5.6933850049972534e-01
+ <_>
+
+ 1 0 284 5.6929360143840313e-03 -1 -2 285
+ -5.3880861960351467e-03
+
+ -7.8456932306289673e-01 2.6201328635215759e-01
+ -2.2232030332088470e-01
+ <_>
+
+ 1 0 286 4.8205819912254810e-03 -1 -2 287
+ 3.4279188513755798e-01
+
+ 5.6795972585678101e-01 -1.8314230442047119e-01
+ 5.4108071327209473e-01
+ <_>
+
+ 0 1 288 5.1370919682085514e-03 -1 -2 289
+ -9.1285221278667450e-03
+
+ -3.9116761088371277e-01 5.3076338768005371e-01
+ -3.0019309371709824e-02
+ <_>
+ 21
+ -2.1121981143951416e+00
+
+ <_>
+
+ 1 0 290 -5.1386129111051559e-02 -1 -2 291
+ 5.1850839518010616e-03
+
+ -5.3148782253265381e-01 -2.4744540452957153e-01
+ 6.1181622743606567e-01
+ <_>
+
+ 1 0 292 -1.5259400010108948e-02 -1 -2 293
+ 2.5995150208473206e-02
+
+ -4.3303629755973816e-01 4.3979901820421219e-02
+ 7.3829138278961182e-01
+ <_>
+
+ 1 0 294 -3.2312370836734772e-02 -1 -2 295
+ 1.3700700365006924e-02
+
+ -3.9609751105308533e-01 -2.7643880248069763e-01
+ 4.2535358667373657e-01
+ <_>
+
+ 1 0 296 -2.2647869773209095e-03 -1 -2 297
+ -6.8290620110929012e-03
+
+ -3.2005569338798523e-01 -5.1682972908020020e-01
+ 3.6975708603858948e-01
+ <_>
+
+ 1 0 298 -2.2481549531221390e-03 -1 -2 299
+ 4.5944549143314362e-02
+
+ -3.6244350671768188e-01 -1.3187309959903359e-03
+ 6.3217681646347046e-01
+ <_>
+
+ 1 0 300 1.8755620112642646e-03 -1 -2 301
+ -1.9700559787452221e-03
+
+ -7.1403390169143677e-01 -5.8730661869049072e-01
+ 1.7592810094356537e-01
+ <_>
+
+ 1 0 302 -6.5721389837563038e-03 -1 -2 303
+ -1.1746180243790150e-02
+
+ -3.6347511410713196e-01 3.1440791487693787e-01
+ -4.0111118555068970e-01
+ <_>
+
+ 1 0 304 -1.6494120063725859e-04 -1 -2 305
+ -7.2169408667832613e-05
+
+ -3.7792590260505676e-01 5.2791112661361694e-01
+ -1.0790319740772247e-01
+ <_>
+
+ 0 1 306 1.9697639800142497e-04 -1 -2 307
+ -1.1423509567975998e-02
+
+ -4.7097641229629517e-01 -8.5209292173385620e-01
+ 1.7662869393825531e-01
+ <_>
+
+ 0 1 308 -4.5562228187918663e-03 -1 -2 309
+ -4.4720191508531570e-03
+
+ -8.0601161718368530e-01 -6.1500209569931030e-01
+ 1.2908309698104858e-01
+ <_>
+
+ 0 1 310 -1.7765410011634231e-03 -1 -2 311
+ -7.8799277544021606e-03
+
+ 3.1382599472999573e-01 3.0394628643989563e-01
+ -3.7204921245574951e-01
+ <_>
+
+ 0 1 312 -1.4284689677879214e-03 -1 -2 313
+ -1.8939910223707557e-03
+
+ 5.0413030385971069e-01 3.4823760390281677e-01
+ -2.3673820495605469e-01
+ <_>
+
+ 0 1 314 -3.1496640294790268e-03 -1 -2 315
+ -1.0716119781136513e-02
+
+ -6.6812378168106079e-01 -4.8515519499778748e-01
+ 1.9036419689655304e-01
+ <_>
+
+ 0 1 316 -6.8033537827432156e-03 -1 -2 317
+ 1.4902319759130478e-02
+
+ -5.6979268789291382e-01 1.3098250329494476e-01
+ -7.1448272466659546e-01
+ <_>
+
+ 0 1 318 -3.4170228987932205e-02 -1 -2 319
+ -1.4779250323772430e-01
+
+ 5.0575131177902222e-01 2.8233268857002258e-01
+ -2.7205321192741394e-01
+ <_>
+
+ 1 0 320 -5.5842810979811475e-05 -1 -2 321
+ 3.9885081350803375e-02
+
+ -2.6936730742454529e-01 5.6696129031479359e-03
+ 6.3975161314010620e-01
+ <_>
+
+ 1 0 322 1.2483130209147930e-02 -1 -2 323
+ -3.2864511013031006e-04
+
+ -7.4533742666244507e-01 3.6449620127677917e-01
+ -9.6498817205429077e-02
+ <_>
+
+ 0 1 324 -1.4710469986312091e-04 -1 -2 325
+ -2.7814340591430664e-01
+
+ 1.4060440659523010e-01 5.7002830505371094e-01
+ -4.8755478858947754e-01
+ <_>
+
+ 0 1 326 -1.3452640268951654e-03 -1 -2 327
+ 9.1500842245295644e-04
+
+ 3.9255830645561218e-01 -3.0215170979499817e-01
+ 3.6698031425476074e-01
+ <_>
+
+ 0 1 328 -3.4133149310946465e-03 -1 -2 329
+ 5.1169008947908878e-03
+
+ -6.4085817337036133e-01 -2.3052580654621124e-01
+ 2.4285919964313507e-01
+ <_>
+
+ 1 0 330 8.8846698403358459e-02 -1 -2 331
+ 6.1080828309059143e-03
+
+ 4.5381888747215271e-01 -3.5880088806152344e-01
+ 1.3209380209445953e-01
+ <_>
+ 23
+ -1.8701590299606323e+00
+
+ <_>
+
+ 1 0 332 -1.5930000692605972e-02 -1 -2 333
+ 2.7407450601458549e-02
+
+ -3.5245341062545776e-01 -6.0236789286136627e-02
+ 7.2715848684310913e-01
+ <_>
+
+ 1 0 334 -8.5037678480148315e-02 -1 -2 335
+ -1.1508919997140765e-03
+
+ -4.3576711416244507e-01 4.6471679210662842e-01
+ -3.5896891355514526e-01
+ <_>
+
+ 1 0 336 -6.4599298639222980e-04 -1 -2 337
+ 5.5495807901024818e-03
+
+ -3.1371060013771057e-01 4.1225919127464294e-01
+ -4.9400448799133301e-01
+ <_>
+
+ 1 0 338 -1.1472150217741728e-03 -1 -2 339
+ -6.4546810463070869e-03
+
+ -3.9192581176757812e-01 -6.9197827577590942e-01
+ 2.6103940606117249e-01
+ <_>
+
+ 0 1 340 -1.1414250358939171e-02 -1 -2 341
+ 1.1582579463720322e-03
+
+ 3.2361420989036560e-01 -3.8304999470710754e-01
+ 2.8015980124473572e-01
+ <_>
+
+ 1 0 342 -6.1077292775735259e-04 -1 -2 343
+ 1.1812780285254121e-03
+
+ -3.7471079826354980e-01 -1.7685219645500183e-01
+ 3.5498109459877014e-01
+ <_>
+
+ 1 0 344 7.9117231070995331e-03 -1 -2 345
+ -9.0904926764778793e-05
+
+ -6.9681918621063232e-01 2.0756739377975464e-01
+ -4.4282090663909912e-01
+ <_>
+
+ 0 1 346 2.8638960793614388e-03 -1 -2 347
+ 1.2769990134984255e-03
+
+ -4.1364789009094238e-01 -2.1157020330429077e-01
+ 3.1919568777084351e-01
+ <_>
+
+ 0 1 348 -7.5440858490765095e-03 -1 -2 349
+ 5.4467269219458103e-03
+
+ -7.5495690107345581e-01 1.3229879736900330e-01
+ -6.7695891857147217e-01
+ <_>
+
+ 1 0 350 1.3641830300912261e-03 -1 -2 351
+ 1.3810779899358749e-02
+
+ -4.2168149352073669e-01 1.5719360113143921e-01
+ -6.7965167760848999e-01
+ <_>
+
+ 1 0 352 5.0265640020370483e-02 -1 -2 353
+ 4.7765119234099984e-05
+
+ 7.4369138479232788e-01 -3.8102349638938904e-01
+ 1.0605350136756897e-01
+ <_>
+
+ 1 0 354 1.4666689932346344e-01 -1 -2 355
+ -3.0426830053329468e-01
+
+ 5.3409832715988159e-01 3.7783610820770264e-01
+ -2.1534620225429535e-01
+ <_>
+
+ 0 1 356 -3.2244708854705095e-03 -1 -2 357
+ -1.7187190242111683e-03
+
+ 2.8274241089820862e-01 1.0677109658718109e-01
+ -4.4204118847846985e-01
+ <_>
+
+ 0 1 358 -8.4115704521536827e-03 -1 -2 359
+ -2.3220919072628021e-02
+
+ -8.3557051420211792e-01 -5.1933908462524414e-01
+ 1.3181640207767487e-01
+ <_>
+
+ 0 1 360 -6.3912221230566502e-03 -1 -2 361
+ -3.0661540222354233e-04
+
+ -6.8552321195602417e-01 2.2192850708961487e-01
+ -2.3945030570030212e-01
+ <_>
+
+ 1 0 362 1.8742750398814678e-03 -1 -2 363
+ -2.8299540281295776e-02
+
+ -4.7218438982963562e-01 -6.8186718225479126e-01
+ 1.5923790633678436e-01
+ <_>
+
+ 1 0 364 7.9352483153343201e-03 -1 -2 365
+ -8.7599940598011017e-03
+
+ -7.3135781288146973e-01 -6.0014718770980835e-01
+ 1.0350330173969269e-01
+ <_>
+
+ 0 1 366 -5.5426149629056454e-03 -1 -2 367
+ -1.8066290067508817e-03
+
+ -5.9360408782958984e-01 2.5533521175384521e-01
+ -1.7036439478397369e-01
+ <_>
+
+ 1 0 368 -8.3993803709745407e-03 -1 -2 369
+ -1.9515500171110034e-03
+
+ -2.3953610658645630e-01 3.7252411246299744e-01
+ -1.2982900440692902e-01
+ <_>
+
+ 0 1 370 -2.2850139066576958e-03 -1 -2 371
+ -6.1910818330943584e-03
+
+ 5.0227212905883789e-01 4.4551658630371094e-01
+ -1.6307780146598816e-01
+ <_>
+
+ 1 0 372 1.1659320443868637e-03 -1 -2 373
+ -2.1016779355704784e-03
+
+ 3.4809079766273499e-01 3.1531378626823425e-01
+ -3.4710261225700378e-01
+ <_>
+
+ 0 1 374 -9.1615924611687660e-03 -1 -2 375
+ -2.0036540925502777e-02
+
+ -6.8623197078704834e-01 -6.8991881608963013e-01
+ 1.2962220609188080e-01
+ <_>
+
+ 1 0 376 2.7148448862135410e-03 -1 -2 377
+ 2.2834159899502993e-03
+
+ 4.7745740413665771e-01 -1.3344570063054562e-02
+ -6.1795878410339355e-01
+ <_>
+ 26
+ -1.9807859659194946e+00
+
+ <_>
+
+ 1 0 378 -3.2838471233844757e-02 -1 -2 379
+ -7.5696408748626709e-03
+
+ -5.1984071731567383e-01 6.3690251111984253e-01
+ -1.1562170088291168e-01
+ <_>
+
+ 1 0 380 5.4125871509313583e-02 -1 -2 381
+ 2.7004599571228027e-01
+
+ 5.0340247154235840e-01 -3.4640678763389587e-01
+ 3.7651509046554565e-01
+ <_>
+
+ 0 1 382 7.0261410437524319e-03 -1 -2 383
+ 3.1245660502463579e-03
+
+ -4.1046440601348877e-01 -4.1382190585136414e-01
+ 3.7550741434097290e-01
+ <_>
+
+ 1 0 384 -1.8708549905568361e-03 -1 -2 385
+ -1.4969009906053543e-02
+
+ -3.7827330827713013e-01 3.9941680431365967e-01
+ -2.2254510223865509e-01
+ <_>
+
+ 1 0 386 3.4136420581489801e-03 -1 -2 387
+ 2.3454260081052780e-03
+
+ -5.4667568206787109e-01 1.6618840396404266e-01
+ -6.3203942775726318e-01
+ <_>
+
+ 1 0 388 -1.1689099483191967e-03 -1 -2 389
+ -7.8206984326243401e-03
+
+ -4.4972181320190430e-01 -5.7166117429733276e-01
+ 1.8599990010261536e-01
+ <_>
+
+ 0 1 390 -2.6324259117245674e-02 -1 -2 391
+ -9.1647548833861947e-04
+
+ -7.8041112422943115e-01 2.3100090026855469e-01
+ -2.1224120259284973e-01
+ <_>
+
+ 0 1 392 -2.3702960461378098e-03 -1 -2 393
+ -9.2874821275472641e-03
+
+ 2.7304211258888245e-01 2.3200799524784088e-01
+ -3.4602558612823486e-01
+ <_>
+
+ 1 0 394 2.9221060685813427e-03 -1 -2 395
+ -1.4097889652475715e-03
+
+ -6.9972628355026245e-01 4.8019358515739441e-01
+ -4.2650200426578522e-02
+ <_>
+
+ 1 0 396 9.3326548812910914e-04 -1 -2 397
+ -5.6837309151887894e-02
+
+ 3.7708479166030884e-01 4.6375161409378052e-01
+ -2.0441579818725586e-01
+ <_>
+
+ 1 0 398 -9.1405760031193495e-05 -1 -2 399
+ -1.1147770099341869e-02
+
+ -2.9447770118713379e-01 3.6579200625419617e-01
+ -1.6106230020523071e-01
+ <_>
+
+ 1 0 400 8.0759642878547311e-04 -1 -2 401
+ 1.7215589759871364e-03
+
+ -3.8769969344139099e-01 1.7790059745311737e-01
+ -5.9673792123794556e-01
+ <_>
+
+ 0 1 402 1.4305640012025833e-02 -1 -2 403
+ -3.8885008543729782e-02
+
+ -2.8887918591499329e-01 3.6497229337692261e-01
+ -1.3762719929218292e-01
+ <_>
+
+ 0 1 404 -3.4479280002415180e-03 -1 -2 405
+ 3.0168178677558899e-01
+
+ 1.8110840022563934e-01 -3.5425490140914917e-01
+ 4.2958360910415649e-01
+ <_>
+
+ 1 0 406 2.8582389932125807e-03 -1 -2 407
+ 1.4091320335865021e-03
+
+ 5.2957808971405029e-01 -2.1234430372714996e-01
+ 3.1428509950637817e-01
+ <_>
+
+ 0 1 408 -1.6597079811617732e-03 -1 -2 409
+ 8.7804382201284170e-04
+
+ -6.3348418474197388e-01 -5.5315300822257996e-02
+ 3.9389958977699280e-01
+ <_>
+
+ 1 0 410 2.0211800001561642e-03 -1 -2 411
+ -6.8409871309995651e-03
+
+ -4.7127309441566467e-01 -6.4065527915954590e-01
+ 1.4861440658569336e-01
+ <_>
+
+ 1 0 412 4.7200761735439301e-02 -1 -2 413
+ 4.9684080295264721e-03
+
+ 4.1216409206390381e-01 -3.2404300570487976e-01
+ 1.5755960345268250e-01
+ <_>
+
+ 1 0 414 3.7529911845922470e-02 -1 -2 415
+ -1.1665089987218380e-02
+
+ 4.1328459978103638e-01 2.5467500090599060e-01
+ -3.1303560733795166e-01
+ <_>
+
+ 1 0 416 -6.8298257247079164e-05 -1 -2 417
+ 1.5325429849326611e-02
+
+ -2.7212071418762207e-01 2.2946609556674957e-01
+ -6.7345708608627319e-01
+ <_>
+
+ 1 0 418 8.5185896605253220e-03 -1 -2 419
+ -2.6828479021787643e-03
+
+ -7.1114671230316162e-01 1.5511700510978699e-01
+ -3.5444891452789307e-01
+ <_>
+
+ 1 0 420 1.3791749952360988e-03 -1 -2 421
+ -3.3968368370551616e-05
+
+ 3.6916270852088928e-01 5.9150930494070053e-02
+ -4.6007719635963440e-01
+ <_>
+
+ 1 0 422 5.8259358629584312e-03 -1 -2 423
+ -8.1688696518540382e-03
+
+ -5.4986697435379028e-01 -5.0567412376403809e-01
+ 1.5189670026302338e-01
+ <_>
+
+ 0 1 424 -2.3251199163496494e-03 -1 -2 425
+ -4.8669208772480488e-03
+
+ 3.4904810786247253e-01 5.3138560056686401e-01
+ -2.1413469314575195e-01
+ <_>
+
+ 1 0 426 4.3380381539463997e-03 -1 -2 427
+ 3.4176679328083992e-03
+
+ -7.8248262405395508e-01 1.2460789829492569e-01
+ -5.5297750234603882e-01
+ <_>
+
+ 1 0 428 5.5309730768203735e-01 -1 -2 429
+ 2.3636389523744583e-03
+
+ 4.6573078632354736e-01 -3.3309051394462585e-01
+ 9.4380050897598267e-02
+ <_>
+ 26
+ -1.9697020053863525e+00
+
+ <_>
+
+ 1 0 430 -2.2934280335903168e-02 -1 -2 431
+ -4.2665850371122360e-02
+
+ -4.4716298580169678e-01 5.4085898399353027e-01
+ -3.3589279651641846e-01
+ <_>
+
+ 0 1 432 -9.8418388515710831e-03 -1 -2 433
+ -1.1932349763810635e-02
+
+ 3.9958000183105469e-01 3.4219118952751160e-01
+ -4.2416951060295105e-01
+ <_>
+
+ 1 0 434 -2.4437010288238525e-02 -1 -2 435
+ -4.9987169913947582e-03
+
+ -3.7337359786033630e-01 4.0358328819274902e-01
+ -3.5199370980262756e-01
+ <_>
+
+ 0 1 436 1.8582950579002500e-03 -1 -2 437
+ 2.7540219016373158e-03
+
+ -4.4158118963241577e-01 -2.8722938895225525e-01
+ 3.3857241272926331e-01
+ <_>
+
+ 1 0 438 -3.4452530089765787e-03 -1 -2 439
+ -5.9277489781379700e-03
+
+ -3.1821981072425842e-01 -6.5073519945144653e-01
+ 2.7109220623970032e-01
+ <_>
+
+ 1 0 440 -1.2391789641696960e-04 -1 -2 441
+ -7.3327139019966125e-02
+
+ -3.3467200398445129e-01 -5.9646248817443848e-01
+ 2.2861810028553009e-01
+ <_>
+
+ 1 0 442 -8.3964750170707703e-02 -1 -2 443
+ -8.1644707825034857e-04
+
+ -2.2525189816951752e-01 3.8213649392127991e-01
+ -3.3410450816154480e-01
+ <_>
+
+ 0 1 444 -1.5207779593765736e-02 -1 -2 445
+ 4.6894788742065430e-02
+
+ 3.0742698907852173e-01 -3.8833889365196228e-01
+ 2.3177519440650940e-01
+ <_>
+
+ 0 1 446 -1.0398440062999725e-01 -1 -2 447
+ 3.9815339259803295e-03
+
+ 7.1321141719818115e-01 -2.3310199379920959e-01
+ 2.9247841238975525e-01
+ <_>
+
+ 1 0 448 2.5737080723047256e-03 -1 -2 449
+ 9.1035291552543640e-04
+
+ -5.5017340183258057e-01 -1.8228930234909058e-01
+ 2.8370320796966553e-01
+ <_>
+
+ 1 0 450 6.4211348071694374e-03 -1 -2 451
+ -5.8243819512426853e-03
+
+ -4.8581978678703308e-01 2.4608190357685089e-01
+ -2.1565020084381104e-01
+ <_>
+
+ 0 1 452 -4.0043629705905914e-02 -1 -2 453
+ 8.4683427121490240e-04
+
+ -6.3880550861358643e-01 -6.0435589402914047e-02
+ 4.3711128830909729e-01
+ <_>
+
+ 1 0 454 1.2964580208063126e-02 -1 -2 455
+ -2.2524749510921538e-04
+
+ 5.9495061635971069e-01 8.6831472814083099e-02
+ -3.6362320184707642e-01
+ <_>
+
+ 0 1 456 -1.7258729785680771e-03 -1 -2 457
+ -7.2289421223104000e-03
+
+ -6.4707720279693604e-01 -6.8775367736816406e-01
+ 1.3838720321655273e-01
+ <_>
+
+ 1 0 458 2.5079259648919106e-03 -1 -2 459
+ -1.9473560387268662e-03
+
+ 3.0659309029579163e-01 2.2967760264873505e-01
+ -3.4737649559974670e-01
+ <_>
+
+ 1 0 460 7.4747111648321152e-03 -1 -2 461
+ 1.0328400094294921e-04
+
+ -6.5191787481307983e-01 -2.0725889503955841e-01
+ 2.2402130067348480e-01
+ <_>
+
+ 0 1 462 -7.8996885567903519e-03 -1 -2 463
+ 4.2833909392356873e-03
+
+ -7.2479170560836792e-01 1.3954970240592957e-01
+ -4.3086060881614685e-01
+ <_>
+
+ 1 0 464 6.3452741596847773e-04 -1 -2 465
+ -5.4966621100902557e-03
+
+ 2.9792639613151550e-01 -5.6205391883850098e-01
+ -2.9608119279146194e-02
+ <_>
+
+ 1 0 466 3.1408690847456455e-03 -1 -2 467
+ -5.0443639047443867e-03
+
+ -6.1322140693664551e-01 -5.3060102462768555e-01
+ 1.2507459521293640e-01
+ <_>
+
+ 1 0 468 4.5964870601892471e-02 -1 -2 469
+ -5.3749699145555496e-03
+
+ 3.8188719749450684e-01 1.4089010655879974e-01
+ -3.5535690188407898e-01
+ <_>
+
+ 1 0 470 2.9262059833854437e-03 -1 -2 471
+ 5.2230368601158261e-04
+
+ -6.0886657238006592e-01 -7.1441568434238434e-02
+ 3.6275258660316467e-01
+ <_>
+
+ 0 1 472 -4.4181118719279766e-03 -1 -2 473
+ 4.3349149636924267e-03
+
+ -7.6458007097244263e-01 1.1246410012245178e-01
+ -5.4553848505020142e-01
+ <_>
+
+ 1 0 474 2.6483018882572651e-03 -1 -2 475
+ -1.0814110282808542e-03
+
+ 2.3542310297489166e-01 1.4422300457954407e-01
+ -3.4401959180831909e-01
+ <_>
+
+ 1 0 476 -5.4296739108394831e-05 -1 -2 477
+ 5.5393581278622150e-03
+
+ -2.8607460856437683e-01 1.9345289468765259e-01
+ -5.0549429655075073e-01
+ <_>
+
+ 1 0 478 3.3703099936246872e-02 -1 -2 479
+ -1.2178930046502501e-04
+
+ 3.8302558660507202e-01 6.6414177417755127e-02
+ -4.8530051112174988e-01
+ <_>
+
+ 0 1 480 -1.7803770024329424e-03 -1 -2 481
+ -5.6019638577708974e-05
+
+ 4.4113549590110779e-01 1.2396749854087830e-01
+ -2.6292270421981812e-01
+ <_>
+ 30
+ -2.0330519676208496e+00
+
+ <_>
+
+ 1 0 482 3.1982790678739548e-03 -1 -2 483
+ -1.5240450156852603e-03
+
+ 5.4208421707153320e-01 8.2784838974475861e-02
+ -5.0164830684661865e-01
+ <_>
+
+ 0 1 484 -1.2284429743885994e-02 -1 -2 485
+ -8.3555448800325394e-03
+
+ 4.4174939393997192e-01 3.5863399505615234e-01
+ -3.6254858970642090e-01
+ <_>
+
+ 1 0 486 4.1357800364494324e-02 -1 -2 487
+ 2.2308749612420797e-03
+
+ 4.7858810424804688e-01 -6.0390347242355347e-01
+ -8.7199418339878321e-04
+ <_>
+
+ 1 0 488 -5.4160541296005249e-01 -1 -2 489
+ 7.9009458422660828e-03
+
+ -3.2536658644676208e-01 -3.6415100097656250e-01
+ 4.0501600503921509e-01
+ <_>
+
+ 1 0 490 -2.7236728928983212e-03 -1 -2 491
+ 2.1041880827397108e-03
+
+ -2.7644181251525879e-01 3.4068119525909424e-01
+ -4.1922488808631897e-01
+ <_>
+
+ 1 0 492 1.2688159476965666e-03 -1 -2 493
+ -4.2881062254309654e-03
+
+ -5.4520767927169800e-01 3.0060088634490967e-01
+ -1.5233190357685089e-01
+ <_>
+
+ 1 0 494 -4.8890449106693268e-03 -1 -2 495
+ 5.0922110676765442e-03
+
+ -3.7665820121765137e-01 2.1803319454193115e-01
+ -5.7126522064208984e-01
+ <_>
+
+ 0 1 496 -7.0944731123745441e-03 -1 -2 497
+ 2.5431890040636063e-02
+
+ 5.1921921968460083e-01 -2.1260249614715576e-01
+ 3.0566200613975525e-01
+ <_>
+
+ 1 0 498 -6.7461907747201622e-05 -1 -2 499
+ -8.5350889712572098e-03
+
+ -3.3406749367713928e-01 3.5043460130691528e-01
+ -9.0384833514690399e-02
+ <_>
+
+ 0 1 500 -4.1117807850241661e-03 -1 -2 501
+ 6.3964081928133965e-03
+
+ -6.9683700799942017e-01 1.1542639881372452e-01
+ -6.6645371913909912e-01
+ <_>
+
+ 1 0 502 9.8322751000523567e-04 -1 -2 503
+ -5.5737968068569899e-04
+
+ 3.5695379972457886e-01 2.3081110417842865e-01
+ -2.8862631320953369e-01
+ <_>
+
+ 1 0 504 2.8798289131373167e-03 -1 -2 505
+ -7.7164517715573311e-03
+
+ -5.9923267364501953e-01 3.6074900627136230e-01
+ -8.1827618181705475e-02
+ <_>
+
+ 0 1 506 3.7285129074007273e-03 -1 -2 507
+ -1.3161109760403633e-02
+
+ -3.7732011079788208e-01 6.7023038864135742e-01
+ 1.5114549547433853e-02
+ <_>
+
+ 1 0 508 -3.8966130465269089e-02 -1 -2 509
+ -5.7413699105381966e-03
+
+ -3.1252211332321167e-01 3.3947479724884033e-01
+ -1.6011409461498260e-01
+ <_>
+
+ 1 0 510 1.2538330256938934e-01 -1 -2 511
+ -9.7243122756481171e-02
+
+ 7.3721152544021606e-01 5.0288981199264526e-01
+ -1.3284370303153992e-01
+ <_>
+
+ 0 1 512 -2.0128490868955851e-03 -1 -2 513
+ 3.5349070094525814e-03
+
+ 4.1367891430854797e-01 -1.5923270583152771e-01
+ 4.4056579470634460e-01
+ <_>
+
+ 1 0 514 4.4846540689468384e-01 -1 -2 515
+ -1.0387780144810677e-02
+
+ 5.9423661231994629e-01 3.0399119853973389e-01
+ -1.8287350237369537e-01
+ <_>
+
+ 0 1 516 -1.4210389927029610e-03 -1 -2 517
+ 3.6446070298552513e-03
+
+ -4.5361068844795227e-01 1.5766820311546326e-01
+ -6.2608838081359863e-01
+ <_>
+
+ 1 0 518 3.2253630924969912e-03 -1 -2 519
+ 9.8893349058926105e-04
+
+ -4.1410240530967712e-01 -1.0757800191640854e-01
+ 3.1156888604164124e-01
+ <_>
+
+ 0 1 520 -2.7107829228043556e-03 -1 -2 521
+ -6.9264871999621391e-03
+
+ -7.5352817773818970e-01 2.7464428544044495e-01
+ -1.1728949844837189e-01
+ <_>
+
+ 0 1 522 -3.7942770868539810e-02 -1 -2 523
+ 1.3486459851264954e-02
+
+ 2.6936548948287964e-01 -3.1532868742942810e-01
+ 2.5785440206527710e-01
+ <_>
+
+ 1 0 524 2.7866458985954523e-03 -1 -2 525
+ 3.2895719632506371e-03
+
+ -6.8431657552719116e-01 1.2949100136756897e-01
+ -4.4475141167640686e-01
+ <_>
+
+ 1 0 526 1.7910100286826491e-03 -1 -2 527
+ 3.3694170415401459e-03
+
+ -5.6237429380416870e-01 -6.1936769634485245e-02
+ 3.6794289946556091e-01
+ <_>
+
+ 0 1 528 6.5897632157430053e-04 -1 -2 529
+ -3.2603838917566463e-05
+
+ -2.7705720067024231e-01 2.7426779270172119e-01
+ -2.2369539737701416e-01
+ <_>
+
+ 0 1 530 -6.0175720602273941e-02 -1 -2 531
+ -2.1217610687017441e-02
+
+ -7.4174910783767700e-01 -4.5034751296043396e-01
+ 1.1426000297069550e-01
+ <_>
+
+ 1 0 532 -2.2632910404354334e-03 -1 -2 533
+ 6.0313078574836254e-03
+
+ -3.0538588762283325e-01 2.0562660694122314e-01
+ -4.0689799189567566e-01
+ <_>
+
+ 1 0 534 5.7578482665121555e-04 -1 -2 535
+ -9.3677162658423185e-04
+
+ 3.5098749399185181e-01 2.1616159379482269e-01
+ -2.4415770173072815e-01
+ <_>
+
+ 0 1 536 -3.7626568228006363e-02 -1 -2 537
+ 4.4729812070727348e-03
+
+ -5.9113681316375732e-01 1.5792270004749298e-01
+ -3.2226279377937317e-01
+ <_>
+
+ 0 1 538 -7.1853301487863064e-03 -1 -2 539
+ 4.0520228445529938e-02
+
+ -5.9519052505493164e-01 -6.6688463091850281e-02
+ 3.4030249714851379e-01
+ <_>
+
+ 0 1 540 -6.1968388035893440e-03 -1 -2 541
+ 1.0311529971659184e-02
+
+ -6.7287462949752808e-01 1.0683239996433258e-01
+ -5.4825967550277710e-01
+ <_>
+ 33
+ -1.9516259431838989e+00
+
+ <_>
+
+ 1 0 542 -1.9320519641041756e-02 -1 -2 543
+ -1.5126460231840611e-02
+
+ -3.8712570071220398e-01 6.4468181133270264e-01
+ -1.2727110087871552e-01
+ <_>
+
+ 1 0 544 -6.0182690620422363e-02 -1 -2 545
+ -1.3576049823313951e-03
+
+ -3.0819109082221985e-01 4.8021888732910156e-01
+ -3.3428680896759033e-01
+ <_>
+
+ 1 0 546 -5.6930771097540855e-03 -1 -2 547
+ -8.0942036584019661e-03
+
+ -3.3166080713272095e-01 4.7517481446266174e-01
+ -7.4761562049388885e-02
+ <_>
+
+ 0 1 548 6.8413332337513566e-04 -1 -2 549
+ -1.1520589888095856e-01
+
+ -3.5741969943046570e-01 2.6105090975761414e-01
+ -3.1773808598518372e-01
+ <_>
+
+ 0 1 550 -9.1124046593904495e-03 -1 -2 551
+ 5.4891068430151790e-05
+
+ -5.8540707826614380e-01 -2.2981899976730347e-01
+ 2.3482909798622131e-01
+ <_>
+
+ 0 1 552 -9.5622539520263672e-03 -1 -2 553
+ -8.2032606005668640e-03
+
+ 3.9155280590057373e-01 4.3179950118064880e-01
+ -2.3173290491104126e-01
+ <_>
+
+ 0 1 554 -4.0035760030150414e-03 -1 -2 555
+ 2.5406230706721544e-03
+
+ -5.8700478076934814e-01 1.7990030348300934e-01
+ -4.1681569814682007e-01
+ <_>
+
+ 1 0 556 1.9435470458120108e-03 -1 -2 557
+ 8.4362342022359371e-04
+
+ 3.0340009927749634e-01 -3.0661040544509888e-01
+ 2.3646999895572662e-01
+ <_>
+
+ 0 1 558 -5.3103519603610039e-03 -1 -2 559
+ -3.5526719875633717e-03
+
+ -5.6304818391799927e-01 -5.5695772171020508e-01
+ 1.5022790431976318e-01
+ <_>
+
+ 1 0 560 7.1414401754736900e-03 -1 -2 561
+ -1.1435860069468617e-03
+
+ -6.7626637220382690e-01 3.7873879075050354e-01
+ -7.4442893266677856e-02
+ <_>
+
+ 0 1 562 -3.1177429482340813e-03 -1 -2 563
+ -7.7415622770786285e-02
+
+ -6.2568587064743042e-01 3.9839410781860352e-01
+ -5.5262319743633270e-02
+ <_>
+
+ 0 1 564 -3.9252988994121552e-02 -1 -2 565
+ 2.2049970924854279e-02
+
+ 3.4094831347465515e-01 -2.4413719773292542e-01
+ 4.3050870299339294e-01
+ <_>
+
+ 0 1 566 -2.2205871064215899e-03 -1 -2 567
+ 2.8649640735238791e-03
+
+ 2.8309720754623413e-01 -3.5401880741119385e-01
+ 2.1054570376873016e-01
+ <_>
+
+ 0 1 568 5.8806730521610007e-05 -1 -2 569
+ -6.6595021635293961e-03
+
+ -2.7014040946960449e-01 -5.9313482046127319e-01
+ 2.1892869472503662e-01
+ <_>
+
+ 0 1 570 1.6931600868701935e-02 -1 -2 571
+ 4.7026639804244041e-03
+
+ -1.1279620230197906e-01 4.9212211370468140e-01
+ -3.9702880382537842e-01
+ <_>
+
+ 0 1 572 1.7478819936513901e-03 -1 -2 573
+ -2.0893230102956295e-03
+
+ -2.2339369356632233e-01 -4.3157818913459778e-01
+ 2.5373139977455139e-01
+ <_>
+
+ 1 0 574 1.1534850113093853e-02 -1 -2 575
+ 8.7350117973983288e-04
+
+ -7.0668542385101318e-01 -7.2509132325649261e-02
+ 3.9975029230117798e-01
+ <_>
+
+ 1 0 576 -7.2836421895772219e-04 -1 -2 577
+ 1.2666890397667885e-03
+
+ -2.3567649722099304e-01 2.2582389414310455e-01
+ -4.2317348718643188e-01
+ <_>
+
+ 1 0 578 -8.4794021677225828e-04 -1 -2 579
+ 3.6212441325187683e-01
+
+ -2.8307029604911804e-01 1.6724239289760590e-01
+ -7.6826947927474976e-01
+ <_>
+
+ 1 0 580 -1.9437649752944708e-03 -1 -2 581
+ -4.1159680113196373e-03
+
+ -2.7229419350624084e-01 -6.4211308956146240e-01
+ 1.8810230493545532e-01
+ <_>
+
+ 1 0 582 2.3254039697349072e-03 -1 -2 583
+ -1.4815620379522443e-03
+
+ 2.8516888618469238e-01 4.2574208974838257e-01
+ -2.1113610267639160e-01
+ <_>
+
+ 1 0 584 -6.6233296820428222e-05 -1 -2 585
+ -3.3756431192159653e-02
+
+ -2.8205850720405579e-01 -8.1803041696548462e-01
+ 1.7053669691085815e-01
+ <_>
+
+ 0 1 586 -9.4350927975028753e-04 -1 -2 587
+ 1.0650219628587365e-03
+
+ 1.5273140370845795e-01 -4.2650490999221802e-01
+ 1.5235939621925354e-01
+ <_>
+
+ 0 1 588 -1.2905279872938991e-03 -1 -2 589
+ 9.6549028530716896e-03
+
+ 1.7365390062332153e-01 -3.9721599221229553e-01
+ 1.7953179776668549e-01
+ <_>
+
+ 1 0 590 1.3434770517051220e-03 -1 -2 591
+ 5.5220007197931409e-04
+
+ -6.9609320163726807e-01 -7.2258770465850830e-02
+ 3.4493291378021240e-01
+ <_>
+
+ 1 0 592 3.5795350559055805e-03 -1 -2 593
+ -1.0585499927401543e-02
+
+ -4.8070669174194336e-01 -3.2975581288337708e-01
+ 1.4686919748783112e-01
+ <_>
+
+ 1 0 594 3.5636040847748518e-03 -1 -2 595
+ -1.0298290103673935e-01
+
+ -6.1415022611618042e-01 -7.2366482019424438e-01
+ 8.4447070956230164e-02
+ <_>
+
+ 0 1 596 -2.9605759307742119e-02 -1 -2 597
+ -3.4580599516630173e-02
+
+ 4.7113609313964844e-01 -4.3128991127014160e-01
+ 2.4623470380902290e-02
+ <_>
+
+ 1 0 598 4.7923368401825428e-03 -1 -2 599
+ 1.7058040248230100e-03
+
+ -4.6270799636840820e-01 1.4738570153713226e-01
+ -3.7818890810012817e-01
+ <_>
+
+ 0 1 600 -3.3174119889736176e-03 -1 -2 601
+ -1.7022279789671302e-03
+
+ 2.7929860353469849e-01 2.6326990127563477e-01
+ -2.5129210948944092e-01
+ <_>
+
+ 1 0 602 -8.1695342669263482e-04 -1 -2 603
+ -1.4184829778969288e-03
+
+ -1.2859649956226349e-01 5.8855402469635010e-01
+ -5.0085168331861496e-02
+ <_>
+
+ 0 1 604 -1.0478599928319454e-02 -1 -2 605
+ 3.1981911510229111e-02
+
+ 1.4732900261878967e-01 -4.1299548745155334e-01
+ 3.4442049264907837e-01
+ <_>
+
+ 1 0 606 4.5543849468231201e-02 -1 -2 607
+ 2.3574009537696838e-02
+
+ 4.8842081427574158e-01 -4.6383219957351685e-01
+ 3.7443768233060837e-02
+ <_>
+ 29
+ -1.7628519535064697e+00
+
+ <_>
+
+ 1 0 608 -3.2347131520509720e-02 -1 -2 609
+ -7.4855431914329529e-02
+
+ -4.1153168678283691e-01 5.4409480094909668e-01
+ -2.1043080091476440e-01
+ <_>
+
+ 0 1 610 -5.9164799749851227e-02 -1 -2 611
+ -5.0734709948301315e-03
+
+ 4.6945521235466003e-01 8.0933347344398499e-02
+ -4.0436869859695435e-01
+ <_>
+
+ 0 1 612 6.6304411739110947e-03 -1 -2 613
+ 2.2804280743002892e-02
+
+ -3.1943950057029724e-01 -3.5277611017227173e-01
+ 3.6358159780502319e-01
+ <_>
+
+ 1 0 614 3.4148059785366058e-03 -1 -2 615
+ -6.0696629807353020e-03
+
+ -4.2139899730682373e-01 2.8190940618515015e-01
+ -2.5727981328964233e-01
+ <_>
+
+ 1 0 616 -3.3271780703216791e-03 -1 -2 617
+ 1.2381239794194698e-02
+
+ -3.3380180597305298e-01 2.5831120088696480e-02
+ 5.8200639486312866e-01
+ <_>
+
+ 0 1 618 -7.8561902046203613e-02 -1 -2 619
+ -7.6863910071551800e-03
+
+ 5.7080817222595215e-01 1.9097380340099335e-01
+ -2.4749469757080078e-01
+ <_>
+
+ 1 0 620 3.9404830895364285e-03 -1 -2 621
+ -7.0624810177832842e-05
+
+ -3.5295888781547546e-01 2.8438061475753784e-01
+ -1.6469420492649078e-01
+ <_>
+
+ 0 1 622 -2.2568539716303349e-03 -1 -2 623
+ -3.5595949739217758e-03
+
+ -4.6189218759536743e-01 2.4525940418243408e-01
+ -1.8984979391098022e-01
+ <_>
+
+ 0 1 624 -3.0113100074231625e-03 -1 -2 625
+ -6.2748990021646023e-03
+
+ 3.0594390630722046e-01 1.4716149866580963e-01
+ -3.3265221118927002e-01
+ <_>
+
+ 1 0 626 2.5835279375314713e-03 -1 -2 627
+ 3.2576550729572773e-03
+
+ -7.4853891134262085e-01 -1.4949619770050049e-01
+ 2.6293671131134033e-01
+ <_>
+
+ 1 0 628 -2.6957978843711317e-04 -1 -2 629
+ -4.4593680649995804e-03
+
+ -2.9468360543251038e-01 -4.5905289053916931e-01
+ 2.2235380113124847e-01
+ <_>
+
+ 1 0 630 2.2841650061309338e-03 -1 -2 631
+ -6.7595718428492546e-04
+
+ -6.3815939426422119e-01 -3.1756940484046936e-01
+ 1.4903070032596588e-01
+ <_>
+
+ 1 0 632 6.1428439803421497e-03 -1 -2 633
+ 2.7392068877816200e-03
+
+ 2.4187029898166656e-01 -3.1487539410591125e-01
+ 2.3589129745960236e-01
+ <_>
+
+ 0 1 634 -2.0209311041980982e-03 -1 -2 635
+ 2.6892140507698059e-02
+
+ 2.5389561057090759e-01 -3.4391039609909058e-01
+ 2.3010760545730591e-01
+ <_>
+
+ 1 0 636 1.4671060256659985e-02 -1 -2 637
+ -1.2444119900465012e-02
+
+ 5.9517538547515869e-01 3.7335929274559021e-01
+ -1.4540639519691467e-01
+ <_>
+
+ 0 1 638 2.0527220331132412e-03 -1 -2 639
+ -1.7088990658521652e-02
+
+ -2.1135020256042480e-01 -7.2516232728958130e-01
+ 2.3358739912509918e-01
+ <_>
+
+ 0 1 640 -9.8585523664951324e-03 -1 -2 641
+ -1.0541190393269062e-02
+
+ 4.5390421152114868e-01 3.5500058531761169e-01
+ -1.7118500173091888e-01
+ <_>
+
+ 1 0 642 4.0034228004515171e-03 -1 -2 643
+ -1.1889140121638775e-02
+
+ -7.0433962345123291e-01 4.0436559915542603e-01
+ -4.6263620257377625e-02
+ <_>
+
+ 0 1 644 -2.0685700699687004e-02 -1 -2 645
+ -7.9243928194046021e-03
+
+ -6.4347600936889648e-01 -5.3632920980453491e-01
+ 1.1002989858388901e-01
+ <_>
+
+ 1 0 646 1.2431150535121560e-03 -1 -2 647
+ -4.2312019504606724e-03
+
+ 4.1220021247863770e-01 7.9887658357620239e-02
+ -3.0926740169525146e-01
+ <_>
+
+ 1 0 648 9.8197339102625847e-03 -1 -2 649
+ 4.5455411076545715e-02
+
+ -6.0976761579513550e-01 1.0621140152215958e-01
+ -6.4687371253967285e-01
+ <_>
+
+ 1 0 650 2.6892758905887604e-03 -1 -2 651
+ -1.5172710409387946e-03
+
+ -4.9122989177703857e-01 1.7578749358654022e-01
+ -2.6818940043449402e-01
+ <_>
+
+ 1 0 652 6.2014168361201882e-04 -1 -2 653
+ -2.0233519899193197e-04
+
+ 2.5500729680061340e-01 7.2745857760310173e-03
+ -5.0815272331237793e-01
+ <_>
+
+ 1 0 654 3.1760020647197962e-03 -1 -2 655
+ -1.2668699491769075e-03
+
+ 4.3849268555641174e-01 1.6349400579929352e-01
+ -2.9128161072731018e-01
+ <_>
+
+ 1 0 656 5.1056100055575371e-03 -1 -2 657
+ -1.5026510227471590e-03
+
+ -7.5001358985900879e-01 2.7198830246925354e-01
+ -9.9486798048019409e-02
+ <_>
+
+ 0 1 658 -3.6238620523363352e-03 -1 -2 659
+ 7.6577658765017986e-03
+
+ -6.0396248102188110e-01 1.0938379913568497e-01
+ -5.3007638454437256e-01
+ <_>
+
+ 0 1 660 -3.1830249354243279e-03 -1 -2 661
+ 1.0931329801678658e-02
+
+ -4.7724890708923340e-01 -4.3065819889307022e-02
+ 3.8945859670639038e-01
+ <_>
+
+ 0 1 662 -1.0047679534181952e-03 -1 -2 663
+ -4.6660430729389191e-02
+
+ 4.1553598642349243e-01 3.0159878730773926e-01
+ -1.6184380650520325e-01
+ <_>
+
+ 1 0 664 3.2002381049096584e-03 -1 -2 665
+ -1.7367519903928041e-03
+
+ -5.4621779918670654e-01 -2.1987779438495636e-01
+ 1.9606420397758484e-01
+ <_>
+ 33
+ -1.8088439702987671e+00
+
+ <_>
+
+ 0 1 666 1.7160519957542419e-02 -1 -2 667
+ 1.4503560028970242e-02
+
+ -3.2273009419441223e-01 -3.9438620209693909e-01
+ 5.7922977209091187e-01
+ <_>
+
+ 1 0 668 -9.0323518961668015e-03 -1 -2 669
+ -6.9836131297051907e-03
+
+ -4.1536870598793030e-01 3.5515859723091125e-01
+ -3.8177150487899780e-01
+ <_>
+
+ 0 1 670 -1.9220909103751183e-02 -1 -2 671
+ -4.0087159723043442e-02
+
+ 4.5315900444984436e-01 1.7228379845619202e-01
+ -3.1110560894012451e-01
+ <_>
+
+ 0 1 672 5.6549701839685440e-03 -1 -2 673
+ -1.1611269786953926e-02
+
+ -4.0461608767509460e-01 2.9034239053726196e-01
+ -2.2078509628772736e-01
+ <_>
+
+ 0 1 674 -1.0576159693300724e-03 -1 -2 675
+ -1.3360800221562386e-03
+
+ 3.5851669311523438e-01 1.5968900173902512e-02
+ -4.1990101337432861e-01
+ <_>
+
+ 1 0 676 5.2302791737020016e-03 -1 -2 677
+ -2.7848479803651571e-03
+
+ -4.9663281440734863e-01 -5.2960211038589478e-01
+ 1.5535449981689453e-01
+ <_>
+
+ 0 1 678 -2.5654129683971405e-02 -1 -2 679
+ -6.8942131474614143e-03
+
+ -5.9309178590774536e-01 2.4318109452724457e-01
+ -1.8231940269470215e-01
+ <_>
+
+ 1 0 680 -6.9622750743292272e-05 -1 -2 681
+ -6.4154611900448799e-03
+
+ -3.2716289162635803e-01 -5.0821667909622192e-01
+ 1.9543349742889404e-01
+ <_>
+
+ 0 1 682 -6.7164386564400047e-05 -1 -2 683
+ 2.2416690364480019e-02
+
+ 1.8602199852466583e-01 -3.9281991124153137e-01
+ 1.3279129564762115e-01
+ <_>
+
+ 1 0 684 8.4287580102682114e-03 -1 -2 685
+ -8.7357551092281938e-04
+
+ -5.5447560548782349e-01 4.7158730030059814e-01
+ -3.8492478430271149e-02
+ <_>
+
+ 1 0 686 -4.7496971092186868e-05 -1 -2 687
+ 4.5816078782081604e-03
+
+ -2.5197029113769531e-01 2.0250399410724640e-01
+ -6.1638081073760986e-01
+ <_>
+
+ 1 0 688 -1.1175150051712990e-02 -1 -2 689
+ -7.4238609522581100e-03
+
+ -2.7771198749542236e-01 -5.0103437900543213e-01
+ 1.9318529963493347e-01
+ <_>
+
+ 0 1 690 -3.0201480258256197e-03 -1 -2 691
+ -3.0343679245561361e-03
+
+ -6.5904247760772705e-01 3.1962481141090393e-01
+ -1.0512910038232803e-01
+ <_>
+
+ 0 1 692 -1.0971290059387684e-02 -1 -2 693
+ 1.2000739661743864e-04
+
+ 3.2707008719444275e-01 -4.1679269075393677e-01
+ 1.1645200103521347e-01
+ <_>
+
+ 1 0 694 2.1552699618041515e-03 -1 -2 695
+ 1.5970800304785371e-03
+
+ 1.5389390289783478e-01 -4.2979270219802856e-01
+ 1.9192950427532196e-01
+ <_>
+
+ 0 1 696 -4.3590939603745937e-03 -1 -2 697
+ -6.5752048976719379e-03
+
+ -8.6613738536834717e-01 3.5298541188240051e-01
+ -7.2624720633029938e-02
+ <_>
+
+ 1 0 698 3.5486191045492887e-03 -1 -2 699
+ 1.7437560018151999e-03
+
+ -3.6141040921211243e-01 -4.0250919759273529e-02
+ 4.1119590401649475e-01
+ <_>
+
+ 1 0 700 6.5892767452169210e-05 -1 -2 701
+ 1.2217169627547264e-02
+
+ 1.5523989498615265e-01 -3.6567229032516479e-01
+ 2.5159689784049988e-01
+ <_>
+
+ 1 0 702 6.0199309140443802e-02 -1 -2 703
+ -9.1684371232986450e-02
+
+ -6.8959599733352661e-01 -6.6311872005462646e-01
+ 9.4827361404895782e-02
+ <_>
+
+ 1 0 704 8.9392811059951782e-04 -1 -2 705
+ -1.1146500473842025e-03
+
+ 2.8731009364128113e-01 3.6127060651779175e-01
+ -2.4054229259490967e-01
+ <_>
+
+ 0 1 706 -1.1042780242860317e-02 -1 -2 707
+ 3.7769351154565811e-02
+
+ -7.1686691045761108e-01 1.1125349998474121e-01
+ -5.6320947408676147e-01
+ <_>
+
+ 1 0 708 5.5979429744184017e-03 -1 -2 709
+ -2.5462140329182148e-03
+
+ -5.6998908519744873e-01 2.6734578609466553e-01
+ -1.0527700185775757e-01
+ <_>
+
+ 0 1 710 -1.7929819878190756e-03 -1 -2 711
+ -8.9686378487385809e-05
+
+ 1.7712120711803436e-01 1.6762410104274750e-01
+ -4.1336658596992493e-01
+ <_>
+
+ 1 0 712 -6.8254990037530661e-04 -1 -2 713
+ 4.0599349886178970e-03
+
+ -3.1327050924301147e-01 2.0312629640102386e-01
+ -4.6360948681831360e-01
+ <_>
+
+ 1 0 714 1.5843180008232594e-03 -1 -2 715
+ -4.6101640909910202e-02
+
+ 2.6413089036941528e-01 2.4587640166282654e-01
+ -3.1151199340820312e-01
+ <_>
+
+ 1 0 716 1.5759950038045645e-03 -1 -2 717
+ 3.5904631018638611e-02
+
+ -3.6593970656394958e-01 -1.3352620415389538e-02
+ 4.9500739574432373e-01
+ <_>
+
+ 1 0 718 1.9230529665946960e-02 -1 -2 719
+ 1.3461830094456673e-02
+
+ 1.8603560328483582e-01 -4.2704311013221741e-01
+ 1.4756950736045837e-01
+ <_>
+
+ 1 0 720 6.3534970395267010e-03 -1 -2 721
+ 4.7998740337789059e-03
+
+ -5.8824592828750610e-01 1.3966129720211029e-01
+ -3.6948320269584656e-01
+ <_>
+
+ 0 1 722 -9.7894563805311918e-04 -1 -2 723
+ 1.8534340197220445e-03
+
+ 4.3156591057777405e-01 -1.9053110480308533e-01
+ 2.6868799328804016e-01
+ <_>
+
+ 1 0 724 5.5962381884455681e-04 -1 -2 725
+ -8.1787789240479469e-03
+
+ -3.0545750260353088e-01 -7.2353351116180420e-01
+ 1.6197769343852997e-01
+ <_>
+
+ 1 0 726 -6.4591833506710827e-05 -1 -2 727
+ -4.2282380163669586e-03
+
+ -1.6121749579906464e-01 4.2441681027412415e-01
+ -1.1488209664821625e-01
+ <_>
+
+ 0 1 728 -3.2379399053752422e-03 -1 -2 729
+ -4.7763898037374020e-03
+
+ -8.2811427116394043e-01 3.9157009124755859e-01
+ -3.7677429616451263e-02
+ <_>
+
+ 0 1 730 -6.1182728968560696e-03 -1 -2 731
+ 3.1565790995955467e-03
+
+ 3.0208829045295715e-01 -1.9045789539813995e-01
+ 3.0219689011573792e-01
+
+ <_>
+
+ <_>
+ 8 12 3 8 -1.
+ <_>
+ 8 16 3 4 2.
+ <_>
+
+ <_>
+ 5 11 8 9 -1.
+ <_>
+ 7 11 4 9 2.
+ <_>
+
+ <_>
+ 8 7 11 12 -1.
+ <_>
+ 8 11 11 4 3.
+ <_>
+
+ <_>
+ 1 0 7 8 -1.
+ <_>
+ 1 4 7 4 2.
+ <_>
+
+ <_>
+ 9 7 6 6 -1.
+ <_>
+ 7 9 6 2 3.
+ 1
+ <_>
+
+ <_>
+ 0 0 7 4 -1.
+ <_>
+ 0 2 7 2 2.
+ <_>
+
+ <_>
+ 16 13 4 4 -1.
+ <_>
+ 18 13 2 4 2.
+ <_>
+
+ <_>
+ 17 15 2 3 -1.
+ <_>
+ 17 15 1 3 2.
+ 1
+ <_>
+
+ <_>
+ 0 13 6 2 -1.
+ <_>
+ 2 13 2 2 3.
+ <_>
+
+ <_>
+ 5 0 6 6 -1.
+ <_>
+ 7 0 2 6 3.
+ <_>
+
+ <_>
+ 5 7 9 12 -1.
+ <_>
+ 8 11 3 4 9.
+ <_>
+
+ <_>
+ 5 6 4 10 -1.
+ <_>
+ 5 6 2 5 2.
+ <_>
+ 7 11 2 5 2.
+ <_>
+
+ <_>
+ 8 12 11 8 -1.
+ <_>
+ 8 16 11 4 2.
+ <_>
+
+ <_>
+ 0 0 1 8 -1.
+ <_>
+ 0 4 1 4 2.
+ <_>
+
+ <_>
+ 0 0 6 6 -1.
+ <_>
+ 3 0 3 6 2.
+ <_>
+
+ <_>
+ 14 14 6 6 -1.
+ <_>
+ 14 17 6 3 2.
+ <_>
+
+ <_>
+ 5 13 9 7 -1.
+ <_>
+ 8 13 3 7 3.
+ <_>
+
+ <_>
+ 6 17 6 3 -1.
+ <_>
+ 8 17 2 3 3.
+ <_>
+
+ <_>
+ 0 0 4 4 -1.
+ <_>
+ 0 2 4 2 2.
+ <_>
+
+ <_>
+ 1 0 3 3 -1.
+ <_>
+ 2 1 1 1 9.
+ <_>
+
+ <_>
+ 3 18 6 2 -1.
+ <_>
+ 3 19 6 1 2.
+ <_>
+
+ <_>
+ 7 18 4 2 -1.
+ <_>
+ 8 18 2 2 2.
+ <_>
+
+ <_>
+ 6 10 12 2 -1.
+ <_>
+ 6 11 12 1 2.
+ <_>
+
+ <_>
+ 15 8 3 1 -1.
+ <_>
+ 16 9 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 7 9 12 -1.
+ <_>
+ 8 11 3 4 9.
+ <_>
+
+ <_>
+ 16 13 1 6 -1.
+ <_>
+ 16 16 1 3 2.
+ <_>
+
+ <_>
+ 9 7 5 6 -1.
+ <_>
+ 7 9 5 2 3.
+ 1
+ <_>
+
+ <_>
+ 16 12 4 6 -1.
+ <_>
+ 18 12 2 6 2.
+ <_>
+
+ <_>
+ 0 0 6 8 -1.
+ <_>
+ 0 4 6 4 2.
+ <_>
+
+ <_>
+ 3 1 15 12 -1.
+ <_>
+ 3 5 15 4 3.
+ <_>
+
+ <_>
+ 11 12 9 8 -1.
+ <_>
+ 11 16 9 4 2.
+ <_>
+
+ <_>
+ 0 0 12 9 -1.
+ <_>
+ 4 0 4 9 3.
+ <_>
+
+ <_>
+ 0 12 6 4 -1.
+ <_>
+ 2 12 2 4 3.
+ <_>
+
+ <_>
+ 10 18 4 2 -1.
+ <_>
+ 11 18 2 2 2.
+ <_>
+
+ <_>
+ 5 2 3 3 -1.
+ <_>
+ 6 2 1 3 3.
+ <_>
+
+ <_>
+ 12 18 3 2 -1.
+ <_>
+ 13 18 1 2 3.
+ <_>
+
+ <_>
+ 0 0 2 8 -1.
+ <_>
+ 1 0 1 8 2.
+ <_>
+
+ <_>
+ 5 18 4 2 -1.
+ <_>
+ 5 19 4 1 2.
+ <_>
+
+ <_>
+ 14 11 6 6 -1.
+ <_>
+ 17 11 3 6 2.
+ <_>
+
+ <_>
+ 6 12 8 4 -1.
+ <_>
+ 8 12 4 4 2.
+ <_>
+
+ <_>
+ 12 6 4 9 -1.
+ <_>
+ 9 9 4 3 3.
+ 1
+ <_>
+
+ <_>
+ 11 9 4 7 -1.
+ <_>
+ 12 10 2 7 2.
+ 1
+ <_>
+
+ <_>
+ 5 8 4 8 -1.
+ <_>
+ 5 8 2 4 2.
+ <_>
+ 7 12 2 4 2.
+ <_>
+
+ <_>
+ 8 12 11 8 -1.
+ <_>
+ 8 16 11 4 2.
+ <_>
+
+ <_>
+ 3 0 14 6 -1.
+ <_>
+ 3 3 14 3 2.
+ <_>
+
+ <_>
+ 7 1 6 12 -1.
+ <_>
+ 7 4 6 6 2.
+ <_>
+
+ <_>
+ 0 18 7 2 -1.
+ <_>
+ 0 19 7 1 2.
+ <_>
+
+ <_>
+ 16 12 4 3 -1.
+ <_>
+ 18 12 2 3 2.
+ <_>
+
+ <_>
+ 0 0 4 8 -1.
+ <_>
+ 2 0 2 8 2.
+ <_>
+
+ <_>
+ 3 0 4 1 -1.
+ <_>
+ 5 0 2 1 2.
+ <_>
+
+ <_>
+ 3 13 2 2 -1.
+ <_>
+ 3 13 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 0 16 19 4 -1.
+ <_>
+ 0 18 19 2 2.
+ <_>
+
+ <_>
+ 7 13 8 2 -1.
+ <_>
+ 11 13 4 2 2.
+ <_>
+
+ <_>
+ 8 8 4 1 -1.
+ <_>
+ 9 8 2 1 2.
+ <_>
+
+ <_>
+ 0 1 1 4 -1.
+ <_>
+ 0 3 1 2 2.
+ <_>
+
+ <_>
+ 0 0 1 4 -1.
+ <_>
+ 0 1 1 2 2.
+ <_>
+
+ <_>
+ 15 15 5 2 -1.
+ <_>
+ 15 16 5 1 2.
+ <_>
+
+ <_>
+ 7 18 3 2 -1.
+ <_>
+ 8 18 1 2 3.
+ <_>
+
+ <_>
+ 13 7 3 8 -1.
+ <_>
+ 11 9 3 4 2.
+ 1
+ <_>
+
+ <_>
+ 15 12 2 8 -1.
+ <_>
+ 15 16 2 4 2.
+ <_>
+
+ <_>
+ 2 0 10 6 -1.
+ <_>
+ 2 3 10 3 2.
+ <_>
+
+ <_>
+ 0 5 18 15 -1.
+ <_>
+ 6 10 6 5 9.
+ <_>
+
+ <_>
+ 3 11 12 6 -1.
+ <_>
+ 7 13 4 2 9.
+ <_>
+
+ <_>
+ 16 12 4 7 -1.
+ <_>
+ 18 12 2 7 2.
+ <_>
+
+ <_>
+ 8 18 4 2 -1.
+ <_>
+ 9 18 2 2 2.
+ <_>
+
+ <_>
+ 8 17 4 3 -1.
+ <_>
+ 9 17 2 3 2.
+ <_>
+
+ <_>
+ 0 12 6 6 -1.
+ <_>
+ 2 12 2 6 3.
+ <_>
+
+ <_>
+ 4 16 4 4 -1.
+ <_>
+ 5 16 2 4 2.
+ <_>
+
+ <_>
+ 3 0 4 6 -1.
+ <_>
+ 4 0 2 6 2.
+ <_>
+
+ <_>
+ 1 0 4 7 -1.
+ <_>
+ 2 0 2 7 2.
+ <_>
+
+ <_>
+ 2 0 8 3 -1.
+ <_>
+ 6 0 4 3 2.
+ <_>
+
+ <_>
+ 8 3 4 6 -1.
+ <_>
+ 9 3 2 6 2.
+ <_>
+
+ <_>
+ 10 10 3 2 -1.
+ <_>
+ 10 11 3 1 2.
+ <_>
+
+ <_>
+ 4 3 7 6 -1.
+ <_>
+ 4 6 7 3 2.
+ <_>
+
+ <_>
+ 10 18 10 2 -1.
+ <_>
+ 15 18 5 2 2.
+ <_>
+
+ <_>
+ 9 13 6 1 -1.
+ <_>
+ 9 13 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 10 8 4 6 -1.
+ <_>
+ 8 10 4 2 3.
+ 1
+ <_>
+
+ <_>
+ 14 12 6 8 -1.
+ <_>
+ 14 16 6 4 2.
+ <_>
+
+ <_>
+ 10 8 6 4 -1.
+ <_>
+ 12 10 2 4 3.
+ 1
+ <_>
+
+ <_>
+ 0 12 6 3 -1.
+ <_>
+ 2 12 2 3 3.
+ <_>
+
+ <_>
+ 18 11 2 6 -1.
+ <_>
+ 19 11 1 6 2.
+ <_>
+
+ <_>
+ 0 0 1 10 -1.
+ <_>
+ 0 5 1 5 2.
+ <_>
+
+ <_>
+ 5 4 8 12 -1.
+ <_>
+ 7 4 4 12 2.
+ <_>
+
+ <_>
+ 1 3 9 8 -1.
+ <_>
+ 4 3 3 8 3.
+ <_>
+
+ <_>
+ 0 0 2 2 -1.
+ <_>
+ 0 1 2 1 2.
+ <_>
+
+ <_>
+ 12 8 6 12 -1.
+ <_>
+ 14 12 2 4 9.
+ <_>
+
+ <_>
+ 4 2 14 6 -1.
+ <_>
+ 4 4 14 2 3.
+ <_>
+
+ <_>
+ 3 0 12 8 -1.
+ <_>
+ 3 4 12 4 2.
+ <_>
+
+ <_>
+ 0 0 17 20 -1.
+ <_>
+ 0 5 17 10 2.
+ <_>
+
+ <_>
+ 4 0 13 6 -1.
+ <_>
+ 4 2 13 2 3.
+ <_>
+
+ <_>
+ 2 10 3 6 -1.
+ <_>
+ 3 10 1 6 3.
+ <_>
+
+ <_>
+ 4 14 6 4 -1.
+ <_>
+ 4 14 3 2 2.
+ <_>
+ 7 16 3 2 2.
+ <_>
+
+ <_>
+ 8 1 6 8 -1.
+ <_>
+ 10 1 2 8 3.
+ <_>
+
+ <_>
+ 0 1 2 6 -1.
+ <_>
+ 1 1 1 6 2.
+ <_>
+
+ <_>
+ 8 12 1 3 -1.
+ <_>
+ 7 13 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 4 8 4 -1.
+ <_>
+ 5 4 8 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 2 4 5 -1.
+ <_>
+ 1 2 2 5 2.
+ <_>
+
+ <_>
+ 5 12 3 2 -1.
+ <_>
+ 6 12 1 2 3.
+ <_>
+
+ <_>
+ 5 13 8 2 -1.
+ <_>
+ 7 13 4 2 2.
+ <_>
+
+ <_>
+ 11 9 9 8 -1.
+ <_>
+ 11 11 9 4 2.
+ <_>
+
+ <_>
+ 16 12 4 3 -1.
+ <_>
+ 18 12 2 3 2.
+ <_>
+
+ <_>
+ 16 14 4 6 -1.
+ <_>
+ 16 17 4 3 2.
+ <_>
+
+ <_>
+ 0 12 6 3 -1.
+ <_>
+ 2 12 2 3 3.
+ <_>
+
+ <_>
+ 8 6 7 6 -1.
+ <_>
+ 6 8 7 2 3.
+ 1
+ <_>
+
+ <_>
+ 0 0 1 6 -1.
+ <_>
+ 0 3 1 3 2.
+ <_>
+
+ <_>
+ 0 2 15 5 -1.
+ <_>
+ 5 2 5 5 3.
+ <_>
+
+ <_>
+ 8 11 10 3 -1.
+ <_>
+ 13 11 5 3 2.
+ <_>
+
+ <_>
+ 8 11 2 8 -1.
+ <_>
+ 8 15 2 4 2.
+ <_>
+
+ <_>
+ 0 1 2 6 -1.
+ <_>
+ 1 1 1 6 2.
+ <_>
+
+ <_>
+ 0 1 4 4 -1.
+ <_>
+ 1 1 2 4 2.
+ <_>
+
+ <_>
+ 5 16 3 1 -1.
+ <_>
+ 6 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 0 7 15 -1.
+ <_>
+ 5 5 7 5 3.
+ <_>
+
+ <_>
+ 17 0 3 2 -1.
+ <_>
+ 18 1 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 4 18 6 2 -1.
+ <_>
+ 6 18 2 2 3.
+ <_>
+
+ <_>
+ 7 1 4 5 -1.
+ <_>
+ 7 1 2 5 2.
+ 1
+ <_>
+
+ <_>
+ 14 0 6 8 -1.
+ <_>
+ 14 0 3 4 2.
+ <_>
+ 17 4 3 4 2.
+ <_>
+
+ <_>
+ 5 2 4 18 -1.
+ <_>
+ 5 2 2 9 2.
+ <_>
+ 7 11 2 9 2.
+ <_>
+
+ <_>
+ 7 18 6 2 -1.
+ <_>
+ 9 18 2 2 3.
+ <_>
+
+ <_>
+ 10 8 2 3 -1.
+ <_>
+ 10 9 2 1 3.
+ <_>
+
+ <_>
+ 10 10 4 2 -1.
+ <_>
+ 10 10 2 1 2.
+ <_>
+ 12 11 2 1 2.
+ <_>
+
+ <_>
+ 4 2 12 6 -1.
+ <_>
+ 4 4 12 2 3.
+ <_>
+
+ <_>
+ 5 1 12 8 -1.
+ <_>
+ 5 3 12 4 2.
+ <_>
+
+ <_>
+ 2 18 4 2 -1.
+ <_>
+ 2 19 4 1 2.
+ <_>
+
+ <_>
+ 0 18 8 1 -1.
+ <_>
+ 4 18 4 1 2.
+ <_>
+
+ <_>
+ 4 7 12 12 -1.
+ <_>
+ 8 11 4 4 9.
+ <_>
+
+ <_>
+ 16 11 4 6 -1.
+ <_>
+ 18 11 2 6 2.
+ <_>
+
+ <_>
+ 6 13 6 7 -1.
+ <_>
+ 8 13 2 7 3.
+ <_>
+
+ <_>
+ 0 0 1 8 -1.
+ <_>
+ 0 4 1 4 2.
+ <_>
+
+ <_>
+ 15 14 5 6 -1.
+ <_>
+ 15 17 5 3 2.
+ <_>
+
+ <_>
+ 0 7 6 9 -1.
+ <_>
+ 2 7 2 9 3.
+ <_>
+
+ <_>
+ 15 11 4 1 -1.
+ <_>
+ 16 12 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 11 11 8 2 -1.
+ <_>
+ 15 11 4 2 2.
+ <_>
+
+ <_>
+ 0 1 12 11 -1.
+ <_>
+ 3 1 6 11 2.
+ <_>
+
+ <_>
+ 8 8 6 4 -1.
+ <_>
+ 7 9 6 2 2.
+ 1
+ <_>
+
+ <_>
+ 6 17 6 3 -1.
+ <_>
+ 8 17 2 3 3.
+ <_>
+
+ <_>
+ 0 0 1 4 -1.
+ <_>
+ 0 2 1 2 2.
+ <_>
+
+ <_>
+ 3 1 1 3 -1.
+ <_>
+ 2 2 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 18 11 2 3 -1.
+ <_>
+ 18 12 2 1 3.
+ <_>
+
+ <_>
+ 3 12 2 8 -1.
+ <_>
+ 3 12 1 4 2.
+ <_>
+ 4 16 1 4 2.
+ <_>
+
+ <_>
+ 3 12 3 3 -1.
+ <_>
+ 4 12 1 3 3.
+ <_>
+
+ <_>
+ 11 18 4 2 -1.
+ <_>
+ 12 18 2 2 2.
+ <_>
+
+ <_>
+ 17 10 3 3 -1.
+ <_>
+ 17 11 3 1 3.
+ <_>
+
+ <_>
+ 7 14 5 2 -1.
+ <_>
+ 7 15 5 1 2.
+ <_>
+
+ <_>
+ 6 0 4 5 -1.
+ <_>
+ 6 0 2 5 2.
+ 1
+ <_>
+
+ <_>
+ 6 1 5 8 -1.
+ <_>
+ 6 5 5 4 2.
+ <_>
+
+ <_>
+ 3 1 9 8 -1.
+ <_>
+ 3 5 9 4 2.
+ <_>
+
+ <_>
+ 2 14 15 6 -1.
+ <_>
+ 7 14 5 6 3.
+ <_>
+
+ <_>
+ 12 3 6 5 -1.
+ <_>
+ 14 3 2 5 3.
+ <_>
+
+ <_>
+ 5 16 2 2 -1.
+ <_>
+ 5 16 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 5 16 2 2 -1.
+ <_>
+ 5 16 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 9 8 6 4 -1.
+ <_>
+ 11 10 2 4 3.
+ 1
+ <_>
+
+ <_>
+ 4 11 3 4 -1.
+ <_>
+ 4 13 3 2 2.
+ <_>
+
+ <_>
+ 13 8 6 12 -1.
+ <_>
+ 15 12 2 4 9.
+ <_>
+
+ <_>
+ 0 0 1 10 -1.
+ <_>
+ 0 5 1 5 2.
+ <_>
+
+ <_>
+ 0 12 6 4 -1.
+ <_>
+ 2 12 2 4 3.
+ <_>
+
+ <_>
+ 7 5 8 6 -1.
+ <_>
+ 5 7 8 2 3.
+ 1
+ <_>
+
+ <_>
+ 3 1 16 4 -1.
+ <_>
+ 3 3 16 2 2.
+ <_>
+
+ <_>
+ 6 2 10 9 -1.
+ <_>
+ 6 5 10 3 3.
+ <_>
+
+ <_>
+ 14 10 6 10 -1.
+ <_>
+ 17 10 3 10 2.
+ <_>
+
+ <_>
+ 5 17 4 3 -1.
+ <_>
+ 6 17 2 3 2.
+ <_>
+
+ <_>
+ 5 12 3 2 -1.
+ <_>
+ 6 12 1 2 3.
+ <_>
+
+ <_>
+ 5 12 3 2 -1.
+ <_>
+ 6 12 1 2 3.
+ <_>
+
+ <_>
+ 0 0 2 9 -1.
+ <_>
+ 1 0 1 9 2.
+ <_>
+
+ <_>
+ 2 6 3 2 -1.
+ <_>
+ 2 6 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 7 16 6 3 -1.
+ <_>
+ 9 16 2 3 3.
+ <_>
+
+ <_>
+ 7 17 6 2 -1.
+ <_>
+ 9 17 2 2 3.
+ <_>
+
+ <_>
+ 6 3 9 6 -1.
+ <_>
+ 4 5 9 2 3.
+ 1
+ <_>
+
+ <_>
+ 6 15 3 2 -1.
+ <_>
+ 7 16 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 6 2 3 3 -1.
+ <_>
+ 7 2 1 3 3.
+ <_>
+
+ <_>
+ 2 1 6 4 -1.
+ <_>
+ 4 1 2 4 3.
+ <_>
+
+ <_>
+ 13 11 4 2 -1.
+ <_>
+ 13 11 2 1 2.
+ <_>
+ 15 12 2 1 2.
+ <_>
+
+ <_>
+ 14 10 2 2 -1.
+ <_>
+ 14 10 1 1 2.
+ <_>
+ 15 11 1 1 2.
+ <_>
+
+ <_>
+ 17 7 3 3 -1.
+ <_>
+ 18 8 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 17 7 3 2 -1.
+ <_>
+ 18 8 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 0 3 1 2 -1.
+ <_>
+ 0 4 1 1 2.
+ <_>
+
+ <_>
+ 10 1 2 5 -1.
+ <_>
+ 11 1 1 5 2.
+ <_>
+
+ <_>
+ 1 8 3 12 -1.
+ <_>
+ 1 11 3 6 2.
+ <_>
+
+ <_>
+ 2 10 8 2 -1.
+ <_>
+ 2 10 4 2 2.
+ 1
+ <_>
+
+ <_>
+ 6 12 3 3 -1.
+ <_>
+ 7 13 1 1 9.
+ <_>
+
+ <_>
+ 6 11 3 4 -1.
+ <_>
+ 7 11 1 4 3.
+ <_>
+
+ <_>
+ 5 17 4 2 -1.
+ <_>
+ 6 17 2 2 2.
+ <_>
+
+ <_>
+ 0 19 20 1 -1.
+ <_>
+ 10 19 10 1 2.
+ <_>
+
+ <_>
+ 5 11 8 5 -1.
+ <_>
+ 7 11 4 5 2.
+ <_>
+
+ <_>
+ 10 8 8 9 -1.
+ <_>
+ 10 11 8 3 3.
+ <_>
+
+ <_>
+ 0 13 6 2 -1.
+ <_>
+ 2 13 2 2 3.
+ <_>
+
+ <_>
+ 18 14 2 1 -1.
+ <_>
+ 18 14 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 1 2 2 4 -1.
+ <_>
+ 2 2 1 4 2.
+ <_>
+
+ <_>
+ 5 5 8 5 -1.
+ <_>
+ 9 5 4 5 2.
+ <_>
+
+ <_>
+ 7 13 5 4 -1.
+ <_>
+ 7 15 5 2 2.
+ <_>
+
+ <_>
+ 17 18 3 2 -1.
+ <_>
+ 17 19 3 1 2.
+ <_>
+
+ <_>
+ 0 2 1 2 -1.
+ <_>
+ 0 3 1 1 2.
+ <_>
+
+ <_>
+ 3 0 1 3 -1.
+ <_>
+ 2 1 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 10 11 3 4 -1.
+ <_>
+ 11 11 1 4 3.
+ <_>
+
+ <_>
+ 14 11 4 8 -1.
+ <_>
+ 16 11 2 8 2.
+ <_>
+
+ <_>
+ 2 2 9 6 -1.
+ <_>
+ 2 5 9 3 2.
+ <_>
+
+ <_>
+ 0 4 17 8 -1.
+ <_>
+ 0 6 17 4 2.
+ <_>
+
+ <_>
+ 15 17 5 3 -1.
+ <_>
+ 15 18 5 1 3.
+ <_>
+
+ <_>
+ 2 11 2 8 -1.
+ <_>
+ 2 15 2 4 2.
+ <_>
+
+ <_>
+ 3 12 3 3 -1.
+ <_>
+ 4 12 1 3 3.
+ <_>
+
+ <_>
+ 3 12 9 7 -1.
+ <_>
+ 6 12 3 7 3.
+ <_>
+
+ <_>
+ 13 1 4 7 -1.
+ <_>
+ 14 1 2 7 2.
+ <_>
+
+ <_>
+ 3 16 2 2 -1.
+ <_>
+ 3 16 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 3 17 2 1 -1.
+ <_>
+ 3 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 4 9 6 6 -1.
+ <_>
+ 4 9 3 3 2.
+ <_>
+ 7 12 3 3 2.
+ <_>
+
+ <_>
+ 11 13 3 1 -1.
+ <_>
+ 12 13 1 1 3.
+ <_>
+
+ <_>
+ 0 0 20 3 -1.
+ <_>
+ 5 0 10 3 2.
+ <_>
+
+ <_>
+ 0 0 1 2 -1.
+ <_>
+ 0 1 1 1 2.
+ <_>
+
+ <_>
+ 17 0 3 1 -1.
+ <_>
+ 18 1 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 4 0 8 9 -1.
+ <_>
+ 4 3 8 3 3.
+ <_>
+
+ <_>
+ 6 0 6 4 -1.
+ <_>
+ 6 2 6 2 2.
+ <_>
+
+ <_>
+ 18 0 2 1 -1.
+ <_>
+ 18 0 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 14 2 6 1 -1.
+ <_>
+ 17 2 3 1 2.
+ <_>
+
+ <_>
+ 5 13 8 2 -1.
+ <_>
+ 7 13 4 2 2.
+ <_>
+
+ <_>
+ 15 12 3 8 -1.
+ <_>
+ 15 16 3 4 2.
+ <_>
+
+ <_>
+ 5 10 8 3 -1.
+ <_>
+ 5 11 8 1 3.
+ <_>
+
+ <_>
+ 5 0 11 9 -1.
+ <_>
+ 5 3 11 3 3.
+ <_>
+
+ <_>
+ 18 14 2 2 -1.
+ <_>
+ 19 14 1 2 2.
+ <_>
+
+ <_>
+ 1 3 9 8 -1.
+ <_>
+ 4 3 3 8 3.
+ <_>
+
+ <_>
+ 3 6 2 3 -1.
+ <_>
+ 2 7 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 6 2 3 -1.
+ <_>
+ 2 7 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 17 7 1 12 -1.
+ <_>
+ 13 11 1 4 3.
+ 1
+ <_>
+
+ <_>
+ 0 0 1 15 -1.
+ <_>
+ 0 5 1 5 3.
+ <_>
+
+ <_>
+ 6 9 6 3 -1.
+ <_>
+ 6 10 6 1 3.
+ <_>
+
+ <_>
+ 3 18 3 2 -1.
+ <_>
+ 3 19 3 1 2.
+ <_>
+
+ <_>
+ 16 17 4 3 -1.
+ <_>
+ 16 18 4 1 3.
+ <_>
+
+ <_>
+ 10 17 4 3 -1.
+ <_>
+ 11 17 2 3 2.
+ <_>
+
+ <_>
+ 13 13 4 3 -1.
+ <_>
+ 14 13 2 3 2.
+ <_>
+
+ <_>
+ 4 15 3 2 -1.
+ <_>
+ 5 16 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 0 4 2 2 -1.
+ <_>
+ 1 4 1 2 2.
+ <_>
+
+ <_>
+ 4 0 2 5 -1.
+ <_>
+ 5 0 1 5 2.
+ <_>
+
+ <_>
+ 1 9 3 8 -1.
+ <_>
+ 1 11 3 4 2.
+ <_>
+
+ <_>
+ 5 8 1 3 -1.
+ <_>
+ 4 9 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 4 13 2 1 -1.
+ <_>
+ 5 13 1 1 2.
+ <_>
+
+ <_>
+ 9 11 4 9 -1.
+ <_>
+ 11 11 2 9 2.
+ <_>
+
+ <_>
+ 0 1 1 2 -1.
+ <_>
+ 0 2 1 1 2.
+ <_>
+
+ <_>
+ 0 0 1 3 -1.
+ <_>
+ 0 1 1 1 3.
+ <_>
+
+ <_>
+ 12 11 1 4 -1.
+ <_>
+ 12 12 1 2 2.
+ <_>
+
+ <_>
+ 16 10 3 3 -1.
+ <_>
+ 15 11 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 18 12 1 6 -1.
+ <_>
+ 18 12 1 3 2.
+ 1
+ <_>
+
+ <_>
+ 4 17 3 2 -1.
+ <_>
+ 5 17 1 2 3.
+ <_>
+
+ <_>
+ 17 7 3 2 -1.
+ <_>
+ 18 8 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 18 9 2 1 -1.
+ <_>
+ 18 9 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 8 11 4 5 -1.
+ <_>
+ 9 12 2 5 2.
+ 1
+ <_>
+
+ <_>
+ 7 1 2 7 -1.
+ <_>
+ 8 1 1 7 2.
+ <_>
+
+ <_>
+ 4 4 14 6 -1.
+ <_>
+ 4 6 14 2 3.
+ <_>
+
+ <_>
+ 2 2 11 6 -1.
+ <_>
+ 2 5 11 3 2.
+ <_>
+
+ <_>
+ 18 16 2 2 -1.
+ <_>
+ 18 17 2 1 2.
+ <_>
+
+ <_>
+ 17 11 2 6 -1.
+ <_>
+ 18 11 1 6 2.
+ <_>
+
+ <_>
+ 17 0 3 3 -1.
+ <_>
+ 18 1 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 18 0 2 6 -1.
+ <_>
+ 18 3 2 3 2.
+ <_>
+
+ <_>
+ 4 7 6 8 -1.
+ <_>
+ 4 7 3 4 2.
+ <_>
+ 7 11 3 4 2.
+ <_>
+
+ <_>
+ 11 11 4 2 -1.
+ <_>
+ 11 11 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 0 6 7 -1.
+ <_>
+ 3 0 3 7 2.
+ <_>
+
+ <_>
+ 15 10 5 8 -1.
+ <_>
+ 15 12 5 4 2.
+ <_>
+
+ <_>
+ 2 10 3 8 -1.
+ <_>
+ 3 10 1 8 3.
+ <_>
+
+ <_>
+ 9 7 6 6 -1.
+ <_>
+ 7 9 6 2 3.
+ 1
+ <_>
+
+ <_>
+ 4 1 6 6 -1.
+ <_>
+ 4 4 6 3 2.
+ <_>
+
+ <_>
+ 4 0 16 2 -1.
+ <_>
+ 4 1 16 1 2.
+ <_>
+
+ <_>
+ 14 8 6 6 -1.
+ <_>
+ 14 8 3 3 2.
+ <_>
+ 17 11 3 3 2.
+ <_>
+
+ <_>
+ 4 12 2 8 -1.
+ <_>
+ 4 12 1 4 2.
+ <_>
+ 5 16 1 4 2.
+ <_>
+
+ <_>
+ 0 18 7 2 -1.
+ <_>
+ 0 19 7 1 2.
+ <_>
+
+ <_>
+ 9 13 1 4 -1.
+ <_>
+ 9 15 1 2 2.
+ <_>
+
+ <_>
+ 18 10 2 8 -1.
+ <_>
+ 19 10 1 8 2.
+ <_>
+
+ <_>
+ 6 0 4 8 -1.
+ <_>
+ 7 0 2 8 2.
+ <_>
+
+ <_>
+ 1 2 6 6 -1.
+ <_>
+ 3 2 2 6 3.
+ <_>
+
+ <_>
+ 10 10 8 2 -1.
+ <_>
+ 10 10 4 1 2.
+ <_>
+ 14 11 4 1 2.
+ <_>
+
+ <_>
+ 3 9 2 3 -1.
+ <_>
+ 2 10 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 1 13 6 -1.
+ <_>
+ 5 3 13 2 3.
+ <_>
+
+ <_>
+ 4 4 13 6 -1.
+ <_>
+ 4 6 13 2 3.
+ <_>
+
+ <_>
+ 8 1 4 5 -1.
+ <_>
+ 8 1 2 5 2.
+ 1
+ <_>
+
+ <_>
+ 7 7 2 1 -1.
+ <_>
+ 8 7 1 1 2.
+ <_>
+
+ <_>
+ 5 5 4 4 -1.
+ <_>
+ 6 5 2 4 2.
+ <_>
+
+ <_>
+ 14 12 4 2 -1.
+ <_>
+ 14 12 2 1 2.
+ <_>
+ 16 13 2 1 2.
+ <_>
+
+ <_>
+ 13 11 4 2 -1.
+ <_>
+ 13 11 2 1 2.
+ <_>
+ 15 12 2 1 2.
+ <_>
+
+ <_>
+ 16 10 4 3 -1.
+ <_>
+ 16 11 4 1 3.
+ <_>
+
+ <_>
+ 10 0 4 5 -1.
+ <_>
+ 11 0 2 5 2.
+ <_>
+
+ <_>
+ 8 11 1 3 -1.
+ <_>
+ 7 12 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 6 12 3 2 -1.
+ <_>
+ 7 12 1 2 3.
+ <_>
+
+ <_>
+ 17 8 2 3 -1.
+ <_>
+ 17 8 1 3 2.
+ 1
+ <_>
+
+ <_>
+ 11 0 6 5 -1.
+ <_>
+ 13 0 2 5 3.
+ <_>
+
+ <_>
+ 0 0 3 3 -1.
+ <_>
+ 0 1 3 1 3.
+ <_>
+
+ <_>
+ 2 0 1 2 -1.
+ <_>
+ 2 1 1 1 2.
+ <_>
+
+ <_>
+ 13 11 7 2 -1.
+ <_>
+ 13 12 7 1 2.
+ <_>
+
+ <_>
+ 17 8 3 3 -1.
+ <_>
+ 18 9 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 15 15 1 3 -1.
+ <_>
+ 14 16 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 6 13 6 2 -1.
+ <_>
+ 8 13 2 2 3.
+ <_>
+
+ <_>
+ 8 10 3 4 -1.
+ <_>
+ 9 10 1 4 3.
+ <_>
+
+ <_>
+ 7 0 12 19 -1.
+ <_>
+ 13 0 6 19 2.
+ <_>
+
+ <_>
+ 12 16 8 4 -1.
+ <_>
+ 12 18 8 2 2.
+ <_>
+
+ <_>
+ 8 5 12 2 -1.
+ <_>
+ 14 5 6 2 2.
+ <_>
+
+ <_>
+ 10 8 6 4 -1.
+ <_>
+ 12 10 2 4 3.
+ 1
+ <_>
+
+ <_>
+ 4 11 3 4 -1.
+ <_>
+ 4 13 3 2 2.
+ <_>
+
+ <_>
+ 0 2 12 7 -1.
+ <_>
+ 3 2 6 7 2.
+ <_>
+
+ <_>
+ 8 0 4 2 -1.
+ <_>
+ 8 0 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 13 11 6 6 -1.
+ <_>
+ 15 13 2 2 9.
+ <_>
+
+ <_>
+ 7 11 10 4 -1.
+ <_>
+ 12 11 5 4 2.
+ <_>
+
+ <_>
+ 1 11 4 5 -1.
+ <_>
+ 2 11 2 5 2.
+ <_>
+
+ <_>
+ 2 14 4 2 -1.
+ <_>
+ 3 15 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 0 1 6 -1.
+ <_>
+ 0 3 1 3 2.
+ <_>
+
+ <_>
+ 6 2 6 6 -1.
+ <_>
+ 6 5 6 3 2.
+ <_>
+
+ <_>
+ 6 18 4 2 -1.
+ <_>
+ 7 18 2 2 2.
+ <_>
+
+ <_>
+ 6 18 4 2 -1.
+ <_>
+ 7 18 2 2 2.
+ <_>
+
+ <_>
+ 4 4 7 4 -1.
+ <_>
+ 3 5 7 2 2.
+ 1
+ <_>
+
+ <_>
+ 5 8 8 12 -1.
+ <_>
+ 7 8 4 12 2.
+ <_>
+
+ <_>
+ 5 17 2 1 -1.
+ <_>
+ 5 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 4 18 2 1 -1.
+ <_>
+ 5 18 1 1 2.
+ <_>
+
+ <_>
+ 13 16 7 2 -1.
+ <_>
+ 13 17 7 1 2.
+ <_>
+
+ <_>
+ 7 15 2 3 -1.
+ <_>
+ 7 15 1 3 2.
+ 1
+ <_>
+
+ <_>
+ 9 2 4 5 -1.
+ <_>
+ 10 2 2 5 2.
+ <_>
+
+ <_>
+ 7 2 4 6 -1.
+ <_>
+ 8 2 2 6 2.
+ <_>
+
+ <_>
+ 3 12 3 3 -1.
+ <_>
+ 4 12 1 3 3.
+ <_>
+
+ <_>
+ 5 12 3 3 -1.
+ <_>
+ 6 13 1 1 9.
+ <_>
+
+ <_>
+ 4 12 3 2 -1.
+ <_>
+ 5 12 1 2 3.
+ <_>
+
+ <_>
+ 10 13 3 1 -1.
+ <_>
+ 11 13 1 1 3.
+ <_>
+
+ <_>
+ 11 5 4 3 -1.
+ <_>
+ 12 5 2 3 2.
+ <_>
+
+ <_>
+ 19 7 1 10 -1.
+ <_>
+ 19 12 1 5 2.
+ <_>
+
+ <_>
+ 4 8 2 3 -1.
+ <_>
+ 3 9 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 7 0 6 5 -1.
+ <_>
+ 9 0 2 5 3.
+ <_>
+
+ <_>
+ 5 0 6 2 -1.
+ <_>
+ 5 0 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 5 0 13 9 -1.
+ <_>
+ 5 3 13 3 3.
+ <_>
+
+ <_>
+ 0 6 1 2 -1.
+ <_>
+ 0 7 1 1 2.
+ <_>
+
+ <_>
+ 1 0 16 6 -1.
+ <_>
+ 1 2 16 2 3.
+ <_>
+
+ <_>
+ 18 0 2 4 -1.
+ <_>
+ 18 0 1 4 2.
+ 1
+ <_>
+
+ <_>
+ 4 13 2 2 -1.
+ <_>
+ 4 13 1 1 2.
+ <_>
+ 5 14 1 1 2.
+ <_>
+
+ <_>
+ 0 3 4 1 -1.
+ <_>
+ 2 3 2 1 2.
+ <_>
+
+ <_>
+ 3 0 8 12 -1.
+ <_>
+ 3 6 8 6 2.
+ <_>
+
+ <_>
+ 12 13 4 1 -1.
+ <_>
+ 13 13 2 1 2.
+ <_>
+
+ <_>
+ 12 12 2 2 -1.
+ <_>
+ 12 12 1 1 2.
+ <_>
+ 13 13 1 1 2.
+ <_>
+
+ <_>
+ 5 16 3 1 -1.
+ <_>
+ 6 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 13 8 4 -1.
+ <_>
+ 3 13 4 2 2.
+ <_>
+ 7 15 4 2 2.
+ <_>
+
+ <_>
+ 0 8 18 3 -1.
+ <_>
+ 6 9 6 1 9.
+ <_>
+
+ <_>
+ 8 4 6 5 -1.
+ <_>
+ 11 4 3 5 2.
+ <_>
+
+ <_>
+ 5 14 9 1 -1.
+ <_>
+ 8 14 3 1 3.
+ <_>
+
+ <_>
+ 4 0 4 4 -1.
+ <_>
+ 4 0 2 4 2.
+ 1
+ <_>
+
+ <_>
+ 7 9 12 8 -1.
+ <_>
+ 7 11 12 4 2.
+ <_>
+
+ <_>
+ 18 15 2 1 -1.
+ <_>
+ 18 15 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 3 13 2 4 -1.
+ <_>
+ 3 13 1 2 2.
+ <_>
+ 4 15 1 2 2.
+ <_>
+
+ <_>
+ 4 7 3 3 -1.
+ <_>
+ 3 8 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 0 1 2 7 -1.
+ <_>
+ 1 1 1 7 2.
+ <_>
+
+ <_>
+ 4 0 3 9 -1.
+ <_>
+ 5 0 1 9 3.
+ <_>
+
+ <_>
+ 15 10 3 3 -1.
+ <_>
+ 14 11 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 12 11 2 2 -1.
+ <_>
+ 12 11 1 1 2.
+ <_>
+ 13 12 1 1 2.
+ <_>
+
+ <_>
+ 0 0 1 4 -1.
+ <_>
+ 0 2 1 2 2.
+ <_>
+
+ <_>
+ 12 18 8 2 -1.
+ <_>
+ 12 19 8 1 2.
+ <_>
+
+ <_>
+ 17 9 2 2 -1.
+ <_>
+ 17 9 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 16 10 4 2 -1.
+ <_>
+ 17 11 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 7 13 10 1 -1.
+ <_>
+ 12 13 5 1 2.
+ <_>
+
+ <_>
+ 7 7 4 3 -1.
+ <_>
+ 9 7 2 3 2.
+ <_>
+
+ <_>
+ 9 18 6 2 -1.
+ <_>
+ 11 18 2 2 3.
+ <_>
+
+ <_>
+ 8 18 6 2 -1.
+ <_>
+ 10 18 2 2 3.
+ <_>
+
+ <_>
+ 17 9 3 1 -1.
+ <_>
+ 18 10 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 17 7 2 11 -1.
+ <_>
+ 18 7 1 11 2.
+ <_>
+
+ <_>
+ 8 2 4 4 -1.
+ <_>
+ 8 2 2 4 2.
+ 1
+ <_>
+
+ <_>
+ 6 6 2 3 -1.
+ <_>
+ 7 6 1 3 2.
+ <_>
+
+ <_>
+ 7 0 9 5 -1.
+ <_>
+ 10 3 3 5 3.
+ 1
+ <_>
+
+ <_>
+ 1 0 15 9 -1.
+ <_>
+ 6 3 5 3 9.
+ <_>
+
+ <_>
+ 2 12 4 3 -1.
+ <_>
+ 3 12 2 3 2.
+ <_>
+
+ <_>
+ 0 12 4 5 -1.
+ <_>
+ 1 12 2 5 2.
+ <_>
+
+ <_>
+ 3 2 2 3 -1.
+ <_>
+ 2 3 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 4 13 6 1 -1.
+ <_>
+ 4 13 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 5 0 4 6 -1.
+ <_>
+ 6 0 2 6 2.
+ <_>
+
+ <_>
+ 2 17 2 1 -1.
+ <_>
+ 2 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 4 9 1 3 -1.
+ <_>
+ 3 10 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 0 2 6 9 -1.
+ <_>
+ 2 2 2 9 3.
+ <_>
+
+ <_>
+ 16 7 2 2 -1.
+ <_>
+ 16 7 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 7 2 6 4 -1.
+ <_>
+ 9 2 2 4 3.
+ <_>
+
+ <_>
+ 7 18 6 2 -1.
+ <_>
+ 9 18 2 2 3.
+ <_>
+
+ <_>
+ 1 14 6 4 -1.
+ <_>
+ 3 14 2 4 3.
+ <_>
+
+ <_>
+ 6 8 7 3 -1.
+ <_>
+ 5 9 7 1 3.
+ 1
+ <_>
+
+ <_>
+ 14 12 4 1 -1.
+ <_>
+ 15 13 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 4 12 3 2 -1.
+ <_>
+ 5 12 1 2 3.
+ <_>
+
+ <_>
+ 5 12 3 3 -1.
+ <_>
+ 6 12 1 3 3.
+ <_>
+
+ <_>
+ 18 2 2 2 -1.
+ <_>
+ 19 2 1 2 2.
+ <_>
+
+ <_>
+ 14 0 6 1 -1.
+ <_>
+ 17 0 3 1 2.
+ <_>
+
+ <_>
+ 17 0 3 3 -1.
+ <_>
+ 18 1 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 11 4 6 8 -1.
+ <_>
+ 13 4 2 8 3.
+ <_>
+
+ <_>
+ 7 12 3 2 -1.
+ <_>
+ 8 12 1 2 3.
+ <_>
+
+ <_>
+ 16 0 3 2 -1.
+ <_>
+ 16 1 3 1 2.
+ <_>
+
+ <_>
+ 5 11 9 4 -1.
+ <_>
+ 8 11 3 4 3.
+ <_>
+
+ <_>
+ 12 9 1 6 -1.
+ <_>
+ 12 11 1 2 3.
+ <_>
+
+ <_>
+ 4 0 4 4 -1.
+ <_>
+ 4 0 2 4 2.
+ 1
+ <_>
+
+ <_>
+ 5 1 11 12 -1.
+ <_>
+ 5 5 11 4 3.
+ <_>
+
+ <_>
+ 16 12 4 8 -1.
+ <_>
+ 18 12 2 8 2.
+ <_>
+
+ <_>
+ 18 14 2 6 -1.
+ <_>
+ 18 17 2 3 2.
+ <_>
+
+ <_>
+ 1 12 4 4 -1.
+ <_>
+ 2 12 2 4 2.
+ <_>
+
+ <_>
+ 6 7 6 4 -1.
+ <_>
+ 5 8 6 2 2.
+ 1
+ <_>
+
+ <_>
+ 5 15 3 2 -1.
+ <_>
+ 6 16 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 6 16 3 1 -1.
+ <_>
+ 7 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 10 14 1 2 -1.
+ <_>
+ 10 14 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 4 7 3 3 -1.
+ <_>
+ 3 8 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 2 0 6 8 -1.
+ <_>
+ 4 0 2 8 3.
+ <_>
+
+ <_>
+ 2 5 6 3 -1.
+ <_>
+ 4 5 2 3 3.
+ <_>
+
+ <_>
+ 3 11 3 6 -1.
+ <_>
+ 4 11 1 6 3.
+ <_>
+
+ <_>
+ 15 11 2 3 -1.
+ <_>
+ 14 12 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 11 17 4 3 -1.
+ <_>
+ 12 17 2 3 2.
+ <_>
+
+ <_>
+ 13 11 2 2 -1.
+ <_>
+ 13 11 1 1 2.
+ <_>
+ 14 12 1 1 2.
+ <_>
+
+ <_>
+ 13 11 2 2 -1.
+ <_>
+ 13 11 1 1 2.
+ <_>
+ 14 12 1 1 2.
+ <_>
+
+ <_>
+ 8 2 5 6 -1.
+ <_>
+ 8 5 5 3 2.
+ <_>
+
+ <_>
+ 0 0 1 2 -1.
+ <_>
+ 0 1 1 1 2.
+ <_>
+
+ <_>
+ 0 8 10 4 -1.
+ <_>
+ 0 10 10 2 2.
+ <_>
+
+ <_>
+ 17 11 3 1 -1.
+ <_>
+ 18 12 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 7 18 2 2 -1.
+ <_>
+ 8 18 1 2 2.
+ <_>
+
+ <_>
+ 0 6 18 4 -1.
+ <_>
+ 9 6 9 4 2.
+ <_>
+
+ <_>
+ 2 12 12 8 -1.
+ <_>
+ 6 12 4 8 3.
+ <_>
+
+ <_>
+ 1 0 14 1 -1.
+ <_>
+ 8 0 7 1 2.
+ <_>
+
+ <_>
+ 8 0 12 19 -1.
+ <_>
+ 14 0 6 19 2.
+ <_>
+
+ <_>
+ 7 12 3 2 -1.
+ <_>
+ 8 12 1 2 3.
+ <_>
+
+ <_>
+ 8 11 3 5 -1.
+ <_>
+ 9 11 1 5 3.
+ <_>
+
+ <_>
+ 7 18 3 2 -1.
+ <_>
+ 8 18 1 2 3.
+ <_>
+
+ <_>
+ 5 13 2 2 -1.
+ <_>
+ 5 13 1 1 2.
+ <_>
+ 6 14 1 1 2.
+ <_>
+
+ <_>
+ 16 9 3 1 -1.
+ <_>
+ 17 10 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 18 0 2 3 -1.
+ <_>
+ 18 0 1 3 2.
+ 1
+ <_>
+
+ <_>
+ 4 2 15 6 -1.
+ <_>
+ 4 4 15 2 3.
+ <_>
+
+ <_>
+ 10 0 10 4 -1.
+ <_>
+ 10 0 5 2 2.
+ <_>
+ 15 2 5 2 2.
+ <_>
+
+ <_>
+ 5 0 12 6 -1.
+ <_>
+ 5 2 12 2 3.
+ <_>
+
+ <_>
+ 12 1 8 6 -1.
+ <_>
+ 12 1 4 3 2.
+ <_>
+ 16 4 4 3 2.
+ <_>
+
+ <_>
+ 0 3 2 1 -1.
+ <_>
+ 1 3 1 1 2.
+ <_>
+
+ <_>
+ 16 7 2 4 -1.
+ <_>
+ 16 7 1 4 2.
+ 1
+ <_>
+
+ <_>
+ 15 17 5 3 -1.
+ <_>
+ 15 18 5 1 3.
+ <_>
+
+ <_>
+ 6 12 6 8 -1.
+ <_>
+ 8 12 2 8 3.
+ <_>
+
+ <_>
+ 5 12 2 2 -1.
+ <_>
+ 6 12 1 2 2.
+ <_>
+
+ <_>
+ 13 12 4 6 -1.
+ <_>
+ 14 12 2 6 2.
+ <_>
+
+ <_>
+ 17 0 3 4 -1.
+ <_>
+ 18 1 1 4 3.
+ 1
+ <_>
+
+ <_>
+ 4 0 4 10 -1.
+ <_>
+ 5 0 2 10 2.
+ <_>
+
+ <_>
+ 5 12 3 3 -1.
+ <_>
+ 6 12 1 3 3.
+ <_>
+
+ <_>
+ 11 12 3 3 -1.
+ <_>
+ 12 12 1 3 3.
+ <_>
+
+ <_>
+ 3 2 1 3 -1.
+ <_>
+ 2 3 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 2 1 8 1 -1.
+ <_>
+ 4 1 4 1 2.
+ <_>
+
+ <_>
+ 0 3 18 12 -1.
+ <_>
+ 6 7 6 4 9.
+ <_>
+
+ <_>
+ 12 18 6 2 -1.
+ <_>
+ 15 18 3 2 2.
+ <_>
+
+ <_>
+ 11 9 4 7 -1.
+ <_>
+ 12 10 2 7 2.
+ 1
+ <_>
+
+ <_>
+ 15 8 3 12 -1.
+ <_>
+ 16 12 1 4 9.
+ <_>
+
+ <_>
+ 6 10 7 3 -1.
+ <_>
+ 6 11 7 1 3.
+ <_>
+
+ <_>
+ 4 9 10 3 -1.
+ <_>
+ 4 10 10 1 3.
+ <_>
+
+ <_>
+ 0 1 15 7 -1.
+ <_>
+ 5 1 5 7 3.
+ <_>
+
+ <_>
+ 0 0 1 18 -1.
+ <_>
+ 0 6 1 6 3.
+ <_>
+
+ <_>
+ 9 13 2 4 -1.
+ <_>
+ 8 14 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 16 16 4 4 -1.
+ <_>
+ 16 18 4 2 2.
+ <_>
+
+ <_>
+ 1 10 4 8 -1.
+ <_>
+ 2 10 2 8 2.
+ <_>
+
+ <_>
+ 2 15 3 2 -1.
+ <_>
+ 3 16 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 2 17 2 1 -1.
+ <_>
+ 2 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 18 10 2 8 -1.
+ <_>
+ 18 10 2 4 2.
+ 1
+ <_>
+
+ <_>
+ 0 11 18 3 -1.
+ <_>
+ 6 12 6 1 9.
+ <_>
+
+ <_>
+ 15 10 4 2 -1.
+ <_>
+ 16 11 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 9 1 5 4 -1.
+ <_>
+ 9 3 5 2 2.
+ <_>
+
+ <_>
+ 6 1 7 6 -1.
+ <_>
+ 6 4 7 3 2.
+ <_>
+
+ <_>
+ 3 3 8 6 -1.
+ <_>
+ 3 6 8 3 2.
+ <_>
+
+ <_>
+ 16 1 4 2 -1.
+ <_>
+ 18 1 2 2 2.
+ <_>
+
+ <_>
+ 18 12 2 3 -1.
+ <_>
+ 18 13 2 1 3.
+ <_>
+
+ <_>
+ 17 6 2 8 -1.
+ <_>
+ 17 6 1 4 2.
+ <_>
+ 18 10 1 4 2.
+ <_>
+
+ <_>
+ 17 5 3 4 -1.
+ <_>
+ 18 6 1 4 3.
+ 1
+ <_>
+
+ <_>
+ 0 9 4 8 -1.
+ <_>
+ 0 11 4 4 2.
+ <_>
+
+ <_>
+ 0 6 3 8 -1.
+ <_>
+ 0 10 3 4 2.
+ <_>
+
+ <_>
+ 14 11 2 2 -1.
+ <_>
+ 14 11 1 1 2.
+ <_>
+ 15 12 1 1 2.
+ <_>
+
+ <_>
+ 15 11 3 3 -1.
+ <_>
+ 14 12 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 14 12 5 2 -1.
+ <_>
+ 14 13 5 1 2.
+ <_>
+
+ <_>
+ 19 12 1 2 -1.
+ <_>
+ 19 13 1 1 2.
+ <_>
+
+ <_>
+ 6 0 4 7 -1.
+ <_>
+ 7 0 2 7 2.
+ <_>
+
+ <_>
+ 12 12 3 2 -1.
+ <_>
+ 12 13 3 1 2.
+ <_>
+
+ <_>
+ 12 13 4 2 -1.
+ <_>
+ 12 13 2 1 2.
+ <_>
+ 14 14 2 1 2.
+ <_>
+
+ <_>
+ 16 18 4 2 -1.
+ <_>
+ 16 19 4 1 2.
+ <_>
+
+ <_>
+ 14 18 1 2 -1.
+ <_>
+ 14 19 1 1 2.
+ <_>
+
+ <_>
+ 16 0 3 2 -1.
+ <_>
+ 17 1 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 16 0 4 2 -1.
+ <_>
+ 17 1 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 12 13 2 2 -1.
+ <_>
+ 12 13 1 1 2.
+ <_>
+ 13 14 1 1 2.
+ <_>
+
+ <_>
+ 7 10 4 2 -1.
+ <_>
+ 7 10 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 3 3 1 3 -1.
+ <_>
+ 2 4 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 4 2 3 -1.
+ <_>
+ 2 5 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 0 16 6 -1.
+ <_>
+ 3 2 16 2 3.
+ <_>
+
+ <_>
+ 12 2 2 5 -1.
+ <_>
+ 12 2 1 5 2.
+ 1
+ <_>
+
+ <_>
+ 4 0 1 3 -1.
+ <_>
+ 3 1 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 13 12 2 2 -1.
+ <_>
+ 13 12 1 1 2.
+ <_>
+ 14 13 1 1 2.
+ <_>
+
+ <_>
+ 5 17 4 3 -1.
+ <_>
+ 6 17 2 3 2.
+ <_>
+
+ <_>
+ 17 13 3 3 -1.
+ <_>
+ 17 14 3 1 3.
+ <_>
+
+ <_>
+ 0 12 2 8 -1.
+ <_>
+ 0 12 1 4 2.
+ <_>
+ 1 16 1 4 2.
+ <_>
+
+ <_>
+ 4 16 1 3 -1.
+ <_>
+ 3 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 0 2 1 2 -1.
+ <_>
+ 0 3 1 1 2.
+ <_>
+
+ <_>
+ 10 2 4 7 -1.
+ <_>
+ 11 2 2 7 2.
+ <_>
+
+ <_>
+ 2 1 6 9 -1.
+ <_>
+ 2 4 6 3 3.
+ <_>
+
+ <_>
+ 1 4 2 2 -1.
+ <_>
+ 2 4 1 2 2.
+ <_>
+
+ <_>
+ 13 12 2 2 -1.
+ <_>
+ 13 12 1 1 2.
+ <_>
+ 14 13 1 1 2.
+ <_>
+
+ <_>
+ 18 0 2 1 -1.
+ <_>
+ 19 0 1 1 2.
+ <_>
+
+ <_>
+ 4 13 3 1 -1.
+ <_>
+ 5 13 1 1 3.
+ <_>
+
+ <_>
+ 6 13 4 1 -1.
+ <_>
+ 7 13 2 1 2.
+ <_>
+
+ <_>
+ 6 10 6 3 -1.
+ <_>
+ 6 11 6 1 3.
+ <_>
+
+ <_>
+ 7 9 4 3 -1.
+ <_>
+ 7 10 4 1 3.
+ <_>
+
+ <_>
+ 6 0 4 3 -1.
+ <_>
+ 6 0 2 3 2.
+ 1
+ <_>
+
+ <_>
+ 15 15 5 2 -1.
+ <_>
+ 15 16 5 1 2.
+ <_>
+
+ <_>
+ 0 8 18 12 -1.
+ <_>
+ 6 12 6 4 9.
+ <_>
+
+ <_>
+ 1 6 14 4 -1.
+ <_>
+ 8 6 7 4 2.
+ <_>
+
+ <_>
+ 3 11 6 3 -1.
+ <_>
+ 2 12 6 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 9 1 3 -1.
+ <_>
+ 4 10 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 17 10 3 3 -1.
+ <_>
+ 18 11 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 17 11 1 4 -1.
+ <_>
+ 16 12 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 1 0 12 9 -1.
+ <_>
+ 4 0 6 9 2.
+ <_>
+
+ <_>
+ 9 3 4 5 -1.
+ <_>
+ 10 3 2 5 2.
+ <_>
+
+ <_>
+ 7 8 6 3 -1.
+ <_>
+ 7 9 6 1 3.
+ <_>
+
+ <_>
+ 7 1 9 6 -1.
+ <_>
+ 7 3 9 2 3.
+ <_>
+
+ <_>
+ 0 1 2 2 -1.
+ <_>
+ 0 2 2 1 2.
+ <_>
+
+ <_>
+ 13 8 3 5 -1.
+ <_>
+ 14 9 1 5 3.
+ 1
+ <_>
+
+ <_>
+ 3 16 3 1 -1.
+ <_>
+ 4 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 11 1 4 7 -1.
+ <_>
+ 12 1 2 7 2.
+ <_>
+
+ <_>
+ 11 13 2 2 -1.
+ <_>
+ 11 13 1 1 2.
+ <_>
+ 12 14 1 1 2.
+ <_>
+
+ <_>
+ 12 14 3 1 -1.
+ <_>
+ 13 14 1 1 3.
+ <_>
+
+ <_>
+ 17 2 3 1 -1.
+ <_>
+ 18 3 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 14 2 6 6 -1.
+ <_>
+ 14 2 3 3 2.
+ <_>
+ 17 5 3 3 2.
+ <_>
+
+ <_>
+ 12 16 8 4 -1.
+ <_>
+ 12 18 8 2 2.
+ <_>
+
+ <_>
+ 7 11 3 3 -1.
+ <_>
+ 6 12 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 6 3 8 6 -1.
+ <_>
+ 4 5 8 2 3.
+ 1
+ <_>
+
+ <_>
+ 1 8 3 8 -1.
+ <_>
+ 1 10 3 4 2.
+ <_>
+
+ <_>
+ 7 0 8 6 -1.
+ <_>
+ 9 2 4 6 2.
+ 1
+ <_>
+
+ <_>
+ 5 2 7 6 -1.
+ <_>
+ 5 5 7 3 2.
+ <_>
+
+ <_>
+ 10 13 3 1 -1.
+ <_>
+ 11 13 1 1 3.
+ <_>
+
+ <_>
+ 12 12 4 2 -1.
+ <_>
+ 12 12 2 1 2.
+ <_>
+ 14 13 2 1 2.
+ <_>
+
+ <_>
+ 6 1 14 19 -1.
+ <_>
+ 13 1 7 19 2.
+ <_>
+
+ <_>
+ 6 9 14 1 -1.
+ <_>
+ 13 9 7 1 2.
+ <_>
+
+ <_>
+ 18 0 2 1 -1.
+ <_>
+ 18 0 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 15 0 3 1 -1.
+ <_>
+ 16 1 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 7 2 3 -1.
+ <_>
+ 4 8 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 15 12 3 3 -1.
+ <_>
+ 14 13 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 10 17 4 2 -1.
+ <_>
+ 11 17 2 2 2.
+ <_>
+
+ <_>
+ 8 12 3 3 -1.
+ <_>
+ 9 13 1 1 9.
+ <_>
+
+ <_>
+ 4 1 7 6 -1.
+ <_>
+ 4 3 7 2 3.
+ <_>
+
+ <_>
+ 11 0 6 6 -1.
+ <_>
+ 11 2 6 2 3.
+ <_>
+
+ <_>
+ 0 1 1 4 -1.
+ <_>
+ 0 2 1 2 2.
+ <_>
+
+ <_>
+ 7 5 4 4 -1.
+ <_>
+ 8 5 2 4 2.
+ <_>
+
+ <_>
+ 1 0 1 3 -1.
+ <_>
+ 1 1 1 1 3.
+ <_>
+
+ <_>
+ 9 3 4 2 -1.
+ <_>
+ 9 4 4 1 2.
+ <_>
+
+ <_>
+ 18 13 2 5 -1.
+ <_>
+ 19 13 1 5 2.
+ <_>
+
+ <_>
+ 2 11 3 6 -1.
+ <_>
+ 3 11 1 6 3.
+ <_>
+
+ <_>
+ 0 5 2 12 -1.
+ <_>
+ 0 9 2 4 3.
+ <_>
+
+ <_>
+ 11 10 8 5 -1.
+ <_>
+ 15 10 4 5 2.
+ <_>
+
+ <_>
+ 15 11 4 2 -1.
+ <_>
+ 16 12 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 15 8 4 2 -1.
+ <_>
+ 16 9 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 5 13 2 1 -1.
+ <_>
+ 6 13 1 1 2.
+ <_>
+
+ <_>
+ 12 13 2 2 -1.
+ <_>
+ 13 13 1 2 2.
+ <_>
+
+ <_>
+ 11 12 8 8 -1.
+ <_>
+ 13 12 4 8 2.
+ <_>
+
+ <_>
+ 3 0 6 10 -1.
+ <_>
+ 5 0 2 10 3.
+ <_>
+
+ <_>
+ 6 14 2 2 -1.
+ <_>
+ 6 14 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 5 19 4 -1.
+ <_>
+ 0 7 19 2 2.
+ <_>
+
+ <_>
+ 17 4 3 2 -1.
+ <_>
+ 18 5 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 17 3 3 4 -1.
+ <_>
+ 18 4 1 4 3.
+ 1
+ <_>
+
+ <_>
+ 5 13 8 2 -1.
+ <_>
+ 7 13 4 2 2.
+ <_>
+
+ <_>
+ 0 0 2 8 -1.
+ <_>
+ 0 4 2 4 2.
+ <_>
+
+ <_>
+ 0 9 15 6 -1.
+ <_>
+ 0 11 15 2 3.
+ <_>
+
+ <_>
+ 18 14 2 1 -1.
+ <_>
+ 18 14 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 0 0 4 8 -1.
+ <_>
+ 2 0 2 8 2.
+ <_>
+
+ <_>
+ 0 13 6 2 -1.
+ <_>
+ 2 13 2 2 3.
+ <_>
+
+ <_>
+ 3 18 3 2 -1.
+ <_>
+ 3 19 3 1 2.
+ <_>
+
+ <_>
+ 2 11 15 6 -1.
+ <_>
+ 7 13 5 2 9.
+ <_>
+
+ <_>
+ 7 14 3 3 -1.
+ <_>
+ 8 15 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 7 8 2 2 -1.
+ <_>
+ 8 8 1 2 2.
+ <_>
+
+ <_>
+ 6 9 6 3 -1.
+ <_>
+ 6 10 6 1 3.
+ <_>
+
+ <_>
+ 5 8 7 3 -1.
+ <_>
+ 5 9 7 1 3.
+ <_>
+
+ <_>
+ 17 9 3 1 -1.
+ <_>
+ 18 10 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 17 9 3 2 -1.
+ <_>
+ 18 10 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 11 9 1 3 -1.
+ <_>
+ 11 10 1 1 3.
+ <_>
+
+ <_>
+ 12 11 2 2 -1.
+ <_>
+ 12 11 1 1 2.
+ <_>
+ 13 12 1 1 2.
+ <_>
+
+ <_>
+ 3 6 4 5 -1.
+ <_>
+ 4 6 2 5 2.
+ <_>
+
+ <_>
+ 5 6 4 3 -1.
+ <_>
+ 6 6 2 3 2.
+ <_>
+
+ <_>
+ 0 3 1 6 -1.
+ <_>
+ 0 5 1 2 3.
+ <_>
+
+ <_>
+ 14 12 2 2 -1.
+ <_>
+ 14 12 1 1 2.
+ <_>
+ 15 13 1 1 2.
+ <_>
+
+ <_>
+ 3 16 3 3 -1.
+ <_>
+ 4 16 1 3 3.
+ <_>
+
+ <_>
+ 3 1 14 4 -1.
+ <_>
+ 3 3 14 2 2.
+ <_>
+
+ <_>
+ 6 0 14 8 -1.
+ <_>
+ 6 0 7 4 2.
+ <_>
+ 13 4 7 4 2.
+ <_>
+
+ <_>
+ 4 0 4 8 -1.
+ <_>
+ 4 2 4 4 2.
+ <_>
+
+ <_>
+ 9 0 8 1 -1.
+ <_>
+ 13 0 4 1 2.
+ <_>
+
+ <_>
+ 14 1 6 1 -1.
+ <_>
+ 17 1 3 1 2.
+ <_>
+
+ <_>
+ 18 18 2 2 -1.
+ <_>
+ 18 19 2 1 2.
+ <_>
+
+ <_>
+ 5 16 2 2 -1.
+ <_>
+ 5 16 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 2 8 11 3 -1.
+ <_>
+ 2 9 11 1 3.
+ <_>
+
+ <_>
+ 1 8 2 3 -1.
+ <_>
+ 1 9 2 1 3.
+ <_>
+
+ <_>
+ 18 12 2 5 -1.
+ <_>
+ 19 12 1 5 2.
+ <_>
+
+ <_>
+ 19 16 1 3 -1.
+ <_>
+ 18 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 14 9 2 2 -1.
+ <_>
+ 14 9 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 13 11 2 2 -1.
+ <_>
+ 13 11 1 1 2.
+ <_>
+ 14 12 1 1 2.
+ <_>
+
+ <_>
+ 13 12 4 4 -1.
+ <_>
+ 14 12 2 4 2.
+ <_>
+
+ <_>
+ 19 11 1 3 -1.
+ <_>
+ 19 12 1 1 3.
+ <_>
+
+ <_>
+ 0 1 1 4 -1.
+ <_>
+ 0 3 1 2 2.
+ <_>
+
+ <_>
+ 0 0 20 20 -1.
+ <_>
+ 0 0 10 10 2.
+ <_>
+ 10 10 10 10 2.
+ <_>
+
+ <_>
+ 11 12 3 3 -1.
+ <_>
+ 10 13 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 16 17 1 2 -1.
+ <_>
+ 16 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 13 10 4 2 -1.
+ <_>
+ 13 10 2 1 2.
+ <_>
+ 15 11 2 1 2.
+ <_>
+
+ <_>
+ 15 11 2 2 -1.
+ <_>
+ 15 11 1 1 2.
+ <_>
+ 16 12 1 1 2.
+ <_>
+
+ <_>
+ 2 10 3 6 -1.
+ <_>
+ 3 10 1 6 3.
+ <_>
+
+ <_>
+ 0 0 6 9 -1.
+ <_>
+ 2 0 2 9 3.
+ <_>
+
+ <_>
+ 8 17 2 1 -1.
+ <_>
+ 8 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 4 18 8 1 -1.
+ <_>
+ 8 18 4 1 2.
+ <_>
+
+ <_>
+ 4 11 1 4 -1.
+ <_>
+ 3 12 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 7 11 3 3 -1.
+ <_>
+ 6 12 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 9 18 4 1 -1.
+ <_>
+ 10 18 2 1 2.
+ <_>
+
+ <_>
+ 0 19 2 1 -1.
+ <_>
+ 1 19 1 1 2.
+ <_>
+
+ <_>
+ 11 6 3 5 -1.
+ <_>
+ 12 6 1 5 3.
+ <_>
+
+ <_>
+ 8 0 12 20 -1.
+ <_>
+ 8 0 6 10 2.
+ <_>
+ 14 10 6 10 2.
+ <_>
+
+ <_>
+ 4 0 1 4 -1.
+ <_>
+ 3 1 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 4 14 16 4 -1.
+ <_>
+ 8 14 8 4 2.
+ <_>
+
+ <_>
+ 7 9 5 4 -1.
+ <_>
+ 6 10 5 2 2.
+ 1
+ <_>
+
+ <_>
+ 5 12 6 2 -1.
+ <_>
+ 5 12 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 1 14 4 1 -1.
+ <_>
+ 1 14 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 4 10 1 3 -1.
+ <_>
+ 3 11 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 10 3 9 -1.
+ <_>
+ 4 10 1 9 3.
+ <_>
+
+ <_>
+ 4 11 3 4 -1.
+ <_>
+ 5 11 1 4 3.
+ <_>
+
+ <_>
+ 5 12 3 2 -1.
+ <_>
+ 6 12 1 2 3.
+ <_>
+
+ <_>
+ 7 12 3 2 -1.
+ <_>
+ 8 12 1 2 3.
+ <_>
+
+ <_>
+ 1 2 12 6 -1.
+ <_>
+ 5 2 4 6 3.
+ <_>
+
+ <_>
+ 9 0 8 3 -1.
+ <_>
+ 11 2 4 3 2.
+ 1
+ <_>
+
+ <_>
+ 8 1 6 2 -1.
+ <_>
+ 8 1 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 4 4 15 9 -1.
+ <_>
+ 4 7 15 3 3.
+ <_>
+
+ <_>
+ 5 10 8 6 -1.
+ <_>
+ 7 10 4 6 2.
+ <_>
+
+ <_>
+ 11 8 9 9 -1.
+ <_>
+ 11 11 9 3 3.
+ <_>
+
+ <_>
+ 7 0 6 4 -1.
+ <_>
+ 9 2 2 4 3.
+ 1
+ <_>
+
+ <_>
+ 3 11 6 3 -1.
+ <_>
+ 2 12 6 1 3.
+ 1
+ <_>
+
+ <_>
+ 16 12 4 3 -1.
+ <_>
+ 18 12 2 3 2.
+ <_>
+
+ <_>
+ 10 10 2 10 -1.
+ <_>
+ 10 15 2 5 2.
+ <_>
+
+ <_>
+ 5 7 3 4 -1.
+ <_>
+ 4 8 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 1 9 6 1 -1.
+ <_>
+ 3 11 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 0 0 1 6 -1.
+ <_>
+ 0 3 1 3 2.
+ <_>
+
+ <_>
+ 8 10 10 2 -1.
+ <_>
+ 8 10 5 1 2.
+ <_>
+ 13 11 5 1 2.
+ <_>
+
+ <_>
+ 5 2 5 6 -1.
+ <_>
+ 5 5 5 3 2.
+ <_>
+
+ <_>
+ 6 1 6 1 -1.
+ <_>
+ 6 1 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 0 3 1 12 -1.
+ <_>
+ 0 7 1 4 3.
+ <_>
+
+ <_>
+ 0 7 2 1 -1.
+ <_>
+ 1 7 1 1 2.
+ <_>
+
+ <_>
+ 3 5 1 3 -1.
+ <_>
+ 2 6 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 11 12 2 3 -1.
+ <_>
+ 10 13 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 10 12 3 3 -1.
+ <_>
+ 11 12 1 3 3.
+ <_>
+
+ <_>
+ 9 11 3 3 -1.
+ <_>
+ 10 12 1 1 9.
+ <_>
+
+ <_>
+ 6 17 4 2 -1.
+ <_>
+ 7 17 2 2 2.
+ <_>
+
+ <_>
+ 12 18 6 2 -1.
+ <_>
+ 15 18 3 2 2.
+ <_>
+
+ <_>
+ 3 17 2 1 -1.
+ <_>
+ 3 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 1 15 4 1 -1.
+ <_>
+ 2 16 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 18 0 2 2 -1.
+ <_>
+ 18 1 2 1 2.
+ <_>
+
+ <_>
+ 19 0 1 3 -1.
+ <_>
+ 19 1 1 1 3.
+ <_>
+
+ <_>
+ 16 11 3 2 -1.
+ <_>
+ 16 11 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 16 12 2 3 -1.
+ <_>
+ 15 13 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 12 0 8 1 -1.
+ <_>
+ 16 0 4 1 2.
+ <_>
+
+ <_>
+ 2 1 9 6 -1.
+ <_>
+ 2 4 9 3 2.
+ <_>
+
+ <_>
+ 17 1 3 2 -1.
+ <_>
+ 17 1 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 7 5 6 4 -1.
+ <_>
+ 7 6 6 2 2.
+ <_>
+
+ <_>
+ 4 6 6 2 -1.
+ <_>
+ 7 6 3 2 2.
+ <_>
+
+ <_>
+ 11 4 6 6 -1.
+ <_>
+ 13 4 2 6 3.
+ <_>
+
+ <_>
+ 5 7 9 3 -1.
+ <_>
+ 5 8 9 1 3.
+ <_>
+
+ <_>
+ 5 8 9 3 -1.
+ <_>
+ 5 9 9 1 3.
+ <_>
+
+ <_>
+ 1 0 4 3 -1.
+ <_>
+ 2 0 2 3 2.
+ <_>
+
+ <_>
+ 9 9 5 4 -1.
+ <_>
+ 9 10 5 2 2.
+ <_>
+
+ <_>
+ 1 0 6 7 -1.
+ <_>
+ 3 0 2 7 3.
+ <_>
+
+ <_>
+ 16 9 3 2 -1.
+ <_>
+ 17 10 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 14 12 2 2 -1.
+ <_>
+ 14 12 1 1 2.
+ <_>
+ 15 13 1 1 2.
+ <_>
+
+ <_>
+ 0 0 14 1 -1.
+ <_>
+ 7 0 7 1 2.
+ <_>
+
+ <_>
+ 15 11 2 2 -1.
+ <_>
+ 15 11 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 3 14 12 4 -1.
+ <_>
+ 3 14 6 2 2.
+ <_>
+ 9 16 6 2 2.
+ <_>
+
+ <_>
+ 5 2 1 3 -1.
+ <_>
+ 4 3 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 8 12 3 2 -1.
+ <_>
+ 9 13 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 14 11 2 2 -1.
+ <_>
+ 14 11 1 1 2.
+ <_>
+ 15 12 1 1 2.
+ <_>
+
+ <_>
+ 13 10 7 2 -1.
+ <_>
+ 13 11 7 1 2.
+ <_>
+
+ <_>
+ 7 13 1 2 -1.
+ <_>
+ 7 13 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 5 12 4 3 -1.
+ <_>
+ 6 12 2 3 2.
+ <_>
+
+ <_>
+ 8 2 2 5 -1.
+ <_>
+ 9 2 1 5 2.
+ <_>
+
+ <_>
+ 1 17 4 2 -1.
+ <_>
+ 3 17 2 2 2.
+ <_>
+
+ <_>
+ 12 17 4 3 -1.
+ <_>
+ 13 17 2 3 2.
+ <_>
+
+ <_>
+ 15 16 5 3 -1.
+ <_>
+ 15 17 5 1 3.
+ <_>
+
+ <_>
+ 15 16 4 3 -1.
+ <_>
+ 15 17 4 1 3.
+ <_>
+
+ <_>
+ 0 17 16 3 -1.
+ <_>
+ 4 17 8 3 2.
+ <_>
+
+ <_>
+ 0 14 2 2 -1.
+ <_>
+ 0 14 1 1 2.
+ <_>
+ 1 15 1 1 2.
+ <_>
+
+ <_>
+ 7 2 6 6 -1.
+ <_>
+ 7 4 6 2 3.
+ <_>
+
+ <_>
+ 3 5 1 3 -1.
+ <_>
+ 2 6 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 2 7 2 2 -1.
+ <_>
+ 2 7 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 6 11 5 3 -1.
+ <_>
+ 5 12 5 1 3.
+ 1
+ <_>
+
+ <_>
+ 16 14 4 6 -1.
+ <_>
+ 16 17 4 3 2.
+ <_>
+
+ <_>
+ 6 13 6 7 -1.
+ <_>
+ 8 13 2 7 3.
+ <_>
+
+ <_>
+ 0 1 12 11 -1.
+ <_>
+ 3 1 6 11 2.
+ <_>
+
+ <_>
+ 6 10 7 3 -1.
+ <_>
+ 6 11 7 1 3.
+ <_>
+
+ <_>
+ 8 0 9 4 -1.
+ <_>
+ 8 2 9 2 2.
+ <_>
+
+ <_>
+ 10 14 10 2 -1.
+ <_>
+ 10 15 10 1 2.
+ <_>
+
+ <_>
+ 0 0 1 18 -1.
+ <_>
+ 0 6 1 6 3.
+ <_>
+
+ <_>
+ 4 13 2 2 -1.
+ <_>
+ 4 13 1 1 2.
+ <_>
+ 5 14 1 1 2.
+ <_>
+
+ <_>
+ 8 11 3 6 -1.
+ <_>
+ 9 12 1 6 3.
+ 1
+ <_>
+
+ <_>
+ 6 7 2 3 -1.
+ <_>
+ 5 8 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 4 8 3 3 -1.
+ <_>
+ 5 8 1 3 3.
+ <_>
+
+ <_>
+ 1 4 14 1 -1.
+ <_>
+ 1 4 7 1 2.
+ 1
+ <_>
+
+ <_>
+ 12 13 8 3 -1.
+ <_>
+ 14 13 4 3 2.
+ <_>
+
+ <_>
+ 4 17 2 1 -1.
+ <_>
+ 4 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 6 16 2 2 -1.
+ <_>
+ 6 16 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 3 17 4 2 -1.
+ <_>
+ 4 17 2 2 2.
+ <_>
+
+ <_>
+ 0 7 20 2 -1.
+ <_>
+ 5 7 10 2 2.
+ <_>
+
+ <_>
+ 15 9 2 2 -1.
+ <_>
+ 15 9 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 3 12 2 2 -1.
+ <_>
+ 3 12 1 1 2.
+ <_>
+ 4 13 1 1 2.
+ <_>
+
+ <_>
+ 0 5 2 1 -1.
+ <_>
+ 1 5 1 1 2.
+ <_>
+
+ <_>
+ 17 0 3 2 -1.
+ <_>
+ 18 1 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 2 8 3 9 -1.
+ <_>
+ 3 11 1 3 9.
+ <_>
+
+ <_>
+ 15 7 4 2 -1.
+ <_>
+ 16 8 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 4 16 3 3 -1.
+ <_>
+ 5 16 1 3 3.
+ <_>
+
+ <_>
+ 8 14 6 1 -1.
+ <_>
+ 10 14 2 1 3.
+ <_>
+
+ <_>
+ 14 0 6 6 -1.
+ <_>
+ 14 0 3 3 2.
+ <_>
+ 17 3 3 3 2.
+ <_>
+
+ <_>
+ 17 2 2 1 -1.
+ <_>
+ 17 2 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 0 19 20 1 -1.
+ <_>
+ 10 19 10 1 2.
+ <_>
+
+ <_>
+ 0 19 6 1 -1.
+ <_>
+ 3 19 3 1 2.
+ <_>
+
+ <_>
+ 9 17 4 3 -1.
+ <_>
+ 10 17 2 3 2.
+ <_>
+
+ <_>
+ 4 11 3 3 -1.
+ <_>
+ 5 12 1 1 9.
+ <_>
+
+ <_>
+ 17 7 3 3 -1.
+ <_>
+ 18 8 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 19 1 1 4 -1.
+ <_>
+ 18 2 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 6 8 2 1 -1.
+ <_>
+ 7 8 1 1 2.
+ <_>
+
+ <_>
+ 5 4 4 4 -1.
+ <_>
+ 6 5 2 4 2.
+ 1
+ <_>
+
+ <_>
+ 5 0 8 7 -1.
+ <_>
+ 9 0 4 7 2.
+ <_>
+
+ <_>
+ 0 7 5 9 -1.
+ <_>
+ 0 10 5 3 3.
+ <_>
+
+ <_>
+ 14 10 2 2 -1.
+ <_>
+ 14 10 1 1 2.
+ <_>
+ 15 11 1 1 2.
+ <_>
+
+ <_>
+ 15 11 2 2 -1.
+ <_>
+ 15 11 1 1 2.
+ <_>
+ 16 12 1 1 2.
+ <_>
+
+ <_>
+ 9 2 6 4 -1.
+ <_>
+ 11 2 2 4 3.
+ <_>
+
+ <_>
+ 0 12 12 8 -1.
+ <_>
+ 6 12 6 8 2.
+ <_>
+
+ <_>
+ 1 0 6 2 -1.
+ <_>
+ 3 0 2 2 3.
+ <_>
+
+ <_>
+ 0 12 4 5 -1.
+ <_>
+ 1 12 2 5 2.
+ <_>
+
+ <_>
+ 2 12 4 4 -1.
+ <_>
+ 3 12 2 4 2.
+ <_>
+
+ <_>
+ 12 11 2 4 -1.
+ <_>
+ 13 11 1 4 2.
+ <_>
+
+ <_>
+ 2 0 1 4 -1.
+ <_>
+ 2 2 1 2 2.
+ <_>
+
+ <_>
+ 6 1 4 9 -1.
+ <_>
+ 7 1 2 9 2.
+ <_>
+
+ <_>
+ 13 10 2 3 -1.
+ <_>
+ 13 11 2 1 3.
+ <_>
+
+ <_>
+ 3 9 15 3 -1.
+ <_>
+ 8 10 5 1 9.
+ <_>
+
+ <_>
+ 15 10 3 1 -1.
+ <_>
+ 16 11 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 1 0 15 8 -1.
+ <_>
+ 1 2 15 4 2.
+ <_>
+
+ <_>
+ 2 3 15 6 -1.
+ <_>
+ 2 6 15 3 2.
+ <_>
+
+ <_>
+ 6 0 6 6 -1.
+ <_>
+ 6 2 6 2 3.
+ <_>
+
+ <_>
+ 16 9 4 3 -1.
+ <_>
+ 16 10 4 1 3.
+ <_>
+
+ <_>
+ 16 7 4 3 -1.
+ <_>
+ 16 8 4 1 3.
+ <_>
+
+ <_>
+ 15 10 2 2 -1.
+ <_>
+ 15 10 1 1 2.
+ <_>
+ 16 11 1 1 2.
+ <_>
+
+ <_>
+ 13 11 2 3 -1.
+ <_>
+ 13 12 2 1 3.
+ <_>
+
+ <_>
+ 2 16 2 2 -1.
+ <_>
+ 2 16 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 3 0 4 7 -1.
+ <_>
+ 4 0 2 7 2.
+ <_>
+
+ <_>
+ 0 16 2 2 -1.
+ <_>
+ 0 16 1 1 2.
+ <_>
+ 1 17 1 1 2.
+ <_>
+
+ <_>
+ 2 0 18 3 -1.
+ <_>
+ 8 0 6 3 3.
+ <_>
+
+ <_>
+ 0 1 1 3 -1.
+ <_>
+ 0 2 1 1 3.
+ <_>
+
+ <_>
+ 10 6 4 4 -1.
+ <_>
+ 10 7 4 2 2.
+ <_>
+
+ <_>
+ 16 4 4 6 -1.
+ <_>
+ 16 4 2 3 2.
+ <_>
+ 18 7 2 3 2.
+ <_>
+
+ <_>
+ 11 12 4 2 -1.
+ <_>
+ 11 12 2 1 2.
+ <_>
+ 13 13 2 1 2.
+
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_righteye_2splits.xml b/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_righteye_2splits.xml
new file mode 100644
index 00000000..db4571cd
--- /dev/null
+++ b/MachineLearning Projects/Driver-Drowsiness-Detection/haar_cascade_files/haarcascade_righteye_2splits.xml
@@ -0,0 +1,7407 @@
+
+
+
+BOOST
+ HAAR
+ 20
+ 20
+
+ 34
+
+ 0
+ 20
+
+ <_>
+ 5
+ -2.2325520515441895e+00
+
+ <_>
+
+ 1 0 0 -4.8210550099611282e-02 -1 -2 1
+ -4.1576199233531952e-02
+
+ -8.6140447854995728e-01 9.1769057512283325e-01
+ -2.1284009516239166e-01
+ <_>
+
+ 0 1 2 9.3528684228658676e-03 -1 -2 3 -2.2144919785205275e-04
+
+ -6.9785767793655396e-01 7.9523372650146484e-01
+ -4.8948091268539429e-01
+ <_>
+
+ 0 1 4 -2.1853350102901459e-02 -1 -2 5 9.9672928452491760e-02
+
+ 7.0574641227722168e-01 -7.0666241645812988e-01
+ 7.9210978746414185e-01
+ <_>
+
+ 1 0 6 -2.1664820611476898e-02 -1 -2 7
+ -7.5680727604776621e-04
+
+ -6.0898607969284058e-01 7.1685701608657837e-01
+ -3.0464568734169006e-01
+ <_>
+
+ 1 0 8 -1.3333049602806568e-02 -1 -2 9 9.2925298959016800e-03
+
+ -4.6844691038131714e-01 6.4235931634902954e-01
+ -5.1180428266525269e-01
+ <_>
+ 5
+ -2.1598019599914551e+00
+
+ <_>
+
+ 0 1 10 -3.3948719501495361e-01 -1 -2 11
+ -1.3672479987144470e-01
+
+ 7.7913260459899902e-01 2.6421278715133667e-01
+ -8.7910091876983643e-01
+ <_>
+
+ 0 1 12 3.1394500285387039e-02 -1 -2 13
+ -1.0828140191733837e-02
+
+ -6.9956701993942261e-01 7.6504492759704590e-01
+ -4.3719211220741272e-01
+ <_>
+
+ 1 0 14 -4.2506768368184566e-03 -1 -2 15
+ -2.2675469517707825e-02
+
+ -5.7561582326889038e-01 7.4080592393875122e-01
+ -3.6677250266075134e-01
+ <_>
+
+ 1 0 16 3.9161480963230133e-02 -1 -2 17
+ -3.1934089493006468e-03
+
+ 6.4045161008834839e-01 1.6047589480876923e-01
+ -7.1010977029800415e-01
+ <_>
+
+ 1 0 18 2.5321990251541138e-02 -1 -2 19
+ 7.7583367237821221e-04
+
+ 4.9574860930442810e-01 -7.1737897396087646e-01
+ -1.8581770360469818e-02
+ <_>
+ 8
+ -2.3451159000396729e+00
+
+ <_>
+
+ 1 0 20 -2.6554059982299805e-01 -1 -2 21
+ -2.2532779723405838e-02
+
+ -8.4712451696395874e-01 8.7977188825607300e-01
+ -3.3394691348075867e-01
+ <_>
+
+ 0 1 22 8.5310067515820265e-04 -1 -2 23
+ 1.5820249973330647e-04
+
+ -8.2032448053359985e-01 -7.5176358222961426e-01
+ 6.7769712209701538e-01
+ <_>
+
+ 1 0 24 -1.0837490117410198e-04 -1 -2 25
+ 2.6810260023921728e-03
+
+ -8.3314001560211182e-01 5.3844749927520752e-01
+ -7.6534157991409302e-01
+ <_>
+
+ 0 1 26 8.5202371701598167e-04 -1 -2 27
+ -1.2241739779710770e-02
+
+ -7.7514898777008057e-01 6.3240152597427368e-01
+ -6.3395208120346069e-01
+ <_>
+
+ 1 0 28 6.2314196838997304e-05 -1 -2 29
+ -7.1911108493804932e-01
+
+ 4.4290411472320557e-01 8.0135929584503174e-01
+ -5.3431099653244019e-01
+ <_>
+
+ 1 0 30 -2.4280339479446411e-02 -1 -2 31
+ 3.4558640327304602e-03
+
+ -6.7797917127609253e-01 4.9030610918998718e-01
+ -8.8447982072830200e-01
+ <_>
+
+ 1 0 32 -6.2993327446747571e-05 -1 -2 33
+ -4.6443562023341656e-03
+
+ -5.7883417606353760e-01 -8.5878807306289673e-01
+ 5.2454602718353271e-01
+ <_>
+
+ 1 0 34 -4.0299328247783706e-05 -1 -2 35
+ -3.7485519424080849e-03
+
+ -5.2713459730148315e-01 -8.5626190900802612e-01
+ 4.8944610357284546e-01
+ <_>
+ 10
+ -2.3431489467620850e+00
+
+ <_>
+
+ 0 1 36 -3.8377079367637634e-01 -1 -2 37
+ -1.3837030529975891e-01
+
+ 7.1715021133422852e-01 3.4392359852790833e-01
+ -7.9931277036666870e-01
+ <_>
+
+ 0 1 38 3.3107071067206562e-04 -1 -2 39
+ -5.1273438148200512e-03
+
+ -6.8352431058883667e-01 5.8250617980957031e-01
+ -4.0955001115798950e-01
+ <_>
+
+ 1 0 40 -2.6100680232048035e-02 -1 -2 41
+ -1.0628979653120041e-03
+
+ -4.3713301420211792e-01 7.0680737495422363e-01
+ -2.6817938685417175e-01
+ <_>
+
+ 0 1 42 -9.7854852676391602e-02 -1 -2 43
+ -1.1829820275306702e-01
+
+ 7.3940038681030273e-01 6.3814181089401245e-01
+ -3.8721871376037598e-01
+ <_>
+
+ 1 0 44 -7.5409049168229103e-03 -1 -2 45
+ 2.6851659640669823e-03
+
+ -4.8803019523620605e-01 3.9083468914031982e-01
+ -6.5561538934707642e-01
+ <_>
+
+ 0 1 46 1.6870240215212107e-03 -1 -2 47
+ -3.8136160001158714e-03
+
+ -4.9891749024391174e-01 -6.6405588388442993e-01
+ 4.0650749206542969e-01
+ <_>
+
+ 1 0 48 2.0289309322834015e-03 -1 -2 49
+ -7.6308869756758213e-03
+
+ -6.9989210367202759e-01 4.3206840753555298e-01
+ -2.9664969444274902e-01
+ <_>
+
+ 1 0 50 -3.3815231290645897e-04 -1 -2 51
+ 7.5163291767239571e-03
+
+ -4.6808540821075439e-01 3.6521491408348083e-01
+ -7.6014542579650879e-01
+ <_>
+
+ 1 0 52 6.1479508876800537e-02 -1 -2 53
+ -4.6286579221487045e-02
+
+ 5.6990629434585571e-01 2.2625060379505157e-01
+ -4.5330780744552612e-01
+ <_>
+
+ 1 0 54 4.6903551556169987e-03 -1 -2 55
+ 1.8803169950842857e-03
+
+ -7.7286708354949951e-01 2.7349120378494263e-01
+ -6.6667830944061279e-01
+ <_>
+ 8
+ -2.1268370151519775e+00
+
+ <_>
+
+ 1 0 56 -5.5420672893524170e-01 -1 -2 57
+ -6.9329799152910709e-03
+
+ -6.0620260238647461e-01 7.8542029857635498e-01
+ -3.5522121191024780e-01
+ <_>
+
+ 0 1 58 -2.1169960498809814e-02 -1 -2 59
+ -6.7428398132324219e-01
+
+ 5.2947688102722168e-01 4.6065220236778259e-01
+ -7.0058208703994751e-01
+ <_>
+
+ 1 0 60 -4.2725078761577606e-02 -1 -2 61
+ -1.0109329596161842e-02
+
+ -5.9904807806015015e-01 6.8109220266342163e-01
+ -2.0731879770755768e-01
+ <_>
+
+ 0 1 62 6.5861130133271217e-03 -1 -2 63
+ -7.6380418613553047e-03
+
+ -5.2420848608016968e-01 -7.0169782638549805e-01
+ 4.4100138545036316e-01
+ <_>
+
+ 0 1 64 -9.7681581974029541e-02 -1 -2 65
+ 1.0197360068559647e-02
+
+ 5.7708740234375000e-01 -9.8518550395965576e-02
+ -8.8111698627471924e-01
+ <_>
+
+ 0 1 66 -2.5724549777805805e-03 -1 -2 67
+ 2.6594230439513922e-03
+
+ -8.3233338594436646e-01 3.0995351076126099e-01
+ -8.1609177589416504e-01
+ <_>
+
+ 1 0 68 -1.0042720241472125e-03 -1 -2 69
+ 2.6080000679939985e-03
+
+ -4.3558520078659058e-01 3.3566600084304810e-01
+ -8.1889331340789795e-01
+ <_>
+
+ 1 0 70 4.9724509008228779e-03 -1 -2 71
+ 1.2243240140378475e-02
+
+ -7.7048182487487793e-01 2.2534200549125671e-01
+ -6.8695551156997681e-01
+ <_>
+ 10
+ -2.0604379177093506e+00
+
+ <_>
+
+ 1 0 72 -5.7784929871559143e-02 -1 -2 73
+ -1.7517809756100178e-03
+
+ -7.0516008138656616e-01 8.5655921697616577e-01
+ -9.2403419315814972e-02
+ <_>
+
+ 1 0 74 -1.1522379703819752e-02 -1 -2 75
+ -3.8323760963976383e-03
+
+ -4.2749640345573425e-01 7.5913530588150024e-01
+ -1.0894049704074860e-01
+ <_>
+
+ 1 0 76 -8.0922387540340424e-02 -1 -2 77
+ -6.2537011690437794e-03
+
+ -3.1364768743515015e-01 6.9995921850204468e-01
+ -1.1805690079927444e-01
+ <_>
+
+ 0 1 78 -1.2227860093116760e-01 -1 -2 79
+ -6.4168110489845276e-02
+
+ 5.2072501182556152e-01 3.9272749423980713e-01
+ -4.2194411158561707e-01
+ <_>
+
+ 1 0 80 -5.3712888620793819e-04 -1 -2 81
+ -2.8175620827823877e-03
+
+ -4.9524548649787903e-01 4.1350141167640686e-01
+ -3.8919278979301453e-01
+ <_>
+
+ 0 1 82 -3.6368549335747957e-03 -1 -2 83
+ -1.3223909772932529e-03
+
+ 6.7615020275115967e-01 4.3426999449729919e-01
+ -3.7642130255699158e-01
+ <_>
+
+ 0 1 84 3.7143539520911872e-04 -1 -2 85
+ -5.0255712121725082e-03
+
+ -5.5630880594253540e-01 -5.2328592538833618e-01
+ 3.4646821022033691e-01
+ <_>
+
+ 1 0 86 -9.2711612523999065e-05 -1 -2 87
+ 1.9847028888761997e-03
+
+ -4.9652668833732605e-01 3.3401641249656677e-01
+ -6.2446892261505127e-01
+ <_>
+
+ 1 0 88 4.7203440219163895e-02 -1 -2 89
+ -6.8562600063160062e-05
+
+ 5.7562619447708130e-01 2.6172660291194916e-02
+ -6.0849070549011230e-01
+ <_>
+
+ 1 0 90 7.5034219771623611e-03 -1 -2 91
+ 6.3834791071712971e-03
+
+ -6.8576759099960327e-01 -1.7312510311603546e-01
+ 3.8560429215431213e-01
+ <_>
+ 12
+ -2.3187489509582520e+00
+
+ <_>
+
+ 1 0 92 -1.5584450215101242e-02 -1 -2 93
+ 1.4557019807398319e-02
+
+ -6.6648960113525391e-01 -4.3745130300521851e-01
+ 7.2227817773818970e-01
+ <_>
+
+ 1 0 94 -5.7889888994395733e-03 -1 -2 95
+ -8.1936769187450409e-02
+
+ -4.3183240294456482e-01 6.8467652797698975e-01
+ -2.2546729445457458e-01
+ <_>
+
+ 1 0 96 -4.2995368130505085e-03 -1 -2 97
+ -1.3736640103161335e-02
+
+ -5.2409631013870239e-01 6.1626207828521729e-01
+ -3.5893160104751587e-01
+ <_>
+
+ 1 0 98 -4.8069912008941174e-03 -1 -2 99
+ -7.7131099998950958e-02
+
+ -4.2382389307022095e-01 6.0599362850189209e-01
+ -3.1555330753326416e-01
+ <_>
+
+ 0 1 100 4.4640208943746984e-04 -1 -2 101
+ 3.4841578453779221e-02
+
+ -4.9206110835075378e-01 -4.1017889976501465e-02
+ 6.1330878734588623e-01
+ <_>
+
+ 0 1 102 8.2969048526138067e-04 -1 -2 103
+ -7.8510129242204130e-05
+
+ -4.5479419827461243e-01 4.0007328987121582e-01
+ -2.0888769626617432e-01
+ <_>
+
+ 1 0 104 4.6054688282310963e-03 -1 -2 105
+ -7.1904482319951057e-03
+
+ -6.7931377887725830e-01 4.7060671448707581e-01
+ -1.4138610661029816e-01
+ <_>
+
+ 0 1 106 -5.5724480189383030e-03 -1 -2 107
+ -7.0458237314596772e-04
+
+ -7.0525509119033813e-01 3.6097851395606995e-01
+ -1.8361540138721466e-01
+ <_>
+
+ 1 0 108 1.8595060333609581e-02 -1 -2 109
+ 5.0072550773620605e-02
+
+ 4.1765761375427246e-01 -4.1869449615478516e-01
+ 2.8186509013175964e-01
+ <_>
+
+ 1 0 110 -2.0355919376015663e-02 -1 -2 111
+ -2.8686519712209702e-02
+
+ -3.6494150757789612e-01 -5.3867787122726440e-01
+ 3.4767881035804749e-01
+ <_>
+
+ 1 0 112 -7.1101690991781652e-05 -1 -2 113
+ 2.0686469506472349e-03
+
+ -4.0156790614128113e-01 3.2963660359382629e-01
+ -7.0951050519943237e-01
+ <_>
+
+ 1 0 114 1.1430920567363501e-03 -1 -2 115
+ -8.8636036962270737e-03
+
+ 4.4172981381416321e-01 1.8426130712032318e-01
+ -4.1275170445442200e-01
+ <_>
+ 15
+ -2.2203750610351562e+00
+
+ <_>
+
+ 1 0 116 -7.7637642621994019e-02 -1 -2 117
+ -8.4830820560455322e-03
+
+ -4.9321529269218445e-01 7.8138542175292969e-01
+ -3.6062291264533997e-01
+ <_>
+
+ 1 0 118 -1.7180460272356868e-03 -1 -2 119
+ 2.4740949273109436e-02
+
+ -4.7690048813819885e-01 -3.2420080900192261e-01
+ 5.9280002117156982e-01
+ <_>
+
+ 0 1 120 3.3028100151568651e-03 -1 -2 121
+ -3.4622039645910263e-02
+
+ -5.3991597890853882e-01 5.2076727151870728e-01
+ -3.3530798554420471e-01
+ <_>
+
+ 1 0 122 -7.1505777304992080e-04 -1 -2 123
+ -9.0145105496048927e-03
+
+ -4.8981699347496033e-01 -7.7969801425933838e-01
+ 3.6586359143257141e-01
+ <_>
+
+ 1 0 124 -1.0250939521938562e-03 -1 -2 125
+ -5.5693178437650204e-03
+
+ -4.6970510482788086e-01 -6.9695621728897095e-01
+ 3.5025438666343689e-01
+ <_>
+
+ 0 1 126 1.3235070509836078e-03 -1 -2 127
+ -3.3737940248101950e-03
+
+ -4.4707980751991272e-01 -5.6195151805877686e-01
+ 3.1833809614181519e-01
+ <_>
+
+ 1 0 128 -6.4095242123585194e-05 -1 -2 129
+ -2.7294119354337454e-03
+
+ -3.5473638772964478e-01 4.1285240650177002e-01
+ -3.1416821479797363e-01
+ <_>
+
+ 0 1 130 6.3087652961257845e-05 -1 -2 131
+ -1.5436099842190742e-02
+
+ -3.5946568846702576e-01 -6.1329078674316406e-01
+ 3.4301999211311340e-01
+ <_>
+
+ 0 1 132 -2.1025019232183695e-03 -1 -2 133
+ -1.6849569976329803e-02
+
+ -7.6962250471115112e-01 3.6569809913635254e-01
+ -2.1210379898548126e-01
+ <_>
+
+ 0 1 134 5.6847798987291753e-05 -1 -2 135
+ 5.9984489344060421e-03
+
+ -4.0466558933258057e-01 2.8503778576850891e-01
+ -5.8756178617477417e-01
+ <_>
+
+ 1 0 136 6.1389962211251259e-03 -1 -2 137
+ -2.8117469628341496e-04
+
+ -8.7189829349517822e-01 2.5182509422302246e-01
+ -3.1868219375610352e-01
+ <_>
+
+ 1 0 138 -4.5429798774421215e-03 -1 -2 139
+ -3.2167110592126846e-02
+
+ -3.6724218726158142e-01 -7.9481202363967896e-01
+ 2.8887200355529785e-01
+ <_>
+
+ 1 0 140 5.0912089645862579e-03 -1 -2 141
+ -1.5173070132732391e-03
+
+ -7.1477490663528442e-01 4.4514629244804382e-01
+ -9.5207341015338898e-02
+ <_>
+
+ 1 0 142 -6.0079508693888783e-04 -1 -2 143
+ 4.4868541881442070e-03
+
+ -3.6021450161933899e-01 2.8276360034942627e-01
+ -7.2084128856658936e-01
+ <_>
+
+ 1 0 144 -3.7957848981022835e-03 -1 -2 145
+ -9.1829998418688774e-03
+
+ -2.8717440366744995e-01 5.0479042530059814e-01
+ -7.0781037211418152e-02
+ <_>
+ 17
+ -2.1757249832153320e+00
+
+ <_>
+
+ 1 0 146 -5.5760249495506287e-02 -1 -2 147
+ -5.9436690062284470e-02
+
+ -5.5854648351669312e-01 6.8943697214126587e-01
+ -3.7195080518722534e-01
+ <_>
+
+ 0 1 148 -5.4637178778648376e-02 -1 -2 149
+ 2.3608359694480896e-01
+
+ 5.3040331602096558e-01 -4.7355309128761292e-01
+ 4.6322488784790039e-01
+ <_>
+
+ 1 0 150 -9.4560505822300911e-03 -1 -2 151
+ -5.3182709962129593e-02
+
+ -3.2544779777526855e-01 6.3468569517135620e-01
+ -2.8268361091613770e-01
+ <_>
+
+ 1 0 152 -1.0638199746608734e-02 -1 -2 153
+ -2.1207019686698914e-02
+
+ -5.5776351690292358e-01 3.9049190282821655e-01
+ -4.2111930251121521e-01
+ <_>
+
+ 1 0 154 -5.6731878430582583e-05 -1 -2 155
+ -4.4976451317779720e-04
+
+ -4.1803309321403503e-01 3.7355789542198181e-01
+ -3.9199641346931458e-01
+ <_>
+
+ 1 0 156 2.7574670966714621e-03 -1 -2 157
+ 2.5649419985711575e-03
+
+ -7.9104632139205933e-01 1.9258180260658264e-01
+ -7.5344461202621460e-01
+ <_>
+
+ 0 1 158 -9.4359368085861206e-03 -1 -2 159
+ 1.4136210083961487e-03
+
+ 4.4834750890731812e-01 -3.3878430724143982e-01
+ 4.4291919469833374e-01
+ <_>
+
+ 1 0 160 3.9976350963115692e-03 -1 -2 161
+ -1.5278969658538699e-03
+
+ -6.6637581586837769e-01 3.1292399764060974e-01
+ -2.8027990460395813e-01
+ <_>
+
+ 1 0 162 -3.2376639865105972e-05 -1 -2 163
+ 1.6323389718309045e-03
+
+ -4.6672090888023376e-01 2.7995559573173523e-01
+ -6.1321508884429932e-01
+ <_>
+
+ 1 0 164 7.7096219174563885e-03 -1 -2 165
+ -7.8599318861961365e-02
+
+ 2.0352549850940704e-01 7.2726912796497345e-02
+ -6.8677097558975220e-01
+ <_>
+
+ 0 1 166 -3.6581400781869888e-03 -1 -2 167
+ -4.2612198740243912e-02
+
+ -6.8079459667205811e-01 -8.4551781415939331e-01
+ 1.5990570187568665e-01
+ <_>
+
+ 1 0 168 -4.8822778626345098e-04 -1 -2 169
+ -4.6951142139732838e-03
+
+ -4.7945699095726013e-01 -8.2234281301498413e-01
+ 2.0431579649448395e-01
+ <_>
+
+ 0 1 170 6.1706348787993193e-05 -1 -2 171
+ 1.3809910044074059e-02
+
+ -3.1742820143699646e-01 3.0769300460815430e-01
+ -4.3544968962669373e-01
+ <_>
+
+ 0 1 172 -4.2187729850411415e-03 -1 -2 173
+ -3.9540808647871017e-03
+
+ 6.2499982118606567e-01 1.3225209712982178e-01
+ -3.9745101332664490e-01
+ <_>
+
+ 1 0 174 2.2203531116247177e-03 -1 -2 175
+ 6.2806582718621939e-05
+
+ -6.0045331716537476e-01 -2.2429980337619781e-01
+ 2.9768520593643188e-01
+ <_>
+
+ 1 0 176 2.3292789701372385e-03 -1 -2 177
+ -5.3711822256445885e-03
+
+ -7.5982081890106201e-01 2.6484918594360352e-01
+ -2.6005539298057556e-01
+ <_>
+
+ 0 1 178 6.4782587287481874e-05 -1 -2 179
+ 7.6606678776443005e-03
+
+ -3.2119300961494446e-01 2.4176409840583801e-01
+ -8.3822727203369141e-01
+ <_>
+ 19
+ -2.2618789672851562e+00
+
+ <_>
+
+ 1 0 180 -1.4848279766738415e-02 -1 -2 181
+ -1.6066679963842034e-03
+
+ -5.3391128778457642e-01 7.6002711057662964e-01
+ -2.1091739833354950e-01
+ <_>
+
+ 1 0 182 -1.5651920437812805e-01 -1 -2 183
+ -5.5439779534935951e-03
+
+ -4.2818549275398254e-01 6.5620750188827515e-01
+ -2.2949840128421783e-01
+ <_>
+
+ 1 0 184 -1.9448339939117432e-02 -1 -2 185
+ 7.6653067953884602e-03
+
+ -4.4212520122528076e-01 -3.3950591087341309e-01
+ 4.6587219834327698e-01
+ <_>
+
+ 0 1 186 -2.1142010390758514e-01 -1 -2 187
+ -1.0628429800271988e-01
+
+ 5.5007970333099365e-01 6.8280947208404541e-01
+ -3.0987739562988281e-01
+ <_>
+
+ 1 0 188 -5.2653599530458450e-02 -1 -2 189
+ -5.3522300731856376e-05
+
+ -3.4818819165229797e-01 5.0566762685775757e-01
+ -2.5229519605636597e-01
+ <_>
+
+ 0 1 190 -5.7972650974988937e-03 -1 -2 191
+ -3.7428899668157101e-03
+
+ 3.0238011479377747e-01 2.2873230278491974e-01
+ -4.8366579413414001e-01
+ <_>
+
+ 1 0 192 -5.2694038458866999e-05 -1 -2 193
+ -1.1983739677816629e-03
+
+ -3.7988960742950439e-01 -6.7442452907562256e-01
+ 2.8611260652542114e-01
+ <_>
+
+ 1 0 194 2.2544799372553825e-02 -1 -2 195
+ 3.1783939339220524e-03
+
+ 4.7565719485282898e-01 -2.8893348574638367e-01
+ 5.5509638786315918e-01
+ <_>
+
+ 1 0 196 3.4742769785225391e-03 -1 -2 197
+ -8.1408787518739700e-03
+
+ -5.9826552867889404e-01 -5.5933791399002075e-01
+ 2.2349210083484650e-01
+ <_>
+
+ 0 1 198 -3.0238809995353222e-03 -1 -2 199
+ -5.9159598313271999e-03
+
+ 4.5917978882789612e-01 6.2234902381896973e-01
+ -2.4468150734901428e-01
+ <_>
+
+ 1 0 200 2.3184430319815874e-03 -1 -2 201
+ 7.7198208309710026e-03
+
+ -6.0478079319000244e-01 2.1004509925842285e-01
+ -6.4331281185150146e-01
+ <_>
+
+ 0 1 202 -5.5973320268094540e-03 -1 -2 203
+ 2.0320380281191319e-04
+
+ -7.1625810861587524e-01 -3.8018029928207397e-01
+ 2.1336899697780609e-01
+ <_>
+
+ 1 0 204 -3.8205389864742756e-03 -1 -2 205
+ 4.8883338458836079e-03
+
+ -3.5957258939743042e-01 2.6471930742263794e-01
+ -5.8996689319610596e-01
+ <_>
+
+ 0 1 206 -1.3334590476006269e-03 -1 -2 207
+ -1.5447080368176103e-03
+
+ 3.2258489727973938e-01 3.6971050500869751e-01
+ -3.1308570504188538e-01
+ <_>
+
+ 0 1 208 7.5150746852159500e-05 -1 -2 209
+ -1.1108840117231011e-03
+
+ -3.4674531221389771e-01 -5.7477539777755737e-01
+ 2.9201140999794006e-01
+ <_>
+
+ 1 0 210 -1.6881119518075138e-04 -1 -2 211
+ -1.2814450019504875e-04
+
+ -3.6041781306266785e-01 3.5043209791183472e-01
+ -2.2014050185680389e-01
+ <_>
+
+ 1 0 212 1.9546970725059509e-02 -1 -2 213
+ -1.1061180382966995e-02
+
+ 4.1295918822288513e-01 2.5962719321250916e-01
+ -3.4875950217247009e-01
+ <_>
+
+ 1 0 214 1.8147419905290008e-03 -1 -2 215
+ -7.1724010631442070e-03
+
+ -5.2019888162612915e-01 2.7452668547630310e-01
+ -2.6828849315643311e-01
+ <_>
+
+ 1 0 216 2.2158189676702023e-03 -1 -2 217
+ -9.6856858581304550e-03
+
+ -5.7340908050537109e-01 -5.8028572797775269e-01
+ 1.8564410507678986e-01
+ <_>
+ 19
+ -2.0994780063629150e+00
+
+ <_>
+
+ 0 1 218 -1.2065219692885876e-02 -1 -2 219
+ -4.9067771434783936e-01
+
+ 6.1679571866989136e-01 1.4063939452171326e-01
+ -5.5357742309570312e-01
+ <_>
+
+ 1 0 220 -6.6585717722773552e-03 -1 -2 221
+ 1.5827560797333717e-02
+
+ -5.1332288980484009e-01 -3.6301520466804504e-01
+ 4.3343341350555420e-01
+ <_>
+
+ 0 1 222 -1.4081180095672607e-02 -1 -2 223
+ -1.2139449827373028e-02
+
+ 5.4223722219467163e-01 4.4281288981437683e-01
+ -3.4171119332313538e-01
+ <_>
+
+ 0 1 224 7.8055798076093197e-03 -1 -2 225
+ -7.0759910158813000e-05
+
+ -4.8659759759902954e-01 3.4818679094314575e-01
+ -3.2806739211082458e-01
+ <_>
+
+ 0 1 226 -1.8199630081653595e-02 -1 -2 227
+ -2.5289389304816723e-03
+
+ 5.6594151258468628e-01 1.1310060322284698e-01
+ -4.0772381424903870e-01
+ <_>
+
+ 1 0 228 1.0156990028917789e-03 -1 -2 229
+ 2.9432660085149109e-04
+
+ -5.9842979907989502e-01 2.8439450263977051e-01
+ -3.2190230488777161e-01
+ <_>
+
+ 1 0 230 2.0865290425717831e-03 -1 -2 231
+ -1.7371569992974401e-03
+
+ -7.8285712003707886e-01 3.3585301041603088e-01
+ -2.0582370460033417e-01
+ <_>
+
+ 1 0 232 -7.0026202592998743e-05 -1 -2 233
+ -1.4891549944877625e-03
+
+ -3.9109349250793457e-01 -4.6953418850898743e-01
+ 2.7609241008758545e-01
+ <_>
+
+ 1 0 234 -1.1788429692387581e-02 -1 -2 235
+ -1.5155089786276221e-03
+
+ -4.0114149451255798e-01 -7.4290478229522705e-01
+ 2.7695629000663757e-01
+ <_>
+
+ 1 0 236 6.8396717309951782e-02 -1 -2 237
+ -7.6441407203674316e-02
+
+ 4.5235648751258850e-01 4.2848169803619385e-01
+ -3.1636309623718262e-01
+ <_>
+
+ 1 0 238 6.8310201168060303e-02 -1 -2 239
+ -6.4508013427257538e-02
+
+ 5.1404279470443726e-01 1.8081870675086975e-01
+ -3.4217950701713562e-01
+ <_>
+
+ 0 1 240 -2.8335719835013151e-03 -1 -2 241
+ -9.9732237868010998e-04
+
+ -6.9509768486022949e-01 -4.3724590539932251e-01
+ 2.0226080715656281e-01
+ <_>
+
+ 0 1 242 -2.2869910299777985e-01 -1 -2 243
+ 2.9855249449610710e-03
+
+ 6.4662200212478638e-01 8.1149758771061897e-03
+ -6.0210299491882324e-01
+ <_>
+
+ 0 1 244 -2.9535989742726088e-03 -1 -2 245
+ -2.1225619129836559e-03
+
+ -7.2013127803802490e-01 5.0875622034072876e-01
+ -5.9366609901189804e-02
+ <_>
+
+ 0 1 246 -2.9382819775491953e-03 -1 -2 247
+ -5.8961478061974049e-03
+
+ 3.9287531375885010e-01 4.1866040229797363e-01
+ -2.5405511260032654e-01
+ <_>
+
+ 1 0 248 2.5730929337441921e-03 -1 -2 249
+ 1.6647739335894585e-02
+
+ -5.8707278966903687e-01 1.9208480417728424e-01
+ -6.0388940572738647e-01
+ <_>
+
+ 1 0 250 2.4041840806603432e-03 -1 -2 251
+ -9.0452830772846937e-04
+
+ -5.7192337512969971e-01 3.4860768914222717e-01
+ -1.3049240410327911e-01
+ <_>
+
+ 1 0 252 4.0814210660755634e-03 -1 -2 253
+ 3.3811479806900024e-03
+
+ 5.1778018474578857e-01 -6.3828541897237301e-03
+ -6.1447817087173462e-01
+ <_>
+
+ 0 1 254 -2.7499340940266848e-03 -1 -2 255
+ -4.8207710497081280e-03
+
+ -6.5407788753509521e-01 -6.0029619932174683e-01
+ 1.4374589920043945e-01
+ <_>
+ 21
+ -2.1254189014434814e+00
+
+ <_>
+
+ 0 1 256 7.9710120335221291e-03 -1 -2 257
+ -9.7160867881029844e-04
+
+ -6.1992239952087402e-01 5.4877161979675293e-01
+ -4.0606960654258728e-01
+ <_>
+
+ 0 1 258 -1.0945869609713554e-02 -1 -2 259
+ -6.1174821108579636e-02
+
+ 4.6936869621276855e-01 3.0570849776268005e-01
+ -4.4459891319274902e-01
+ <_>
+
+ 1 0 260 -2.3100150283426046e-03 -1 -2 261
+ -4.7585051506757736e-02
+
+ -3.7816441059112549e-01 4.8865839838981628e-01
+ -2.9728868603706360e-01
+ <_>
+
+ 1 0 262 -2.5944279041141272e-03 -1 -2 263
+ -3.9469371549785137e-03
+
+ -5.4405367374420166e-01 3.6382490396499634e-01
+ -3.0469849705696106e-01
+ <_>
+
+ 0 1 264 3.1871569808572531e-04 -1 -2 265
+ -2.6655721012502909e-03
+
+ -4.6822971105575562e-01 3.3131968975067139e-01
+ -2.9918238520622253e-01
+ <_>
+
+ 1 0 266 -3.9534650743007660e-02 -1 -2 267
+ -9.4085611635819077e-04
+
+ -3.5316830873489380e-01 4.4447100162506104e-01
+ -1.1088660359382629e-01
+ <_>
+
+ 0 1 268 6.9526307925116271e-05 -1 -2 269
+ -9.6976682543754578e-03
+
+ -3.9403268694877625e-01 5.7181888818740845e-01
+ -1.6370950266718864e-02
+ <_>
+
+ 1 0 270 3.9469040930271149e-02 -1 -2 271
+ -8.2811042666435242e-03
+
+ 6.9152122735977173e-01 1.3349990546703339e-01
+ -4.7064480185508728e-01
+ <_>
+
+ 0 1 272 -4.3219728395342827e-03 -1 -2 273
+ -5.5436040274798870e-03
+
+ 3.8239258527755737e-01 1.5645879507064819e-01
+ -4.1088208556175232e-01
+ <_>
+
+ 1 0 274 -5.9953341406071559e-05 -1 -2 275
+ -5.9089371934533119e-03
+
+ -3.9221799373626709e-01 -5.9083867073059082e-01
+ 2.7924481034278870e-01
+ <_>
+
+ 0 1 276 -4.4721391052007675e-02 -1 -2 277
+ 4.1267018765211105e-02
+
+ 4.1454491019248962e-01 -3.2242009043693542e-01
+ 3.7849879264831543e-01
+ <_>
+
+ 0 1 278 5.6728709751041606e-05 -1 -2 279
+ -6.2427870929241180e-02
+
+ -3.2228040695190430e-01 -5.9666448831558228e-01
+ 2.8915780782699585e-01
+ <_>
+
+ 0 1 280 -5.6994128972291946e-03 -1 -2 281
+ 7.5202910229563713e-03
+
+ 3.7499341368675232e-01 -2.8132459521293640e-01
+ 5.0988858938217163e-01
+ <_>
+
+ 0 1 282 -3.3640549518167973e-03 -1 -2 283
+ -6.8076648749411106e-03
+
+ -6.3978207111358643e-01 -7.3105818033218384e-01
+ 1.4475250244140625e-01
+ <_>
+
+ 1 0 284 1.2633459642529488e-02 -1 -2 285
+ -2.9199919663369656e-03
+
+ -7.7725297212600708e-01 2.3258599638938904e-01
+ -2.0490600168704987e-01
+ <_>
+
+ 0 1 286 -3.0582249164581299e-02 -1 -2 287
+ -2.7796169742941856e-03
+
+ -6.5738821029663086e-01 -5.4888349771499634e-01
+ 1.3837890326976776e-01
+ <_>
+
+ 0 1 288 -7.6163080520927906e-03 -1 -2 289
+ -1.8409560434520245e-03
+
+ -3.5912349820137024e-01 2.2404469549655914e-01
+ -3.7881860136985779e-01
+ <_>
+
+ 0 1 290 -3.9200261235237122e-02 -1 -2 291
+ -2.2543789818882942e-03
+
+ 5.0090551376342773e-01 3.1364008784294128e-01
+ -2.2131860256195068e-01
+ <_>
+
+ 1 0 292 2.3894659243524075e-03 -1 -2 293
+ -1.0725490283221006e-03
+
+ -5.8699512481689453e-01 4.7141209244728088e-01
+ -3.2570488750934601e-02
+ <_>
+
+ 0 1 294 8.9095337898470461e-05 -1 -2 295
+ 1.6920049674808979e-03
+
+ -3.0444309115409851e-01 3.0280891060829163e-01
+ -3.8902729749679565e-01
+ <_>
+
+ 1 0 296 1.1784000322222710e-02 -1 -2 297
+ 3.9335917681455612e-03
+
+ -6.8993437290191650e-01 -6.7763939499855042e-02
+ 4.6499788761138916e-01
+ <_>
+ 22
+ -2.0614759922027588e+00
+
+ <_>
+
+ 0 1 298 1.1430840007960796e-02 -1 -2 299
+ -3.2242920249700546e-02
+
+ -3.9274570345878601e-01 6.5568798780441284e-01
+ -3.1068810820579529e-01
+ <_>
+
+ 1 0 300 -1.8382760463282466e-03 -1 -2 301
+ -1.0764399915933609e-01
+
+ -4.0825068950653076e-01 4.3280079960823059e-01
+ -4.2263451218605042e-01
+ <_>
+
+ 1 0 302 -2.3866090923547745e-03 -1 -2 303
+ 8.6586214601993561e-03
+
+ -4.6435201168060303e-01 -4.0673071146011353e-01
+ 4.1267868876457214e-01
+ <_>
+
+ 1 0 304 -1.6437229933217168e-03 -1 -2 305
+ -9.8511137068271637e-02
+
+ -2.1344049274921417e-01 6.8432319164276123e-01
+ -9.7035013139247894e-02
+ <_>
+
+ 0 1 306 4.4292360544204712e-03 -1 -2 307
+ 4.6966210938990116e-03
+
+ -3.9498910307884216e-01 -1.1345980316400528e-01
+ 4.9681991338729858e-01
+ <_>
+
+ 1 0 308 -8.8480701670050621e-03 -1 -2 309
+ -6.7258379422128201e-03
+
+ -3.1293100118637085e-01 -6.1635792255401611e-01
+ 3.1764769554138184e-01
+ <_>
+
+ 1 0 310 2.0052040927112103e-03 -1 -2 311
+ -1.3407340273261070e-02
+
+ 3.1724271178245544e-01 1.9735060632228851e-01
+ -3.7199181318283081e-01
+ <_>
+
+ 0 1 312 -4.4199679978191853e-03 -1 -2 313
+ -3.2800938934087753e-02
+
+ -5.7164478302001953e-01 3.0599930882453918e-01
+ -1.7397969961166382e-01
+ <_>
+
+ 0 1 314 4.9407979531679302e-05 -1 -2 315
+ 4.1550169698894024e-03
+
+ -2.8270530700683594e-01 2.9686808586120605e-01
+ -4.8494309186935425e-01
+ <_>
+
+ 1 0 316 -7.5589967309497297e-05 -1 -2 317
+ -3.2147730235010386e-03
+
+ -3.8531139492988586e-01 -6.3306808471679688e-01
+ 2.3434750735759735e-01
+ <_>
+
+ 0 1 318 1.6021779738366604e-03 -1 -2 319
+ -1.9478019326925278e-02
+
+ -2.9579049348831177e-01 -4.9625208973884583e-01
+ 2.6092579960823059e-01
+ <_>
+
+ 0 1 320 -2.5193750858306885e-02 -1 -2 321
+ -4.6487729996442795e-02
+
+ 3.9384880661964417e-01 2.2168830037117004e-01
+ -2.9691740870475769e-01
+ <_>
+
+ 1 0 322 4.3414267711341381e-03 -1 -2 323
+ -2.4886759929358959e-03
+
+ -6.7661178112030029e-01 2.0509929955005646e-01
+ -2.9771140217781067e-01
+ <_>
+
+ 0 1 324 -5.8827269822359085e-03 -1 -2 325
+ 9.0498890494927764e-04
+
+ -6.1301797628402710e-01 -3.4023219347000122e-01
+ 1.8168209493160248e-01
+ <_>
+
+ 0 1 326 -9.8338901996612549e-02 -1 -2 327
+ 5.6141808629035950e-02
+
+ 4.7729569673538208e-01 -2.2904439270496368e-01
+ 3.4410089254379272e-01
+ <_>
+
+ 1 0 328 -5.5787130258977413e-03 -1 -2 329
+ 1.5108759980648756e-03
+
+ -3.5910171270370483e-01 2.4900430440902710e-01
+ -4.3798071146011353e-01
+ <_>
+
+ 0 1 330 -6.0129738412797451e-03 -1 -2 331
+ -7.9341192031279206e-04
+
+ 3.1164181232452393e-01 2.6759660243988037e-01
+ -3.6802908778190613e-01
+ <_>
+
+ 1 0 332 6.1855330131947994e-03 -1 -2 333
+ -7.3785060085356236e-03
+
+ -7.2153317928314209e-01 -5.3714382648468018e-01
+ 1.3824890553951263e-01
+ <_>
+
+ 0 1 334 -6.7488732747733593e-04 -1 -2 335
+ -1.3102099765092134e-03
+
+ 3.7406051158905029e-01 1.9003790616989136e-01
+ -3.1632271409034729e-01
+ <_>
+
+ 0 1 336 4.9453211249783635e-04 -1 -2 337
+ 1.2824690202251077e-03
+
+ -2.3283170163631439e-01 3.0463808774948120e-01
+ -4.8092108964920044e-01
+ <_>
+
+ 0 1 338 -2.2624820470809937e-02 -1 -2 339
+ 4.3685249984264374e-03
+
+ -6.8783479928970337e-01 1.2403090298175812e-01
+ -7.9220730066299438e-01
+ <_>
+
+ 1 0 340 5.6756488047540188e-03 -1 -2 341
+ -8.1769213080406189e-02
+
+ 1.7611420154571533e-01 3.8942161202430725e-01
+ -4.5094010233879089e-01
+ <_>
+ 24
+ -1.9795049428939819e+00
+
+ <_>
+
+ 1 0 342 -2.0003549754619598e-02 -1 -2 343
+ -3.2621208578348160e-02
+
+ -5.6650751829147339e-01 5.0807082653045654e-01
+ -4.5345708727836609e-01
+ <_>
+
+ 0 1 344 1.0668139904737473e-02 -1 -2 345
+ -1.6276689246296883e-02
+
+ -3.2316839694976807e-01 6.0189497470855713e-01
+ -2.4059510231018066e-01
+ <_>
+
+ 1 0 346 -2.8211208991706371e-03 -1 -2 347
+ -1.4291180297732353e-02
+
+ -4.7181150317192078e-01 5.1280087232589722e-01
+ -1.0744000226259232e-01
+ <_>
+
+ 0 1 348 1.0120410006493330e-03 -1 -2 349
+ -5.9822672046720982e-03
+
+ -3.8844698667526245e-01 4.6928858757019043e-01
+ -9.1355919837951660e-02
+ <_>
+
+ 1 0 350 -2.4705699179321527e-03 -1 -2 351
+ 2.4079859722405672e-03
+
+ -4.5964410901069641e-01 2.1830670535564423e-01
+ -5.9373402595520020e-01
+ <_>
+
+ 1 0 352 -1.4312269631773233e-03 -1 -2 353
+ 2.9141810955479741e-04
+
+ -2.4731670320034027e-01 -2.5972241163253784e-01
+ 3.8206368684768677e-01
+ <_>
+
+ 0 1 354 -3.2818811014294624e-03 -1 -2 355
+ -1.0365940397605300e-03
+
+ -7.7180129289627075e-01 2.3569859564304352e-01
+ -2.2067700326442719e-01
+ <_>
+
+ 0 1 356 -2.2078400943428278e-03 -1 -2 357
+ 3.5239339340478182e-03
+
+ 3.0886119604110718e-01 -2.8496000170707703e-01
+ 4.7544300556182861e-01
+ <_>
+
+ 0 1 358 -6.1774807982146740e-03 -1 -2 359
+ -3.2023619860410690e-03
+
+ -7.0318382978439331e-01 -5.1361310482025146e-01
+ 1.5656259655952454e-01
+ <_>
+
+ 1 0 360 -8.7003601947799325e-04 -1 -2 361
+ -3.8079950027167797e-03
+
+ -2.9925128817558289e-01 5.5215638875961304e-01
+ -8.0608041025698185e-04
+ <_>
+
+ 1 0 362 4.9994210712611675e-03 -1 -2 363
+ -1.0323170572519302e-03
+
+ -4.3541741371154785e-01 5.4992151260375977e-01
+ -5.0770761445164680e-03
+ <_>
+
+ 1 0 364 6.9215619005262852e-03 -1 -2 365
+ -8.1578325480222702e-03
+
+ 3.3900010585784912e-01 3.4354889392852783e-01
+ -2.4483889341354370e-01
+ <_>
+
+ 0 1 366 -1.6159559600055218e-03 -1 -2 367
+ 4.7165839932858944e-03
+
+ -7.4653702974319458e-01 1.1855059862136841e-01
+ -7.1803867816925049e-01
+ <_>
+
+ 1 0 368 -1.6093119978904724e-02 -1 -2 369
+ -5.9861610643565655e-03
+
+ -3.2987210154533386e-01 3.1263980269432068e-01
+ -2.3194029927253723e-01
+ <_>
+
+ 1 0 370 6.4122617244720459e-02 -1 -2 371
+ 2.1518159657716751e-02
+
+ 4.6239149570465088e-01 -2.4277320504188538e-01
+ 4.0963909029960632e-01
+ <_>
+
+ 0 1 372 -2.8541380167007446e-01 -1 -2 373
+ 2.7372559998184443e-04
+
+ 4.4521799683570862e-01 -4.7307610511779785e-01
+ 7.6739721000194550e-02
+ <_>
+
+ 0 1 374 -6.4039281569421291e-03 -1 -2 375
+ 1.4279670082032681e-02
+
+ -5.6167787313461304e-01 -6.7311890423297882e-02
+ 4.3806758522987366e-01
+ <_>
+
+ 0 1 376 -1.3179860077798367e-02 -1 -2 377
+ 6.6828072071075439e-02
+
+ -6.7672669887542725e-01 -3.2182909548282623e-02
+ 5.1308721303939819e-01
+ <_>
+
+ 0 1 378 6.3021448440849781e-03 -1 -2 379
+ -1.6806010389700532e-03
+
+ -2.0082660019397736e-01 -5.1767241954803467e-01
+ 3.8576510548591614e-01
+ <_>
+
+ 0 1 380 -1.5057720011100173e-03 -1 -2 381
+ 1.1699240421876311e-03
+
+ 3.9358091354370117e-01 -2.5579568743705750e-01
+ 3.1927299499511719e-01
+ <_>
+
+ 1 0 382 7.2735180146992207e-03 -1 -2 383
+ 7.8693883551750332e-05
+
+ -7.1667242050170898e-01 -1.8908829987049103e-01
+ 2.3849080502986908e-01
+ <_>
+
+ 1 0 384 1.9624589476734400e-03 -1 -2 385
+ -3.1472831033170223e-03
+
+ -5.1583772897720337e-01 4.8033049702644348e-01
+ -3.6237910389900208e-02
+ <_>
+
+ 1 0 386 5.0133569166064262e-03 -1 -2 387
+ -6.5994369797408581e-03
+
+ -5.2729338407516479e-01 -6.9400531053543091e-01
+ 1.2275890260934830e-01
+ <_>
+
+ 0 1 388 -4.2700361460447311e-02 -1 -2 389
+ -3.5096149076707661e-05
+
+ -6.8218547105789185e-01 1.2160310149192810e-01
+ -4.2142289876937866e-01
+ <_>
+ 24
+ -1.9048260450363159e+00
+
+ <_>
+
+ 0 1 390 8.7128365412354469e-03 -1 -2 391
+ -4.0675927884876728e-03
+
+ -4.4048839807510376e-01 6.0030102729797363e-01
+ -2.6042649149894714e-01
+ <_>
+
+ 1 0 392 -8.3933398127555847e-02 -1 -2 393
+ -2.2626180201768875e-02
+
+ -3.7943989038467407e-01 5.2529489994049072e-01
+ -3.2733321189880371e-01
+ <_>
+
+ 1 0 394 -3.5725389607250690e-03 -1 -2 395
+ -1.6297569964081049e-03
+
+ -2.6030939817428589e-01 4.8434230685234070e-01
+ -3.8363268971443176e-01
+ <_>
+
+ 0 1 396 -8.0011576414108276e-02 -1 -2 397
+ -9.6061453223228455e-02
+
+ 3.9579561352729797e-01 4.2874181270599365e-01
+ -2.9096639156341553e-01
+ <_>
+
+ 1 0 398 -9.3183852732181549e-03 -1 -2 399
+ 9.2205153778195381e-03
+
+ -3.9325499534606934e-01 -2.9857379198074341e-01
+ 3.1733301281929016e-01
+ <_>
+
+ 1 0 400 2.3208750411868095e-02 -1 -2 401
+ 1.6389730153605342e-03
+
+ 3.9295229315757751e-01 -5.4035997390747070e-01
+ -2.1836880594491959e-02
+ <_>
+
+ 1 0 402 2.8872499242424965e-03 -1 -2 403
+ 4.7465260140597820e-03
+
+ -7.8172737360000610e-01 1.4474189281463623e-01
+ -6.4237701892852783e-01
+ <_>
+
+ 0 1 404 -5.7432148605585098e-03 -1 -2 405
+ -8.5324952378869057e-03
+
+ -6.5556287765502930e-01 2.2090309858322144e-01
+ -2.5790300965309143e-01
+ <_>
+
+ 0 1 406 -8.8752172887325287e-03 -1 -2 407
+ -7.7129527926445007e-03
+
+ 4.6596860885620117e-01 2.5279781222343445e-01
+ -2.6170450448989868e-01
+ <_>
+
+ 1 0 408 7.6909800991415977e-03 -1 -2 409
+ 2.6657560374587774e-03
+
+ -5.9350818395614624e-01 1.6969729959964752e-01
+ -5.4123950004577637e-01
+ <_>
+
+ 1 0 410 -4.4685939792543650e-04 -1 -2 411
+ -1.5998890157788992e-03
+
+ -3.0383870005607605e-01 -5.4817748069763184e-01
+ 2.4971559643745422e-01
+ <_>
+
+ 1 0 412 1.9368670182302594e-03 -1 -2 413
+ -2.4878541007637978e-03
+
+ -6.3200348615646362e-01 4.7051379084587097e-01
+ -4.5187219977378845e-02
+ <_>
+
+ 0 1 414 -2.8134910389780998e-03 -1 -2 415
+ -1.4107710449025035e-03
+
+ 3.9270851016044617e-01 1.8017080426216125e-01
+ -2.5714579224586487e-01
+ <_>
+
+ 0 1 416 -6.9013070315122604e-03 -1 -2 417
+ -1.1458620429039001e-03
+
+ -5.3386241197586060e-01 2.8174358606338501e-01
+ -1.6080249845981598e-01
+ <_>
+
+ 0 1 418 9.2800445854663849e-03 -1 -2 419
+ -4.1281301528215408e-02
+
+ -3.0028960108757019e-01 -6.2409067153930664e-01
+ 2.0549909770488739e-01
+ <_>
+
+ 0 1 420 -3.5625360906124115e-02 -1 -2 421
+ -4.1647539474070072e-03
+
+ -5.2529340982437134e-01 -6.3538008928298950e-01
+ 1.2846650183200836e-01
+ <_>
+
+ 0 1 422 -9.5598259940743446e-04 -1 -2 423
+ -8.9347851462662220e-04
+
+ 2.6505509018898010e-01 1.8266810476779938e-01
+ -3.7531790137290955e-01
+ <_>
+
+ 1 0 424 2.5431478861719370e-03 -1 -2 425
+ -1.5853889286518097e-02
+
+ -6.1057221889495850e-01 3.0754768848419189e-01
+ -9.8143920302391052e-02
+ <_>
+
+ 0 1 426 -4.1315760463476181e-02 -1 -2 427
+ -6.8226549774408340e-04
+
+ 4.9247589707374573e-01 6.2975943088531494e-02
+ -4.2634299397468567e-01
+ <_>
+
+ 1 0 428 6.3098431564867496e-04 -1 -2 429
+ -2.8946860693395138e-03
+
+ 3.1397339701652527e-01 2.8590971231460571e-01
+ -2.5623229146003723e-01
+ <_>
+
+ 0 1 430 -1.0244140401482582e-02 -1 -2 431
+ -1.6979850828647614e-02
+
+ -6.9737482070922852e-01 -7.3125731945037842e-01
+ 1.0389179736375809e-01
+ <_>
+
+ 1 0 432 -7.0198569446802139e-03 -1 -2 433
+ -6.0688778758049011e-03
+
+ -3.5070639848709106e-01 -5.3395807743072510e-01
+ 1.7334850132465363e-01
+ <_>
+
+ 0 1 434 -9.6911415457725525e-03 -1 -2 435
+ 8.5460003465414047e-03
+
+ 5.6399798393249512e-01 -2.4716490507125854e-01
+ 1.8216520547866821e-01
+ <_>
+
+ 1 0 436 -4.9479231238365173e-03 -1 -2 437
+ 1.9269150216132402e-03
+
+ -2.8333988785743713e-01 -6.8196073174476624e-02
+ 3.7787199020385742e-01
+ <_>
+ 28
+ -1.9407349824905396e+00
+
+ <_>
+
+ 1 0 438 -2.8639819473028183e-02 -1 -2 439
+ -4.2176660150289536e-02
+
+ -3.7718260288238525e-01 7.2298699617385864e-01
+ -7.6141163706779480e-02
+ <_>
+
+ 1 0 440 -2.2537210024893284e-03 -1 -2 441
+ -3.0683329328894615e-02
+
+ -3.2727459073066711e-01 5.1505237817764282e-01
+ -2.2235199809074402e-01
+ <_>
+
+ 0 1 442 -1.2341269850730896e-01 -1 -2 443
+ -2.3674150928854942e-02
+
+ 4.4699010252952576e-01 3.4708538651466370e-01
+ -3.1773900985717773e-01
+ <_>
+
+ 0 1 444 3.1951239798218012e-03 -1 -2 445
+ -1.4915530337020755e-03
+
+ -4.9775049090385437e-01 2.6384419202804565e-01
+ -3.8912549614906311e-01
+ <_>
+
+ 0 1 446 8.8097527623176575e-04 -1 -2 447
+ -5.8355771005153656e-02
+
+ -4.0939790010452271e-01 3.2287618517875671e-01
+ -2.3045599460601807e-01
+ <_>
+
+ 1 0 448 5.1132370717823505e-03 -1 -2 449
+ -4.5418320223689079e-03
+
+ -5.1353681087493896e-01 5.3011757135391235e-01
+ -3.0649330466985703e-02
+ <_>
+
+ 1 0 450 1.6811339883133769e-03 -1 -2 451
+ 2.8129699639976025e-03
+
+ -5.3161472082138062e-01 -6.7524053156375885e-02
+ 3.8542249798774719e-01
+ <_>
+
+ 1 0 452 2.1835418883711100e-03 -1 -2 453
+ -2.4335379712283611e-03
+
+ -6.4298832416534424e-01 -6.6313308477401733e-01
+ 1.3882370293140411e-01
+ <_>
+
+ 1 0 454 3.0736608896404505e-03 -1 -2 455
+ -9.6425544470548630e-03
+
+ -6.3433158397674561e-01 3.8696160912513733e-01
+ -6.8737797439098358e-02
+ <_>
+
+ 0 1 456 -7.2082108817994595e-03 -1 -2 457
+ -8.0191977322101593e-03
+
+ 1.6121250391006470e-01 3.8011130690574646e-01
+ -4.1397979855537415e-01
+ <_>
+
+ 0 1 458 -7.2479159571230412e-03 -1 -2 459
+ -2.2631640732288361e-01
+
+ 2.4351879954338074e-01 6.0667949914932251e-01
+ -2.2521880269050598e-01
+ <_>
+
+ 0 1 460 -7.0091613451950252e-05 -1 -2 461
+ -1.8161399662494659e-01
+
+ 1.7115320265293121e-01 5.2725982666015625e-01
+ -3.5247540473937988e-01
+ <_>
+
+ 0 1 462 -9.4038434326648712e-03 -1 -2 463
+ -2.1289030555635691e-03
+
+ 3.4970518946647644e-01 5.5878698825836182e-02
+ -4.9816590547561646e-01
+ <_>
+
+ 0 1 464 -5.1798550412058830e-03 -1 -2 465
+ -6.5030192490667105e-04
+
+ -6.3095641136169434e-01 3.5856458544731140e-01
+ -7.8281052410602570e-02
+ <_>
+
+ 0 1 466 -1.0555930435657501e-02 -1 -2 467
+ -5.1852981559932232e-03
+
+ -5.5502831935882568e-01 3.5548681020736694e-01
+ -6.8892292678356171e-02
+ <_>
+
+ 0 1 468 -7.8725479543209076e-03 -1 -2 469
+ -6.5342970192432404e-03
+
+ -4.8596179485321045e-01 2.1178959310054779e-01
+ -2.3174080252647400e-01
+ <_>
+
+ 0 1 470 -1.3909920118749142e-02 -1 -2 471
+ 1.5418450348079205e-03
+
+ 5.9936982393264771e-01 -9.5086917281150818e-03
+ -6.4796131849288940e-01
+ <_>
+
+ 1 0 472 -1.1549900518730283e-03 -1 -2 473
+ -3.2687030732631683e-02
+
+ -2.7501720190048218e-01 -6.7336207628250122e-01
+ 1.9520400464534760e-01
+ <_>
+
+ 0 1 474 -2.6422590017318726e-01 -1 -2 475
+ 6.9438670761883259e-03
+
+ 3.6986869573593140e-01 -3.0029740929603577e-01
+ 1.4998969435691833e-01
+ <_>
+
+ 0 1 476 -1.2077920138835907e-02 -1 -2 477
+ -1.3986700214445591e-03
+
+ 4.1644129157066345e-01 4.1248729825019836e-01
+ -1.9533659517765045e-01
+ <_>
+
+ 1 0 478 1.3138339854776859e-02 -1 -2 479
+ 7.2417110204696655e-03
+
+ -6.4204931259155273e-01 1.1359360069036484e-01
+ -7.3838871717453003e-01
+ <_>
+
+ 0 1 480 -7.4837901629507542e-03 -1 -2 481
+ 6.8022231571376324e-03
+
+ -6.9246298074722290e-01 9.2873439192771912e-02
+ -6.0047471523284912e-01
+ <_>
+
+ 1 0 482 4.5322909951210022e-01 -1 -2 483
+ -5.5721630342304707e-03
+
+ 5.6260532140731812e-01 7.7820159494876862e-02
+ -3.3990600705146790e-01
+ <_>
+
+ 1 0 484 3.1583961099386215e-02 -1 -2 485
+ -5.7926177978515625e-03
+
+ 3.2292670011520386e-01 1.5534450113773346e-01
+ -3.5717839002609253e-01
+ <_>
+
+ 0 1 486 -7.6025379821658134e-03 -1 -2 487
+ 9.5151038840413094e-04
+
+ -5.1859498023986816e-01 -2.9570670798420906e-02
+ 4.6027511358261108e-01
+ <_>
+
+ 1 0 488 1.9723300356417894e-03 -1 -2 489
+ 2.3158260155469179e-03
+
+ 3.6926651000976562e-01 -2.1299740672111511e-01
+ 2.6948541402816772e-01
+ <_>
+
+ 1 0 490 2.1179600153118372e-03 -1 -2 491
+ -2.6946600992232561e-03
+
+ -4.8369500041007996e-01 1.8545660376548767e-01
+ -2.9411968588829041e-01
+ <_>
+
+ 1 0 492 5.8865409344434738e-02 -1 -2 493
+ -6.8408921360969543e-03
+
+ -4.6770378947257996e-01 -6.6371321678161621e-01
+ 1.2721349298954010e-01
+ <_>
+ 26
+ -1.8931059837341309e+00
+
+ <_>
+
+ 1 0 494 -1.2766489759087563e-02 -1 -2 495
+ 3.7821640726178885e-03
+
+ -3.7968099117279053e-01 -1.6001829504966736e-01
+ 6.1953288316726685e-01
+ <_>
+
+ 1 0 496 -3.3049881458282471e-02 -1 -2 497
+ 4.5050241053104401e-02
+
+ -3.6825481057167053e-01 9.3770343810319901e-03
+ 7.1570581197738647e-01
+ <_>
+
+ 1 0 498 -3.5275409463793039e-03 -1 -2 499
+ 2.2250709589570761e-03
+
+ -3.7336608767509460e-01 -6.6712491214275360e-02
+ 4.9906119704246521e-01
+ <_>
+
+ 1 0 500 1.3609490124508739e-03 -1 -2 501
+ -2.9087859392166138e-01
+
+ 1.7162929475307465e-01 3.6158901453018188e-01
+ -5.0871372222900391e-01
+ <_>
+
+ 1 0 502 3.3148950897157192e-03 -1 -2 503
+ -8.8641437469050288e-04
+
+ -7.1788138151168823e-01 2.5713619589805603e-01
+ -1.7978949844837189e-01
+ <_>
+
+ 1 0 504 1.1313590221107006e-03 -1 -2 505
+ -3.0621800106018782e-03
+
+ 3.5387420654296875e-01 3.0790808796882629e-01
+ -3.1217241287231445e-01
+ <_>
+
+ 1 0 506 2.5443620979785919e-03 -1 -2 507
+ -6.7088878713548183e-03
+
+ -5.6788551807403564e-01 2.1222899854183197e-01
+ -2.6821109652519226e-01
+ <_>
+
+ 0 1 508 -1.6446809470653534e-01 -1 -2 509
+ 4.0828108787536621e-02
+
+ 4.9016961455345154e-01 -3.1217470765113831e-01
+ 2.4748149514198303e-01
+ <_>
+
+ 0 1 510 -3.6051510833203793e-03 -1 -2 511
+ -2.3608640767633915e-03
+
+ 3.4355860948562622e-01 2.6566460728645325e-01
+ -2.8644719719886780e-01
+ <_>
+
+ 0 1 512 1.2965350179001689e-03 -1 -2 513
+ 6.0111000202596188e-03
+
+ -2.9317760467529297e-01 2.1941700577735901e-01
+ -6.0014218091964722e-01
+ <_>
+
+ 1 0 514 -6.1628420371562243e-04 -1 -2 515
+ 2.0573718938976526e-03
+
+ -3.1292331218719482e-01 2.8763169050216675e-01
+ -3.7320709228515625e-01
+ <_>
+
+ 0 1 516 -7.7166007831692696e-03 -1 -2 517
+ -2.8222459368407726e-03
+
+ -7.1683251857757568e-01 4.2501831054687500e-01
+ -5.3294889628887177e-02
+ <_>
+
+ 0 1 518 -7.3861207056324929e-05 -1 -2 519
+ 5.8680498041212559e-03
+
+ 1.4903450012207031e-01 -5.8436650037765503e-01
+ 1.0724759846925735e-01
+ <_>
+
+ 1 0 520 -7.9013723880052567e-03 -1 -2 521
+ 2.7825690340250731e-03
+
+ -3.4319949150085449e-01 1.7655360698699951e-01
+ -6.1473757028579712e-01
+ <_>
+
+ 0 1 522 3.2751538674347103e-04 -1 -2 523
+ 3.0700899660587311e-02
+
+ -3.3837568759918213e-01 1.8566130101680756e-01
+ -5.3450268507003784e-01
+ <_>
+
+ 1 0 524 5.6932470761239529e-03 -1 -2 525
+ 2.1375140547752380e-01
+
+ -5.1750451326370239e-01 1.2332399934530258e-01
+ -6.4288139343261719e-01
+ <_>
+
+ 0 1 526 -4.4024959206581116e-03 -1 -2 527
+ -4.5719969784840941e-04
+
+ 5.8535677194595337e-01 2.3368820548057556e-01
+ -1.9039009511470795e-01
+ <_>
+
+ 0 1 528 -4.2587839998304844e-03 -1 -2 529
+ -2.3462621029466391e-03
+
+ -5.1190847158432007e-01 -4.7164770960807800e-01
+ 1.4783400297164917e-01
+ <_>
+
+ 1 0 530 -6.5065571106970310e-05 -1 -2 531
+ -5.5082160979509354e-03
+
+ -2.9886341094970703e-01 -4.8508960008621216e-01
+ 2.0014910399913788e-01
+ <_>
+
+ 1 0 532 1.8942790105938911e-02 -1 -2 533
+ 6.9123771972954273e-03
+
+ 3.1028950214385986e-01 -2.8701239824295044e-01
+ 2.0534069836139679e-01
+ <_>
+
+ 1 0 534 8.1696882843971252e-03 -1 -2 535
+ 1.0069769807159901e-02
+
+ 4.5810830593109131e-01 -2.4175919592380524e-01
+ 1.7593820393085480e-01
+ <_>
+
+ 1 0 536 2.1663580555468798e-03 -1 -2 537
+ 1.0505730286240578e-02
+
+ -4.9877908825874329e-01 1.6231280565261841e-01
+ -4.2988869547843933e-01
+ <_>
+
+ 1 0 538 5.7576788822188973e-04 -1 -2 539
+ -3.0608899891376495e-02
+
+ -3.1012570858001709e-01 -7.4064302444458008e-01
+ 1.6217179596424103e-01
+ <_>
+
+ 0 1 540 -1.3430659659206867e-02 -1 -2 541
+ 1.1859040241688490e-03
+
+ 4.5505639910697937e-01 -2.7227258682250977e-01
+ 2.2475010156631470e-01
+ <_>
+
+ 0 1 542 -4.9311347538605332e-04 -1 -2 543
+ -2.4509918875992298e-03
+
+ -3.9598318934440613e-01 2.5004211068153381e-01
+ -1.6140510141849518e-01
+ <_>
+
+ 1 0 544 1.3641949743032455e-02 -1 -2 545
+ -3.6733329296112061e-02
+
+ -6.4525490999221802e-01 3.4197059273719788e-01
+ -6.5968327224254608e-02
+ <_>
+ 29
+ -1.9677840471267700e+00
+
+ <_>
+
+ 0 1 546 1.3613830087706447e-03 -1 -2 547
+ 1.2211060151457787e-02
+
+ -3.4383928775787354e-01 -4.0358600020408630e-01
+ 5.7873630523681641e-01
+ <_>
+
+ 0 1 548 3.2929528970271349e-03 -1 -2 549
+ -2.4831980466842651e-02
+
+ -2.2164349257946014e-01 5.4256910085678101e-01
+ -4.7585600614547729e-01
+ <_>
+
+ 0 1 550 -3.4081530570983887e-01 -1 -2 551
+ 6.0929641127586365e-02
+
+ 5.3438740968704224e-01 -2.6015359163284302e-01
+ 3.7626558542251587e-01
+ <_>
+
+ 1 0 552 -1.4399300562217832e-03 -1 -2 553
+ -7.5711178779602051e-01
+
+ -4.1635149717330933e-01 4.7764539718627930e-01
+ -1.2374229729175568e-01
+ <_>
+
+ 0 1 554 -5.9891431592404842e-03 -1 -2 555
+ -8.9398561976850033e-04
+
+ 2.1848620474338531e-01 1.7726029455661774e-01
+ -5.4815018177032471e-01
+ <_>
+
+ 1 0 556 2.9013510793447495e-03 -1 -2 557
+ 4.4361278414726257e-03
+
+ -5.6709182262420654e-01 1.4183780550956726e-01
+ -5.8784419298171997e-01
+ <_>
+
+ 1 0 558 -5.3319290600484237e-05 -1 -2 559
+ 2.5481029879301786e-03
+
+ -3.4821888804435730e-01 1.9745320081710815e-01
+ -5.5979222059249878e-01
+ <_>
+
+ 1 0 560 7.4882939457893372e-02 -1 -2 561
+ 4.8816308379173279e-02
+
+ 4.6647951006889343e-01 -2.2575210034847260e-01
+ 3.2325819134712219e-01
+ <_>
+
+ 0 1 562 -3.9128339849412441e-03 -1 -2 563
+ -1.3820629566907883e-02
+
+ -5.9772872924804688e-01 2.6031211018562317e-01
+ -2.0211410522460938e-01
+ <_>
+
+ 0 1 564 9.4047200400382280e-04 -1 -2 565
+ -4.6419431455433369e-03
+
+ -3.4005248546600342e-01 -4.5187801122665405e-01
+ 2.1054859459400177e-01
+ <_>
+
+ 1 0 566 -3.1960941851139069e-02 -1 -2 567
+ -1.2651160068344325e-04
+
+ -2.0826019346714020e-01 3.8553190231323242e-01
+ -2.3116420209407806e-01
+ <_>
+
+ 0 1 568 -5.0413709133863449e-02 -1 -2 569
+ -2.0950778853148222e-03
+
+ 2.2846159338951111e-01 3.2639551162719727e-01
+ -3.4385430812835693e-01
+ <_>
+
+ 0 1 570 -1.1017880402505398e-02 -1 -2 571
+ -9.7415763884782791e-03
+
+ -7.7388781309127808e-01 3.6731991171836853e-01
+ -6.5746001899242401e-02
+ <_>
+
+ 0 1 572 5.3386680519906804e-05 -1 -2 573
+ 5.9820311143994331e-03
+
+ -3.5571750998497009e-01 1.7653119564056396e-01
+ -4.6110078692436218e-01
+ <_>
+
+ 1 0 574 -1.9558269996196032e-03 -1 -2 575
+ 7.6739699579775333e-03
+
+ -3.6172690987586975e-01 1.8038579821586609e-01
+ -4.0452030301094055e-01
+ <_>
+
+ 1 0 576 4.2935381643474102e-03 -1 -2 577
+ 1.4181300066411495e-03
+
+ 5.2086359262466431e-01 -2.2085809707641602e-01
+ 2.7357560396194458e-01
+ <_>
+
+ 0 1 578 -2.8263099491596222e-02 -1 -2 579
+ 6.3434068579226732e-04
+
+ -6.3833731412887573e-01 1.5636380016803741e-01
+ -3.2148900628089905e-01
+ <_>
+
+ 0 1 580 -7.2387307882308960e-03 -1 -2 581
+ -9.9928081035614014e-03
+
+ 2.3126259446144104e-01 3.0397319793701172e-01
+ -2.4478439986705780e-01
+ <_>
+
+ 1 0 582 6.4995248976629227e-05 -1 -2 583
+ -5.3049270063638687e-03
+
+ 1.5132980048656464e-01 2.0417870581150055e-01
+ -4.6260431408882141e-01
+ <_>
+
+ 0 1 584 -1.6613099724054337e-02 -1 -2 585
+ -1.1630290187895298e-02
+
+ 3.3399769663810730e-01 3.7053430080413818e-01
+ -1.9361549615859985e-01
+ <_>
+
+ 1 0 586 1.9068180117756128e-03 -1 -2 587
+ -5.6926468387246132e-03
+
+ -3.8105058670043945e-01 5.0645208358764648e-01
+ 6.5170922316610813e-03
+ <_>
+
+ 1 0 588 -2.2453670680988580e-04 -1 -2 589
+ 9.5565039664506912e-03
+
+ -3.1526011228561401e-01 -5.3035598993301392e-01
+ 2.0532760024070740e-01
+ <_>
+
+ 1 0 590 3.1540619675070047e-03 -1 -2 591
+ -3.0681329965591431e-01
+
+ -4.5928329229354858e-01 5.0717717409133911e-01
+ -1.4439250342547894e-02
+ <_>
+
+ 0 1 592 2.8239809907972813e-03 -1 -2 593
+ -3.3063529990613461e-03
+
+ -1.5437939763069153e-01 -4.3571388721466064e-01
+ 3.9342719316482544e-01
+ <_>
+
+ 1 0 594 3.7848789361305535e-04 -1 -2 595
+ -3.0488630291074514e-03
+
+ 2.5212600827217102e-01 4.6662339568138123e-01
+ -2.2792230546474457e-01
+ <_>
+
+ 0 1 596 -1.4724380336701870e-02 -1 -2 597
+ 3.6062300205230713e-02
+
+ -7.8602111339569092e-01 -6.8571321666240692e-02
+ 3.6698839068412781e-01
+ <_>
+
+ 0 1 598 -2.2327410988509655e-03 -1 -2 599
+ -7.8541820403188467e-04
+
+ -5.9740197658538818e-01 2.0273469388484955e-01
+ -1.7221680283546448e-01
+ <_>
+
+ 1 0 600 7.8553898492828012e-04 -1 -2 601
+ 1.0078109800815582e-02
+
+ -4.3407449126243591e-01 1.2464140355587006e-01
+ -4.8391419649124146e-01
+ <_>
+
+ 1 0 602 2.0928790792822838e-02 -1 -2 603
+ 1.3340089935809374e-03
+
+ 5.6864207983016968e-01 1.4524639584124088e-02
+ -4.6003210544586182e-01
+ <_>
+ 34
+ -1.9657919406890869e+00
+
+ <_>
+
+ 1 0 604 -1.5313959680497646e-02 -1 -2 605
+ -1.4265860430896282e-02
+
+ -3.4347689151763916e-01 5.8209532499313354e-01
+ -3.5527399182319641e-01
+ <_>
+
+ 0 1 606 1.2652979930862784e-03 -1 -2 607
+ -7.3807648732326925e-05
+
+ -3.1498318910598755e-01 4.7249591350555420e-01
+ -2.6380801200866699e-01
+ <_>
+
+ 0 1 608 -3.8527030497789383e-02 -1 -2 609
+ -1.4758770354092121e-02
+
+ 4.1556850075721741e-01 1.5677249431610107e-01
+ -3.7650239467620850e-01
+ <_>
+
+ 1 0 610 -1.5448270132765174e-03 -1 -2 611
+ 6.4564580097794533e-03
+
+ -3.5932019352912903e-01 2.1276639401912689e-01
+ -7.2287178039550781e-01
+ <_>
+
+ 0 1 612 1.0267349891364574e-02 -1 -2 613
+ -8.6422899039462209e-04
+
+ -4.6045809984207153e-01 2.4920259416103363e-01
+ -2.6721361279487610e-01
+ <_>
+
+ 0 1 614 3.2311889808624983e-03 -1 -2 615
+ 1.3676529750227928e-02
+
+ -4.0939199924468994e-01 -2.7391690760850906e-02
+ 4.5259070396423340e-01
+ <_>
+
+ 1 0 616 3.2787120435386896e-03 -1 -2 617
+ -1.4256529975682497e-03
+
+ -7.0025652647018433e-01 2.5787800550460815e-01
+ -1.5093439817428589e-01
+ <_>
+
+ 0 1 618 -2.2095029707998037e-03 -1 -2 619
+ -8.7701372802257538e-02
+
+ 3.5148110985755920e-01 4.1978740692138672e-01
+ -2.3600180447101593e-01
+ <_>
+
+ 0 1 620 -2.8805620968341827e-03 -1 -2 621
+ -2.5028509553521872e-03
+
+ 3.0479869246482849e-01 1.3316699862480164e-01
+ -3.1691300868988037e-01
+ <_>
+
+ 1 0 622 -5.1710562547668815e-04 -1 -2 623
+ 6.7088729701936245e-03
+
+ -3.5199090838432312e-01 2.0163150131702423e-01
+ -6.0948008298873901e-01
+ <_>
+
+ 0 1 624 -7.6058752834796906e-02 -1 -2 625
+ -3.0889140907675028e-03
+
+ -6.3694208860397339e-01 -7.9025340080261230e-01
+ 1.0366079956293106e-01
+ <_>
+
+ 1 0 626 2.5740528944879770e-03 -1 -2 627
+ -5.4877097718417645e-03
+
+ -4.5424199104309082e-01 2.1481299400329590e-01
+ -1.9329510629177094e-01
+ <_>
+
+ 1 0 628 -1.2507289648056030e-03 -1 -2 629
+ -4.3231048621237278e-03
+
+ -2.1651449799537659e-01 -6.2799078226089478e-01
+ 2.4270740151405334e-01
+ <_>
+
+ 1 0 630 4.3724630959331989e-03 -1 -2 631
+ 7.4632692849263549e-04
+
+ -5.1889377832412720e-01 -1.1378680169582367e-01
+ 2.8224378824234009e-01
+ <_>
+
+ 0 1 632 -1.3375070411711931e-03 -1 -2 633
+ -2.9367550741881132e-03
+
+ 2.4589119851589203e-01 2.4335819482803345e-01
+ -2.9112818837165833e-01
+ <_>
+
+ 0 1 634 6.3193867390509695e-05 -1 -2 635
+ -5.1338938064873219e-03
+
+ -2.5806590914726257e-01 -4.6110409498214722e-01
+ 2.4333980679512024e-01
+ <_>
+
+ 1 0 636 4.9400608986616135e-03 -1 -2 637
+ -5.6112580932676792e-03
+
+ -3.9632990956306458e-01 2.4502380192279816e-01
+ -1.5639010071754456e-01
+ <_>
+
+ 1 0 638 4.2950599454343319e-03 -1 -2 639
+ 4.5142881572246552e-03
+
+ -4.7671678662300110e-01 1.0698430240154266e-01
+ -9.0471321344375610e-01
+ <_>
+
+ 1 0 640 7.5297639705240726e-03 -1 -2 641
+ -1.2225280515849590e-03
+
+ 4.1239809989929199e-01 2.8488171100616455e-01
+ -1.9815699756145477e-01
+ <_>
+
+ 0 1 642 -3.4703810233622789e-03 -1 -2 643
+ 8.3724651485681534e-03
+
+ -4.4967961311340332e-01 1.5324249863624573e-01
+ -3.8666850328445435e-01
+ <_>
+
+ 1 0 644 -3.3934618841158226e-05 -1 -2 645
+ -2.7241709828376770e-01
+
+ -3.1429070234298706e-01 -5.5842101573944092e-01
+ 1.6627819836139679e-01
+ <_>
+
+ 0 1 646 -2.7582740876823664e-03 -1 -2 647
+ 2.5530489161610603e-02
+
+ 2.7189570665359497e-01 -1.9172009825706482e-01
+ 4.3780499696731567e-01
+ <_>
+
+ 1 0 648 4.2080380953848362e-03 -1 -2 649
+ -8.2151442766189575e-03
+
+ -4.4684138894081116e-01 2.2786709666252136e-01
+ -1.7441789805889130e-01
+ <_>
+
+ 0 1 650 -2.9405429959297180e-03 -1 -2 651
+ -9.4840265810489655e-03
+
+ -7.2643548250198364e-01 2.0794290304183960e-01
+ -1.5239919722080231e-01
+ <_>
+
+ 1 0 652 4.2596450075507164e-03 -1 -2 653
+ -1.7117479583248496e-03
+
+ 6.1772680282592773e-01 -7.1106612682342529e-01
+ -6.1875251121819019e-03
+ <_>
+
+ 0 1 654 -1.3266160385683179e-03 -1 -2 655
+ 9.1314306482672691e-03
+
+ 1.7181269824504852e-01 -4.1138759255409241e-01
+ 1.8124279379844666e-01
+ <_>
+
+ 1 0 656 6.8382360041141510e-03 -1 -2 657
+ 7.5181988067924976e-03
+
+ -5.7601082324981689e-01 -1.0819079726934433e-01
+ 2.9561421275138855e-01
+ <_>
+
+ 0 1 658 -7.2788819670677185e-03 -1 -2 659
+ -1.8039470538496971e-02
+
+ -5.8113521337509155e-01 4.5183068513870239e-01
+ -2.7083089575171471e-02
+ <_>
+
+ 0 1 660 -1.0126599809154868e-03 -1 -2 661
+ -6.7263199016451836e-03
+
+ 2.4344119429588318e-01 1.6870440542697906e-01
+ -2.7007728815078735e-01
+ <_>
+
+ 0 1 662 -3.2334970310330391e-03 -1 -2 663
+ -7.7852200774941593e-05
+
+ -6.0048222541809082e-01 2.4241769313812256e-01
+ -1.2413249909877777e-01
+ <_>
+
+ 0 1 664 -6.7774722992908210e-05 -1 -2 665
+ 7.1789676439948380e-05
+
+ 1.5729150176048279e-01 -5.2893507480621338e-01
+ -3.1665571033954620e-02
+ <_>
+
+ 1 0 666 1.0024299845099449e-02 -1 -2 667
+ 9.4298496842384338e-03
+
+ -4.8646959662437439e-01 1.1240869760513306e-01
+ -4.2570489645004272e-01
+ <_>
+
+ 0 1 668 -7.4433721601963043e-04 -1 -2 669
+ 1.1660560034215450e-02
+
+ 2.7540761232376099e-01 -2.3117260634899139e-01
+ 2.2442330420017242e-01
+ <_>
+
+ 1 0 670 3.9079408161342144e-03 -1 -2 671
+ 1.6550149768590927e-02
+
+ -6.3519638776779175e-01 1.0619100183248520e-01
+ -4.7654989361763000e-01
+ <_>
+ 32
+ -1.7649420499801636e+00
+
+ <_>
+
+ 1 0 672 -1.8439030274748802e-02 -1 -2 673
+ -5.3364519029855728e-02
+
+ -4.8745709657669067e-01 5.1037812232971191e-01
+ -2.2670130431652069e-01
+ <_>
+
+ 0 1 674 -7.5706318020820618e-02 -1 -2 675
+ -1.5329009620472789e-03
+
+ 4.1487750411033630e-01 8.5764937102794647e-02
+ -4.3470910191535950e-01
+ <_>
+
+ 1 0 676 -2.4494890123605728e-02 -1 -2 677
+ -3.8144161226227880e-04
+
+ -2.7532699704170227e-01 3.8043969869613647e-01
+ -4.3967849016189575e-01
+ <_>
+
+ 1 0 678 -8.8816778734326363e-03 -1 -2 679
+ -3.9625130593776703e-02
+
+ -4.3258818984031677e-01 2.4481220543384552e-01
+ -2.6193639636039734e-01
+ <_>
+
+ 1 0 680 -3.5907390993088484e-03 -1 -2 681
+ 3.7008870393037796e-02
+
+ -3.6199480295181274e-01 2.2637460380792618e-02
+ 5.5778437852859497e-01
+ <_>
+
+ 0 1 682 7.8503930126316845e-05 -1 -2 683
+ -4.7969701699912548e-03
+
+ -3.3861130475997925e-01 3.1856098771095276e-01
+ -1.6600249707698822e-01
+ <_>
+
+ 0 1 684 -1.1298010125756264e-02 -1 -2 685
+ -4.4886539690196514e-03
+
+ 3.7305471301078796e-01 2.9692959785461426e-01
+ -2.5235760211944580e-01
+ <_>
+
+ 0 1 686 -2.2497780155390501e-03 -1 -2 687
+ 2.9247230850160122e-03
+
+ 3.4263029694557190e-01 -5.6593239307403564e-02
+ -7.0626032352447510e-01
+ <_>
+
+ 1 0 688 1.7976630479097366e-03 -1 -2 689
+ 1.9808609504252672e-03
+
+ -5.4180228710174561e-01 -2.5643008947372437e-01
+ 1.8446870148181915e-01
+ <_>
+
+ 0 1 690 -4.7688339836895466e-03 -1 -2 691
+ -1.5755610540509224e-02
+
+ -2.9698228836059570e-01 2.8959378600120544e-01
+ -1.6480749845504761e-01
+ <_>
+
+ 0 1 692 -1.1919640004634857e-02 -1 -2 693
+ 4.2308131232857704e-03
+
+ -5.8567219972610474e-01 1.3601270318031311e-01
+ -4.8162451386451721e-01
+ <_>
+
+ 1 0 694 2.0548550412058830e-02 -1 -2 695
+ -7.3943338356912136e-03
+
+ 3.0143499374389648e-01 4.6367760747671127e-02
+ -4.2379519343376160e-01
+ <_>
+
+ 0 1 696 -6.2137800268828869e-03 -1 -2 697
+ 1.4182809973135591e-03
+
+ 4.5724278688430786e-01 -3.0143639445304871e-01
+ 1.8204510211944580e-01
+ <_>
+
+ 1 0 698 4.1609420441091061e-03 -1 -2 699
+ -3.7915320135653019e-03
+
+ -5.2654838562011719e-01 -5.8677071332931519e-01
+ 1.1703660339117050e-01
+ <_>
+
+ 1 0 700 2.0879150833934546e-03 -1 -2 701
+ 1.5018540434539318e-03
+
+ -3.5307729244232178e-01 1.8624800443649292e-01
+ -3.2729730010032654e-01
+ <_>
+
+ 1 0 702 2.1248809993267059e-02 -1 -2 703
+ -5.5249751312658191e-04
+
+ -3.1979259848594666e-01 2.3370230197906494e-01
+ -1.7386199533939362e-01
+ <_>
+
+ 0 1 704 -3.0085169710218906e-03 -1 -2 705
+ -1.1611919617280364e-03
+
+ 1.7596049606800079e-01 1.6033430397510529e-01
+ -3.9680978655815125e-01
+ <_>
+
+ 0 1 706 -3.9655580185353756e-03 -1 -2 707
+ -6.5836100839078426e-03
+
+ 3.6691769957542419e-01 -6.2966358661651611e-01
+ -2.4926450103521347e-02
+ <_>
+
+ 0 1 708 -9.0950471349060535e-04 -1 -2 709
+ -5.7984529994428158e-03
+
+ 3.9574980735778809e-01 1.7492240667343140e-01
+ -2.6837408542633057e-01
+ <_>
+
+ 0 1 710 -5.7758802175521851e-01 -1 -2 711
+ -1.5161310322582722e-02
+
+ 5.9611392021179199e-01 -6.6131639480590820e-01
+ 3.3608361263759434e-04
+ <_>
+
+ 1 0 712 7.6604672358371317e-05 -1 -2 713
+ 2.7769979089498520e-02
+
+ 2.0401589572429657e-01 -3.2097330689430237e-01
+ 2.2317400574684143e-01
+ <_>
+
+ 0 1 714 -2.6336179580539465e-03 -1 -2 715
+ 8.3722146227955818e-03
+
+ -3.9656499028205872e-01 1.3883970677852631e-01
+ -5.8006221055984497e-01
+ <_>
+
+ 0 1 716 -7.0203031646087766e-04 -1 -2 717
+ -4.8448870074935257e-04
+
+ 2.7777281403541565e-01 2.1628519892692566e-01
+ -2.9692250490188599e-01
+ <_>
+
+ 0 1 718 -3.3638171851634979e-02 -1 -2 719
+ 4.4241230934858322e-03
+
+ 3.5791969299316406e-01 -8.6632027523592114e-04
+ -5.5872720479965210e-01
+ <_>
+
+ 1 0 720 1.1545260436832905e-02 -1 -2 721
+ -1.5816639643162489e-03
+
+ 3.3837619423866272e-01 2.8660699725151062e-02
+ -3.5041970014572144e-01
+ <_>
+
+ 1 0 722 1.3838140293955803e-02 -1 -2 723
+ 2.8327409178018570e-02
+
+ -7.7886807918548584e-01 -1.8604910001158714e-02
+ 6.2147867679595947e-01
+ <_>
+
+ 0 1 724 -8.8482163846492767e-03 -1 -2 725
+ -1.1661020107567310e-03
+
+ 2.6369819045066833e-01 1.0302580147981644e-01
+ -3.2680010795593262e-01
+ <_>
+
+ 0 1 726 -3.2252211123704910e-02 -1 -2 727
+ -9.4921119511127472e-02
+
+ -5.0046241283416748e-01 -7.2761011123657227e-01
+ 1.0330100357532501e-01
+ <_>
+
+ 1 0 728 2.5177269708365202e-03 -1 -2 729
+ -4.0892168879508972e-02
+
+ -6.3938027620315552e-01 -5.7345229387283325e-01
+ 8.1502526998519897e-02
+ <_>
+
+ 0 1 730 -1.9293189980089664e-03 -1 -2 731
+ -1.4116390375420451e-03
+
+ 2.4177229404449463e-01 8.0363817512989044e-02
+ -3.6146539449691772e-01
+ <_>
+
+ 0 1 732 -3.8812779821455479e-03 -1 -2 733
+ 4.4630360789597034e-03
+
+ -5.7638782262802124e-01 9.1835789382457733e-02
+ -6.8039101362228394e-01
+ <_>
+
+ 0 1 734 2.9870839789509773e-03 -1 -2 735
+ 9.4975335523486137e-03
+
+ -1.0236640274524689e-01 4.9150609970092773e-01
+ -3.8011389970779419e-01
+
+ <_>
+
+ <_>
+ 8 7 3 12 -1.
+ <_>
+ 8 11 3 4 3.
+ <_>
+
+ <_>
+ 8 7 8 3 -1.
+ <_>
+ 10 9 4 3 2.
+ 1
+ <_>
+
+ <_>
+ 9 13 2 6 -1.
+ <_>
+ 9 16 2 3 2.
+ <_>
+
+ <_>
+ 8 2 12 8 -1.
+ <_>
+ 11 2 6 8 2.
+ <_>
+
+ <_>
+ 14 0 6 6 -1.
+ <_>
+ 14 3 6 3 2.
+ <_>
+
+ <_>
+ 8 1 5 12 -1.
+ <_>
+ 8 4 5 6 2.
+ <_>
+
+ <_>
+ 1 8 3 12 -1.
+ <_>
+ 1 12 3 4 3.
+ <_>
+
+ <_>
+ 0 11 2 7 -1.
+ <_>
+ 1 11 1 7 2.
+ <_>
+
+ <_>
+ 6 12 9 7 -1.
+ <_>
+ 9 12 3 7 3.
+ <_>
+
+ <_>
+ 13 4 6 9 -1.
+ <_>
+ 15 4 2 9 3.
+ <_>
+
+ <_>
+ 4 7 12 12 -1.
+ <_>
+ 8 11 4 4 9.
+ <_>
+
+ <_>
+ 15 0 4 20 -1.
+ <_>
+ 15 5 4 10 2.
+ <_>
+
+ <_>
+ 0 12 5 8 -1.
+ <_>
+ 0 16 5 4 2.
+ <_>
+
+ <_>
+ 8 2 12 8 -1.
+ <_>
+ 12 2 4 8 3.
+ <_>
+
+ <_>
+ 19 0 1 8 -1.
+ <_>
+ 19 4 1 4 2.
+ <_>
+
+ <_>
+ 9 7 3 12 -1.
+ <_>
+ 9 11 3 4 3.
+ <_>
+
+ <_>
+ 1 2 8 8 -1.
+ <_>
+ 1 6 8 4 2.
+ <_>
+
+ <_>
+ 0 12 4 4 -1.
+ <_>
+ 2 12 2 4 2.
+ <_>
+
+ <_>
+ 9 7 6 8 -1.
+ <_>
+ 9 7 3 4 2.
+ <_>
+ 12 11 3 4 2.
+ <_>
+
+ <_>
+ 13 18 7 2 -1.
+ <_>
+ 13 19 7 1 2.
+ <_>
+
+ <_>
+ 4 7 12 12 -1.
+ <_>
+ 8 11 4 4 9.
+ <_>
+
+ <_>
+ 0 8 5 12 -1.
+ <_>
+ 0 12 5 4 3.
+ <_>
+
+ <_>
+ 16 0 4 8 -1.
+ <_>
+ 18 0 2 8 2.
+ <_>
+
+ <_>
+ 16 12 1 8 -1.
+ <_>
+ 16 16 1 4 2.
+ <_>
+
+ <_>
+ 9 1 9 9 -1.
+ <_>
+ 12 1 3 9 3.
+ <_>
+
+ <_>
+ 16 16 1 3 -1.
+ <_>
+ 15 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 2 14 2 4 -1.
+ <_>
+ 2 16 2 2 2.
+ <_>
+
+ <_>
+ 6 12 9 3 -1.
+ <_>
+ 9 12 3 3 3.
+ <_>
+
+ <_>
+ 0 18 5 2 -1.
+ <_>
+ 0 19 5 1 2.
+ <_>
+
+ <_>
+ 1 7 18 12 -1.
+ <_>
+ 7 11 6 4 9.
+ <_>
+
+ <_>
+ 4 0 16 12 -1.
+ <_>
+ 4 0 8 6 2.
+ <_>
+ 12 6 8 6 2.
+ <_>
+
+ <_>
+ 8 3 2 5 -1.
+ <_>
+ 9 3 1 5 2.
+ <_>
+
+ <_>
+ 17 17 1 2 -1.
+ <_>
+ 17 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 18 16 1 3 -1.
+ <_>
+ 17 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 0 9 2 6 -1.
+ <_>
+ 1 9 1 6 2.
+ <_>
+
+ <_>
+ 3 3 3 4 -1.
+ <_>
+ 4 3 1 4 3.
+ <_>
+
+ <_>
+ 4 7 12 12 -1.
+ <_>
+ 8 11 4 4 9.
+ <_>
+
+ <_>
+ 10 0 7 8 -1.
+ <_>
+ 10 4 7 4 2.
+ <_>
+
+ <_>
+ 18 0 2 9 -1.
+ <_>
+ 19 0 1 9 2.
+ <_>
+
+ <_>
+ 4 13 1 4 -1.
+ <_>
+ 4 13 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 10 8 6 2 -1.
+ <_>
+ 12 10 2 2 3.
+ 1
+ <_>
+
+ <_>
+ 14 11 4 7 -1.
+ <_>
+ 15 11 2 7 2.
+ <_>
+
+ <_>
+ 4 0 13 8 -1.
+ <_>
+ 4 2 13 4 2.
+ <_>
+
+ <_>
+ 9 1 7 8 -1.
+ <_>
+ 9 5 7 4 2.
+ <_>
+
+ <_>
+ 7 0 12 9 -1.
+ <_>
+ 10 0 6 9 2.
+ <_>
+
+ <_>
+ 14 3 4 4 -1.
+ <_>
+ 15 3 2 4 2.
+ <_>
+
+ <_>
+ 0 16 4 4 -1.
+ <_>
+ 0 18 4 2 2.
+ <_>
+
+ <_>
+ 3 17 2 1 -1.
+ <_>
+ 3 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 17 16 1 3 -1.
+ <_>
+ 16 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 11 10 6 4 -1.
+ <_>
+ 10 11 6 2 2.
+ 1
+ <_>
+
+ <_>
+ 19 0 1 4 -1.
+ <_>
+ 19 2 1 2 2.
+ <_>
+
+ <_>
+ 17 0 3 3 -1.
+ <_>
+ 18 1 1 1 9.
+ <_>
+
+ <_>
+ 2 1 12 6 -1.
+ <_>
+ 2 4 12 3 2.
+ <_>
+
+ <_>
+ 19 2 1 16 -1.
+ <_>
+ 15 6 1 8 2.
+ 1
+ <_>
+
+ <_>
+ 12 2 4 6 -1.
+ <_>
+ 13 2 2 6 2.
+ <_>
+
+ <_>
+ 11 3 3 3 -1.
+ <_>
+ 12 3 1 3 3.
+ <_>
+
+ <_>
+ 1 7 18 12 -1.
+ <_>
+ 7 11 6 4 9.
+ <_>
+
+ <_>
+ 8 1 12 9 -1.
+ <_>
+ 12 1 4 9 3.
+ <_>
+
+ <_>
+ 18 0 2 10 -1.
+ <_>
+ 18 5 2 5 2.
+ <_>
+
+ <_>
+ 4 5 12 15 -1.
+ <_>
+ 8 10 4 5 9.
+ <_>
+
+ <_>
+ 1 8 4 12 -1.
+ <_>
+ 1 12 4 4 3.
+ <_>
+
+ <_>
+ 6 13 8 2 -1.
+ <_>
+ 8 13 4 2 2.
+ <_>
+
+ <_>
+ 16 0 4 15 -1.
+ <_>
+ 18 0 2 15 2.
+ <_>
+
+ <_>
+ 14 0 4 8 -1.
+ <_>
+ 15 0 2 8 2.
+ <_>
+
+ <_>
+ 5 0 8 9 -1.
+ <_>
+ 5 3 8 3 3.
+ <_>
+
+ <_>
+ 8 0 6 6 -1.
+ <_>
+ 10 0 2 6 3.
+ <_>
+
+ <_>
+ 10 17 3 3 -1.
+ <_>
+ 11 17 1 3 3.
+ <_>
+
+ <_>
+ 10 17 4 3 -1.
+ <_>
+ 11 17 2 3 2.
+ <_>
+
+ <_>
+ 14 12 4 4 -1.
+ <_>
+ 15 12 2 4 2.
+ <_>
+
+ <_>
+ 8 18 4 2 -1.
+ <_>
+ 9 18 2 2 2.
+ <_>
+
+ <_>
+ 6 1 4 5 -1.
+ <_>
+ 7 1 2 5 2.
+ <_>
+
+ <_>
+ 2 0 6 5 -1.
+ <_>
+ 4 0 2 5 3.
+ <_>
+
+ <_>
+ 8 7 8 3 -1.
+ <_>
+ 10 9 4 3 2.
+ 1
+ <_>
+
+ <_>
+ 14 12 4 3 -1.
+ <_>
+ 15 12 2 3 2.
+ <_>
+
+ <_>
+ 10 10 3 4 -1.
+ <_>
+ 9 11 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 17 0 2 6 -1.
+ <_>
+ 17 3 2 3 2.
+ <_>
+
+ <_>
+ 1 9 6 9 -1.
+ <_>
+ 3 12 2 3 9.
+ <_>
+
+ <_>
+ 5 11 8 4 -1.
+ <_>
+ 9 11 4 4 2.
+ <_>
+
+ <_>
+ 1 0 16 6 -1.
+ <_>
+ 1 3 16 3 2.
+ <_>
+
+ <_>
+ 2 0 14 6 -1.
+ <_>
+ 2 2 14 2 3.
+ <_>
+
+ <_>
+ 0 11 2 9 -1.
+ <_>
+ 1 11 1 9 2.
+ <_>
+
+ <_>
+ 18 11 1 8 -1.
+ <_>
+ 18 11 1 4 2.
+ 1
+ <_>
+
+ <_>
+ 10 12 3 2 -1.
+ <_>
+ 11 12 1 2 3.
+ <_>
+
+ <_>
+ 11 13 3 1 -1.
+ <_>
+ 12 13 1 1 3.
+ <_>
+
+ <_>
+ 15 0 4 8 -1.
+ <_>
+ 17 0 2 8 2.
+ <_>
+
+ <_>
+ 12 17 4 3 -1.
+ <_>
+ 14 17 2 3 2.
+ <_>
+
+ <_>
+ 15 17 1 2 -1.
+ <_>
+ 15 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 15 16 1 3 -1.
+ <_>
+ 14 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 0 14 8 -1.
+ <_>
+ 3 2 14 4 2.
+ <_>
+
+ <_>
+ 18 1 1 2 -1.
+ <_>
+ 18 2 1 1 2.
+ <_>
+
+ <_>
+ 6 0 8 3 -1.
+ <_>
+ 8 0 4 3 2.
+ <_>
+
+ <_>
+ 9 4 1 9 -1.
+ <_>
+ 9 7 1 3 3.
+ <_>
+
+ <_>
+ 6 13 9 2 -1.
+ <_>
+ 9 13 3 2 3.
+ <_>
+
+ <_>
+ 0 13 5 6 -1.
+ <_>
+ 0 16 5 3 2.
+ <_>
+
+ <_>
+ 13 12 6 4 -1.
+ <_>
+ 15 12 2 4 3.
+ <_>
+
+ <_>
+ 4 6 12 2 -1.
+ <_>
+ 8 10 4 2 3.
+ 1
+ <_>
+
+ <_>
+ 19 0 1 8 -1.
+ <_>
+ 19 4 1 4 2.
+ <_>
+
+ <_>
+ 8 2 12 8 -1.
+ <_>
+ 11 2 6 8 2.
+ <_>
+
+ <_>
+ 0 12 4 4 -1.
+ <_>
+ 2 12 2 4 2.
+ <_>
+
+ <_>
+ 7 8 13 9 -1.
+ <_>
+ 7 11 13 3 3.
+ <_>
+
+ <_>
+ 18 1 2 6 -1.
+ <_>
+ 19 1 1 6 2.
+ <_>
+
+ <_>
+ 7 4 5 8 -1.
+ <_>
+ 7 6 5 4 2.
+ <_>
+
+ <_>
+ 11 18 9 2 -1.
+ <_>
+ 11 19 9 1 2.
+ <_>
+
+ <_>
+ 10 7 2 3 -1.
+ <_>
+ 11 7 1 3 2.
+ <_>
+
+ <_>
+ 4 18 6 2 -1.
+ <_>
+ 6 18 2 2 3.
+ <_>
+
+ <_>
+ 6 13 6 7 -1.
+ <_>
+ 8 13 2 7 3.
+ <_>
+
+ <_>
+ 5 18 6 2 -1.
+ <_>
+ 7 18 2 2 3.
+ <_>
+
+ <_>
+ 18 5 2 2 -1.
+ <_>
+ 18 6 2 1 2.
+ <_>
+
+ <_>
+ 6 2 9 4 -1.
+ <_>
+ 6 4 9 2 2.
+ <_>
+
+ <_>
+ 13 0 7 4 -1.
+ <_>
+ 13 0 7 2 2.
+ 1
+ <_>
+
+ <_>
+ 13 9 3 6 -1.
+ <_>
+ 11 11 3 2 3.
+ 1
+ <_>
+
+ <_>
+ 16 8 4 6 -1.
+ <_>
+ 16 11 4 3 2.
+ <_>
+
+ <_>
+ 19 2 1 2 -1.
+ <_>
+ 19 3 1 1 2.
+ <_>
+
+ <_>
+ 19 1 1 3 -1.
+ <_>
+ 19 2 1 1 3.
+ <_>
+
+ <_>
+ 13 12 2 4 -1.
+ <_>
+ 13 12 1 2 2.
+ <_>
+ 14 14 1 2 2.
+ <_>
+
+ <_>
+ 14 9 3 5 -1.
+ <_>
+ 15 10 1 5 3.
+ 1
+ <_>
+
+ <_>
+ 8 7 8 3 -1.
+ <_>
+ 10 9 4 3 2.
+ 1
+ <_>
+
+ <_>
+ 7 7 9 4 -1.
+ <_>
+ 6 8 9 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 11 2 6 -1.
+ <_>
+ 1 11 1 6 2.
+ <_>
+
+ <_>
+ 0 13 5 6 -1.
+ <_>
+ 0 16 5 3 2.
+ <_>
+
+ <_>
+ 16 2 4 6 -1.
+ <_>
+ 18 2 2 6 2.
+ <_>
+
+ <_>
+ 13 5 6 7 -1.
+ <_>
+ 15 7 2 7 3.
+ 1
+ <_>
+
+ <_>
+ 19 2 1 4 -1.
+ <_>
+ 19 4 1 2 2.
+ <_>
+
+ <_>
+ 14 1 6 2 -1.
+ <_>
+ 16 1 2 2 3.
+ <_>
+
+ <_>
+ 14 12 4 5 -1.
+ <_>
+ 15 12 2 5 2.
+ <_>
+
+ <_>
+ 18 15 2 3 -1.
+ <_>
+ 17 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 14 16 3 4 -1.
+ <_>
+ 14 18 3 2 2.
+ <_>
+
+ <_>
+ 16 16 1 2 -1.
+ <_>
+ 16 16 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 18 0 1 2 -1.
+ <_>
+ 18 1 1 1 2.
+ <_>
+
+ <_>
+ 9 8 1 6 -1.
+ <_>
+ 9 11 1 3 2.
+ <_>
+
+ <_>
+ 18 5 2 1 -1.
+ <_>
+ 19 5 1 1 2.
+ <_>
+
+ <_>
+ 14 3 6 4 -1.
+ <_>
+ 16 3 2 4 3.
+ <_>
+
+ <_>
+ 8 18 4 2 -1.
+ <_>
+ 9 18 2 2 2.
+ <_>
+
+ <_>
+ 6 13 9 7 -1.
+ <_>
+ 9 13 3 7 3.
+ <_>
+
+ <_>
+ 1 16 2 2 -1.
+ <_>
+ 1 17 2 1 2.
+ <_>
+
+ <_>
+ 0 16 3 4 -1.
+ <_>
+ 0 17 3 2 2.
+ <_>
+
+ <_>
+ 8 1 4 5 -1.
+ <_>
+ 9 1 2 5 2.
+ <_>
+
+ <_>
+ 10 1 6 9 -1.
+ <_>
+ 12 1 2 9 3.
+ <_>
+
+ <_>
+ 10 8 10 4 -1.
+ <_>
+ 10 10 10 2 2.
+ <_>
+
+ <_>
+ 15 8 5 4 -1.
+ <_>
+ 15 10 5 2 2.
+ <_>
+
+ <_>
+ 17 1 3 2 -1.
+ <_>
+ 18 2 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 13 11 3 5 -1.
+ <_>
+ 14 11 1 5 3.
+ <_>
+
+ <_>
+ 8 7 4 3 -1.
+ <_>
+ 10 7 2 3 2.
+ <_>
+
+ <_>
+ 3 0 8 1 -1.
+ <_>
+ 5 0 4 1 2.
+ <_>
+
+ <_>
+ 1 13 6 5 -1.
+ <_>
+ 3 13 2 5 3.
+ <_>
+
+ <_>
+ 13 9 3 5 -1.
+ <_>
+ 14 10 1 5 3.
+ 1
+ <_>
+
+ <_>
+ 11 8 4 6 -1.
+ <_>
+ 9 10 4 2 3.
+ 1
+ <_>
+
+ <_>
+ 11 7 6 6 -1.
+ <_>
+ 13 9 2 6 3.
+ 1
+ <_>
+
+ <_>
+ 7 0 7 6 -1.
+ <_>
+ 7 3 7 3 2.
+ <_>
+
+ <_>
+ 3 1 10 12 -1.
+ <_>
+ 3 5 10 4 3.
+ <_>
+
+ <_>
+ 13 12 6 4 -1.
+ <_>
+ 15 12 2 4 3.
+ <_>
+
+ <_>
+ 0 9 6 9 -1.
+ <_>
+ 2 12 2 3 9.
+ <_>
+
+ <_>
+ 8 0 12 11 -1.
+ <_>
+ 12 0 4 11 3.
+ <_>
+
+ <_>
+ 13 11 1 8 -1.
+ <_>
+ 13 11 1 4 2.
+ 1
+ <_>
+
+ <_>
+ 19 4 1 2 -1.
+ <_>
+ 19 5 1 1 2.
+ <_>
+
+ <_>
+ 2 15 1 2 -1.
+ <_>
+ 2 15 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 17 16 2 2 -1.
+ <_>
+ 17 16 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 16 16 1 3 -1.
+ <_>
+ 15 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 11 3 2 -1.
+ <_>
+ 6 12 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 4 11 2 2 -1.
+ <_>
+ 4 11 1 1 2.
+ <_>
+ 5 12 1 1 2.
+ <_>
+
+ <_>
+ 17 7 3 2 -1.
+ <_>
+ 18 8 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 16 9 3 8 -1.
+ <_>
+ 16 11 3 4 2.
+ <_>
+
+ <_>
+ 19 0 1 4 -1.
+ <_>
+ 19 2 1 2 2.
+ <_>
+
+ <_>
+ 19 0 1 3 -1.
+ <_>
+ 19 1 1 1 3.
+ <_>
+
+ <_>
+ 9 0 10 3 -1.
+ <_>
+ 14 0 5 3 2.
+ <_>
+
+ <_>
+ 3 3 15 17 -1.
+ <_>
+ 8 3 5 17 3.
+ <_>
+
+ <_>
+ 8 0 4 4 -1.
+ <_>
+ 9 0 2 4 2.
+ <_>
+
+ <_>
+ 1 11 8 1 -1.
+ <_>
+ 1 11 4 1 2.
+ 1
+ <_>
+
+ <_>
+ 4 10 2 4 -1.
+ <_>
+ 3 11 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 4 17 4 3 -1.
+ <_>
+ 5 17 2 3 2.
+ <_>
+
+ <_>
+ 18 7 2 1 -1.
+ <_>
+ 19 7 1 1 2.
+ <_>
+
+ <_>
+ 2 7 18 3 -1.
+ <_>
+ 11 7 9 3 2.
+ <_>
+
+ <_>
+ 4 11 4 2 -1.
+ <_>
+ 4 11 2 1 2.
+ <_>
+ 6 12 2 1 2.
+ <_>
+
+ <_>
+ 4 9 2 4 -1.
+ <_>
+ 4 11 2 2 2.
+ <_>
+
+ <_>
+ 16 1 3 1 -1.
+ <_>
+ 17 2 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 4 18 1 2 -1.
+ <_>
+ 4 19 1 1 2.
+ <_>
+
+ <_>
+ 9 18 4 2 -1.
+ <_>
+ 10 18 2 2 2.
+ <_>
+
+ <_>
+ 12 11 5 4 -1.
+ <_>
+ 11 12 5 2 2.
+ 1
+ <_>
+
+ <_>
+ 18 2 2 1 -1.
+ <_>
+ 19 2 1 1 2.
+ <_>
+
+ <_>
+ 7 0 6 2 -1.
+ <_>
+ 9 0 2 2 3.
+ <_>
+
+ <_>
+ 6 13 8 2 -1.
+ <_>
+ 8 13 4 2 2.
+ <_>
+
+ <_>
+ 14 12 4 4 -1.
+ <_>
+ 15 12 2 4 2.
+ <_>
+
+ <_>
+ 3 8 17 9 -1.
+ <_>
+ 3 11 17 3 3.
+ <_>
+
+ <_>
+ 0 12 4 3 -1.
+ <_>
+ 2 12 2 3 2.
+ <_>
+
+ <_>
+ 8 3 12 6 -1.
+ <_>
+ 12 3 4 6 3.
+ <_>
+
+ <_>
+ 0 14 3 6 -1.
+ <_>
+ 0 17 3 3 2.
+ <_>
+
+ <_>
+ 3 0 13 9 -1.
+ <_>
+ 3 3 13 3 3.
+ <_>
+
+ <_>
+ 8 2 8 6 -1.
+ <_>
+ 8 5 8 3 2.
+ <_>
+
+ <_>
+ 1 11 18 3 -1.
+ <_>
+ 7 11 6 3 3.
+ <_>
+
+ <_>
+ 16 17 1 2 -1.
+ <_>
+ 16 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 14 12 6 4 -1.
+ <_>
+ 16 12 2 4 3.
+ <_>
+
+ <_>
+ 13 11 4 5 -1.
+ <_>
+ 14 11 2 5 2.
+ <_>
+
+ <_>
+ 19 3 1 2 -1.
+ <_>
+ 19 4 1 1 2.
+ <_>
+
+ <_>
+ 19 0 1 3 -1.
+ <_>
+ 19 1 1 1 3.
+ <_>
+
+ <_>
+ 7 2 8 4 -1.
+ <_>
+ 7 4 8 2 2.
+ <_>
+
+ <_>
+ 9 12 3 2 -1.
+ <_>
+ 10 12 1 2 3.
+ <_>
+
+ <_>
+ 15 8 3 2 -1.
+ <_>
+ 16 9 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 16 15 3 2 -1.
+ <_>
+ 16 15 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 6 12 3 3 -1.
+ <_>
+ 7 12 1 3 3.
+ <_>
+
+ <_>
+ 13 12 3 1 -1.
+ <_>
+ 14 13 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 4 0 1 3 -1.
+ <_>
+ 3 1 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 8 2 6 4 -1.
+ <_>
+ 10 2 2 4 3.
+ <_>
+
+ <_>
+ 15 15 2 3 -1.
+ <_>
+ 14 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 12 18 8 2 -1.
+ <_>
+ 12 19 8 1 2.
+ <_>
+
+ <_>
+ 7 12 6 7 -1.
+ <_>
+ 9 12 2 7 3.
+ <_>
+
+ <_>
+ 4 18 6 2 -1.
+ <_>
+ 6 18 2 2 3.
+ <_>
+
+ <_>
+ 11 12 3 3 -1.
+ <_>
+ 12 12 1 3 3.
+ <_>
+
+ <_>
+ 12 12 2 2 -1.
+ <_>
+ 13 12 1 2 2.
+ <_>
+
+ <_>
+ 18 5 2 1 -1.
+ <_>
+ 19 5 1 1 2.
+ <_>
+
+ <_>
+ 5 19 4 1 -1.
+ <_>
+ 6 19 2 1 2.
+ <_>
+
+ <_>
+ 0 11 5 2 -1.
+ <_>
+ 0 12 5 1 2.
+ <_>
+
+ <_>
+ 18 0 2 2 -1.
+ <_>
+ 18 1 2 1 2.
+ <_>
+
+ <_>
+ 1 0 12 6 -1.
+ <_>
+ 1 2 12 2 3.
+ <_>
+
+ <_>
+ 1 1 6 1 -1.
+ <_>
+ 3 3 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 16 9 3 1 -1.
+ <_>
+ 17 10 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 14 10 1 6 -1.
+ <_>
+ 12 12 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 3 1 1 3 -1.
+ <_>
+ 2 2 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 0 4 3 -1.
+ <_>
+ 2 1 4 1 3.
+ 1
+ <_>
+
+ <_>
+ 6 14 8 1 -1.
+ <_>
+ 8 14 4 1 2.
+ <_>
+
+ <_>
+ 1 8 18 9 -1.
+ <_>
+ 7 11 6 3 9.
+ <_>
+
+ <_>
+ 19 0 1 18 -1.
+ <_>
+ 19 6 1 6 3.
+ <_>
+
+ <_>
+ 1 13 3 6 -1.
+ <_>
+ 1 16 3 3 2.
+ <_>
+
+ <_>
+ 6 10 7 3 -1.
+ <_>
+ 6 11 7 1 3.
+ <_>
+
+ <_>
+ 6 9 7 3 -1.
+ <_>
+ 6 10 7 1 3.
+ <_>
+
+ <_>
+ 14 1 6 8 -1.
+ <_>
+ 17 1 3 8 2.
+ <_>
+
+ <_>
+ 9 6 2 4 -1.
+ <_>
+ 10 6 1 4 2.
+ <_>
+
+ <_>
+ 6 11 7 2 -1.
+ <_>
+ 6 12 7 1 2.
+ <_>
+
+ <_>
+ 17 11 3 6 -1.
+ <_>
+ 18 12 1 6 3.
+ 1
+ <_>
+
+ <_>
+ 19 17 1 2 -1.
+ <_>
+ 19 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 16 9 4 2 -1.
+ <_>
+ 17 10 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 6 18 4 2 -1.
+ <_>
+ 7 18 2 2 2.
+ <_>
+
+ <_>
+ 2 12 4 4 -1.
+ <_>
+ 3 12 2 4 2.
+ <_>
+
+ <_>
+ 19 2 1 2 -1.
+ <_>
+ 19 3 1 1 2.
+ <_>
+
+ <_>
+ 19 2 1 3 -1.
+ <_>
+ 19 3 1 1 3.
+ <_>
+
+ <_>
+ 1 12 12 3 -1.
+ <_>
+ 7 12 6 3 2.
+ <_>
+
+ <_>
+ 6 18 4 1 -1.
+ <_>
+ 7 18 2 1 2.
+ <_>
+
+ <_>
+ 5 2 12 6 -1.
+ <_>
+ 5 5 12 3 2.
+ <_>
+
+ <_>
+ 9 1 6 6 -1.
+ <_>
+ 9 4 6 3 2.
+ <_>
+
+ <_>
+ 7 0 11 9 -1.
+ <_>
+ 7 3 11 3 3.
+ <_>
+
+ <_>
+ 2 0 8 9 -1.
+ <_>
+ 2 3 8 3 3.
+ <_>
+
+ <_>
+ 5 3 4 3 -1.
+ <_>
+ 6 3 2 3 2.
+ <_>
+
+ <_>
+ 0 18 3 2 -1.
+ <_>
+ 0 19 3 1 2.
+ <_>
+
+ <_>
+ 1 0 10 19 -1.
+ <_>
+ 6 0 5 19 2.
+ <_>
+
+ <_>
+ 3 8 2 3 -1.
+ <_>
+ 2 9 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 10 17 4 3 -1.
+ <_>
+ 11 17 2 3 2.
+ <_>
+
+ <_>
+ 11 13 3 2 -1.
+ <_>
+ 12 13 1 2 3.
+ <_>
+
+ <_>
+ 10 12 3 2 -1.
+ <_>
+ 11 12 1 2 3.
+ <_>
+
+ <_>
+ 9 11 3 3 -1.
+ <_>
+ 10 11 1 3 3.
+ <_>
+
+ <_>
+ 17 2 3 1 -1.
+ <_>
+ 18 3 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 12 0 6 13 -1.
+ <_>
+ 14 0 2 13 3.
+ <_>
+
+ <_>
+ 16 0 3 1 -1.
+ <_>
+ 17 1 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 11 1 2 -1.
+ <_>
+ 5 12 1 1 2.
+ <_>
+
+ <_>
+ 2 11 4 2 -1.
+ <_>
+ 2 11 2 1 2.
+ <_>
+ 4 12 2 1 2.
+ <_>
+
+ <_>
+ 16 15 2 3 -1.
+ <_>
+ 15 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 8 17 4 2 -1.
+ <_>
+ 9 17 2 2 2.
+ <_>
+
+ <_>
+ 0 16 4 3 -1.
+ <_>
+ 0 17 4 1 3.
+ <_>
+
+ <_>
+ 9 13 6 2 -1.
+ <_>
+ 12 13 3 2 2.
+ <_>
+
+ <_>
+ 2 14 1 2 -1.
+ <_>
+ 2 14 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 5 10 8 3 -1.
+ <_>
+ 5 11 8 1 3.
+ <_>
+
+ <_>
+ 15 0 3 8 -1.
+ <_>
+ 13 2 3 4 2.
+ 1
+ <_>
+
+ <_>
+ 14 11 4 7 -1.
+ <_>
+ 15 11 2 7 2.
+ <_>
+
+ <_>
+ 3 11 15 4 -1.
+ <_>
+ 8 11 5 4 3.
+ <_>
+
+ <_>
+ 9 1 9 9 -1.
+ <_>
+ 12 1 3 9 3.
+ <_>
+
+ <_>
+ 0 11 4 7 -1.
+ <_>
+ 2 11 2 7 2.
+ <_>
+
+ <_>
+ 0 16 1 4 -1.
+ <_>
+ 0 18 1 2 2.
+ <_>
+
+ <_>
+ 19 0 1 6 -1.
+ <_>
+ 19 3 1 3 2.
+ <_>
+
+ <_>
+ 11 8 9 9 -1.
+ <_>
+ 11 11 9 3 3.
+ <_>
+
+ <_>
+ 9 17 8 3 -1.
+ <_>
+ 11 17 4 3 2.
+ <_>
+
+ <_>
+ 18 4 2 2 -1.
+ <_>
+ 19 4 1 2 2.
+ <_>
+
+ <_>
+ 8 11 3 3 -1.
+ <_>
+ 9 12 1 1 9.
+ <_>
+
+ <_>
+ 13 2 3 4 -1.
+ <_>
+ 13 2 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 4 6 16 3 -1.
+ <_>
+ 12 6 8 3 2.
+ <_>
+
+ <_>
+ 10 12 1 3 -1.
+ <_>
+ 9 13 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 8 12 3 3 -1.
+ <_>
+ 9 13 1 1 9.
+ <_>
+
+ <_>
+ 17 17 1 2 -1.
+ <_>
+ 17 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 16 16 2 2 -1.
+ <_>
+ 16 16 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 6 0 9 6 -1.
+ <_>
+ 6 2 9 2 3.
+ <_>
+
+ <_>
+ 5 0 10 8 -1.
+ <_>
+ 5 2 10 4 2.
+ <_>
+
+ <_>
+ 17 5 2 1 -1.
+ <_>
+ 18 5 1 1 2.
+ <_>
+
+ <_>
+ 11 0 9 9 -1.
+ <_>
+ 14 0 3 9 3.
+ <_>
+
+ <_>
+ 6 9 7 3 -1.
+ <_>
+ 6 10 7 1 3.
+ <_>
+
+ <_>
+ 3 12 6 2 -1.
+ <_>
+ 3 12 3 1 2.
+ <_>
+ 6 13 3 1 2.
+ <_>
+
+ <_>
+ 2 10 1 2 -1.
+ <_>
+ 2 10 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 13 15 2 3 -1.
+ <_>
+ 12 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 7 2 6 5 -1.
+ <_>
+ 9 2 2 5 3.
+ <_>
+
+ <_>
+ 13 13 6 3 -1.
+ <_>
+ 15 13 2 3 3.
+ <_>
+
+ <_>
+ 17 9 3 8 -1.
+ <_>
+ 17 11 3 4 2.
+ <_>
+
+ <_>
+ 8 3 4 3 -1.
+ <_>
+ 9 3 2 3 2.
+ <_>
+
+ <_>
+ 15 6 2 12 -1.
+ <_>
+ 15 6 1 12 2.
+ 1
+ <_>
+
+ <_>
+ 11 14 4 2 -1.
+ <_>
+ 11 14 4 1 2.
+ 1
+ <_>
+
+ <_>
+ 9 2 5 4 -1.
+ <_>
+ 9 4 5 2 2.
+ <_>
+
+ <_>
+ 13 12 3 3 -1.
+ <_>
+ 14 12 1 3 3.
+ <_>
+
+ <_>
+ 18 1 2 3 -1.
+ <_>
+ 18 2 2 1 3.
+ <_>
+
+ <_>
+ 5 13 4 1 -1.
+ <_>
+ 6 13 2 1 2.
+ <_>
+
+ <_>
+ 5 10 2 2 -1.
+ <_>
+ 5 10 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 2 11 1 2 -1.
+ <_>
+ 2 11 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 18 3 2 6 -1.
+ <_>
+ 18 5 2 2 3.
+ <_>
+
+ <_>
+ 10 4 6 2 -1.
+ <_>
+ 10 5 6 1 2.
+ <_>
+
+ <_>
+ 11 13 6 2 -1.
+ <_>
+ 13 13 2 2 3.
+ <_>
+
+ <_>
+ 9 11 3 4 -1.
+ <_>
+ 9 11 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 11 2 5 -1.
+ <_>
+ 1 11 1 5 2.
+ <_>
+
+ <_>
+ 0 8 20 9 -1.
+ <_>
+ 0 11 20 3 3.
+ <_>
+
+ <_>
+ 18 0 1 6 -1.
+ <_>
+ 18 3 1 3 2.
+ <_>
+
+ <_>
+ 14 1 6 7 -1.
+ <_>
+ 17 1 3 7 2.
+ <_>
+
+ <_>
+ 4 13 2 4 -1.
+ <_>
+ 4 13 1 2 2.
+ <_>
+ 5 15 1 2 2.
+ <_>
+
+ <_>
+ 1 9 18 6 -1.
+ <_>
+ 7 9 6 6 3.
+ <_>
+
+ <_>
+ 0 16 5 4 -1.
+ <_>
+ 0 18 5 2 2.
+ <_>
+
+ <_>
+ 8 14 3 4 -1.
+ <_>
+ 8 15 3 2 2.
+ <_>
+
+ <_>
+ 7 7 8 3 -1.
+ <_>
+ 11 7 4 3 2.
+ <_>
+
+ <_>
+ 12 3 4 7 -1.
+ <_>
+ 13 3 2 7 2.
+ <_>
+
+ <_>
+ 13 12 2 8 -1.
+ <_>
+ 13 12 1 4 2.
+ <_>
+ 14 16 1 4 2.
+ <_>
+
+ <_>
+ 13 10 3 5 -1.
+ <_>
+ 14 11 1 5 3.
+ 1
+ <_>
+
+ <_>
+ 10 5 4 5 -1.
+ <_>
+ 11 5 2 5 2.
+ <_>
+
+ <_>
+ 2 11 18 2 -1.
+ <_>
+ 8 11 6 2 3.
+ <_>
+
+ <_>
+ 2 0 1 2 -1.
+ <_>
+ 2 0 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 2 0 1 2 -1.
+ <_>
+ 2 0 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 15 17 1 2 -1.
+ <_>
+ 15 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 17 16 1 3 -1.
+ <_>
+ 16 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 18 0 2 10 -1.
+ <_>
+ 19 0 1 10 2.
+ <_>
+
+ <_>
+ 14 2 6 7 -1.
+ <_>
+ 16 2 2 7 3.
+ <_>
+
+ <_>
+ 12 0 4 4 -1.
+ <_>
+ 12 0 4 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 3 15 6 -1.
+ <_>
+ 0 5 15 2 3.
+ <_>
+
+ <_>
+ 5 1 4 4 -1.
+ <_>
+ 6 1 2 4 2.
+ <_>
+
+ <_>
+ 7 13 6 7 -1.
+ <_>
+ 9 13 2 7 3.
+ <_>
+
+ <_>
+ 6 18 6 2 -1.
+ <_>
+ 8 18 2 2 3.
+ <_>
+
+ <_>
+ 0 15 5 2 -1.
+ <_>
+ 0 16 5 1 2.
+ <_>
+
+ <_>
+ 4 1 12 6 -1.
+ <_>
+ 4 3 12 2 3.
+ <_>
+
+ <_>
+ 5 0 13 8 -1.
+ <_>
+ 5 2 13 4 2.
+ <_>
+
+ <_>
+ 13 10 6 6 -1.
+ <_>
+ 15 12 2 2 9.
+ <_>
+
+ <_>
+ 15 9 3 1 -1.
+ <_>
+ 16 10 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 11 3 3 -1.
+ <_>
+ 6 12 1 1 9.
+ <_>
+
+ <_>
+ 6 11 2 2 -1.
+ <_>
+ 6 11 1 1 2.
+ <_>
+ 7 12 1 1 2.
+ <_>
+
+ <_>
+ 17 3 3 2 -1.
+ <_>
+ 18 4 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 16 3 3 3 -1.
+ <_>
+ 17 4 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 12 13 3 1 -1.
+ <_>
+ 13 13 1 1 3.
+ <_>
+
+ <_>
+ 11 12 3 2 -1.
+ <_>
+ 12 12 1 2 3.
+ <_>
+
+ <_>
+ 10 0 1 2 -1.
+ <_>
+ 10 0 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 17 13 1 6 -1.
+ <_>
+ 17 13 1 3 2.
+ 1
+ <_>
+
+ <_>
+ 16 14 2 4 -1.
+ <_>
+ 16 14 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 3 0 4 3 -1.
+ <_>
+ 4 0 2 3 2.
+ <_>
+
+ <_>
+ 6 0 14 1 -1.
+ <_>
+ 13 0 7 1 2.
+ <_>
+
+ <_>
+ 2 15 18 5 -1.
+ <_>
+ 8 15 6 5 3.
+ <_>
+
+ <_>
+ 6 11 8 5 -1.
+ <_>
+ 8 11 4 5 2.
+ <_>
+
+ <_>
+ 0 8 5 12 -1.
+ <_>
+ 0 11 5 6 2.
+ <_>
+
+ <_>
+ 14 0 6 2 -1.
+ <_>
+ 14 0 6 1 2.
+ 1
+ <_>
+
+ <_>
+ 13 8 4 5 -1.
+ <_>
+ 14 9 2 5 2.
+ 1
+ <_>
+
+ <_>
+ 0 11 4 9 -1.
+ <_>
+ 2 11 2 9 2.
+ <_>
+
+ <_>
+ 6 9 2 6 -1.
+ <_>
+ 6 11 2 2 3.
+ <_>
+
+ <_>
+ 12 18 4 2 -1.
+ <_>
+ 12 19 4 1 2.
+ <_>
+
+ <_>
+ 14 13 6 2 -1.
+ <_>
+ 16 13 2 2 3.
+ <_>
+
+ <_>
+ 19 9 1 10 -1.
+ <_>
+ 19 9 1 5 2.
+ 1
+ <_>
+
+ <_>
+ 11 5 4 4 -1.
+ <_>
+ 12 5 2 4 2.
+ <_>
+
+ <_>
+ 14 12 3 5 -1.
+ <_>
+ 15 12 1 5 3.
+ <_>
+
+ <_>
+ 17 0 2 6 -1.
+ <_>
+ 18 0 1 6 2.
+ <_>
+
+ <_>
+ 13 16 3 3 -1.
+ <_>
+ 14 16 1 3 3.
+ <_>
+
+ <_>
+ 19 0 1 4 -1.
+ <_>
+ 19 2 1 2 2.
+ <_>
+
+ <_>
+ 6 13 4 2 -1.
+ <_>
+ 7 13 2 2 2.
+ <_>
+
+ <_>
+ 9 11 3 3 -1.
+ <_>
+ 10 11 1 3 3.
+ <_>
+
+ <_>
+ 14 15 2 3 -1.
+ <_>
+ 13 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 11 7 3 4 -1.
+ <_>
+ 12 7 1 4 3.
+ <_>
+
+ <_>
+ 5 12 1 3 -1.
+ <_>
+ 4 13 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 1 11 6 2 -1.
+ <_>
+ 1 11 3 1 2.
+ <_>
+ 4 12 3 1 2.
+ <_>
+
+ <_>
+ 5 7 2 3 -1.
+ <_>
+ 4 8 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 12 2 2 -1.
+ <_>
+ 5 12 1 1 2.
+ <_>
+ 6 13 1 1 2.
+ <_>
+
+ <_>
+ 8 8 4 3 -1.
+ <_>
+ 8 9 4 1 3.
+ <_>
+
+ <_>
+ 7 8 5 3 -1.
+ <_>
+ 7 9 5 1 3.
+ <_>
+
+ <_>
+ 6 19 4 1 -1.
+ <_>
+ 7 19 2 1 2.
+ <_>
+
+ <_>
+ 5 0 4 4 -1.
+ <_>
+ 6 0 2 4 2.
+ <_>
+
+ <_>
+ 4 0 16 8 -1.
+ <_>
+ 8 0 8 8 2.
+ <_>
+
+ <_>
+ 12 11 3 4 -1.
+ <_>
+ 11 12 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 4 20 6 -1.
+ <_>
+ 5 4 10 6 2.
+ <_>
+
+ <_>
+ 13 2 2 4 -1.
+ <_>
+ 13 2 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 5 14 15 -1.
+ <_>
+ 7 5 7 15 2.
+ <_>
+
+ <_>
+ 1 18 3 2 -1.
+ <_>
+ 1 19 3 1 2.
+ <_>
+
+ <_>
+ 3 6 3 3 -1.
+ <_>
+ 2 7 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 0 1 6 8 -1.
+ <_>
+ 0 1 3 4 2.
+ <_>
+ 3 5 3 4 2.
+ <_>
+
+ <_>
+ 5 0 6 6 -1.
+ <_>
+ 7 0 2 6 3.
+ <_>
+
+ <_>
+ 1 1 15 8 -1.
+ <_>
+ 1 3 15 4 2.
+ <_>
+
+ <_>
+ 0 0 16 1 -1.
+ <_>
+ 8 0 8 1 2.
+ <_>
+
+ <_>
+ 3 0 1 2 -1.
+ <_>
+ 3 0 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 3 13 4 1 -1.
+ <_>
+ 4 13 2 1 2.
+ <_>
+
+ <_>
+ 4 11 2 2 -1.
+ <_>
+ 4 11 1 1 2.
+ <_>
+ 5 12 1 1 2.
+ <_>
+
+ <_>
+ 17 2 3 3 -1.
+ <_>
+ 18 3 1 1 9.
+ <_>
+
+ <_>
+ 16 3 2 1 -1.
+ <_>
+ 17 3 1 1 2.
+ <_>
+
+ <_>
+ 0 11 3 2 -1.
+ <_>
+ 0 12 3 1 2.
+ <_>
+
+ <_>
+ 4 11 4 2 -1.
+ <_>
+ 4 11 2 1 2.
+ <_>
+ 6 12 2 1 2.
+ <_>
+
+ <_>
+ 10 0 4 11 -1.
+ <_>
+ 11 0 2 11 2.
+ <_>
+
+ <_>
+ 18 15 2 3 -1.
+ <_>
+ 17 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 2 11 8 1 -1.
+ <_>
+ 2 11 4 1 2.
+ 1
+ <_>
+
+ <_>
+ 17 13 1 6 -1.
+ <_>
+ 17 13 1 3 2.
+ 1
+ <_>
+
+ <_>
+ 11 13 6 2 -1.
+ <_>
+ 13 13 2 2 3.
+ <_>
+
+ <_>
+ 19 0 1 10 -1.
+ <_>
+ 19 5 1 5 2.
+ <_>
+
+ <_>
+ 2 8 7 9 -1.
+ <_>
+ 2 11 7 3 3.
+ <_>
+
+ <_>
+ 0 11 20 2 -1.
+ <_>
+ 5 11 10 2 2.
+ <_>
+
+ <_>
+ 6 14 6 1 -1.
+ <_>
+ 8 14 2 1 3.
+ <_>
+
+ <_>
+ 10 3 8 7 -1.
+ <_>
+ 12 3 4 7 2.
+ <_>
+
+ <_>
+ 7 0 5 9 -1.
+ <_>
+ 7 3 5 3 3.
+ <_>
+
+ <_>
+ 0 0 16 6 -1.
+ <_>
+ 0 2 16 2 3.
+ <_>
+
+ <_>
+ 6 10 2 6 -1.
+ <_>
+ 4 12 2 2 3.
+ 1
+ <_>
+
+ <_>
+ 16 0 4 14 -1.
+ <_>
+ 18 0 2 14 2.
+ <_>
+
+ <_>
+ 6 0 9 6 -1.
+ <_>
+ 6 2 9 2 3.
+ <_>
+
+ <_>
+ 8 18 12 2 -1.
+ <_>
+ 8 19 12 1 2.
+ <_>
+
+ <_>
+ 10 17 4 3 -1.
+ <_>
+ 11 17 2 3 2.
+ <_>
+
+ <_>
+ 5 0 1 4 -1.
+ <_>
+ 4 1 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 18 6 2 2 -1.
+ <_>
+ 18 6 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 12 10 3 4 -1.
+ <_>
+ 11 11 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 9 9 4 3 -1.
+ <_>
+ 9 10 4 1 3.
+ <_>
+
+ <_>
+ 9 10 4 3 -1.
+ <_>
+ 9 11 4 1 3.
+ <_>
+
+ <_>
+ 17 4 3 4 -1.
+ <_>
+ 18 5 1 4 3.
+ 1
+ <_>
+
+ <_>
+ 18 0 2 3 -1.
+ <_>
+ 18 1 2 1 3.
+ <_>
+
+ <_>
+ 18 1 2 2 -1.
+ <_>
+ 18 2 2 1 2.
+ <_>
+
+ <_>
+ 19 1 1 3 -1.
+ <_>
+ 19 2 1 1 3.
+ <_>
+
+ <_>
+ 8 18 4 2 -1.
+ <_>
+ 9 18 2 2 2.
+ <_>
+
+ <_>
+ 2 13 4 2 -1.
+ <_>
+ 2 13 2 1 2.
+ <_>
+ 4 14 2 1 2.
+ <_>
+
+ <_>
+ 3 11 4 2 -1.
+ <_>
+ 3 11 2 1 2.
+ <_>
+ 5 12 2 1 2.
+ <_>
+
+ <_>
+ 2 10 4 2 -1.
+ <_>
+ 2 10 2 1 2.
+ <_>
+ 4 11 2 1 2.
+ <_>
+
+ <_>
+ 5 9 2 3 -1.
+ <_>
+ 4 10 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 2 10 4 6 -1.
+ <_>
+ 3 10 2 6 2.
+ <_>
+
+ <_>
+ 13 0 6 8 -1.
+ <_>
+ 16 0 3 8 2.
+ <_>
+
+ <_>
+ 10 0 8 9 -1.
+ <_>
+ 12 0 4 9 2.
+ <_>
+
+ <_>
+ 1 11 8 1 -1.
+ <_>
+ 1 11 4 1 2.
+ 1
+ <_>
+
+ <_>
+ 3 0 1 3 -1.
+ <_>
+ 2 1 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 13 13 2 2 -1.
+ <_>
+ 14 13 1 2 2.
+ <_>
+
+ <_>
+ 4 12 3 4 -1.
+ <_>
+ 5 12 1 4 3.
+ <_>
+
+ <_>
+ 6 17 4 3 -1.
+ <_>
+ 7 17 2 3 2.
+ <_>
+
+ <_>
+ 14 1 2 6 -1.
+ <_>
+ 14 1 2 3 2.
+ 1
+ <_>
+
+ <_>
+ 8 4 8 4 -1.
+ <_>
+ 8 6 8 2 2.
+ <_>
+
+ <_>
+ 8 3 4 5 -1.
+ <_>
+ 10 3 2 5 2.
+ <_>
+
+ <_>
+ 13 12 2 2 -1.
+ <_>
+ 13 12 1 1 2.
+ <_>
+ 14 13 1 1 2.
+ <_>
+
+ <_>
+ 6 12 3 3 -1.
+ <_>
+ 7 12 1 3 3.
+ <_>
+
+ <_>
+ 5 7 3 3 -1.
+ <_>
+ 4 8 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 15 10 5 4 -1.
+ <_>
+ 15 11 5 2 2.
+ <_>
+
+ <_>
+ 14 8 4 9 -1.
+ <_>
+ 14 11 4 3 3.
+ <_>
+
+ <_>
+ 16 9 4 3 -1.
+ <_>
+ 16 10 4 1 3.
+ <_>
+
+ <_>
+ 18 7 2 13 -1.
+ <_>
+ 19 7 1 13 2.
+ <_>
+
+ <_>
+ 0 0 16 1 -1.
+ <_>
+ 8 0 8 1 2.
+ <_>
+
+ <_>
+ 12 11 5 4 -1.
+ <_>
+ 11 12 5 2 2.
+ 1
+ <_>
+
+ <_>
+ 17 13 2 4 -1.
+ <_>
+ 18 13 1 4 2.
+ <_>
+
+ <_>
+ 6 13 9 2 -1.
+ <_>
+ 9 13 3 2 3.
+ <_>
+
+ <_>
+ 3 8 6 8 -1.
+ <_>
+ 3 10 6 4 2.
+ <_>
+
+ <_>
+ 14 12 4 3 -1.
+ <_>
+ 15 12 2 3 2.
+ <_>
+
+ <_>
+ 12 6 6 4 -1.
+ <_>
+ 14 8 2 4 3.
+ 1
+ <_>
+
+ <_>
+ 4 0 12 6 -1.
+ <_>
+ 4 3 12 3 2.
+ <_>
+
+ <_>
+ 0 0 17 2 -1.
+ <_>
+ 0 1 17 1 2.
+ <_>
+
+ <_>
+ 2 14 1 6 -1.
+ <_>
+ 2 17 1 3 2.
+ <_>
+
+ <_>
+ 3 10 3 3 -1.
+ <_>
+ 2 11 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 18 2 2 9 -1.
+ <_>
+ 19 2 1 9 2.
+ <_>
+
+ <_>
+ 7 9 13 8 -1.
+ <_>
+ 7 11 13 4 2.
+ <_>
+
+ <_>
+ 17 6 3 4 -1.
+ <_>
+ 18 7 1 4 3.
+ 1
+ <_>
+
+ <_>
+ 6 13 2 2 -1.
+ <_>
+ 7 13 1 2 2.
+ <_>
+
+ <_>
+ 15 16 1 3 -1.
+ <_>
+ 14 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 11 16 6 4 -1.
+ <_>
+ 11 16 3 2 2.
+ <_>
+ 14 18 3 2 2.
+ <_>
+
+ <_>
+ 19 0 1 4 -1.
+ <_>
+ 19 1 1 2 2.
+ <_>
+
+ <_>
+ 19 0 1 2 -1.
+ <_>
+ 19 1 1 1 2.
+ <_>
+
+ <_>
+ 12 3 3 6 -1.
+ <_>
+ 13 3 1 6 3.
+ <_>
+
+ <_>
+ 8 10 4 3 -1.
+ <_>
+ 8 11 4 1 3.
+ <_>
+
+ <_>
+ 19 0 1 8 -1.
+ <_>
+ 19 4 1 4 2.
+ <_>
+
+ <_>
+ 14 0 6 6 -1.
+ <_>
+ 14 0 3 3 2.
+ <_>
+ 17 3 3 3 2.
+ <_>
+
+ <_>
+ 8 11 3 3 -1.
+ <_>
+ 9 12 1 1 9.
+ <_>
+
+ <_>
+ 1 6 10 12 -1.
+ <_>
+ 6 6 5 12 2.
+ <_>
+
+ <_>
+ 10 6 2 1 -1.
+ <_>
+ 11 6 1 1 2.
+ <_>
+
+ <_>
+ 8 1 7 10 -1.
+ <_>
+ 8 6 7 5 2.
+ <_>
+
+ <_>
+ 13 11 3 3 -1.
+ <_>
+ 14 12 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 10 13 4 4 -1.
+ <_>
+ 10 13 2 2 2.
+ <_>
+ 12 15 2 2 2.
+ <_>
+
+ <_>
+ 15 15 2 3 -1.
+ <_>
+ 14 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 13 13 3 1 -1.
+ <_>
+ 14 13 1 1 3.
+ <_>
+
+ <_>
+ 10 4 6 3 -1.
+ <_>
+ 12 4 2 3 3.
+ <_>
+
+ <_>
+ 1 7 6 4 -1.
+ <_>
+ 1 7 3 2 2.
+ <_>
+ 4 9 3 2 2.
+ <_>
+
+ <_>
+ 15 7 4 2 -1.
+ <_>
+ 16 8 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 10 4 9 6 -1.
+ <_>
+ 13 4 3 6 3.
+ <_>
+
+ <_>
+ 14 2 6 2 -1.
+ <_>
+ 14 2 6 1 2.
+ 1
+ <_>
+
+ <_>
+ 5 18 4 2 -1.
+ <_>
+ 6 18 2 2 2.
+ <_>
+
+ <_>
+ 0 12 2 8 -1.
+ <_>
+ 1 12 1 8 2.
+ <_>
+
+ <_>
+ 1 19 18 1 -1.
+ <_>
+ 10 19 9 1 2.
+ <_>
+
+ <_>
+ 2 0 12 20 -1.
+ <_>
+ 8 0 6 20 2.
+ <_>
+
+ <_>
+ 2 0 14 1 -1.
+ <_>
+ 9 0 7 1 2.
+ <_>
+
+ <_>
+ 7 9 8 3 -1.
+ <_>
+ 7 10 8 1 3.
+ <_>
+
+ <_>
+ 3 11 2 2 -1.
+ <_>
+ 3 11 1 1 2.
+ <_>
+ 4 12 1 1 2.
+ <_>
+
+ <_>
+ 11 0 9 2 -1.
+ <_>
+ 14 0 3 2 3.
+ <_>
+
+ <_>
+ 6 0 9 1 -1.
+ <_>
+ 9 0 3 1 3.
+ <_>
+
+ <_>
+ 4 8 1 4 -1.
+ <_>
+ 3 9 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 9 3 3 -1.
+ <_>
+ 0 10 3 1 3.
+ <_>
+
+ <_>
+ 3 4 15 12 -1.
+ <_>
+ 8 8 5 4 9.
+ <_>
+
+ <_>
+ 7 13 6 6 -1.
+ <_>
+ 9 13 2 6 3.
+ <_>
+
+ <_>
+ 2 1 12 6 -1.
+ <_>
+ 2 3 12 2 3.
+ <_>
+
+ <_>
+ 1 1 6 1 -1.
+ <_>
+ 3 3 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 4 5 3 -1.
+ <_>
+ 2 5 5 1 3.
+ 1
+ <_>
+
+ <_>
+ 2 12 2 2 -1.
+ <_>
+ 2 12 1 1 2.
+ <_>
+ 3 13 1 1 2.
+ <_>
+
+ <_>
+ 8 11 3 3 -1.
+ <_>
+ 9 11 1 3 3.
+ <_>
+
+ <_>
+ 9 11 3 4 -1.
+ <_>
+ 10 11 1 4 3.
+ <_>
+
+ <_>
+ 17 2 3 1 -1.
+ <_>
+ 18 3 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 11 6 3 -1.
+ <_>
+ 8 11 3 3 2.
+ <_>
+
+ <_>
+ 2 12 12 8 -1.
+ <_>
+ 2 12 6 4 2.
+ <_>
+ 8 16 6 4 2.
+ <_>
+
+ <_>
+ 13 15 2 3 -1.
+ <_>
+ 12 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 5 14 9 1 -1.
+ <_>
+ 8 14 3 1 3.
+ <_>
+
+ <_>
+ 13 13 4 6 -1.
+ <_>
+ 13 13 2 3 2.
+ <_>
+ 15 16 2 3 2.
+ <_>
+
+ <_>
+ 8 7 9 1 -1.
+ <_>
+ 11 10 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 16 0 4 4 -1.
+ <_>
+ 16 0 4 2 2.
+ 1
+ <_>
+
+ <_>
+ 2 13 2 2 -1.
+ <_>
+ 2 13 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 5 12 2 2 -1.
+ <_>
+ 5 13 2 1 2.
+ <_>
+
+ <_>
+ 0 16 2 4 -1.
+ <_>
+ 0 18 2 2 2.
+ <_>
+
+ <_>
+ 0 8 14 11 -1.
+ <_>
+ 7 8 7 11 2.
+ <_>
+
+ <_>
+ 4 17 4 3 -1.
+ <_>
+ 5 17 2 3 2.
+ <_>
+
+ <_>
+ 3 12 3 5 -1.
+ <_>
+ 4 12 1 5 3.
+ <_>
+
+ <_>
+ 5 11 1 3 -1.
+ <_>
+ 5 12 1 1 3.
+ <_>
+
+ <_>
+ 4 10 4 2 -1.
+ <_>
+ 4 10 2 1 2.
+ <_>
+ 6 11 2 1 2.
+ <_>
+
+ <_>
+ 15 9 3 1 -1.
+ <_>
+ 16 10 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 0 16 7 -1.
+ <_>
+ 7 0 8 7 2.
+ <_>
+
+ <_>
+ 2 2 17 6 -1.
+ <_>
+ 2 5 17 3 2.
+ <_>
+
+ <_>
+ 2 4 14 6 -1.
+ <_>
+ 2 6 14 2 3.
+ <_>
+
+ <_>
+ 2 9 6 2 -1.
+ <_>
+ 2 9 3 1 2.
+ <_>
+ 5 10 3 1 2.
+ <_>
+
+ <_>
+ 3 11 4 2 -1.
+ <_>
+ 3 11 2 1 2.
+ <_>
+ 5 12 2 1 2.
+ <_>
+
+ <_>
+ 16 13 4 2 -1.
+ <_>
+ 18 13 2 2 2.
+ <_>
+
+ <_>
+ 15 7 3 2 -1.
+ <_>
+ 16 8 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 0 11 4 2 -1.
+ <_>
+ 0 12 4 1 2.
+ <_>
+
+ <_>
+ 4 9 2 3 -1.
+ <_>
+ 3 10 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 18 6 2 -1.
+ <_>
+ 5 18 2 2 3.
+ <_>
+
+ <_>
+ 11 12 3 2 -1.
+ <_>
+ 12 12 1 2 3.
+ <_>
+
+ <_>
+ 19 0 1 2 -1.
+ <_>
+ 19 1 1 1 2.
+ <_>
+
+ <_>
+ 0 0 14 1 -1.
+ <_>
+ 7 0 7 1 2.
+ <_>
+
+ <_>
+ 11 10 3 4 -1.
+ <_>
+ 10 11 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 14 16 1 3 -1.
+ <_>
+ 13 17 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 18 1 2 4 -1.
+ <_>
+ 19 1 1 4 2.
+ <_>
+
+ <_>
+ 15 13 5 6 -1.
+ <_>
+ 15 15 5 2 3.
+ <_>
+
+ <_>
+ 16 4 3 3 -1.
+ <_>
+ 17 5 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 4 6 16 14 -1.
+ <_>
+ 12 6 8 14 2.
+ <_>
+
+ <_>
+ 10 12 3 1 -1.
+ <_>
+ 11 12 1 1 3.
+ <_>
+
+ <_>
+ 5 12 2 2 -1.
+ <_>
+ 5 12 1 1 2.
+ <_>
+ 6 13 1 1 2.
+ <_>
+
+ <_>
+ 9 3 4 5 -1.
+ <_>
+ 10 3 2 5 2.
+ <_>
+
+ <_>
+ 18 1 2 3 -1.
+ <_>
+ 18 2 2 1 3.
+ <_>
+
+ <_>
+ 19 17 1 2 -1.
+ <_>
+ 19 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 17 16 2 2 -1.
+ <_>
+ 17 16 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 10 2 7 6 -1.
+ <_>
+ 10 4 7 2 3.
+ <_>
+
+ <_>
+ 2 0 13 4 -1.
+ <_>
+ 2 1 13 2 2.
+ <_>
+
+ <_>
+ 2 0 2 2 -1.
+ <_>
+ 2 0 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 0 3 6 8 -1.
+ <_>
+ 3 3 3 8 2.
+ <_>
+
+ <_>
+ 3 0 1 3 -1.
+ <_>
+ 2 1 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 8 0 6 9 -1.
+ <_>
+ 10 0 2 9 3.
+ <_>
+
+ <_>
+ 17 9 3 2 -1.
+ <_>
+ 18 10 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 16 8 4 6 -1.
+ <_>
+ 16 10 4 2 3.
+ <_>
+
+ <_>
+ 6 9 7 3 -1.
+ <_>
+ 6 10 7 1 3.
+ <_>
+
+ <_>
+ 2 10 3 4 -1.
+ <_>
+ 2 11 3 2 2.
+ <_>
+
+ <_>
+ 15 8 1 6 -1.
+ <_>
+ 15 8 1 3 2.
+ 1
+ <_>
+
+ <_>
+ 19 3 1 12 -1.
+ <_>
+ 19 7 1 4 3.
+ <_>
+
+ <_>
+ 2 0 5 2 -1.
+ <_>
+ 2 0 5 1 2.
+ 1
+ <_>
+
+ <_>
+ 1 3 11 6 -1.
+ <_>
+ 1 5 11 2 3.
+ <_>
+
+ <_>
+ 14 13 2 4 -1.
+ <_>
+ 14 13 1 2 2.
+ <_>
+ 15 15 1 2 2.
+ <_>
+
+ <_>
+ 8 11 10 3 -1.
+ <_>
+ 13 11 5 3 2.
+ <_>
+
+ <_>
+ 6 11 1 4 -1.
+ <_>
+ 6 13 1 2 2.
+ <_>
+
+ <_>
+ 2 9 3 9 -1.
+ <_>
+ 3 12 1 3 9.
+ <_>
+
+ <_>
+ 4 0 15 9 -1.
+ <_>
+ 9 3 5 3 9.
+ <_>
+
+ <_>
+ 12 0 6 4 -1.
+ <_>
+ 12 0 6 2 2.
+ 1
+ <_>
+
+ <_>
+ 10 5 4 5 -1.
+ <_>
+ 12 5 2 5 2.
+ <_>
+
+ <_>
+ 1 7 18 12 -1.
+ <_>
+ 7 11 6 4 9.
+ <_>
+
+ <_>
+ 14 12 6 4 -1.
+ <_>
+ 16 12 2 4 3.
+ <_>
+
+ <_>
+ 13 12 3 3 -1.
+ <_>
+ 14 12 1 3 3.
+ <_>
+
+ <_>
+ 14 9 4 1 -1.
+ <_>
+ 15 10 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 17 7 3 2 -1.
+ <_>
+ 18 8 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 19 3 1 2 -1.
+ <_>
+ 19 4 1 1 2.
+ <_>
+
+ <_>
+ 19 1 1 4 -1.
+ <_>
+ 19 2 1 2 2.
+ <_>
+
+ <_>
+ 3 2 12 8 -1.
+ <_>
+ 3 4 12 4 2.
+ <_>
+
+ <_>
+ 1 0 16 6 -1.
+ <_>
+ 1 2 16 2 3.
+ <_>
+
+ <_>
+ 16 8 3 1 -1.
+ <_>
+ 17 9 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 7 13 6 3 -1.
+ <_>
+ 9 14 2 1 9.
+ <_>
+
+ <_>
+ 11 18 6 2 -1.
+ <_>
+ 11 19 6 1 2.
+ <_>
+
+ <_>
+ 15 17 5 3 -1.
+ <_>
+ 15 18 5 1 3.
+ <_>
+
+ <_>
+ 2 1 18 4 -1.
+ <_>
+ 8 1 6 4 3.
+ <_>
+
+ <_>
+ 5 0 1 2 -1.
+ <_>
+ 5 1 1 1 2.
+ <_>
+
+ <_>
+ 1 11 6 6 -1.
+ <_>
+ 3 13 2 2 9.
+ <_>
+
+ <_>
+ 3 12 4 2 -1.
+ <_>
+ 3 12 2 1 2.
+ <_>
+ 5 13 2 1 2.
+ <_>
+
+ <_>
+ 3 0 3 3 -1.
+ <_>
+ 2 1 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 8 10 3 3 -1.
+ <_>
+ 9 11 1 1 9.
+ <_>
+
+ <_>
+ 0 16 2 2 -1.
+ <_>
+ 0 17 2 1 2.
+ <_>
+
+ <_>
+ 0 16 4 3 -1.
+ <_>
+ 0 17 4 1 3.
+ <_>
+
+ <_>
+ 0 13 12 1 -1.
+ <_>
+ 6 13 6 1 2.
+ <_>
+
+ <_>
+ 13 2 6 9 -1.
+ <_>
+ 15 2 2 9 3.
+ <_>
+
+ <_>
+ 8 11 3 3 -1.
+ <_>
+ 9 11 1 3 3.
+ <_>
+
+ <_>
+ 9 11 3 4 -1.
+ <_>
+ 10 11 1 4 3.
+ <_>
+
+ <_>
+ 13 0 6 10 -1.
+ <_>
+ 15 0 2 10 3.
+ <_>
+
+ <_>
+ 4 10 1 4 -1.
+ <_>
+ 3 11 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 9 11 3 3 -1.
+ <_>
+ 10 12 1 1 9.
+ <_>
+
+ <_>
+ 6 12 3 3 -1.
+ <_>
+ 5 13 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 17 6 2 1 -1.
+ <_>
+ 18 6 1 1 2.
+ <_>
+
+ <_>
+ 16 2 1 4 -1.
+ <_>
+ 16 2 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 2 5 13 4 -1.
+ <_>
+ 2 6 13 2 2.
+ <_>
+
+ <_>
+ 14 4 6 2 -1.
+ <_>
+ 14 4 6 1 2.
+ 1
+ <_>
+
+ <_>
+ 3 8 1 3 -1.
+ <_>
+ 2 9 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 7 7 8 3 -1.
+ <_>
+ 7 8 8 1 3.
+ <_>
+
+ <_>
+ 8 8 4 3 -1.
+ <_>
+ 10 8 2 3 2.
+ <_>
+
+ <_>
+ 10 11 3 8 -1.
+ <_>
+ 10 15 3 4 2.
+ <_>
+
+ <_>
+ 13 15 2 3 -1.
+ <_>
+ 12 16 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 0 0 12 20 -1.
+ <_>
+ 6 0 6 20 2.
+ <_>
+
+ <_>
+ 0 0 10 1 -1.
+ <_>
+ 5 0 5 1 2.
+ <_>
+
+ <_>
+ 0 0 6 3 -1.
+ <_>
+ 0 1 6 1 3.
+ <_>
+
+ <_>
+ 14 13 2 2 -1.
+ <_>
+ 14 13 1 1 2.
+ <_>
+ 15 14 1 1 2.
+ <_>
+
+ <_>
+ 12 10 4 2 -1.
+ <_>
+ 12 10 2 1 2.
+ <_>
+ 14 11 2 1 2.
+ <_>
+
+ <_>
+ 7 0 6 4 -1.
+ <_>
+ 9 0 2 4 3.
+ <_>
+
+ <_>
+ 0 0 10 10 -1.
+ <_>
+ 0 0 5 5 2.
+ <_>
+ 5 5 5 5 2.
+ <_>
+
+ <_>
+ 6 3 4 2 -1.
+ <_>
+ 7 3 2 2 2.
+ <_>
+
+ <_>
+ 1 5 4 11 -1.
+ <_>
+ 2 5 2 11 2.
+ <_>
+
+ <_>
+ 12 8 3 1 -1.
+ <_>
+ 13 8 1 1 3.
+ <_>
+
+ <_>
+ 2 2 6 2 -1.
+ <_>
+ 2 2 6 1 2.
+ 1
+ <_>
+
+ <_>
+ 13 5 7 3 -1.
+ <_>
+ 12 6 7 1 3.
+ 1
+ <_>
+
+ <_>
+ 13 7 3 4 -1.
+ <_>
+ 14 7 1 4 3.
+ <_>
+
+ <_>
+ 8 12 3 2 -1.
+ <_>
+ 8 12 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 0 10 4 8 -1.
+ <_>
+ 0 12 4 4 2.
+ <_>
+
+ <_>
+ 14 13 2 6 -1.
+ <_>
+ 14 13 1 3 2.
+ <_>
+ 15 16 1 3 2.
+ <_>
+
+ <_>
+ 16 17 1 2 -1.
+ <_>
+ 16 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 12 0 3 6 -1.
+ <_>
+ 10 2 3 2 3.
+ 1
+ <_>
+
+ <_>
+ 4 10 14 3 -1.
+ <_>
+ 4 11 14 1 3.
+ <_>
+
+ <_>
+ 19 4 1 12 -1.
+ <_>
+ 19 8 1 4 3.
+ <_>
+
+ <_>
+ 19 2 1 6 -1.
+ <_>
+ 19 4 1 2 3.
+ <_>
+
+ <_>
+ 8 12 12 3 -1.
+ <_>
+ 14 12 6 3 2.
+ <_>
+
+ <_>
+ 0 13 2 3 -1.
+ <_>
+ 1 13 1 3 2.
+ <_>
+
+ <_>
+ 16 0 4 9 -1.
+ <_>
+ 18 0 2 9 2.
+ <_>
+
+ <_>
+ 9 2 6 4 -1.
+ <_>
+ 9 4 6 2 2.
+ <_>
+
+ <_>
+ 16 2 3 1 -1.
+ <_>
+ 17 3 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 15 12 3 6 -1.
+ <_>
+ 16 12 1 6 3.
+ <_>
+
+ <_>
+ 13 12 3 3 -1.
+ <_>
+ 14 12 1 3 3.
+ <_>
+
+ <_>
+ 3 3 15 4 -1.
+ <_>
+ 3 5 15 2 2.
+ <_>
+
+ <_>
+ 11 11 3 4 -1.
+ <_>
+ 12 11 1 4 3.
+ <_>
+
+ <_>
+ 10 11 3 3 -1.
+ <_>
+ 11 11 1 3 3.
+ <_>
+
+ <_>
+ 19 0 1 4 -1.
+ <_>
+ 19 2 1 2 2.
+ <_>
+
+ <_>
+ 14 0 3 3 -1.
+ <_>
+ 15 1 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 2 10 8 2 -1.
+ <_>
+ 2 10 4 2 2.
+ 1
+ <_>
+
+ <_>
+ 9 18 4 2 -1.
+ <_>
+ 10 18 2 2 2.
+ <_>
+
+ <_>
+ 10 0 4 9 -1.
+ <_>
+ 11 0 2 9 2.
+ <_>
+
+ <_>
+ 15 10 5 6 -1.
+ <_>
+ 15 12 5 2 3.
+ <_>
+
+ <_>
+ 2 13 4 2 -1.
+ <_>
+ 3 13 2 2 2.
+ <_>
+
+ <_>
+ 2 15 4 1 -1.
+ <_>
+ 3 16 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 15 8 3 2 -1.
+ <_>
+ 16 9 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 0 6 4 2 -1.
+ <_>
+ 2 6 2 2 2.
+ <_>
+
+ <_>
+ 9 17 6 1 -1.
+ <_>
+ 12 17 3 1 2.
+ <_>
+
+ <_>
+ 14 19 6 1 -1.
+ <_>
+ 17 19 3 1 2.
+ <_>
+
+ <_>
+ 17 18 1 2 -1.
+ <_>
+ 17 19 1 1 2.
+ <_>
+
+ <_>
+ 17 16 2 2 -1.
+ <_>
+ 17 16 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 19 3 1 9 -1.
+ <_>
+ 19 6 1 3 3.
+ <_>
+
+ <_>
+ 10 10 3 3 -1.
+ <_>
+ 9 11 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 3 0 3 3 -1.
+ <_>
+ 2 1 3 1 3.
+ 1
+ <_>
+
+ <_>
+ 17 16 2 2 -1.
+ <_>
+ 17 16 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 5 11 3 3 -1.
+ <_>
+ 6 12 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 3 11 2 2 -1.
+ <_>
+ 3 11 1 1 2.
+ <_>
+ 4 12 1 1 2.
+ <_>
+
+ <_>
+ 16 9 2 2 -1.
+ <_>
+ 16 9 1 2 2.
+ 1
+ <_>
+
+ <_>
+ 4 9 2 2 -1.
+ <_>
+ 4 9 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 3 10 2 3 -1.
+ <_>
+ 2 11 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 0 0 20 20 -1.
+ <_>
+ 0 0 10 10 2.
+ <_>
+ 10 10 10 10 2.
+ <_>
+
+ <_>
+ 7 16 5 3 -1.
+ <_>
+ 7 17 5 1 3.
+ <_>
+
+ <_>
+ 14 1 3 6 -1.
+ <_>
+ 12 3 3 2 3.
+ 1
+ <_>
+
+ <_>
+ 6 0 4 7 -1.
+ <_>
+ 7 0 2 7 2.
+ <_>
+
+ <_>
+ 9 5 9 6 -1.
+ <_>
+ 12 5 3 6 3.
+ <_>
+
+ <_>
+ 5 18 4 2 -1.
+ <_>
+ 6 18 2 2 2.
+ <_>
+
+ <_>
+ 7 7 6 8 -1.
+ <_>
+ 9 7 2 8 3.
+ <_>
+
+ <_>
+ 18 16 2 4 -1.
+ <_>
+ 18 16 1 2 2.
+ <_>
+ 19 18 1 2 2.
+ <_>
+
+ <_>
+ 11 18 2 2 -1.
+ <_>
+ 12 18 1 2 2.
+ <_>
+
+ <_>
+ 3 2 5 2 -1.
+ <_>
+ 3 3 5 1 2.
+ <_>
+
+ <_>
+ 7 1 6 4 -1.
+ <_>
+ 7 3 6 2 2.
+ <_>
+
+ <_>
+ 2 0 2 2 -1.
+ <_>
+ 2 0 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 0 1 16 1 -1.
+ <_>
+ 8 1 8 1 2.
+ <_>
+
+ <_>
+ 11 1 3 10 -1.
+ <_>
+ 12 1 1 10 3.
+ <_>
+
+ <_>
+ 4 0 4 4 -1.
+ <_>
+ 5 1 2 4 2.
+ 1
+ <_>
+
+ <_>
+ 4 13 3 2 -1.
+ <_>
+ 5 13 1 2 3.
+ <_>
+
+ <_>
+ 8 11 4 3 -1.
+ <_>
+ 7 12 4 1 3.
+ 1
+ <_>
+
+ <_>
+ 7 17 4 3 -1.
+ <_>
+ 8 17 2 3 2.
+ <_>
+
+ <_>
+ 5 19 2 1 -1.
+ <_>
+ 6 19 1 1 2.
+ <_>
+
+ <_>
+ 0 9 2 2 -1.
+ <_>
+ 0 9 1 1 2.
+ <_>
+ 1 10 1 1 2.
+ <_>
+
+ <_>
+ 0 9 2 2 -1.
+ <_>
+ 0 9 1 1 2.
+ <_>
+ 1 10 1 1 2.
+ <_>
+
+ <_>
+ 6 9 2 2 -1.
+ <_>
+ 6 9 2 1 2.
+ 1
+ <_>
+
+ <_>
+ 0 10 5 3 -1.
+ <_>
+ 0 11 5 1 3.
+ <_>
+
+ <_>
+ 3 10 2 2 -1.
+ <_>
+ 3 10 1 1 2.
+ <_>
+ 4 11 1 1 2.
+ <_>
+
+ <_>
+ 0 10 18 1 -1.
+ <_>
+ 6 10 6 1 3.
+ <_>
+
+ <_>
+ 17 4 3 1 -1.
+ <_>
+ 18 5 1 1 3.
+ 1
+ <_>
+
+ <_>
+ 17 1 2 7 -1.
+ <_>
+ 17 1 1 7 2.
+ 1
+ <_>
+
+ <_>
+ 6 13 9 2 -1.
+ <_>
+ 9 13 3 2 3.
+ <_>
+
+ <_>
+ 4 9 16 6 -1.
+ <_>
+ 4 11 16 2 3.
+ <_>
+
+ <_>
+ 1 1 16 4 -1.
+ <_>
+ 1 3 16 2 2.
+ <_>
+
+ <_>
+ 14 12 3 3 -1.
+ <_>
+ 15 12 1 3 3.
+ <_>
+
+ <_>
+ 2 9 6 2 -1.
+ <_>
+ 4 11 2 2 3.
+ 1
+ <_>
+
+ <_>
+ 10 0 8 10 -1.
+ <_>
+ 12 0 4 10 2.
+ <_>
+
+ <_>
+ 1 12 16 4 -1.
+ <_>
+ 5 12 8 4 2.
+ <_>
+
+ <_>
+ 13 8 6 9 -1.
+ <_>
+ 15 11 2 3 9.
+ <_>
+
+ <_>
+ 19 0 1 8 -1.
+ <_>
+ 19 4 1 4 2.
+ <_>
+
+ <_>
+ 8 2 10 6 -1.
+ <_>
+ 8 5 10 3 2.
+ <_>
+
+ <_>
+ 18 7 2 1 -1.
+ <_>
+ 19 7 1 1 2.
+ <_>
+
+ <_>
+ 19 4 1 12 -1.
+ <_>
+ 19 7 1 6 2.
+ <_>
+
+ <_>
+ 8 11 3 3 -1.
+ <_>
+ 9 12 1 1 9.
+ <_>
+
+ <_>
+ 7 12 3 3 -1.
+ <_>
+ 8 12 1 3 3.
+ <_>
+
+ <_>
+ 6 13 3 2 -1.
+ <_>
+ 7 13 1 2 3.
+ <_>
+
+ <_>
+ 17 15 3 2 -1.
+ <_>
+ 17 15 3 1 2.
+ 1
+ <_>
+
+ <_>
+ 11 6 3 3 -1.
+ <_>
+ 12 6 1 3 3.
+ <_>
+
+ <_>
+ 0 15 2 4 -1.
+ <_>
+ 0 17 2 2 2.
+ <_>
+
+ <_>
+ 12 9 7 2 -1.
+ <_>
+ 12 9 7 1 2.
+ 1
+ <_>
+
+ <_>
+ 6 5 8 7 -1.
+ <_>
+ 10 5 4 7 2.
+ <_>
+
+ <_>
+ 6 17 8 3 -1.
+ <_>
+ 8 17 4 3 2.
+ <_>
+
+ <_>
+ 0 17 4 3 -1.
+ <_>
+ 0 18 4 1 3.
+ <_>
+
+ <_>
+ 5 1 10 6 -1.
+ <_>
+ 5 3 10 2 3.
+ <_>
+
+ <_>
+ 0 2 18 2 -1.
+ <_>
+ 6 2 6 2 3.
+ <_>
+
+ <_>
+ 7 8 6 3 -1.
+ <_>
+ 7 9 6 1 3.
+ <_>
+
+ <_>
+ 10 8 1 3 -1.
+ <_>
+ 10 9 1 1 3.
+ <_>
+
+ <_>
+ 16 1 3 2 -1.
+ <_>
+ 17 2 1 2 3.
+ 1
+ <_>
+
+ <_>
+ 2 10 1 2 -1.
+ <_>
+ 2 10 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 2 9 1 2 -1.
+ <_>
+ 2 9 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 3 9 2 3 -1.
+ <_>
+ 2 10 2 1 3.
+ 1
+ <_>
+
+ <_>
+ 2 14 12 6 -1.
+ <_>
+ 2 14 6 3 2.
+ <_>
+ 8 17 6 3 2.
+ <_>
+
+ <_>
+ 15 17 1 2 -1.
+ <_>
+ 15 17 1 1 2.
+ 1
+ <_>
+
+ <_>
+ 17 11 3 3 -1.
+ <_>
+ 18 12 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 13 12 3 2 -1.
+ <_>
+ 14 12 1 2 3.
+ <_>
+
+ <_>
+ 16 18 4 2 -1.
+ <_>
+ 18 18 2 2 2.
+ <_>
+
+ <_>
+ 18 14 2 4 -1.
+ <_>
+ 17 15 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 12 13 3 1 -1.
+ <_>
+ 13 13 1 1 3.
+ <_>
+
+ <_>
+ 11 12 3 3 -1.
+ <_>
+ 12 13 1 1 9.
+ <_>
+
+ <_>
+ 0 0 16 20 -1.
+ <_>
+ 8 0 8 20 2.
+ <_>
+
+ <_>
+ 3 0 8 5 -1.
+ <_>
+ 5 0 4 5 2.
+ <_>
+
+ <_>
+ 0 0 2 1 -1.
+ <_>
+ 1 0 1 1 2.
+ <_>
+
+ <_>
+ 1 2 19 4 -1.
+ <_>
+ 1 4 19 2 2.
+ <_>
+
+ <_>
+ 12 7 3 4 -1.
+ <_>
+ 13 7 1 4 3.
+ <_>
+
+ <_>
+ 15 6 3 3 -1.
+ <_>
+ 16 7 1 3 3.
+ 1
+ <_>
+
+ <_>
+ 3 13 2 2 -1.
+ <_>
+ 3 13 1 1 2.
+ <_>
+ 4 14 1 1 2.
+ <_>
+
+ <_>
+ 2 12 2 2 -1.
+ <_>
+ 2 12 1 1 2.
+ <_>
+ 3 13 1 1 2.
+ <_>
+
+ <_>
+ 0 3 19 4 -1.
+ <_>
+ 0 4 19 2 2.
+ <_>
+
+ <_>
+ 17 7 3 4 -1.
+ <_>
+ 18 8 1 4 3.
+ 1
+ <_>
+
+ <_>
+ 4 8 3 4 -1.
+ <_>
+ 5 9 1 4 3.
+ 1
+ <_>
+
+ <_>
+ 14 11 4 6 -1.
+ <_>
+ 15 11 2 6 2.
+ <_>
+
+ <_>
+ 18 3 2 6 -1.
+ <_>
+ 18 5 2 2 3.
+ <_>
+
+ <_>
+ 14 3 2 4 -1.
+ <_>
+ 14 3 2 2 2.
+ 1
+ <_>
+
+ <_>
+ 7 9 5 4 -1.
+ <_>
+ 7 10 5 2 2.
+ <_>
+
+ <_>
+ 12 11 8 2 -1.
+ <_>
+ 12 12 8 1 2.
+ <_>
+
+ <_>
+ 16 13 3 4 -1.
+ <_>
+ 16 13 3 2 2.
+ 1
+ <_>
+
+ <_>
+ 14 7 5 9 -1.
+ <_>
+ 14 10 5 3 3.
+ <_>
+
+ <_>
+ 0 12 1 3 -1.
+ <_>
+ 0 13 1 1 3.
+ <_>
+
+ <_>
+ 6 6 3 6 -1.
+ <_>
+ 4 8 3 2 3.
+ 1
+ <_>
+
+ <_>
+ 0 9 9 1 -1.
+ <_>
+ 3 9 3 1 3.
+ <_>
+
+ <_>
+ 0 9 6 2 -1.
+ <_>
+ 0 9 3 1 2.
+ <_>
+ 3 10 3 1 2.
+ <_>
+
+ <_>
+ 3 2 4 4 -1.
+ <_>
+ 4 2 2 4 2.
+ <_>
+
+ <_>
+ 18 3 2 3 -1.
+ <_>
+ 18 4 2 1 3.
+ <_>
+
+ <_>
+ 6 16 3 3 -1.
+ <_>
+ 6 17 3 1 3.
+ <_>
+
+ <_>
+ 1 16 6 3 -1.
+ <_>
+ 1 17 6 1 3.
+
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/main.py b/MachineLearning Projects/Driver-Drowsiness-Detection/main.py
new file mode 100644
index 00000000..daa11f1a
--- /dev/null
+++ b/MachineLearning Projects/Driver-Drowsiness-Detection/main.py
@@ -0,0 +1,106 @@
+import cv2
+import os
+from keras.models import load_model
+import numpy as np
+from pygame import mixer
+import time
+
+import os
+print(os.path.abspath('haar cascade files/haarcascade_frontalface_alt.xml'))
+
+
+mixer.init()
+sound = mixer.Sound('alarm.wav')
+
+
+face = cv2.CascadeClassifier('haar_cascade_files/haarcascade_frontalface_alt.xml')
+leye = cv2.CascadeClassifier('haar_cascade_files/haarcascade_lefteye_2splits.xml')
+reye = cv2.CascadeClassifier('haar_cascade_files/haarcascade_righteye_2splits.xml')
+
+
+lbl=['Close','Open']
+model = load_model('models/cnnCat2.h5')
+path = os.getcwd()
+cap = cv2.VideoCapture(0)
+font = cv2.FONT_HERSHEY_COMPLEX_SMALL
+count=0
+score=0
+thicc=2
+rpred=[99]
+lpred=[99]
+
+while(True):
+ ret, frame = cap.read()
+ height,width = frame.shape[:2]
+
+ gray = cv2.cvtColor(frame, cv2.COLOR_BGR2GRAY)
+
+ faces = face.detectMultiScale(gray,minNeighbors=5,scaleFactor=1.1,minSize=(25,25))
+ left_eye = leye.detectMultiScale(gray)
+ right_eye = reye.detectMultiScale(gray)
+
+ cv2.rectangle(frame, (0,height-50) , (200,height) , (0,0,0) , thickness=cv2.FILLED )
+
+ for (x,y,w,h) in faces:
+ cv2.rectangle(frame, (x,y) , (x+w,y+h) , (100,100,100) , 1 )
+
+ for (x,y,w,h) in right_eye:
+ r_eye=frame[y:y+h,x:x+w]
+ count=count+1
+ r_eye = cv2.cvtColor(r_eye,cv2.COLOR_BGR2GRAY)
+ r_eye = cv2.resize(r_eye,(24,24))
+ r_eye= r_eye/255
+ r_eye= r_eye.reshape(24,24,-1)
+ r_eye = np.expand_dims(r_eye,axis=0)
+ rpred = np.argmax(model.predict(r_eye), axis=-1)
+ if(rpred[0]==1):
+ lbl='Open'
+ if(rpred[0]==0):
+ lbl='Closed'
+ break
+
+ for (x,y,w,h) in left_eye:
+ l_eye=frame[y:y+h,x:x+w]
+ count=count+1
+ l_eye = cv2.cvtColor(l_eye,cv2.COLOR_BGR2GRAY)
+ l_eye = cv2.resize(l_eye,(24,24))
+ l_eye= l_eye/255
+ l_eye=l_eye.reshape(24,24,-1)
+ l_eye = np.expand_dims(l_eye,axis=0)
+ lpred = np.argmax(model.predict(l_eye), axis=-1)
+ if(lpred[0]==1):
+ lbl='Open'
+ if(lpred[0]==0):
+ lbl='Closed'
+ break
+
+ if(rpred[0]==0 and lpred[0]==0):
+ score=score+1
+ cv2.putText(frame,"Closed",(10,height-20), font, 1,(255,255,255),1,cv2.LINE_AA)
+ # if(rpred[0]==1 or lpred[0]==1):
+ else:
+ score=score-1
+ cv2.putText(frame,"Open",(10,height-20), font, 1,(255,255,255),1,cv2.LINE_AA)
+
+
+ if(score<0):
+ score=0
+ cv2.putText(frame,'Score:'+str(score),(100,height-20), font, 1,(255,255,255),1,cv2.LINE_AA)
+ if(score>15):
+ cv2.imwrite(os.path.join(path,'image.jpg'),frame)
+ try:
+ sound.play()
+ except:
+ pass
+ if(thicc<16):
+ thicc= thicc+2
+ else:
+ thicc=thicc-2
+ if(thicc<2):
+ thicc=2
+ cv2.rectangle(frame,(0,0),(width,height),(0,0,255),thicc)
+ cv2.imshow('frame',frame)
+ if cv2.waitKey(1) & 0xFF == ord('q'):
+ break
+cap.release()
+cv2.destroyAllWindows()
\ No newline at end of file
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/model.py b/MachineLearning Projects/Driver-Drowsiness-Detection/model.py
new file mode 100644
index 00000000..7cc62c64
--- /dev/null
+++ b/MachineLearning Projects/Driver-Drowsiness-Detection/model.py
@@ -0,0 +1,48 @@
+import os
+from keras.preprocessing import image
+import matplotlib.pyplot as plt
+import numpy as np
+from keras.utils.np_utils import to_categorical
+import random,shutil
+from keras.models import Sequential
+from keras.layers import Dropout,Conv2D,Flatten,Dense, MaxPooling2D, BatchNormalization
+from keras.models import load_model
+
+
+def generator(dir, gen=image.ImageDataGenerator(rescale=1./255), shuffle=True,batch_size=1,target_size=(24,24),class_mode='categorical' ):
+
+ return gen.flow_from_directory(dir,batch_size=batch_size,shuffle=shuffle,color_mode='grayscale',class_mode=class_mode,target_size=target_size)
+
+BS= 32
+TS=(24,24)
+train_batch= generator('data/train',shuffle=True, batch_size=BS,target_size=TS)
+valid_batch= generator('data/valid',shuffle=True, batch_size=BS,target_size=TS)
+SPE= len(train_batch.classes)//BS
+VS = len(valid_batch.classes)//BS
+print(SPE,VS)
+
+
+model = Sequential([
+ Conv2D(32, kernel_size=(3, 3), activation='relu', input_shape=(24,24,1)),
+ MaxPooling2D(pool_size=(1,1)),
+ Conv2D(32,(3,3),activation='relu'),
+ MaxPooling2D(pool_size=(1,1)),
+ Conv2D(64, (3, 3), activation='relu'),
+ MaxPooling2D(pool_size=(1,1)),
+ Dropout(0.25),
+ Flatten(),
+ Dense(128, activation='relu'),
+ Dropout(0.5),
+ Dense(2, activation='softmax')
+])
+
+model.compile(optimizer='adam',loss='categorical_crossentropy',metrics=['accuracy'])
+
+model.fit_generator(train_batch, validation_data=valid_batch,epochs=15,steps_per_epoch=SPE ,validation_steps=VS)
+
+<<<<<<< HEAD
+model.save('models/cnnCat2.h5', overwrite=True)
+=======
+model.save('models/cnnCat2.h5', overwrite=True)
+model = load_model('model.h5')
+>>>>>>> 79e42d9 (Updated)
diff --git a/MachineLearning Projects/Driver-Drowsiness-Detection/models/cnnCat2.h5 b/MachineLearning Projects/Driver-Drowsiness-Detection/models/cnnCat2.h5
new file mode 100644
index 00000000..f89cd07d
Binary files /dev/null and b/MachineLearning Projects/Driver-Drowsiness-Detection/models/cnnCat2.h5 differ
diff --git a/MachineLearning Projects/sudoku_solver/README.md b/MachineLearning Projects/sudoku_solver/README.md
new file mode 100644
index 00000000..4829dc59
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/README.md
@@ -0,0 +1,28 @@
+# Sudoku Solver
+
+* This app was built to allow users to solve their sudokus using a computer.
+* There is a Flask based webserver `web_interface.py` which when run gives a web interface to upload an image of a sudoku to be solved. The response is a solved sudoku.
+* There is a file `full_stack_http.py` which needs to be run alongside the webserver for the full app to run. This is in charge of opening multiple process channels to process the images that are sent to the webserver.
+* The app relies of Pytesseract to identify the characters in the sudoku image.
+
+# Operation
+
+* The image is first stripped of color.
+* It is then cropped to select the section of the sudoku. NOTE: This section is not dependent on the sudoku but has been hardcoded.
+* The resulting image is passed to `Pytesseract` to extract the characters and their position.
+* Using the characters and their position the grid size is determined.
+* The appropriate grid is created and filled with the discovered characters.
+* The grid is then solved with an algorithm contained in `sudoku.py`.
+* A snapshot of the solved grid is then created and sent back to the user.
+* The resultant snapshot is rendered on the browser page.
+
+# To Run
+
+* First install `Pytesseract`
+* Install `Flask`
+* Then run the `full_stack_http.py` file.
+* Then run the `web_interface.py` file.
+* Go to the browser and load the URL provided in the previous step.
+* Click the upload button.
+* Select your image and submit the form.
+* Wait for the result to be loaded.
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/__pycache__/image.cpython-311.pyc b/MachineLearning Projects/sudoku_solver/__pycache__/image.cpython-311.pyc
new file mode 100644
index 00000000..bc46b3c9
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/__pycache__/image.cpython-311.pyc differ
diff --git a/MachineLearning Projects/sudoku_solver/__pycache__/perspective.cpython-312.pyc b/MachineLearning Projects/sudoku_solver/__pycache__/perspective.cpython-312.pyc
new file mode 100644
index 00000000..73b55c0f
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/__pycache__/perspective.cpython-312.pyc differ
diff --git a/MachineLearning Projects/sudoku_solver/__pycache__/sudoku.cpython-312.pyc b/MachineLearning Projects/sudoku_solver/__pycache__/sudoku.cpython-312.pyc
new file mode 100644
index 00000000..d76e94c2
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/__pycache__/sudoku.cpython-312.pyc differ
diff --git a/MachineLearning Projects/sudoku_solver/config.cfg b/MachineLearning Projects/sudoku_solver/config.cfg
new file mode 100644
index 00000000..93d8c2b5
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/config.cfg
@@ -0,0 +1,4 @@
+UPLOAD_FOLDER="uploads"
+SECRET_KEY="secret"
+SOLVER_IP="localhost"
+SOLVER_PORT=3535
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/f1.jpg b/MachineLearning Projects/sudoku_solver/f1.jpg
new file mode 100644
index 00000000..12c2702e
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/f1.jpg differ
diff --git a/MachineLearning Projects/sudoku_solver/f2.jpg b/MachineLearning Projects/sudoku_solver/f2.jpg
new file mode 100644
index 00000000..dc232b54
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/f2.jpg differ
diff --git a/MachineLearning Projects/sudoku_solver/full_stack_http.py b/MachineLearning Projects/sudoku_solver/full_stack_http.py
new file mode 100644
index 00000000..d6232b81
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/full_stack_http.py
@@ -0,0 +1,136 @@
+import multiprocessing.util
+import socket
+from perspective import resolve_image
+from sudoku import Grid
+import argparse
+import multiprocessing
+import os
+
+temp_result_file = "resultfile.png"
+temp_input_file = "tempfile.jpg"
+
+def process_handle_transaction(proc_num:int, sock:socket.socket):
+ print(f"[{proc_num}] Waiting for client...")
+ sock2, address2 = sock.accept()
+ print(f"[{proc_num}] Connected to client with address: {address2}")
+ sock2.settimeout(1)
+ rec_buf = b''
+ split = temp_input_file.split('.')
+ my_temp_input_file = ".".join(i for i in split[:-1]) + str(proc_num) + "." + split[-1]
+ split = temp_result_file.split('.')
+ my_temp_result_file = ".".join(i for i in split[:-1]) + str(proc_num) + "." + split[-1]
+ try:
+ while True:
+ try:
+ rec = sock2.recv(1)
+ rec_buf += rec
+ if len(rec) == 0:
+ print(f"[{proc_num}] Lost connection")
+ break
+ except socket.timeout:
+ with open(my_temp_input_file, "wb") as f:
+ f.write(rec_buf)
+ rec_buf = b''
+ grid_size, points = resolve_image(my_temp_input_file)
+ grid = Grid(rows=grid_size[0], columns=grid_size[1])
+ assignment_values = {}
+ for val,loc in points:
+ assignment_values[loc] = val
+ grid.preassign(assignment_values)
+ grid.solve()
+ grid.save_grid_image(path=my_temp_result_file, size=(400,400))
+ with open(my_temp_result_file, "rb") as f:
+ sock2.send(f.read())
+ os.remove(my_temp_input_file)
+ os.remove(my_temp_result_file)
+ sock2.close()
+ print(f"[{proc_num}] Finished!")
+ break
+ finally:
+ sock2.close()
+
+class Manager():
+ def __init__(self, address:tuple[str,int]):
+ self.sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+ self.address = address
+
+ def wait_for_connect(self):
+ print("Waiting for client...")
+ self.sock2, self.address2 = self.sock.accept()
+ print(f"Connected to client with address: {self.address2}")
+ self.sock2.settimeout(1)
+
+ def run(self):
+ self.sock.bind(self.address)
+ self.sock.listen()
+ print(f"Listening from address: {self.address}")
+ try:
+ while True:
+ self.wait_for_connect()
+ rec_buf = b''
+ while True:
+ try:
+ rec = self.sock2.recv(1)
+ rec_buf += rec
+ if len(rec) == 0:
+ print("Lost connection")
+ break
+ except socket.timeout:
+ with open(temp_input_file, "wb") as f:
+ f.write(rec_buf)
+ rec_buf = b''
+ grid_size, points = resolve_image(temp_input_file)
+ grid = Grid(rows=grid_size[0], columns=grid_size[1])
+ assignment_values = {}
+ for val,loc in points:
+ assignment_values[loc] = val
+ grid.preassign(assignment_values)
+ grid.solve()
+ grid.save_grid_image(path=temp_result_file, size=(400,400))
+ with open(temp_result_file, "rb") as f:
+ self.sock2.send(f.read())
+ os.remove(temp_input_file)
+ os.remove(temp_result_file)
+ self.sock2.close()
+ break
+ finally:
+ try:
+ self.sock2.close()
+ except socket.error:
+ pass
+ except AttributeError:
+ pass
+ self.sock.close()
+
+ def run_multiprocessing(self, max_clients:int=8):
+ self.sock.bind(self.address)
+ self.sock.listen()
+ print(f"Listening from address: {self.address}")
+ processes:dict[int,multiprocessing.Process]= {}
+ proc_num = 0
+ try:
+ while True:
+ if len(processes) <= max_clients:
+ proc = multiprocessing.Process(target=process_handle_transaction, args=(proc_num, self.sock))
+ proc.start()
+ processes[proc_num] = proc
+ proc_num += 1
+ proc_num%=(max_clients*2)
+ keys = list(processes.keys())
+ for proc_n in keys:
+ if not processes[proc_n].is_alive():
+ processes.pop(proc_n)
+ finally:
+ if len(processes):
+ for proc in processes.values():
+ proc.kill()
+ self.sock.close()
+
+if "__main__" == __name__:
+ parser = argparse.ArgumentParser()
+ parser.add_argument("--port", type=int, default=3535, help="The port to host the server.")
+ parser.add_argument("--host", type=str, default="localhost", help="The host or ip-address to host the server.")
+ args = parser.parse_args()
+ address = (args.host, args.port)
+ manager = Manager(address)
+ manager.run_multiprocessing(max_clients=multiprocessing.cpu_count())
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/image.py b/MachineLearning Projects/sudoku_solver/image.py
new file mode 100644
index 00000000..24ca83d4
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/image.py
@@ -0,0 +1,141 @@
+import torch
+from torch.utils.data import Dataset, DataLoader
+import PIL.Image as Image
+import pandas as pd
+from tqdm import tqdm
+import numpy as np
+
+
+class SudokuDataset(Dataset):
+ def __init__(self, grid_locations_file:str, input_shape:tuple[int, int]) -> None:
+ super().__init__()
+ self.grid_locations = []
+ self.image_filenames = []
+ self.input_shape = input_shape
+ self.all_data = pd.read_csv(grid_locations_file, header=0)
+ self.image_filenames = list(self.all_data['filepath'].to_numpy())
+ self.grid_locations = [list(a[1:]) for a in self.all_data.values]
+ to_pop = []
+ for i,file in enumerate(self.image_filenames):
+ try:
+ Image.open(file)
+ except FileNotFoundError:
+ to_pop.append(i)
+ print(f"{file} not found.")
+ for i in reversed(to_pop):
+ self.image_filenames.pop(i)
+ self.grid_locations.pop(i)
+ # print(self.all_data.columns)
+ # print(self.grid_locations)
+
+ def __len__(self) -> int:
+ return len(self.image_filenames)
+
+ def __getitem__(self, index) -> dict[str, torch.Tensor]:
+ image = Image.open(self.image_filenames[index]).convert("L")
+ size = image.size
+ image = image.resize(self.input_shape)
+ image = np.array(image)
+ image = image.reshape((1,*image.shape))
+ location = self.grid_locations[index]
+ for i in range(len(location)):
+ if i%2:
+ location[i] /= size[1]
+ else:
+ location[i] /= size[0]
+ return {
+ "image": torch.tensor(image, dtype=torch.float32)/255.,
+ "grid": torch.tensor(location, dtype=torch.float32)
+ }
+
+class Model(torch.nn.Module):
+ def __init__(self, input_shape:tuple[int,int], number_of_layers:int, dims:int, *args, **kwargs) -> None:
+ super().__init__(*args, **kwargs)
+ self.input_shape = input_shape
+ self.conv_layers:list = []
+ self.conv_layers.append(torch.nn.Conv2d(1, dims, (3,3), padding='same'))
+ for _ in range(number_of_layers-1):
+ self.conv_layers.append(torch.nn.Conv2d(dims, dims, (3,3), padding='same'))
+ self.conv_layers.append(torch.nn.LeakyReLU(negative_slope=0.01))
+ self.conv_layers.append(torch.nn.MaxPool2d((2,2)))
+ self.conv_layers.append(torch.nn.BatchNorm2d(dims))
+ self.flatten = torch.nn.Flatten()
+ self.location = [
+ torch.nn.Linear(4107, 8),
+ torch.nn.Sigmoid()
+ ]
+ self.conv_layers = torch.nn.ModuleList(self.conv_layers)
+ self.location = torch.nn.ModuleList(self.location)
+
+ def forward(self, x:torch.Tensor) -> torch.Tensor:
+ for layer in self.conv_layers:
+ x = layer(x)
+ x = self.flatten(x)
+ location = x
+ for layer in self.location:
+ location = layer(location)
+ return location
+
+def create_model(input_shape:tuple[int,int], number_of_layers:int, dims:int):
+ model = Model(input_shape, number_of_layers, dims)
+ for p in model.parameters():
+ if p.dim() > 1:
+ torch.nn.init.xavier_uniform_(p)
+ return model
+
+def get_dataset(filename:str, input_shape:tuple[int,int], batch_size:int) -> DataLoader:
+ train_dataset = SudokuDataset(filename, input_shape)
+ train_dataloader = DataLoader(train_dataset, batch_size, shuffle=True)
+ return train_dataloader
+
+def train(epochs:int, config:dict, model:None|Model = None) -> Model:
+ device = torch.device('cuda' if torch.cuda.is_available() else 'cpu')
+ if not model:
+ print("========== Using new model =========")
+ model = create_model(config['input_shape'], config['number_of_layers'], config['dims']).to(device)
+ optimizer = torch.optim.Adam(model.parameters(), lr=config['lr'])
+ loss = torch.nn.MSELoss().to(device)
+ dataset = get_dataset(config['filename'], config['input_shape'], config['batch_size'])
+ prev_error = 0
+ try:
+ for epoch in range(1, epochs+1):
+ batch_iterator = tqdm(dataset, f"Epoch {epoch}/{epochs}:")
+ for batch in batch_iterator:
+ x = batch['image'].to(device)
+ y_true = batch['grid'].to(device)
+ # print(batch['grid'])
+ # return
+ y_pred = model(x)
+ error = loss(y_true, y_pred)
+ batch_iterator.set_postfix({"loss":f"Loss: {error.item():6.6f}"})
+ error.backward()
+ optimizer.step()
+ # optimizer.zero_grad()
+ if abs(error-0.5) < 0.05:# or (prev_error-error)<0.000001:
+ del(model)
+ model = create_model(config['input_shape'], config['number_of_layers'], config['dims']).to(device)
+ print("New model created")
+ prev_error = error
+ except KeyboardInterrupt:
+ torch.save(model, "model.pt")
+ return model
+
+def test(config:dict, model_filename:str):
+ device = torch.device('cuda' if torch.cuda.is_available() else 'cpu')
+ model = torch.load("model.pt").to(device)
+ loss = torch.nn.MSELoss().to(device)
+ dataset = get_dataset(config['filename'], config['input_shape'], config['batch_size'])
+
+
+if __name__ == '__main__':
+ config = {
+ "input_shape": (300,300),
+ "filename": "archive/outlines_sorted.csv",
+ "number_of_layers": 4,
+ "dims": 3,
+ "batch_size": 8,
+ "lr": 1e-5
+ }
+ # model = train(50, config)
+ model = torch.load("model.pt")
+ test(config, model)
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/model.pt b/MachineLearning Projects/sudoku_solver/model.pt
new file mode 100644
index 00000000..ba421a06
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/model.pt differ
diff --git a/MachineLearning Projects/sudoku_solver/perspective.py b/MachineLearning Projects/sudoku_solver/perspective.py
new file mode 100644
index 00000000..3c79c78d
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/perspective.py
@@ -0,0 +1,98 @@
+import cv2
+import numpy as np
+from pytesseract import pytesseract as pt
+
+def resolve_perspective(source_image:np.ndarray, points:np.ndarray, target_shape:tuple[int,int]) -> np.ndarray:
+ """Takes an source image and transforms takes the region demarkated by points and creates a rectangular image of target.
+
+ Args:
+ source_image (np.ndarray): the source image.
+ points (np.ndarray): a numpy array of 4 points that will demarkate the vertices of the region to be transformed.\n
+ \tShould be in the form of points from the point that would be transformed to the top left of the rectangle, clockwise
+ target_shape (tuple[int,int]): the target shape of the rectangular output image. Format [height, width].
+
+ Returns:
+ np.ndarray: the output image transformed
+ """
+ output_points:np.ndarray = np.array([
+ [0,0],
+ [target_shape[0]-1, 0],
+ [target_shape[0]-1, target_shape[1]-1],
+ [0,target_shape[1]-1]
+ ], dtype=np.float32)
+ transformation_matrix:cv2.typing.MatLike = cv2.getPerspectiveTransform(points.astype(np.float32), output_points)
+ output:cv2.typing.MatLike = cv2.warpPerspective(source_image, transformation_matrix, (target_shape[1], target_shape[0]), flags=cv2.INTER_LINEAR)
+ return output
+
+def get_grid_size(image:np.ndarray, boxes:list[list[int]], allowed_sizes:list[tuple[int,int]]=[(2,3),(3,3),(4,4)]) -> tuple[int,int]:
+ h,w = image.shape
+ for size in allowed_sizes:
+ s1 = float(w)/float(size[0])
+ s2 = float(h)/float(size[1])
+ for box in boxes:
+ _,x1,y1,x2,y2 = box
+ if (abs(int(x1/s1) - int(x2/s1)) + abs(int((h - y1)/s2) - int((h - y2)/s2))) > 0:
+ break
+ else:
+ return size
+
+def get_points(image:np.ndarray, boxes:list[list[int]], grid_size:tuple[int,int]) -> list[tuple[int,tuple]]:
+ h,w = image.shape
+ size = grid_size[0] * grid_size[1]
+ s1 = float(w)/float(size)
+ s2 = float(h)/float(size)
+ results = []
+ for box in boxes:
+ val,x1,y1,x2,y2 = box
+ center_x = int((x1+x2)/2)
+ center_y = int((y1+y2)/2)
+ results.append((val, (int((h-center_y)/s2), int(center_x/s1))))
+ return results
+
+def resolve_image(path:str) -> tuple[tuple,list[tuple[int,tuple]]]:
+ # img = cv2.imread("images/image210.jpg")
+ img = cv2.imread(path)
+ numbers = [str(i) for i in range(10)]
+ max_size = 500
+ min_area = 150
+ *img_shape,_ = img.shape
+ max_ind = np.argmax(img_shape)
+ min_ind = np.argmin(img_shape)
+ next_shape = [0,0]
+ if max_ind != min_ind:
+ next_shape[max_ind] = max_size
+ next_shape[min_ind] = int(img_shape[min_ind]*max_size/img_shape[max_ind])
+ else:
+ next_shape = [max_size, max_size]
+ img = cv2.resize(img, tuple(reversed(next_shape)))
+ points = np.array([6,97,219,99,216,309,7,310])
+ points = points.reshape((4,2))
+ target_shape = (400,400)
+ output = resolve_perspective(img, points, target_shape)
+ output = cv2.cvtColor(output, cv2.COLOR_BGR2GRAY)
+ norm_img = np.zeros((output.shape[0], output.shape[1]))
+ output = cv2.normalize(output, norm_img, 0, 255, cv2.NORM_MINMAX)
+ output1 = cv2.threshold(output, 140, 255, cv2.THRESH_BINARY_INV)[1]
+ if np.average(output1.flatten()) > 128:
+ output = cv2.threshold(output, 140, 255, cv2.THRESH_BINARY)[1]
+ else:
+ output = output1
+ output = cv2.GaussianBlur(output, (1,1), 0)
+ boxes = pt.image_to_boxes(output, "eng", config=r'-c tessedit_char_whitelist=0123456789 --psm 13 --oem 3')
+ print(boxes)
+ h,w = output.shape
+ new_boxes_str = ""
+ new_boxes = []
+ for bt in boxes.splitlines():
+ b = bt.split(' ')
+ area = (int(b[1]) - int(b[3]))*(int(b[2]) - int(b[4]))
+ if b[0] in numbers and area > min_area:
+ output = cv2.rectangle(output, (int(b[1]), h - int(b[2])), (int(b[3]), h - int(b[4])), (255, 255, 255), 2)
+ new_boxes_str += bt + "\n"
+ new_boxes.append(list(int(i) for i in b[:5]))
+ grid_size = get_grid_size(output, new_boxes)
+ final_points = get_points(output, new_boxes, grid_size)
+ return grid_size,final_points
+
+if "__main__" == __name__:
+ print(resolve_image("f2.jpg"))
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/resultfile2_server.png b/MachineLearning Projects/sudoku_solver/resultfile2_server.png
new file mode 100644
index 00000000..d6af2f3c
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/resultfile2_server.png differ
diff --git a/MachineLearning Projects/sudoku_solver/sudoku.py b/MachineLearning Projects/sudoku_solver/sudoku.py
new file mode 100644
index 00000000..fa5dc225
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/sudoku.py
@@ -0,0 +1,373 @@
+"""This python script contains a class to solve a sudoku.
+"""
+
+from copy import deepcopy
+import pygame as pg
+
+VISITED_COLOR = (50,50,50)
+AGENT_COLOR = (255,0,0)
+BOARD_COLOR = (0,0,0)
+WALL_COLOR = (255,255,255)
+SOLUTION_COLOR = (0,255,0)
+START_CELL_COLOR = (200,0,200)
+END_CELL_COLOR = (0,128,128)
+
+SIZE = (600,600)
+
+class Cell():
+ """Cell element of sudoku.
+ """
+ def __init__(self, name:int|str, domain:list[int]) -> None:
+ """Initialise a cell of the sudoku.
+
+ Args:
+ name (int): the actual cell position.
+ domain (list[int]): list of all the possible values the cell can take.
+ """
+ self.name = name
+ self.value:int|str = None
+ self.domain:list[int] = deepcopy(domain)
+
+class Grid():
+ """The actual sudoku grid.
+ """
+ def __init__(self, rows:int|None = None, columns:int|None = None) -> None:
+ """Initialise the sudoku grid.
+
+ Args:
+ rows (int | None, optional): The number of rows in a block eg 3 for a 9x9 sudoku. Defaults to None.
+ columns (int | None, optional): The number of columns in a block. Defaults to None.
+ """
+ self.rows = rows
+ self.columns = columns
+ if not self.rows or not self.columns:
+ return
+ self.grid_len = self.rows * self.columns
+ self.domain:list[int] = [i for i in range(1, min(10, self.grid_len+1))]
+ if self.grid_len >= 10:
+ self.domain.extend(chr(ord('A') + i - 10) for i in range(10, self.grid_len+1))
+ self.cells:list[Cell] = [Cell(i, self.domain) for i in range(self.grid_len * self.grid_len)]
+ self.unsolved_cells:list[int] = [i for i in range(self.grid_len * self.grid_len)]
+ self.solved_cells:list[int] = []
+ self.initial_solved:list[int] = []
+ self.initial_unsolved:list[int] = [i for i in range(self.grid_len * self.grid_len)]
+
+ def preassign(self, values:dict[tuple, int]) -> None:
+ """Preassigns particular value to the cells already given in the problem.
+
+ Args:
+ values (dict[tuple, int]): a dictionary with keys of the (row,column) and value of the actual value of the cell.
+ """
+ for i, value in values.items():
+ number = int(i[0]*self.grid_len + i[1])
+ if number in self.initial_solved:
+ self.unassign_last(number)
+ self.cells[number].value = value
+ self.cells[number].domain = []
+ self.unsolved_cells.remove(number)
+ self.initial_unsolved.remove(number)
+ self.initial_solved.append(number)
+ self.solved_cells.append(number)
+
+ def unassign_last(self, number:int|None = None):
+ """Unassigns either the last value assigned to a cell or a particular cell given by number.
+
+ Args:
+ number (int | None, optional): The number of the cell in the grid, starting from 0 at the top right and moving left. Defaults to None.
+ """
+ if not number:
+ number = self.solved_cells.pop()
+ self.initial_solved.pop()
+ else:
+ self.solved_cells.remove(number)
+ self.initial_solved.remove(number)
+ self.unsolved_cells.append(number)
+ self.initial_unsolved.append(number)
+ self.cells[number].domain = deepcopy(self.domain)
+ self.cells[number].value = None
+
+ def solve(self) -> None:
+ """Tries to solve the sudoku.
+ """
+ while len(self.unsolved_cells) > 0:
+ changed = False
+ i = 0
+ # first update domains based on known cells
+ while i < len(self.solved_cells):
+ val = self.cells[self.solved_cells[i]].value
+ r,c = int(self.solved_cells[i]/self.grid_len), int(self.solved_cells[i]%self.grid_len)
+ # first check cells on the same row
+ for j in range(r*self.grid_len, (r+1)*self.grid_len):
+ try:
+ self.cells[j].domain.remove(val)
+ if len(self.cells[j].domain) == 1:
+ self.cells[j].value = self.cells[j].domain[0]
+ self.cells[j].domain = []
+ self.unsolved_cells.remove(j)
+ self.solved_cells.append(j)
+ changed = True
+ i = -1
+ except ValueError:
+ pass
+ # next check cells on the same column
+ for k in range(self.grid_len):
+ j = k*self.grid_len + c
+ try:
+ self.cells[j].domain.remove(val)
+ if len(self.cells[j].domain) == 1:
+ self.cells[j].value = self.cells[j].domain[0]
+ self.cells[j].domain = []
+ self.unsolved_cells.remove(j)
+ self.solved_cells.append(j)
+ changed = True
+ i = -1
+ except ValueError:
+ pass
+ # next check cells on the same block
+ br = int(r/self.rows)
+ bc = int(c/self.columns)
+ for k in range(self.grid_len):
+ cr = br*self.rows + int(k/self.columns)
+ cc = bc*self.columns + int(k%self.columns)
+ j = cr*self.grid_len + cc
+ try:
+ self.cells[j].domain.remove(val)
+ if len(self.cells[j].domain) == 1:
+ self.cells[j].value = self.cells[j].domain[0]
+ self.cells[j].domain = []
+ self.unsolved_cells.remove(j)
+ self.solved_cells.append(j)
+ changed = True
+ i = -1
+ except ValueError:
+ pass
+ i += 1
+ # next check for unique value in domains of cells in row column or block
+ # first check rows
+ to_break = False
+ for k in range(self.grid_len):
+ values:dict[int|str, list[int]] = {val:[] for val in self.domain}
+ for m in range(self.grid_len):
+ j = k*self.grid_len + m
+ for v in self.cells[j].domain:
+ values[v].append(j)
+ for val,ls in values.items():
+ if len(ls) == 1:
+ self.cells[ls[0]].value = val
+ self.cells[ls[0]].domain = []
+ self.unsolved_cells.remove(ls[0])
+ self.solved_cells.append(ls[0])
+ to_break = True
+ break
+ if to_break:
+ break
+ if to_break:
+ continue
+ # first check columns
+ to_break = False
+ for k in range(self.grid_len):
+ values:dict[int|str, list[int]] = {val:[] for val in self.domain}
+ for m in range(self.grid_len):
+ j = m*self.grid_len + k
+ for v in self.cells[j].domain:
+ values[v].append(j)
+ for val,ls in values.items():
+ if len(ls) == 1:
+ self.cells[ls[0]].value = val
+ self.cells[ls[0]].domain = []
+ self.unsolved_cells.remove(ls[0])
+ self.solved_cells.append(ls[0])
+ to_break = True
+ break
+ if to_break:
+ break
+ if to_break:
+ continue
+ if not changed:
+ return
+
+ def render_cells(self, window:pg.Surface) -> None:
+ """Draws the grid and populates it with the value of the cells.
+
+ Args:
+ window (pg.Surface): a pygame window to be used to populate the grid and cells.
+ """
+ size = window.get_size()
+ py = int(size[1] / self.grid_len)
+ px = int(size[0] / self.grid_len)
+ ball = pg.Rect(0, 0, size[0], size[1])
+ pg.draw.rect(window, BOARD_COLOR, ball)
+ for i in range(self.grid_len+1):
+ if i%self.columns:
+ pg.draw.line(window, VISITED_COLOR, (i*px, 0), (i*px, size[1]))
+ else:
+ pg.draw.line(window, WALL_COLOR, (i*px, 0), (i*px, size[1]))
+ if i%self.rows:
+ pg.draw.line(window, VISITED_COLOR, (0, i*py), (size[0], i*py))
+ else:
+ pg.draw.line(window, WALL_COLOR, (0, i*py), (size[0], i*py))
+ font = pg.font.SysFont(None, min(py, px))
+ for i in self.initial_solved:
+ text = font.render(str(self.cells[i].value), True, AGENT_COLOR, BOARD_COLOR)
+ textRect = text.get_rect()
+ y = int(i/self.grid_len)
+ x = int(i%self.grid_len)
+ textRect.center = (int((x+0.5)*px),int((y+0.5)*py))
+ window.blit(text, textRect)
+ for i in self.initial_unsolved:
+ if val:=self.cells[i].value:
+ text = font.render(str(val), True, SOLUTION_COLOR, BOARD_COLOR)
+ textRect = text.get_rect()
+ y = int(i/self.grid_len)
+ x = int(i%self.grid_len)
+ textRect.center = (int((x+0.5)*px),int((y+0.5)*py))
+ window.blit(text, textRect)
+ # else:
+ # for dv in self.cells[i].domain:
+ # text = font.render(str(val), True, SOLUTION_COLOR, BOARD_COLOR)
+ # textRect = text.get_rect()
+ # y = int(i/self.grid_len)
+ # x = int(i%self.grid_len)
+ # textRect.center = (int((x+0.5)*px),int((y+0.5)*py))
+ # window.blit(text, textRect)
+
+ def render_grid(self, size:tuple[int, int]=SIZE) -> None:
+ """Creates the grid window and renders it.
+
+ Args:
+ size (tuple[int, int], optional): The size of the window to be used. Defaults to (600,600).
+ """
+ pg.init()
+ window = pg.display.set_mode(size)
+ window.fill(BOARD_COLOR)
+ while True:
+ for event in pg.event.get():
+ if event.type == pg.QUIT:
+ pg.display.quit()
+ return
+ self.render_cells(window)
+ pg.display.update()
+
+ def input_to_grid(self, size:tuple[int, int]=SIZE) -> None:
+ """Allows for input of the value of the grid cells by clicking on a cell and typing the value.
+
+ Args:
+ size (tuple[int, int], optional): The size of the window to which the grid will be rendered. Defaults to (600,600).
+ """
+ pg.init()
+ window = pg.display.set_mode(size)
+ window.fill(BOARD_COLOR)
+ size = window.get_size()
+ py = int(size[1] / self.grid_len)
+ px = int(size[0] / self.grid_len)
+ clicked_cell = None
+ while True:
+ for event in pg.event.get():
+ if event.type == pg.QUIT:
+ pg.display.quit()
+ return
+ if event.type == pg.MOUSEBUTTONUP:
+ clicked_cell = event.dict['pos']
+ if event.type == pg.KEYDOWN:
+ key = event.dict['unicode']
+ if key >= '0' and key <= '9':
+ if clicked_cell:
+ pos = (int(clicked_cell[1] / py), int(clicked_cell[0] / px))
+ if int(key) <= self.grid_len:
+ self.preassign({pos:int(key)})
+ elif key >= 'A' and key <= 'Z':
+ if clicked_cell:
+ pos = (int(clicked_cell[1] / py), int(clicked_cell[0] / px))
+ if (ord(key) - ord('A') + 10) <= self.grid_len:
+ self.preassign({pos:key})
+ elif key == ' ':
+ self.unassign_last()
+ self.render_cells(window)
+ pg.display.update()
+
+ def save(self, filename:str) -> None:
+ """Saves the current state of the grid in a file.\n
+ Save format is:\n
+ rows,columns\n
+ (cell_number,cell_value)|(cell_number,cell_value)|...|(cell_number,cell_value)\n
+ (cell_number,cell_value)|(cell_number,cell_value)|...|(cell_number,cell_value)\n
+ \n
+ where the second line is the initial cell values before trying to solve\n
+ \t the third line is the initially unsolved cell values after solving if Grid.solve() has been run\n
+
+ Args:
+ filename (str): The path of the file to be saved to.
+ """
+ s = f"{self.rows},{self.columns}\n"
+ s += "|".join(f"({a},{self.cells[a].value})" for a in self.initial_solved)
+ s += "\n"
+ s += "|".join(f"({a},{self.cells[a].value})" for a in self.initial_unsolved)
+ with open(filename, 'w') as f:
+ f.write(s)
+ f.close()
+
+ def load(self, filename:str):
+ """Loads the grid from a saved state file created by calling Grid.save(filename)
+
+ Args:
+ filename (str): The path to the file containing the grid status to be loaded.
+ """
+ with open(filename, 'r') as f:
+ for i,line in enumerate(f):
+ line = line.replace("\n","")
+ if i == 0:
+ rows, columns = line.replace("(","").replace(")","").split(",")
+ self.rows = int(rows)
+ self.columns = int(columns)
+ elif i == 1:
+ initial_solved_pairs = [tuple(int(i) for i in a.split(",")) for a in line.replace("(","").replace(")","").split("|")]
+ elif i == 2:
+ initial_unsolved_pairs = [tuple(eval(i) for i in a.split(",")) for a in line.replace("(","").replace(")","").split("|")]
+ f.close()
+ self.grid_len = self.rows * self.columns
+ self.domain:list[int] = [i for i in range(1, min(10, self.grid_len+1))]
+ if self.grid_len >= 10:
+ self.domain.extend(chr(ord('A') + i - 10) for i in range(10, self.grid_len+1))
+ self.cells:list[Cell] = [Cell(i, self.domain) for i in range(self.grid_len * self.grid_len)]
+ self.unsolved_cells:list[int] = [i for i in range(self.grid_len * self.grid_len)]
+ self.solved_cells:list[int] = []
+ self.initial_solved:list[int] = []
+ self.initial_unsolved:list[int] = [i for i in range(self.grid_len * self.grid_len)]
+ for (number,value) in initial_solved_pairs:
+ self.initial_solved.append(number)
+ self.solved_cells.append(number)
+ self.cells[number].value = value
+ self.cells[number].domain = []
+ self.initial_unsolved.remove(number)
+ self.unsolved_cells.remove(number)
+ for (number,value) in initial_unsolved_pairs:
+ if value:
+ self.solved_cells.append(number)
+ self.cells[number].value = value
+ self.cells[number].domain = []
+ self.unsolved_cells.remove(number)
+
+ def save_grid_image(self, path:str, size:tuple[int, int]=SIZE) -> None:
+ pg.init()
+ window = pg.display.set_mode(size)
+ window.fill(BOARD_COLOR)
+ self.render_cells(window)
+ pg.image.save(window, path)
+ pg.quit()
+
+def main():
+ r = int(input("Enter number of rows in a block: "))
+ c = int(input("Enter number of columns in a block: "))
+ grid = Grid(r,c)
+ # grid = Grid()
+ # grid.load("s2.txt")
+ grid.input_to_grid()
+ grid.save("s3.txt")
+ grid.solve()
+ grid.save("s3.txt")
+ # grid = Grid()
+ # grid.load("s1.txt")
+ grid.render_grid()
+
+if __name__ == "__main__":
+ main()
diff --git a/MachineLearning Projects/sudoku_solver/temp.ipynb b/MachineLearning Projects/sudoku_solver/temp.ipynb
new file mode 100644
index 00000000..0737eb93
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/temp.ipynb
@@ -0,0 +1,230 @@
+{
+ "cells": [
+ {
+ "cell_type": "code",
+ "execution_count": 22,
+ "metadata": {},
+ "outputs": [],
+ "source": [
+ "class Node:\n",
+ " def __init__(self,val):\n",
+ " self.val = val\n",
+ " self.to = {}"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 137,
+ "metadata": {},
+ "outputs": [],
+ "source": [
+ "class Node:\n",
+ " def __init__(self,val):\n",
+ " self.val:int = val\n",
+ " self.to:dict[Node,tuple[int,int]] = {} # destinationNode:(steps,price)\n",
+ " \n",
+ " def __str__(self) -> str:\n",
+ " children = ','.join(str(i.val) for i in self.to.keys())\n",
+ " return f\"Node({self.val})\"\n",
+ " \n",
+ " def __repr__(self) -> str:\n",
+ " children = ','.join(str(i.val) for i in self.to.keys())\n",
+ " return f\"Node({self.val})\"\n",
+ " \n",
+ " def full(self) -> str:\n",
+ " children = ','.join(str(i.val) for i in self.to.keys())\n",
+ " return f\"Node({self.val})->[{children}]\"\n",
+ "\n",
+ "def update(node:Node, start:list[int]):\n",
+ " # print(\"iter\", node, start)\n",
+ " if node.val in start:\n",
+ " # print(\"found: \", node, \" => \", start)\n",
+ " return {}\n",
+ " ret:dict[Node,set[tuple[int,int]]] = {\n",
+ " i:set([tuple(node.to[i]),]) for i in node.to.keys()\n",
+ " } # destinationNode:[(steps1,price1), (steps2,price2), ...]\n",
+ " for destinationNode,(steps,price) in node.to.items():\n",
+ " # print(f\"step {node} to {destinationNode}\")\n",
+ " returned = update(destinationNode, [*start,node.val])\n",
+ " # print(f\"{node.val} going to {destinationNode.val} got {returned}\")\n",
+ " if returned == {}:\n",
+ " # print(f\"here on\")\n",
+ " ret[destinationNode].add((steps,price))\n",
+ " continue\n",
+ " for v,mylist in returned.items():\n",
+ " # v is the a possible destination from our destination node\n",
+ " # my list is a list of the steps and prices to that possible destination\n",
+ " for (stp,prc) in mylist:\n",
+ " newTuple = (stp+steps,prc+price)\n",
+ " if ret.get(v):\n",
+ " ret[v].add(newTuple)\n",
+ " else:\n",
+ " ret[v] = set([newTuple,])\n",
+ " return ret"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 176,
+ "metadata": {},
+ "outputs": [],
+ "source": [
+ "from cmath import inf\n",
+ "\n",
+ "def findCheapestPrice(n: int, flights: list[list[int]], src: int, dst: int, k: int) -> int:\n",
+ " nodes:dict[int,Node] = {}\n",
+ " for s,d,p in flights:\n",
+ " dnode = nodes.get(d)\n",
+ " if dnode:\n",
+ " snode = nodes.get(s)\n",
+ " if snode:\n",
+ " snode.to[dnode] = (1,p)\n",
+ " else:\n",
+ " nd = Node(s)\n",
+ " nd.to[dnode] = (1,p)\n",
+ " nodes[s] = nd\n",
+ " else:\n",
+ " snode = nodes.get(s)\n",
+ " if snode:\n",
+ " nd = Node(d)\n",
+ " snode.to[nd] = (1,p)\n",
+ " nodes[d] = nd\n",
+ " else:\n",
+ " nd1 = Node(s)\n",
+ " nd2 = Node(d)\n",
+ " nd1.to[nd2] = (1,p)\n",
+ " nodes[s] = nd1\n",
+ " nodes[d] = nd2\n",
+ " for _,node in nodes.items():\n",
+ " print(node.full())\n",
+ " return method2(nodes, src, dst, k)\n",
+ "\n",
+ "def method1(nodes:dict[int,Node], src:int, dst:int, k:int) -> int:\n",
+ " results = {}\n",
+ " for val,node in nodes.items():\n",
+ " ret = update(node, [])\n",
+ " results[val] = ret\n",
+ " desired = results[src].get(nodes[dst])\n",
+ " if not desired:\n",
+ " return -1\n",
+ " filtered = []\n",
+ " k = k + 1\n",
+ " for d in desired:\n",
+ " if d[0] <= k:\n",
+ " filtered.append(d)\n",
+ " return min(filtered, key=lambda x:x[1])\n",
+ "\n",
+ "def method2(nodes:dict[int,Node], src:int, dst:int, k:int) -> int:\n",
+ " def recurse(node:Node, dst:int, k:int, visited:list[int]):\n",
+ " results = []\n",
+ " if k == 1:\n",
+ " for nd in node.to.keys():\n",
+ " if nd.val == dst:\n",
+ " return node.to[nd][1]\n",
+ " return inf\n",
+ " if node.val in visited:\n",
+ " return inf\n",
+ " for nd in node.to.keys():\n",
+ " if nd.val == dst:\n",
+ " results.append(node.to[nd][1])\n",
+ " else:\n",
+ " temp = recurse(nd, dst, k-1, [*visited, node.val]) + node.to[nd][1]\n",
+ " results.append(temp)\n",
+ " if len(results):\n",
+ " return min(results)\n",
+ " return inf\n",
+ " \n",
+ " k = k+1\n",
+ " node = nodes[src]\n",
+ " result = recurse(node, dst, k, [])\n",
+ " if result == inf:\n",
+ " return -1\n",
+ " return result"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 157,
+ "metadata": {},
+ "outputs": [
+ {
+ "data": {
+ "text/plain": [
+ "100"
+ ]
+ },
+ "execution_count": 157,
+ "metadata": {},
+ "output_type": "execute_result"
+ }
+ ],
+ "source": [
+ "findCheapestPrice(n = 3, flights = [[0,1,100],[1,2,100],[0,2,500]], src = 0, dst = 2, k = 1)"
+ ]
+ },
+ {
+ "cell_type": "code",
+ "execution_count": 178,
+ "metadata": {},
+ "outputs": [
+ {
+ "name": "stdout",
+ "output_type": "stream",
+ "text": [
+ "Node(0)->[12,8,15,10]\n",
+ "Node(12)->[4,3,14,13,9,0,16,6]\n",
+ "Node(5)->[6,14,13,16,10,9,7]\n",
+ "Node(6)->[14,10,2,12]\n",
+ "Node(8)->[6,10,11,9,2,13,3]\n",
+ "Node(13)->[15,12,6,16,0,5,11,7,8]\n",
+ "Node(15)->[3,0,6,13,12,11,14,2]\n",
+ "Node(10)->[12,2,15,11,5,4,9,0,7]\n",
+ "Node(3)->[4,12,5,6,7,10]\n",
+ "Node(7)->[11,3,1,14,0,12,2]\n",
+ "Node(11)->[16,1,0,2,6,9]\n",
+ "Node(9)->[4,6,1,12,7,10,15,5]\n",
+ "Node(4)->[7,9,8,5,11,10]\n",
+ "Node(2)->[12,0,11,5,13,10,7]\n",
+ "Node(14)->[15,1,9,7,11,6]\n",
+ "Node(16)->[4,12,1,3,8,11,9,14]\n",
+ "Node(1)->[11,4,3,7]\n"
+ ]
+ },
+ {
+ "data": {
+ "text/plain": [
+ "47"
+ ]
+ },
+ "execution_count": 178,
+ "metadata": {},
+ "output_type": "execute_result"
+ }
+ ],
+ "source": [
+ "findCheapestPrice(n = 4, flights = [[0,12,28],[5,6,39],[8,6,59],[13,15,7],[13,12,38],[10,12,35],[15,3,23],[7,11,26],[9,4,65],[10,2,38],[4,7,7],[14,15,31],[2,12,44],[8,10,34],[13,6,29],[5,14,89],[11,16,13],[7,3,46],[10,15,19],[12,4,58],[13,16,11],[16,4,76],[2,0,12],[15,0,22],[16,12,13],[7,1,29],[7,14,100],[16,1,14],[9,6,74],[11,1,73],[2,11,60],[10,11,85],[2,5,49],[3,4,17],[4,9,77],[16,3,47],[15,6,78],[14,1,90],[10,5,95],[1,11,30],[11,0,37],[10,4,86],[0,8,57],[6,14,68],[16,8,3],[13,0,65],[2,13,6],[5,13,5],[8,11,31],[6,10,20],[6,2,33],[9,1,3],[14,9,58],[12,3,19],[11,2,74],[12,14,48],[16,11,100],[3,12,38],[12,13,77],[10,9,99],[15,13,98],[15,12,71],[1,4,28],[7,0,83],[3,5,100],[8,9,14],[15,11,57],[3,6,65],[1,3,45],[14,7,74],[2,10,39],[4,8,73],[13,5,77],[10,0,43],[12,9,92],[8,2,26],[1,7,7],[9,12,10],[13,11,64],[8,13,80],[6,12,74],[9,7,35],[0,15,48],[3,7,87],[16,9,42],[5,16,64],[4,5,65],[15,14,70],[12,0,13],[16,14,52],[3,10,80],[14,11,85],[15,2,77],[4,11,19],[2,7,49],[10,7,78],[14,6,84],[13,7,50],[11,6,75],[5,10,46],[13,8,43],[9,10,49],[7,12,64],[0,10,76],[5,9,77],[8,3,28],[11,9,28],[12,16,87],[12,6,24],[9,15,94],[5,7,77],[4,10,18],[7,2,11],[9,5,41]], src = 13, dst = 4, k = 13)"
+ ]
+ }
+ ],
+ "metadata": {
+ "kernelspec": {
+ "display_name": "base",
+ "language": "python",
+ "name": "python3"
+ },
+ "language_info": {
+ "codemirror_mode": {
+ "name": "ipython",
+ "version": 3
+ },
+ "file_extension": ".py",
+ "mimetype": "text/x-python",
+ "name": "python",
+ "nbconvert_exporter": "python",
+ "pygments_lexer": "ipython3",
+ "version": "3.12.4"
+ }
+ },
+ "nbformat": 4,
+ "nbformat_minor": 2
+}
diff --git a/MachineLearning Projects/sudoku_solver/temp.py b/MachineLearning Projects/sudoku_solver/temp.py
new file mode 100644
index 00000000..553f0531
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/temp.py
@@ -0,0 +1,2 @@
+while True:
+ pass
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/tempfile1.jpg b/MachineLearning Projects/sudoku_solver/tempfile1.jpg
new file mode 100644
index 00000000..7e398e54
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/tempfile1.jpg differ
diff --git a/MachineLearning Projects/sudoku_solver/tempfile2.jpg b/MachineLearning Projects/sudoku_solver/tempfile2.jpg
new file mode 100644
index 00000000..b0069382
Binary files /dev/null and b/MachineLearning Projects/sudoku_solver/tempfile2.jpg differ
diff --git a/MachineLearning Projects/sudoku_solver/templates/index.html b/MachineLearning Projects/sudoku_solver/templates/index.html
new file mode 100644
index 00000000..8a812ec4
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/templates/index.html
@@ -0,0 +1,20 @@
+
+
+
+
+
+
Sudoku Solver
+
+
+
Sudoku Solver
+
+
To solve a sudoku select the image of the sudoku and upload it to the page then hit submit.
+
The solution will be returned as an image on the next page.
+
+
+
+
+
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/templates/result.html b/MachineLearning Projects/sudoku_solver/templates/result.html
new file mode 100644
index 00000000..94fbedb1
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/templates/result.html
@@ -0,0 +1,19 @@
+
+
+
+
+
+
Solution
+
+
+
+
Back to Main Page
+
+
+
Solution
+
+
+
+
+
+
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/test_full_stack.py b/MachineLearning Projects/sudoku_solver/test_full_stack.py
new file mode 100644
index 00000000..a24ab068
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/test_full_stack.py
@@ -0,0 +1,31 @@
+import socket
+
+result_file = "resultfile2_server.png"
+input_file = "f1.jpg"
+
+def main(address:tuple[str,int]):
+ sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+ sock.connect(address)
+ sock.settimeout(10)
+ with open(input_file, "rb") as f:
+ sock.send(f.read())
+ res_buf = b''
+ try:
+ while True:
+ try:
+ res = sock.recv(1)
+ res_buf += res
+ if 0 == len(res):
+ sock.close()
+ with open(result_file, "wb") as f:
+ f.write(res_buf)
+ break
+ except socket.timeout:
+ with open(result_file, "wb") as f:
+ f.write(res_buf)
+ break
+ finally:
+ sock.close()
+
+if "__main__" == __name__:
+ main(("localhost", 3535))
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/verify_image.py b/MachineLearning Projects/sudoku_solver/verify_image.py
new file mode 100644
index 00000000..1ad57615
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/verify_image.py
@@ -0,0 +1,110 @@
+"""This code is to verify the image dataset and check that all the labels of the grid location are in the correct place.
+"""
+
+import PIL.Image as Image
+from matplotlib import pyplot as plt
+import numpy as np
+from image import SudokuDataset, get_dataset, tqdm, Model
+import torch
+
+img_size = (300,300)
+
+def mark(positions, image, color_value):
+ print(positions)
+ print(image.shape)
+ x0,y0,x1,y1,x2,y2,x3,y3 = positions
+ image = image.transpose()
+ grad = (y1 - y0)/(x1 - x0)
+ if x1 > x0:
+ for i in range(x1 - x0):
+ image[x0 + i, int(y0 + i * grad)] = color_value
+ else:
+ for i in range(x0 - x1):
+ image[x0 - i, int(y0 - i * grad)] = color_value
+
+ grad = (y2 - y1)/(x2 - x1)
+ if x2 > x1:
+ for i in range(x2 - x1):
+ image[x1 + i, int(y1 + i * grad)] = color_value
+ else:
+ for i in range(x1 - x2):
+ image[x1 - i, int(y1 - i * grad)] = color_value
+
+ grad = (y3 - y2)/(x3 - x2)
+ if x3 > x2:
+ for i in range(x3 - x2):
+ image[x2 + i, int(y2 + i * grad)] = color_value
+ else:
+ for i in range(x2 - x3):
+ image[x2 - i, int(y2 - i * grad)] = color_value
+
+ grad = (y0 - y3)/(x0 - x3)
+ if x0 > x3:
+ for i in range(x0 - x3):
+ image[x3 + i, int(y3 + i * grad)] = color_value
+ else:
+ for i in range(x3 - x0):
+ image[x3 - i, int(y3 - i * grad)] = color_value
+ return image.transpose()
+
+# dataset = SudokuDataset("./archive/outlines_sorted.csv", img_size)
+# for item in dataset:
+# try:
+# image = item['image']
+# grid = item['grid']
+# x0,y0,x1,y1,x2,y2,x3,y3 = list(grid.numpy())
+# x0 = int(x0 * img_size[0])
+# x1 = int(x1 * img_size[0])
+# x2 = int(x2 * img_size[0])
+# x3 = int(x3 * img_size[0])
+# y0 = int(y0 * img_size[1])
+# y1 = int(y1 * img_size[1])
+# y2 = int(y2 * img_size[1])
+# y3 = int(y3 * img_size[1])
+# image = mark((x0,y0,x1,y1,x2,y2,x3,y3), image.numpy()[0], 0.7)
+# plt.imshow(image)
+# plt.colorbar()
+# plt.show()
+# except KeyboardInterrupt:
+# break
+
+def test(config:dict, model_filename:str):
+ device = torch.device('cuda' if torch.cuda.is_available() else 'cpu')
+ model = torch.load(model_filename).to(device)
+ model.eval()
+ loss = torch.nn.MSELoss().to(device)
+ dataset = get_dataset(config['filename'], config['input_shape'], config['batch_size'])
+ batch_iterator = tqdm(dataset)
+ for batch in batch_iterator:
+ x = batch['image'].to(device)
+ y_true = batch['grid'].to(device)
+ # print(batch['grid'])
+ # return
+ y_pred = model(x)
+ error = loss(y_true, y_pred)
+ batch_iterator.set_postfix({"loss":f"Loss: {error.item():6.6f}"})
+ x0,y0,x1,y1,x2,y2,x3,y3 = list(y_pred.detach().numpy()[1])
+ print(x0,y0,x1,y1,x2,y2,x3,y3)
+ x0 = int(x0 * img_size[0])
+ x1 = int(x1 * img_size[0])
+ x2 = int(x2 * img_size[0])
+ x3 = int(x3 * img_size[0])
+ y0 = int(y0 * img_size[1])
+ y1 = int(y1 * img_size[1])
+ y2 = int(y2 * img_size[1])
+ y3 = int(y3 * img_size[1])
+ image = mark((x0,y0,x1,y1,x2,y2,x3,y3), x.detach().numpy()[0][0], 0.7)
+ plt.imshow(image)
+ plt.colorbar()
+ plt.show()
+
+config = {
+ "input_shape": (300,300),
+ "filename": "archive/outlines_sorted.csv",
+ "number_of_layers": 4,
+ "dims": 3,
+ "batch_size": 8,
+ "lr": 1e-5
+}
+# model = train(50, config)
+test(config, "model.pt")
\ No newline at end of file
diff --git a/MachineLearning Projects/sudoku_solver/web_interface.py b/MachineLearning Projects/sudoku_solver/web_interface.py
new file mode 100644
index 00000000..6bc14604
--- /dev/null
+++ b/MachineLearning Projects/sudoku_solver/web_interface.py
@@ -0,0 +1,129 @@
+from flask import Flask, render_template, redirect, url_for, request, flash, session
+from werkzeug.utils import secure_filename
+import os
+from random import choices, choice
+from string import ascii_letters, digits
+from time import sleep
+from datetime import datetime
+import socket
+
+app = Flask(__name__)
+
+app.config.from_pyfile("config.cfg")
+
+def manage_solution(input_file, result_file) -> int:
+ def send(input_file:str, sock:socket.socket) -> int:
+ try:
+ with open(input_file, "rb") as f:
+ sock.send(f.read())
+ return 1
+ except FileNotFoundError:
+ return -2
+ except socket.error:
+ return -1
+
+ def connect() -> socket.socket:
+ sock = socket.socket(socket.AF_INET, socket.SOCK_STREAM)
+ sock.connect((app.config['SOLVER_IP'], int(app.config['SOLVER_PORT'])))
+ sock.settimeout(10)
+ return sock
+
+ def manage_full_send(input_file:str, sock:socket.socket):
+ tries = 0
+ while tries < 5:
+ send_state = send(input_file, sock)
+ if send_state == 1:
+ break
+ elif send_state == -2:
+ return -2
+ elif send_state == -1:
+ sock = connect()
+ tries += 1
+ return send_state
+
+ sock = connect()
+ send_state = manage_full_send(input_file, sock)
+ if send_state == -1:
+ return -1
+ elif send_state == -2:
+ return -2
+ res_buf = b''
+ try:
+ while True:
+ try:
+ res = sock.recv(1)
+ res_buf += res
+ if 0 == len(res):
+ sock.close()
+ with open(result_file, "wb") as f:
+ f.write(res_buf)
+ break
+ except socket.timeout:
+ with open(result_file, "wb") as f:
+ f.write(res_buf)
+ break
+ finally:
+ sock.close()
+ return 0
+
+@app.route('/', methods=['POST', 'GET'])
+def index():
+ if "POST" == request.method:
+ print(request)
+ if 'image' not in request.files:
+ flash('No file part.', "danger")
+ else:
+ file = request.files['image']
+ if '' == file.filename:
+ flash("No file selected.", "danger")
+ else:
+ ext = "." + file.filename.split('.')[-1]
+ filename = datetime.now().strftime("%d%m%y%H%M%S") + "_" + "".join(i for i in choices(ascii_letters+digits, k=3)) + ext
+ filename = os.path.join(app.config['UPLOAD_FOLDER'], filename)
+ print(filename)
+ file.save(filename)
+ session['filename'] = filename
+ return redirect(url_for('result'))
+ else:
+ if session.get('solved'):
+ session.pop('solved')
+ if session.get('filename'):
+ try:
+ os.remove(session['filename'])
+ session.pop('filename')
+ except FileNotFoundError:
+ pass
+ return render_template('index.html', request=request)
+
+@app.route('/result', methods=['GET'])
+def result():
+ if not session.get('solved'):
+ filename = session.get('filename')
+ if not filename:
+ return redirect(url_for('/'))
+ solution = ""
+ result_file = ".".join(i for i in filename.split(".")[:-1]) + "_sol.png"
+ result_file = result_file.split("/")[-1]
+ full_result_file = "static/" + result_file
+ result_file = f"../static/{result_file}"
+ result = manage_solution(filename, full_result_file)
+ os.remove(session['filename'])
+ if result == 0:
+ session['filename'] = full_result_file
+ print("solved")
+ solution = result_file
+ session['solved'] = solution
+ else:
+ session.pop('filename')
+ flash(f"There was an issue, Error {result}", "danger")
+ redirect(url_for('/'))
+ else:
+ solution = session['solved']
+ return render_template('result.html', img=solution)
+
+if "__main__" == __name__:
+ app.run(
+ host="192.168.1.88",
+ port=5000,
+ debug=True
+ )
\ No newline at end of file
diff --git a/OTHERS/Encryption/README.md b/OTHERS/Encryption/README.md
new file mode 100644
index 00000000..46b85add
--- /dev/null
+++ b/OTHERS/Encryption/README.md
@@ -0,0 +1,133 @@
+
+# 🔐 Simple Symmetric Encryption in Python
+
+This project demonstrates the basics of **symmetric encryption** using Python and the [`cryptography`](https://cryptography.io/en/latest/) library. It's a great starting point for beginners interested in **cybersecurity**, **cryptography**, or contributing to **open-source security tools**.
+
+---
+
+## 📚 What You'll Learn
+
+- How to generate secure keys
+- How to encrypt and decrypt messages
+- Basic key management (saving & loading keys)
+- How `Fernet` (AES-based encryption) works under the hood
+
+---
+
+## 🚀 Getting Started
+
+### 1. Clone the Repository
+
+```bash
+git clone https://github.com/your-username/simple-encryption-python.git
+cd simple-encryption-python
+```
+
+### 2. Install Dependencies
+
+Make sure you have Python 3.6+ installed.
+
+Install required package using `pip`:
+
+```bash
+pip install cryptography
+```
+
+### 3. Run the Code
+
+```bash
+python simple_encryption.py
+```
+
+On first run, it will generate a `secret.key` file that is used for both encryption and decryption. Each time you run the script, it:
+- Loads the existing key
+- Encrypts a sample message
+- Decrypts it back and displays the result
+
+---
+
+## 📂 File Structure
+
+```
+simple-encryption-python/
+│
+├── simple_encryption.py # Main script to run encryption and decryption
+├── secret.key # Auto-generated AES-based symmetric key (DO NOT SHARE)
+├── README.md # Documentation
+```
+
+---
+
+## 🔒 Security Note
+
+This example is for educational purposes only. If you’re building a production-grade application:
+- Never store raw keys in plaintext
+- Use environment variables or secure vaults (e.g., AWS KMS, HashiCorp Vault)
+- Handle exceptions and errors securely
+
+---
+
+## 🧠 How It Works (In Brief)
+
+- **Fernet** is a module in the `cryptography` package that provides:
+ - AES-128 in CBC mode
+ - HMAC-SHA256 authentication
+ - Random IVs for each encryption
+
+- The encryption key is:
+ - Generated once and saved to `secret.key`
+ - Loaded on subsequent runs
+
+- The message is:
+ - Encrypted using `.encrypt()`
+ - Decrypted using `.decrypt()`
+
+---
+
+## 💡 Sample Output
+
+```
+[*] Key loaded from 'secret.key'
+
+Original Message: This is a secret message.
+Encrypted Message: b'gAAAAABlZ...'
+Decrypted Message: This is a secret message.
+```
+
+---
+
+## 🤝 Contributing
+
+Contributions are welcome! You can help by:
+- Improving the CLI interface
+- Adding file encryption support
+- Implementing password-based key derivation
+- Writing unit tests
+
+To contribute:
+1. Fork the repo
+2. Create a new branch (`git checkout -b my-feature`)
+3. Commit your changes
+4. Push and create a Pull Request
+
+---
+
+## 📜 License
+
+This project is licensed under the **MIT License**. See [LICENSE](LICENSE) for details.
+
+---
+
+## 👨💻 Author
+
+**Afolabi Adewale**
+A data and security enthusiast exploring the intersection of Python, encryption, and open-source software.
+[GitHub Profile](https://github.com/your-username)
+
+---
+
+## 🔗 Related Resources
+
+- [Python `cryptography` docs](https://cryptography.io/en/latest/)
+- [Understanding Symmetric vs Asymmetric Encryption](https://www.cloudflare.com/learning/ssl/how-does-ssl-work/)
+- [OWASP Crypto Cheat Sheet](https://cheatsheetseries.owasp.org/cheatsheets/Cryptographic_Storage_Cheat_Sheet.html)
diff --git a/OTHERS/Encryption/symmetricEncryption.py b/OTHERS/Encryption/symmetricEncryption.py
new file mode 100644
index 00000000..9d132e07
--- /dev/null
+++ b/OTHERS/Encryption/symmetricEncryption.py
@@ -0,0 +1,72 @@
+# simple_encryption.py
+
+"""
+A simple example of symmetric encryption using Python's 'cryptography' package.
+
+This script:
+1. Generates a secure encryption key
+2. Encrypts a message using the key
+3. Decrypts it back to the original message
+
+Author: Afolabi Adewale
+"""
+
+from cryptography.fernet import Fernet
+
+# 1. Generate a key for encryption and decryption
+def generate_key():
+ """
+ Generates a symmetric key for Fernet (uses AES encryption internally).
+ """
+ key = Fernet.generate_key()
+ with open("secret.key", "wb") as key_file:
+ key_file.write(key)
+ print("[+] Key generated and saved to 'secret.key'")
+ return key
+
+# 2. Load the existing key from file
+def load_key():
+ """
+ Loads the previously generated key from the file.
+ """
+ return open("secret.key", "rb").read()
+
+# 3. Encrypt a message
+def encrypt_message(message: str, key: bytes) -> bytes:
+ """
+ Encrypts a message using the provided symmetric key.
+ """
+ f = Fernet(key)
+ encrypted = f.encrypt(message.encode())
+ return encrypted
+
+
+# 4. Decrypt a message
+def decrypt_message(encrypted_message: bytes, key: bytes) -> str:
+ """
+ Decrypts an encrypted message using the same symmetric key.
+ """
+ f = Fernet(key)
+ decrypted = f.decrypt(encrypted_message)
+ return decrypted.decode()
+
+# 5. Main runner
+if __name__ == "__main__":
+ # Create or load the key
+ try:
+ key = load_key()
+ print("[*] Key loaded from 'secret.key'")
+ except FileNotFoundError:
+ key = generate_key()
+
+ # Example message
+ message = "This is a secret message."
+ print(f"\nOriginal Message: {message}")
+
+ # Encrypt it
+ encrypted = encrypt_message(message, key)
+ print(f"Encrypted Message: {encrypted}")
+
+ # Decrypt it
+ decrypted = decrypt_message(encrypted, key)
+ print(f"Decrypted Message: {decrypted}")
diff --git a/OTHERS/PyDiff/README.md b/OTHERS/PyDiff/README.md
new file mode 100644
index 00000000..d3fdcef5
--- /dev/null
+++ b/OTHERS/PyDiff/README.md
@@ -0,0 +1,15 @@
+## PyDiff
+A simple python script to compare two files using *Dynamic Programming* based algorithm.
+
+Usage:
+```sh
+py pydiff.py file1.txt file2.txt
+```
+
+Output:
+```sh
+file1.txt | - 13 | mattis justo quis porta porttitor.
+file2.txt | + 13 | Aenean mattis justo quis porta porttitor.
+file1.txt | - 10 | Nullam elementum nunc in massa fringilla, sit amet iaculis elit blandit.
+file2.txt | + 10 | elementum nunc in massa fringilla, sit amet iaculis elit blandit.
+```
diff --git a/OTHERS/PyDiff/file1.txt b/OTHERS/PyDiff/file1.txt
new file mode 100644
index 00000000..0fa5f2bf
--- /dev/null
+++ b/OTHERS/PyDiff/file1.txt
@@ -0,0 +1,14 @@
+Lorem ipsum dolor sit amet, consectetur adipiscing elit.
+Nulla volutpat mauris in magna posuere, in volutpat turpis pulvinar.
+Mauris semper ante non maximus vulputate.
+Fusce sollicitudin justo ut arcu blandit, id feugiat ex rhoncus.
+Suspendisse lacinia nisl sit amet vestibulum varius.
+Sed vestibulum erat in urna tempus mollis.
+Aliquam varius lectus eget dui consequat, sed aliquet diam ultricies.
+Sed a lectus a orci blandit accumsan.
+Etiam eu augue ac ipsum tempus lobortis at vitae nibh.
+Nullam elementum nunc in massa fringilla, sit amet iaculis elit blandit.
+Nam et nulla fermentum ligula laoreet malesuada sed nec risus.
+Pellentesque maximus velit non massa faucibus, vel aliquam ante pharetra.
+mattis justo quis porta porttitor.
+Donec dignissim ligula et pretium feugiat.
diff --git a/OTHERS/PyDiff/file2.txt b/OTHERS/PyDiff/file2.txt
new file mode 100644
index 00000000..b348e2d1
--- /dev/null
+++ b/OTHERS/PyDiff/file2.txt
@@ -0,0 +1,14 @@
+Lorem ipsum dolor sit amet, consectetur adipiscing elit.
+Nulla volutpat mauris in magna posuere, in volutpat turpis pulvinar.
+Mauris semper ante non maximus vulputate.
+Fusce sollicitudin justo ut arcu blandit, id feugiat ex rhoncus.
+Suspendisse lacinia nisl sit amet vestibulum varius.
+Sed vestibulum erat in urna tempus mollis.
+Aliquam varius lectus eget dui consequat, sed aliquet diam ultricies.
+Sed a lectus a orci blandit accumsan.
+Etiam eu augue ac ipsum tempus lobortis at vitae nibh.
+elementum nunc in massa fringilla, sit amet iaculis elit blandit.
+Nam et nulla fermentum ligula laoreet malesuada sed nec risus.
+Pellentesque maximus velit non massa faucibus, vel aliquam ante pharetra.
+Aenean mattis justo quis porta porttitor.
+Donec dignissim ligula et pretium feugiat.
diff --git a/OTHERS/PyDiff/pydiff.py b/OTHERS/PyDiff/pydiff.py
new file mode 100644
index 00000000..df581bdc
--- /dev/null
+++ b/OTHERS/PyDiff/pydiff.py
@@ -0,0 +1,118 @@
+#!/usr/bin/env python3
+
+import argparse
+
+
+class Colors:
+ HEADER = '\033[95m'
+ OKBLUE = '\033[94m'
+ OKCYAN = '\033[96m'
+ OKGREEN = '\033[92m'
+ WARNING = '\033[93m'
+ FAIL = '\033[91m'
+ ENDC = '\033[0m'
+ BOLD = '\033[1m'
+ UNDERLINE = '\033[4m'
+
+
+ADD = "Add"
+REMOVE = "Remove"
+IGNORE = "Ignore"
+
+def print_matrix(m1, m2):
+ for i in range(len(m1) + 1):
+ for j in range(len(m2) + 1):
+ print(f"{m1[i][j]}({m2[i][j]})", end=", ")
+ print()
+
+
+def main():
+ parser = argparse.ArgumentParser()
+ parser.add_argument("file1")
+ parser.add_argument("file2")
+ args = parser.parse_args()
+
+ file1 = args.file1
+ file2 = args.file2
+
+ with open(file1, 'r') as f:
+ file_content1 = f.read()
+
+ with open(file2, 'r') as f:
+ file_content2 = f.read()
+
+ lines1 = file_content1.splitlines()
+ lines2 = file_content2.splitlines()
+
+ n = len(lines1)
+ m = len(lines2)
+
+ distances = [[0 for _ in range(m + 1)] for _ in range(n + 1)]
+ action = [['0' for _ in range(m + 1)] for _ in range(n + 1)]
+
+ distances[0][0] = 0
+ action[0][0] = IGNORE
+
+ for j in range(1, m + 1):
+ i = 0
+ distances[i][j] = j
+ action[i][j] = ADD
+
+ for i in range(1, n + 1):
+ j = 0
+ distances[i][j] = i
+ action[i][j] = REMOVE
+
+ for i in range(1, n + 1):
+ for j in range(1, m + 1):
+ if lines1[i - 1] == lines2[j - 1]:
+ action[i][j] = IGNORE
+ distances[i][j] = distances[i - 1][j - 1]
+ continue
+
+ removeOps = distances[i - 1][j]
+ addOps = distances[i][j - 1]
+
+ distances[i][j] = removeOps
+ action[i][j] = REMOVE
+
+ if distances[i][j] > addOps:
+ distances[i][j] = addOps
+ action[i][j] = ADD
+
+ distances[i][j] += 1
+
+ i = n
+ j = m
+ res = []
+
+ while i > 0 and j > 0:
+ _action = action[i][j]
+ if _action == IGNORE:
+ i -= 1
+ j -= 1
+ elif _action == ADD:
+ j -= 1
+ res.append((file2, ADD, j + 1, lines2[j]))
+ elif _action == REMOVE:
+ i -= 1
+ res.append((file1, REMOVE, i + 1, lines1[i]))
+ else:
+ raise Exception("Unhandled action")
+
+ if not res:
+ print(f"{Colors.HEADER}They are the same :){Colors.ENDC}")
+ exit(0)
+
+ for (fname, ac, lineno, line) in res:
+ if ac == ADD:
+ print(fr"{Colors.HEADER}{fname}{Colors.ENDC} | {
+ Colors.OKGREEN}+ {lineno} | {line}{Colors.ENDC}")
+
+ elif ac == REMOVE:
+ print(fr"{Colors.HEADER}{fname}{Colors.ENDC} | {
+ Colors.FAIL}- {lineno} | {line}{Colors.ENDC}")
+
+
+if __name__ == "__main__":
+ main()
diff --git a/PYTHON APPS/CLI-Based-TODO/task.py b/PYTHON APPS/CLI-Based-TODO/task.py
old mode 100644
new mode 100755
index aff9a122..07cacb4c
--- a/PYTHON APPS/CLI-Based-TODO/task.py
+++ b/PYTHON APPS/CLI-Based-TODO/task.py
@@ -1,117 +1,145 @@
-import time,os,sys
+#!/usr/bin/env python3
+# Python todo list
-usage = "Usage :-\n$ ./task add 2 'hello world' # Add a new item with priority 2 and text \"hello world\" to the list\n$ ./task ls # Show incomplete priority list items sorted by priority in ascending order\n$ ./task del INDEX # Delete the incomplete item with the given index\n$ ./task done INDEX # Mark the incomplete item with the given index as complete\n$ ./task help # Show usage\n$ ./task report # Statistics ( list complete/incomplete task )"
-
-def func():
- try:
-
- # printing help
- if sys.argv[1]=="help":
- print(usage)
- return usage
-
- # lisiting all the task
- if sys.argv[1]=="ls":
- try:
- f = open("path/to/plans/task.txt",'r')
- data = f.read()
- datalist = data.split("\n")
- datalist = sorted(datalist)
- datalist = datalist[1:]
- # print(datalist)
- for i in range(len(datalist)):
- print(f"{i+1}. {datalist[i][2:]} [{datalist[i][0:1]}]")
-
- except:
- print("Error: Missing file")
+import os
+from argparse import ArgumentParser as aparse
+# change the path of the files here to the actual desired paths
+taskTxt = "task.txt"
+completedTxt = "completed.txt"
+def create_parser():
+ parser = aparse(description="""Command Line task list""")
+ parser.add_argument("toDo", default="ls", choices=['usage', 'ls', 'add', 'del', 'done', 'report'], help="Enter command: usage, ls, add, del, done, report.")
+ parser.add_argument("-p", required=False, type=int, help="item priority")
+ parser.add_argument("-i", required=False, type=str, help="List item to add, remove, or mark done.")
+ return parser
- # adding the task
- if sys.argv[1]=="add":
- try:
- with open("path/to/plans/task.txt",'a',encoding = 'utf-8') as f:
- res = f.write(f"{sys.argv[2]} {sys.argv[3]}\n")
- except:
- print("Error: Missing tasks string. Nothing added!")
- else:
- print(f"Added task: \"{sys.argv[3]}\" with priority {sys.argv[2]}")
-
-
-
- # deleting the task
- if sys.argv[1]=="del":
- lineno = int(sys.argv[2])
- try:
- with open("path/to/plans/task.txt","r+") as f:
- new_f = f.readlines()
- new_f = sorted(new_f)
- # print(new_f)
- del_f = new_f.pop(lineno-1)
- # print(new_f)
-
- f.seek(0)
- for line in new_f:
- if del_f not in line:
- f.write(line)
- f.truncate()
- except:
- print(f"Error: item with index {lineno} does not exist. Nothing deleted.")
-
-
-
- # marking done
- if sys.argv[1]=="done":
- lineno = int(sys.argv[2])
+def func():
+ args = create_parser().parse_args()
+
+ # check if files exist, create if not
+ if not os.path.exists(taskTxt):
+ with open(taskTxt, "w") as filet:
+ pass
+
+ if not os.path.exists(completedTxt):
+ with open(completedTxt, "w") as filec:
+ pass
+
+ if args.toDo == "ls":
+ lister(read_list())
+
+ # adding the task
+ if args.toDo == "add":
+ if args.i == '' or args.p == '':
+ raise ValueError('An item and priority must be entered')
+ taskList = read_list()
+ taskList.insert((args.p - 1), args.i)
+ with open(taskTxt, "w") as f:
+ for line in taskList:
+ f.write(line + "\n")
+
+
+ # deleting the task
+ if args.toDo == "del":
+ if args.i == '' or args.p == '':
+ raise ValueError('An item or priority must be entered')
+ taskList = read_list()
+ if args.p:
+ index = args.p - 1
+ delete_item(index, taskList)
+ else:
try:
- with open("path/to/plans/task.txt","r+") as f:
- new_f = f.readlines()
- new_f = sorted(new_f)
- # print(new_f)
- del_f = new_f.pop(lineno-1)
- # print(new_f)
-
- f.seek(0)
- for line in new_f:
- if del_f not in line:
- f.write(line)
- with open("path/to/plans/completed.txt","a") as r:
- r.write(del_f)
- f.truncate()
-
-
-
- except:
- print(f"Error: no incomplete item with index #0 exists.")
- else:
- print(f"Marked item as done.")
-
-
- # generating the report
- if sys.argv[1]=="report":
+ index = taskList.index(args.i)
+ delete_item(index, taskList)
+ exit(0)
+ except(ValueError):
+ print(f"Item {args.i} not found. Maybe run ls and try again?")
+ exit(0)
+
+ # marking done
+ if args.toDo == "done":
+ if args.i == '' or args.p == '':
+ raise ValueError('An item or priority must be entered')
+ taskList = read_list()
+ if args.p:
+ index = args.p - 1
+ do_item(index, taskList)
+ else:
try:
- task = open("path/to/plans/task.txt",'r')
- data = task.read()
- datalist = data.split("\n")
- datalist = sorted(datalist)
- datalist = datalist[1:]
- print(f"Pending : {len(datalist)}")
- for i in range(len(datalist)):
- print(f"{i+1}. {datalist[i][2:]} [{datalist[i][0:1]}]")
-
- compt = open("path/to/plans/completed.txt",'r')
- data = compt.read()
- datalist = data.split("\n")
- datalist = sorted(datalist)
- datalist = datalist[1:]
- print(f"Completed : {len(datalist)}")
- for i in range(len(datalist)):
- print(f"{i+1}. {datalist[i][2:]} [{datalist[i][0:1]}]")
- except:
- print("Error: Missing file")
-
- except:
- print(usage)
- return usage.encode('utf8')
-
-func()
\ No newline at end of file
+ index = taskList.index(args.i)
+ do_item(index, taskList)
+ exit(0)
+ except(ValueError):
+ print(f"Item {args.i} not found. Maybe run ls and try again?")
+ exit(0)
+
+ # generating the report
+ if args.toDo == "report":
+ print("\n")
+ print("To do:")
+ lister(read_list())
+ print("\n")
+ print("Done:")
+ lister(read_complete())
+
+def read_list():
+ with open(taskTxt, "r") as file:
+ task_list = file.readlines()
+ # all the newlines added during file writing must be removed otherwise printing is messed up
+ strip_list = []
+ for item in task_list:
+ strip_list.append(item.strip())
+ filtered_list = [item for item in strip_list if item != ""]
+ return filtered_list
+
+def read_complete():
+ with open(completedTxt, "r") as file:
+ completed_list = file.readlines()
+ # all the newlines added during file writing must be removed otherwise printing is messed up
+ strip_list = []
+ for item in completed_list:
+ strip_list.append(item.strip())
+ filtered_list = [item for item in strip_list if item != ""]
+ return filtered_list
+
+def delete_item(index, taskList):
+ print("\n")
+ print(f"Do you want to delete {taskList[index]}?")
+ answer = input("Enter y or n: ")
+ if answer == "y":
+ taskList.pop(index)
+ with open(taskTxt, "w") as f:
+ for line in taskList:
+ f.write(line + "\n")
+ print("Item Deleted")
+ exit(0)
+ print("No item deleted")
+ exit(0)
+
+def do_item(index, taskList):
+ print("\n")
+ print(f"Do you want to move {taskList[index]} to done?")
+ answer = input("Enter y or n: ")
+ if answer == "y":
+ task = taskList.pop(index)
+ with open(taskTxt, "w") as f:
+ for line in taskList:
+ f.write(line + "\n")
+ completed = read_complete()
+ completed.append(task)
+ with open(completedTxt, "w") as f:
+ for line in completed:
+ f.write(line + "\n")
+ print("Item marked done")
+ exit(0)
+ print("No item changed")
+ exit(0)
+
+def lister(items):
+ for item, line in enumerate(items, 1):
+ print(f"{item}: {line.strip()}")
+
+if __name__ == "__main__":
+ func()
diff --git a/PYTHON APPS/CLI-Based-TODO/time,os,sys b/PYTHON APPS/CLI-Based-TODO/time,os,sys
new file mode 100644
index 00000000..e69de29b
diff --git a/PYTHON APPS/ResolutionSwapper/Readme.md b/PYTHON APPS/ResolutionSwapper/Readme.md
new file mode 100644
index 00000000..ebd6eeb2
--- /dev/null
+++ b/PYTHON APPS/ResolutionSwapper/Readme.md
@@ -0,0 +1,21 @@
+# Resolution
+This is a small application for switching monitor resolution without having to go into your computer settings. Very useful if you have an older system, and are having trouble running newer/more demanding games.
+
+# Prerequisites
+pywintypes
+win32con
+win32api
+time
+Pyinstaller (optional, but recommended)
+
+# Usage
+This app currently features 720p, 1080p and 1440p resolutions. If you wish to add more, add them in the same format as the other resolutions. The number is a string, so you could choose to set the input to letters if that is your preference.
+
+When run, the app will create a popup terminal for you to enter the resolution you want. It will first check if what you input is valid, then set your monitor's resolution based on the preset dimensions.
+
+# Export to exe
+ For ease of use, I'd recommend exporting this to an exe using pyinstaller.
+ Instructions for this can be found here -
+ ```https://pyinstaller.org/en/stable/usage.html```
+From there, create a shortcut to have it on your taskbar. To set the image, you can use any image you choose, but it will need to be in a .ico format. You can find converters to make these from other formats online.
+That done, simply click on the icon, then enter your resolution in the terminal popup (only the width).
diff --git a/PYTHON APPS/ResolutionSwapper/ResolutionMulti.py b/PYTHON APPS/ResolutionSwapper/ResolutionMulti.py
new file mode 100644
index 00000000..ff38e433
--- /dev/null
+++ b/PYTHON APPS/ResolutionSwapper/ResolutionMulti.py
@@ -0,0 +1,30 @@
+import pywintypes
+import win32con
+import win32api
+import time
+
+
+devmode = pywintypes.DEVMODEType()
+valid = 0
+while valid == 0:
+ heightinp = input('Set resolution: -- ')
+ if heightinp in ['720','1080','1440']:
+ valid += 1
+ else:
+ print('Invalid resolution. Please try again')
+ time.sleep(2)
+
+
+if heightinp == '720':
+ devmode.PelsWidth = 1280
+ devmode.PelsHeight =720
+if heightinp == '1080':
+ devmode.PelsWidth = 1920
+ devmode.PelsHeight =1080
+if heightinp == '1440':
+ devmode.PelsWidth = 2560
+ devmode.PelsHeight = 1440
+
+devmode.Fields = win32con.DM_PELSWIDTH | win32con.DM_PELSHEIGHT
+
+win32api.ChangeDisplaySettings(devmode, 0)
diff --git a/README.md b/README.md
index d8b51d9f..f664078e 100644
--- a/README.md
+++ b/README.md
@@ -113,12 +113,16 @@ guide [HERE](https://github.com/larymak/Python-project-Scripts/blob/main/CONTRIB
| 64 | [Umbrella Reminder](https://github.com/larymak/Python-project-Scripts/tree/main/TIME%20SCRIPTS/Umbrella%20Reminder) | [Edula Vinay Kumar Reddy](https://github.com/vinayedula) |
| 65 | [Image to PDF](https://github.com/larymak/Python-project-Scripts/tree/main/IMAGES%20%26%20PHOTO%20SCRIPTS/Image%20to%20PDF) | [Vedant Chainani](https://github.com/Envoy-VC) |
| 66 | [KeyLogger](https://github.com/larymak/Python-project-Scripts/tree/main/OTHERS/KeyLogger) | [Akhil](https://github.com/akhil-chagarlamudi) |
-| 67 | [PDF Text Extractor](https://github.com/SamAddy/Python-project-Scripts/tree/main/PYTHON%20APPS/PDF-Text-Extractor) | [Samuel Addison](https://github.com/SamAddy)
-| 68 | [Analyze docx file](https://github.com/larymak/Python-project-Scripts/tree/main/AUTOMATION/analyzing%20and%20writing%20.docx%20file) | [Kashaan Mahmood](https://github.com/Kashaan-M)
-| 69 | [Bitcoin Price](https://github.com/larymak/Python-project-Scripts/tree/main/WEB%20SCRAPING/Bitcoin%20Price) | [Olu-Olagbuji Delight](https://github.com/Dheelyte)
-| 70 | [Password Generator](https://github.com/larymak/Python-project-Scripts/tree/main/GUI/Password%20Generator) | [LpCodes](https://github.com/LpCodes)
-| 71 | [HTML to Excel](https://github.com/larymak/Python-project-Scripts/tree/main/CONVERSION%20SCRIPTS/HTML%20to%20Excel) | [LpCodes](https://github.com/LpCodes)
+| 67 | [PDF Text Extractor](https://github.com/SamAddy/Python-project-Scripts/tree/main/PYTHON%20APPS/PDF-Text-Extractor) | [Samuel Addison](https://github.com/SamAddy)|
+| 68 | [Analyze docx file](https://github.com/larymak/Python-project-Scripts/tree/main/AUTOMATION/analyzing%20and%20writing%20.docx%20file) | [Kashaan Mahmood](https://github.com/Kashaan-M)|
+| 69 | [Bitcoin Price](https://github.com/larymak/Python-project-Scripts/tree/main/WEB%20SCRAPING/Bitcoin%20Price) | [Olu-Olagbuji Delight](https://github.com/Dheelyte) |
+| 70 | [Password Generator](https://github.com/larymak/Python-project-Scripts/tree/main/GUI/Password%20Generator) | [LpCodes](https://github.com/LpCodes) |
+| 71 | [HTML to Excel](https://github.com/larymak/Python-project-Scripts/tree/main/CONVERSION%20SCRIPTS/HTML%20to%20Excel) | [LpCodes](https://github.com/LpCodes) |
| 72 | [Star pattern](https://github.com/larymak/Python-project-Scripts/tree/main/OTHERS/Star%20pattern) | [LpCodes](https://github.com/LpCodes) |
| 73 | [Logging Helper](https://github.com/larymak/Python-project-Scripts/tree/main/OTHERS/add-multiprocessing-logger) | [Jerry W.](https://github.com/Jerry0420) |
| 74 | [Notepad](https://github.com/larymak/Python-project-Scripts/tree/main/PYTHON%20APPS/Notepad) | [Annarhysa Albert](https://github.com/Annarhysa) |
| 75 | [Quadratic Equation Solver](https://github.com/larymak/Python-project-Scripts/tree/main/GUI/Quadratic-Equation-Solver) | [Akinfenwa Ezekiel](https://github.com/Ezek-iel) |
+| 76 | [Internet Connectivity Monitor](https://github.com/larymak/Python-project-Scripts/tree/main/AUTOMATION/InternetConnectivityMonitor) | [Prince Khunt](https://github.com/princekhunt) |
+| 76 | [E-commerce](https://github.com/larymak/Python-project-Scripts/tree/main/FLASK%20PROJECTS/E-commerce) | [Eter Nada](https://github.com/tarenjk24) |
+| 77 | [Resolution Swapper](https://github.com/larymak/Python-project-Scripts/tree/main/PYTHON%20APPS/ResolutionSwapper) | [KnightBlue](https://github.com/KnightBlue14) |
+| 78 | [Anniversary time](https://github.com/larymak/Python-project-Scripts/tree/main/FLASK%20PROJECTS/Anniversary%20time) | [gyyzzz](https://github.com/gyyzzz) |
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/README.md b/SYSTEM MANAGEMENT APPS/Student_management_system/README.md
new file mode 100644
index 00000000..7b755caf
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/README.md
@@ -0,0 +1,103 @@
+# Student Management System
+
+## Overview
+
+The Student Management System is a simple web application designed to manage students' information using CRUD (Create, Read, Update, Delete) functionalities. It allows users to add, view, update, and delete student records. This project is built using Python and Django framework.
+
+## Features
+
+- Add new student records
+- View all student records
+- Update existing student records
+- Delete student records
+
+## Technologies Used
+
+- Python
+- Django
+- SQLite (default database for Django)
+- HTML/CSS and Bootstrap for frontend
+
+## Installation
+
+### Prerequisites
+
+- Python 3.x installed
+- Django installed (`pip install django`)
+
+### Steps
+
+1. **Clone the repository:**
+
+ ```sh
+ git clone https://github.com/yourusername/Student_management_system.git
+ cd Student_management_system
+ ```
+
+2. **Create a virtual environment and activate it:**
+
+ ```sh
+ python -m venv venv
+ source venv/bin/activate # On Windows, use `venv\Scripts\activate`
+ ```
+
+3. **Install dependencies:**
+
+ ```sh
+ pip install -r requirements.txt
+ ```
+
+4. **Run migrations:**
+
+ ```sh
+ python manage.py migrate
+ ```
+
+5. **Run the development server:**
+
+ ```sh
+ python manage.py runserver
+ ```
+
+6. **Access the application:**
+
+ Open your web browser and go to `http://127.0.0.1:8000`
+
+## Usage
+
+### Add a New Student
+
+1. Click on the "Add Student" link in the navigation tab.
+2. Fill out the form with the student's information.
+3. Click "Submit" to save the new student record.
+
+### View Students
+
+1. Click on the "View" button link in the students row.
+2. A students info will be displayed.
+
+### Update a Student
+
+1. Click on the "Edit" button link in the students row you want to update.
+2. Update the student's information in the form.
+3. Click "Submit" to save the changes.
+
+### Delete a Student
+
+1. Click on the "Delete" button link in the student row you want to delete.
+2. Confirm the deletion when prompted.
+
+## Contributing
+1. Fork the repository
+2. Create a new branch (git checkout -b feature-branch)
+3. Commit your changes (git commit -am 'Add new feature')
+4. Push to the branch (git push origin feature-branch)
+5. Create a new Pull Request
+
+## Contact
+If you have any questions or suggestions, feel free to open an issue or contact the project maintainers.
+
+
+This `README.md` file provides a clear overview of the project, how to install and run it, and how to use its features. Adjust the repository link and other details as needed for your specific project.
+
+
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/__init__.py b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/__init__.py
new file mode 100644
index 00000000..e69de29b
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/asgi.py b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/asgi.py
new file mode 100644
index 00000000..2be91e5f
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/asgi.py
@@ -0,0 +1,16 @@
+"""
+ASGI config for django_project project.
+
+It exposes the ASGI callable as a module-level variable named ``application``.
+
+For more information on this file, see
+https://docs.djangoproject.com/en/5.0/howto/deployment/asgi/
+"""
+
+import os
+
+from django.core.asgi import get_asgi_application
+
+os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'django_project.settings')
+
+application = get_asgi_application()
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/settings.py b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/settings.py
new file mode 100644
index 00000000..110a9114
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/settings.py
@@ -0,0 +1,124 @@
+"""
+Django settings for django_project project.
+
+Generated by 'django-admin startproject' using Django 5.0.4.
+
+For more information on this file, see
+https://docs.djangoproject.com/en/5.0/topics/settings/
+
+For the full list of settings and their values, see
+https://docs.djangoproject.com/en/5.0/ref/settings/
+"""
+
+from pathlib import Path
+
+# Build paths inside the project like this: BASE_DIR / 'subdir'.
+BASE_DIR = Path(__file__).resolve().parent.parent
+
+
+# Quick-start development settings - unsuitable for production
+# See https://docs.djangoproject.com/en/5.0/howto/deployment/checklist/
+
+# SECURITY WARNING: keep the secret key used in production secret!
+SECRET_KEY = 'django-insecure-weeft8nl5p-wz+)(k2ye)uo2xiepnd18w6nstud@bjt*bp+a7^'
+
+# SECURITY WARNING: don't run with debug turned on in production!
+DEBUG = True
+
+ALLOWED_HOSTS = []
+
+
+# Application definition
+
+INSTALLED_APPS = [
+ 'django.contrib.admin',
+ 'django.contrib.auth',
+ 'django.contrib.contenttypes',
+ 'django.contrib.sessions',
+ 'django.contrib.messages',
+ 'django.contrib.staticfiles',
+ 'students',
+]
+
+MIDDLEWARE = [
+ 'django.middleware.security.SecurityMiddleware',
+ 'django.contrib.sessions.middleware.SessionMiddleware',
+ 'django.middleware.common.CommonMiddleware',
+ 'django.middleware.csrf.CsrfViewMiddleware',
+ 'django.contrib.auth.middleware.AuthenticationMiddleware',
+ 'django.contrib.messages.middleware.MessageMiddleware',
+ 'django.middleware.clickjacking.XFrameOptionsMiddleware',
+]
+
+ROOT_URLCONF = 'django_project.urls'
+
+TEMPLATES = [
+ {
+ 'BACKEND': 'django.template.backends.django.DjangoTemplates',
+ 'DIRS': [],
+ 'APP_DIRS': True,
+ 'OPTIONS': {
+ 'context_processors': [
+ 'django.template.context_processors.debug',
+ 'django.template.context_processors.request',
+ 'django.contrib.auth.context_processors.auth',
+ 'django.contrib.messages.context_processors.messages',
+ ],
+ },
+ },
+]
+
+WSGI_APPLICATION = 'django_project.wsgi.application'
+
+
+# Database
+# https://docs.djangoproject.com/en/5.0/ref/settings/#databases
+
+DATABASES = {
+ 'default': {
+ 'ENGINE': 'django.db.backends.sqlite3',
+ 'NAME': BASE_DIR / 'db.sqlite3',
+ }
+}
+
+
+# Password validation
+# https://docs.djangoproject.com/en/5.0/ref/settings/#auth-password-validators
+
+AUTH_PASSWORD_VALIDATORS = [
+ {
+ 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator',
+ },
+ {
+ 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator',
+ },
+ {
+ 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator',
+ },
+ {
+ 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator',
+ },
+]
+
+
+# Internationalization
+# https://docs.djangoproject.com/en/5.0/topics/i18n/
+
+LANGUAGE_CODE = 'en-us'
+
+TIME_ZONE = 'UTC'
+
+USE_I18N = True
+
+USE_TZ = True
+
+
+# Static files (CSS, JavaScript, Images)
+# https://docs.djangoproject.com/en/5.0/howto/static-files/
+
+STATIC_URL = 'static/'
+
+# Default primary key field type
+# https://docs.djangoproject.com/en/5.0/ref/settings/#default-auto-field
+
+DEFAULT_AUTO_FIELD = 'django.db.models.BigAutoField'
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/urls.py b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/urls.py
new file mode 100644
index 00000000..6c1a4b31
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/urls.py
@@ -0,0 +1,23 @@
+"""
+URL configuration for django_project project.
+
+The `urlpatterns` list routes URLs to views. For more information please see:
+ https://docs.djangoproject.com/en/5.0/topics/http/urls/
+Examples:
+Function views
+ 1. Add an import: from my_app import views
+ 2. Add a URL to urlpatterns: path('', views.home, name='home')
+Class-based views
+ 1. Add an import: from other_app.views import Home
+ 2. Add a URL to urlpatterns: path('', Home.as_view(), name='home')
+Including another URLconf
+ 1. Import the include() function: from django.urls import include, path
+ 2. Add a URL to urlpatterns: path('blog/', include('blog.urls'))
+"""
+from django.contrib import admin
+from django.urls import path, include
+
+urlpatterns = [
+ path('admin/', admin.site.urls),
+ path('', include('students.urls')),
+]
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/wsgi.py b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/wsgi.py
new file mode 100644
index 00000000..e7493da9
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/django_project/wsgi.py
@@ -0,0 +1,16 @@
+"""
+WSGI config for django_project project.
+
+It exposes the WSGI callable as a module-level variable named ``application``.
+
+For more information on this file, see
+https://docs.djangoproject.com/en/5.0/howto/deployment/wsgi/
+"""
+
+import os
+
+from django.core.wsgi import get_wsgi_application
+
+os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'django_project.settings')
+
+application = get_wsgi_application()
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/manage.py b/SYSTEM MANAGEMENT APPS/Student_management_system/manage.py
new file mode 100755
index 00000000..5ffd8de1
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/manage.py
@@ -0,0 +1,22 @@
+#!/usr/bin/env python
+"""Django's command-line utility for administrative tasks."""
+import os
+import sys
+
+
+def main():
+ """Run administrative tasks."""
+ os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'django_project.settings')
+ try:
+ from django.core.management import execute_from_command_line
+ except ImportError as exc:
+ raise ImportError(
+ "Couldn't import Django. Are you sure it's installed and "
+ "available on your PYTHONPATH environment variable? Did you "
+ "forget to activate a virtual environment?"
+ ) from exc
+ execute_from_command_line(sys.argv)
+
+
+if __name__ == '__main__':
+ main()
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/requirements.txt b/SYSTEM MANAGEMENT APPS/Student_management_system/requirements.txt
new file mode 100644
index 00000000..3cd4051a
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/requirements.txt
@@ -0,0 +1,4 @@
+asgiref==3.8.1
+Django==5.0.4
+sqlparse==0.5.0
+typing_extensions==4.11.0
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/__init__.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/__init__.py
new file mode 100644
index 00000000..e69de29b
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/admin.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/admin.py
new file mode 100644
index 00000000..1bb8d4a1
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/admin.py
@@ -0,0 +1,5 @@
+from django.contrib import admin
+from .models import Student
+
+# Register your models here.
+admin.site.register(Student)
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/apps.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/apps.py
new file mode 100644
index 00000000..c242c4de
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/apps.py
@@ -0,0 +1,6 @@
+from django.apps import AppConfig
+
+
+class StudentsConfig(AppConfig):
+ default_auto_field = 'django.db.models.BigAutoField'
+ name = 'students'
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/forms.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/forms.py
new file mode 100644
index 00000000..911eaeab
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/forms.py
@@ -0,0 +1,23 @@
+from django import forms
+from .models import Student
+
+class StudentForm(forms.ModelForm):
+ class Meta:
+ model = Student
+ fields = ['student_number', 'first_name', 'last_name', 'email', 'field_of_study', 'gpa']
+ labels = {
+ 'student_number': 'Student Number',
+ 'first_name': 'First Name',
+ 'last_name': 'Last Name',
+ 'email': 'Email',
+ 'field_of_study': 'Field of Study',
+ 'gpa': 'GPA'
+ }
+ widgets = {
+ 'student_number': forms.NumberInput(attrs={'class': 'form-control'}),
+ 'first_name': forms.TextInput(attrs={'class': 'form-control'}),
+ 'last_name': forms.TextInput(attrs={'class': 'form-control'}),
+ 'email': forms.EmailInput(attrs={'class': 'form-control'}),
+ 'field_of_study': forms.TextInput(attrs={'class': 'form-control'}),
+ 'gpa': forms.NumberInput(attrs={'class': 'form-control'}),
+ }
\ No newline at end of file
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/migrations/0001_initial.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/migrations/0001_initial.py
new file mode 100644
index 00000000..47deea3c
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/migrations/0001_initial.py
@@ -0,0 +1,26 @@
+# Generated by Django 5.0.4 on 2024-04-15 15:16
+
+from django.db import migrations, models
+
+
+class Migration(migrations.Migration):
+
+ initial = True
+
+ dependencies = [
+ ]
+
+ operations = [
+ migrations.CreateModel(
+ name='Student',
+ fields=[
+ ('id', models.BigAutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),
+ ('student_number', models.PositiveIntegerField()),
+ ('first_name', models.CharField(max_length=50)),
+ ('last_name', models.CharField(max_length=50)),
+ ('email', models.EmailField(max_length=100)),
+ ('field_of_study', models.CharField(max_length=50)),
+ ('gpa', models.FloatField()),
+ ],
+ ),
+ ]
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/migrations/__init__.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/migrations/__init__.py
new file mode 100644
index 00000000..e69de29b
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/models.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/models.py
new file mode 100644
index 00000000..d4756919
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/models.py
@@ -0,0 +1,13 @@
+from django.db import models
+
+# Create your models here.
+class Student(models.Model):
+ student_number = models.PositiveIntegerField()
+ first_name = models.CharField(max_length=50)
+ last_name = models.CharField(max_length=50)
+ email = models.EmailField(max_length=100)
+ field_of_study = models.CharField(max_length=50)
+ gpa = models.FloatField()
+
+ def __str__(self):
+ return f'Student: {self.first_name} {self.last_name}'
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/static/css/bootstrap.min.css b/SYSTEM MANAGEMENT APPS/Student_management_system/students/static/css/bootstrap.min.css
new file mode 100644
index 00000000..a5833054
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/static/css/bootstrap.min.css
@@ -0,0 +1,12 @@
+@charset "UTF-8";/*!
+ * Bootswatch v5.3.3 (https://bootswatch.com)
+ * Theme: zephyr
+ * Copyright 2012-2024 Thomas Park
+ * Licensed under MIT
+ * Based on Bootstrap
+*//*!
+ * Bootstrap v5.3.3 (https://getbootstrap.com/)
+ * Copyright 2011-2024 The Bootstrap Authors
+ * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
+ */@import url(https://fonts.googleapis.com/css2?family=Inter:wght@400;500;700&display=swap);:root,[data-bs-theme=light]{--bs-blue:#3459e6;--bs-indigo:#6610f2;--bs-purple:#6f42c1;--bs-pink:#d63384;--bs-red:#da292e;--bs-orange:#f8765f;--bs-yellow:#f4bd61;--bs-green:#2fb380;--bs-teal:#20c997;--bs-cyan:#287bb5;--bs-black:#000;--bs-white:#fff;--bs-gray:#6c757d;--bs-gray-dark:#343a40;--bs-gray-100:#f8f9fa;--bs-gray-200:#e9ecef;--bs-gray-300:#dee2e6;--bs-gray-400:#ced4da;--bs-gray-500:#adb5bd;--bs-gray-600:#6c757d;--bs-gray-700:#495057;--bs-gray-800:#343a40;--bs-gray-900:#212529;--bs-primary:#3459e6;--bs-secondary:#fff;--bs-success:#2fb380;--bs-info:#287bb5;--bs-warning:#f4bd61;--bs-danger:#da292e;--bs-light:#f8f9fa;--bs-dark:#212529;--bs-primary-rgb:52,89,230;--bs-secondary-rgb:255,255,255;--bs-success-rgb:47,179,128;--bs-info-rgb:40,123,181;--bs-warning-rgb:244,189,97;--bs-danger-rgb:218,41,46;--bs-light-rgb:248,249,250;--bs-dark-rgb:33,37,41;--bs-primary-text-emphasis:#15245c;--bs-secondary-text-emphasis:#666666;--bs-success-text-emphasis:#134833;--bs-info-text-emphasis:#103148;--bs-warning-text-emphasis:#624c27;--bs-danger-text-emphasis:#571012;--bs-light-text-emphasis:#495057;--bs-dark-text-emphasis:#495057;--bs-primary-bg-subtle:#d6defa;--bs-secondary-bg-subtle:white;--bs-success-bg-subtle:#d5f0e6;--bs-info-bg-subtle:#d4e5f0;--bs-warning-bg-subtle:#fdf2df;--bs-danger-bg-subtle:#f8d4d5;--bs-light-bg-subtle:#fcfcfd;--bs-dark-bg-subtle:#ced4da;--bs-primary-border-subtle:#aebdf5;--bs-secondary-border-subtle:white;--bs-success-border-subtle:#ace1cc;--bs-info-border-subtle:#a9cae1;--bs-warning-border-subtle:#fbe5c0;--bs-danger-border-subtle:#f0a9ab;--bs-light-border-subtle:#e9ecef;--bs-dark-border-subtle:#adb5bd;--bs-white-rgb:255,255,255;--bs-black-rgb:0,0,0;--bs-font-sans-serif:Inter,-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,"Helvetica Neue",Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";--bs-font-monospace:SFMono-Regular,Menlo,Monaco,Consolas,"Liberation Mono","Courier New",monospace;--bs-gradient:linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family:var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight:400;--bs-body-line-height:1.5;--bs-body-color:#495057;--bs-body-color-rgb:73,80,87;--bs-body-bg:#fff;--bs-body-bg-rgb:255,255,255;--bs-emphasis-color:#000;--bs-emphasis-color-rgb:0,0,0;--bs-secondary-color:rgba(73, 80, 87, 0.75);--bs-secondary-color-rgb:73,80,87;--bs-secondary-bg:#e9ecef;--bs-secondary-bg-rgb:233,236,239;--bs-tertiary-color:rgba(73, 80, 87, 0.5);--bs-tertiary-color-rgb:73,80,87;--bs-tertiary-bg:#f8f9fa;--bs-tertiary-bg-rgb:248,249,250;--bs-heading-color:var(--bs-primary-color);--bs-link-color:#3459e6;--bs-link-color-rgb:52,89,230;--bs-link-decoration:underline;--bs-link-hover-color:#2a47b8;--bs-link-hover-color-rgb:42,71,184;--bs-code-color:#d63384;--bs-highlight-color:#495057;--bs-highlight-bg:#fdf2df;--bs-border-width:1px;--bs-border-style:solid;--bs-border-color:#dee2e6;--bs-border-color-translucent:rgba(0, 0, 0, 0.175);--bs-border-radius:0.375rem;--bs-border-radius-sm:0.25rem;--bs-border-radius-lg:0.5rem;--bs-border-radius-xl:1rem;--bs-border-radius-xxl:2rem;--bs-border-radius-2xl:var(--bs-border-radius-xxl);--bs-border-radius-pill:50rem;--bs-box-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-box-shadow-sm:0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-box-shadow-lg:0 1px 3px 0 rgba(0, 0, 0, 0.1),0 1px 2px 0 rgba(0, 0, 0, 0.06);--bs-box-shadow-inset:inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-focus-ring-width:0.25rem;--bs-focus-ring-opacity:0.25;--bs-focus-ring-color:rgba(52, 89, 230, 0.25);--bs-form-valid-color:#2fb380;--bs-form-valid-border-color:#2fb380;--bs-form-invalid-color:#da292e;--bs-form-invalid-border-color:#da292e}[data-bs-theme=dark]{color-scheme:dark;--bs-body-color:#dee2e6;--bs-body-color-rgb:222,226,230;--bs-body-bg:#212529;--bs-body-bg-rgb:33,37,41;--bs-emphasis-color:#fff;--bs-emphasis-color-rgb:255,255,255;--bs-secondary-color:rgba(222, 226, 230, 0.75);--bs-secondary-color-rgb:222,226,230;--bs-secondary-bg:#343a40;--bs-secondary-bg-rgb:52,58,64;--bs-tertiary-color:rgba(222, 226, 230, 0.5);--bs-tertiary-color-rgb:222,226,230;--bs-tertiary-bg:#2b3035;--bs-tertiary-bg-rgb:43,48,53;--bs-primary-text-emphasis:#859bf0;--bs-secondary-text-emphasis:white;--bs-success-text-emphasis:#82d1b3;--bs-info-text-emphasis:#7eb0d3;--bs-warning-text-emphasis:#f8d7a0;--bs-danger-text-emphasis:#e97f82;--bs-light-text-emphasis:#f8f9fa;--bs-dark-text-emphasis:#dee2e6;--bs-primary-bg-subtle:#0a122e;--bs-secondary-bg-subtle:#333333;--bs-success-bg-subtle:#09241a;--bs-info-bg-subtle:#081924;--bs-warning-bg-subtle:#312613;--bs-danger-bg-subtle:#2c0809;--bs-light-bg-subtle:#343a40;--bs-dark-bg-subtle:#1a1d20;--bs-primary-border-subtle:#1f358a;--bs-secondary-border-subtle:#999999;--bs-success-border-subtle:#1c6b4d;--bs-info-border-subtle:#184a6d;--bs-warning-border-subtle:#92713a;--bs-danger-border-subtle:#83191c;--bs-light-border-subtle:#495057;--bs-dark-border-subtle:#343a40;--bs-heading-color:inherit;--bs-link-color:#859bf0;--bs-link-hover-color:#9daff3;--bs-link-color-rgb:133,155,240;--bs-link-hover-color-rgb:157,175,243;--bs-code-color:#e685b5;--bs-highlight-color:#dee2e6;--bs-highlight-bg:#624c27;--bs-border-color:#495057;--bs-border-color-translucent:rgba(255, 255, 255, 0.15);--bs-form-valid-color:#82d1b3;--bs-form-valid-border-color:#82d1b3;--bs-form-invalid-color:#e97f82;--bs-form-invalid-border-color:#e97f82}*,::after,::before{box-sizing:border-box}@media (prefers-reduced-motion:no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:transparent}hr{margin:1rem 0;color:inherit;border:0;border-top:var(--bs-border-width) solid;opacity:.25}.h1,.h2,.h3,.h4,.h5,.h6,h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2;color:var(--bs-heading-color)}.h1,h1{font-size:calc(1.375rem + 1.5vw)}@media (min-width:1200px){.h1,h1{font-size:2.5rem}}.h2,h2{font-size:calc(1.325rem + .9vw)}@media (min-width:1200px){.h2,h2{font-size:2rem}}.h3,h3{font-size:calc(1.3rem + .6vw)}@media (min-width:1200px){.h3,h3{font-size:1.75rem}}.h4,h4{font-size:calc(1.275rem + .3vw)}@media (min-width:1200px){.h4,h4{font-size:1.5rem}}.h5,h5{font-size:1.25rem}.h6,h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{-webkit-text-decoration:underline dotted;text-decoration:underline dotted;cursor:help;-webkit-text-decoration-skip-ink:none;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}dl,ol,ul{margin-top:0;margin-bottom:1rem}ol ol,ol ul,ul ol,ul ul{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}.small,small{font-size:.875em}.mark,mark{padding:.1875em;color:var(--bs-highlight-color);background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}a{color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,1));text-decoration:underline}a:hover{--bs-link-color-rgb:var(--bs-link-hover-color-rgb)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}code,kbd,pre,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:1rem;padding-bottom:1rem;color:var(--bs-secondary-color);text-align:left}th{font-weight:500;text-align:inherit;text-align:-webkit-match-parent}tbody,td,tfoot,th,thead,tr{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}button,input,optgroup,select,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none!important}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled),button:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + .3vw);line-height:inherit}@media (min-width:1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-text,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::-webkit-file-upload-button{font:inherit;-webkit-appearance:button}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none!important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media (min-width:1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:var(--bs-body-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);box-shadow:var(--bs-box-shadow-sm);max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:.875em;color:var(--bs-secondary-color)}.container,.container-fluid,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{--bs-gutter-x:1.5rem;--bs-gutter-y:0;width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-right:auto;margin-left:auto}@media (min-width:576px){.container,.container-sm{max-width:540px}}@media (min-width:768px){.container,.container-md,.container-sm{max-width:720px}}@media (min-width:992px){.container,.container-lg,.container-md,.container-sm{max-width:960px}}@media (min-width:1200px){.container,.container-lg,.container-md,.container-sm,.container-xl{max-width:1140px}}@media (min-width:1400px){.container,.container-lg,.container-md,.container-sm,.container-xl,.container-xxl{max-width:1320px}}:root{--bs-breakpoint-xs:0;--bs-breakpoint-sm:576px;--bs-breakpoint-md:768px;--bs-breakpoint-lg:992px;--bs-breakpoint-xl:1200px;--bs-breakpoint-xxl:1400px}.row{--bs-gutter-x:1.5rem;--bs-gutter-y:0;display:flex;flex-wrap:wrap;margin-top:calc(-1 * var(--bs-gutter-y));margin-right:calc(-.5 * var(--bs-gutter-x));margin-left:calc(-.5 * var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x) * .5);padding-left:calc(var(--bs-gutter-x) * .5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.66666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x:0}.g-0,.gy-0{--bs-gutter-y:0}.g-1,.gx-1{--bs-gutter-x:0.25rem}.g-1,.gy-1{--bs-gutter-y:0.25rem}.g-2,.gx-2{--bs-gutter-x:0.5rem}.g-2,.gy-2{--bs-gutter-y:0.5rem}.g-3,.gx-3{--bs-gutter-x:1rem}.g-3,.gy-3{--bs-gutter-y:1rem}.g-4,.gx-4{--bs-gutter-x:1.5rem}.g-4,.gy-4{--bs-gutter-y:1.5rem}.g-5,.gx-5{--bs-gutter-x:3rem}.g-5,.gy-5{--bs-gutter-y:3rem}@media (min-width:576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.66666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x:0}.g-sm-0,.gy-sm-0{--bs-gutter-y:0}.g-sm-1,.gx-sm-1{--bs-gutter-x:0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y:0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x:0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y:0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x:1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y:1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x:1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y:1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x:3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y:3rem}}@media (min-width:768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.66666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x:0}.g-md-0,.gy-md-0{--bs-gutter-y:0}.g-md-1,.gx-md-1{--bs-gutter-x:0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y:0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x:0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y:0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x:1rem}.g-md-3,.gy-md-3{--bs-gutter-y:1rem}.g-md-4,.gx-md-4{--bs-gutter-x:1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y:1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x:3rem}.g-md-5,.gy-md-5{--bs-gutter-y:3rem}}@media (min-width:992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.66666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x:0}.g-lg-0,.gy-lg-0{--bs-gutter-y:0}.g-lg-1,.gx-lg-1{--bs-gutter-x:0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y:0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x:0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y:0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x:1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y:1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x:1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y:1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x:3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y:3rem}}@media (min-width:1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.66666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x:0}.g-xl-0,.gy-xl-0{--bs-gutter-y:0}.g-xl-1,.gx-xl-1{--bs-gutter-x:0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y:0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x:0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y:0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x:1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y:1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x:1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y:1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x:3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y:3rem}}@media (min-width:1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.33333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.66666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x:0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y:0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x:0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y:0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x:0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y:0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x:1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y:1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x:1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y:1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x:3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y:3rem}}.table{--bs-table-color-type:initial;--bs-table-bg-type:initial;--bs-table-color-state:initial;--bs-table-bg-state:initial;--bs-table-color:var(--bs-emphasis-color);--bs-table-bg:var(--bs-body-bg);--bs-table-border-color:var(--bs-border-color);--bs-table-accent-bg:transparent;--bs-table-striped-color:var(--bs-emphasis-color);--bs-table-striped-bg:rgba(var(--bs-emphasis-color-rgb), 0.05);--bs-table-active-color:var(--bs-emphasis-color);--bs-table-active-bg:rgba(var(--bs-emphasis-color-rgb), 0.1);--bs-table-hover-color:var(--bs-emphasis-color);--bs-table-hover-bg:rgba(var(--bs-emphasis-color-rgb), 0.075);width:100%;margin-bottom:1rem;vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:1rem 1rem;color:var(--bs-table-color-state,var(--bs-table-color-type,var(--bs-table-color)));background-color:var(--bs-table-bg);border-bottom-width:var(--bs-border-width);box-shadow:inset 0 0 0 9999px var(--bs-table-bg-state,var(--bs-table-bg-type,var(--bs-table-accent-bg)))}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:calc(var(--bs-border-width) * 2) solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.5rem .5rem}.table-bordered>:not(caption)>*{border-width:var(--bs-border-width) 0}.table-bordered>:not(caption)>*>*{border-width:0 var(--bs-border-width)}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-striped-columns>:not(caption)>tr>:nth-child(2n){--bs-table-color-type:var(--bs-table-striped-color);--bs-table-bg-type:var(--bs-table-striped-bg)}.table-active{--bs-table-color-state:var(--bs-table-active-color);--bs-table-bg-state:var(--bs-table-active-bg)}.table-hover>tbody>tr:hover>*{--bs-table-color-state:var(--bs-table-hover-color);--bs-table-bg-state:var(--bs-table-hover-bg)}.table-primary{--bs-table-color:#000;--bs-table-bg:#d6defa;--bs-table-border-color:#abb2c8;--bs-table-striped-bg:#cbd3ee;--bs-table-striped-color:#000;--bs-table-active-bg:#c1c8e1;--bs-table-active-color:#fff;--bs-table-hover-bg:#c6cde7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color:#000;--bs-table-bg:white;--bs-table-border-color:#cccccc;--bs-table-striped-bg:#f2f2f2;--bs-table-striped-color:#000;--bs-table-active-bg:#e6e6e6;--bs-table-active-color:#000;--bs-table-hover-bg:#ececec;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color:#000;--bs-table-bg:#d5f0e6;--bs-table-border-color:#aac0b8;--bs-table-striped-bg:#cae4db;--bs-table-striped-color:#000;--bs-table-active-bg:#c0d8cf;--bs-table-active-color:#000;--bs-table-hover-bg:#c5ded5;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color:#000;--bs-table-bg:#d4e5f0;--bs-table-border-color:#aab7c0;--bs-table-striped-bg:#c9dae4;--bs-table-striped-color:#000;--bs-table-active-bg:#bfced8;--bs-table-active-color:#000;--bs-table-hover-bg:#c4d4de;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color:#000;--bs-table-bg:#fdf2df;--bs-table-border-color:#cac2b2;--bs-table-striped-bg:#f0e6d4;--bs-table-striped-color:#000;--bs-table-active-bg:#e4dac9;--bs-table-active-color:#000;--bs-table-hover-bg:#eae0ce;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color:#000;--bs-table-bg:#f8d4d5;--bs-table-border-color:#c6aaaa;--bs-table-striped-bg:#ecc9ca;--bs-table-striped-color:#000;--bs-table-active-bg:#dfbfc0;--bs-table-active-color:#fff;--bs-table-hover-bg:#e5c4c5;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color:#000;--bs-table-bg:#f8f9fa;--bs-table-border-color:#c6c7c8;--bs-table-striped-bg:#ecedee;--bs-table-striped-color:#000;--bs-table-active-bg:#dfe0e1;--bs-table-active-color:#000;--bs-table-hover-bg:#e5e6e7;--bs-table-hover-color:#000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color:#fff;--bs-table-bg:#212529;--bs-table-border-color:#4d5154;--bs-table-striped-bg:#2c3034;--bs-table-striped-color:#fff;--bs-table-active-bg:#373b3e;--bs-table-active-color:#fff;--bs-table-hover-bg:#323539;--bs-table-hover-color:#fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media (max-width:575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media (max-width:1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem;font-weight:500}.col-form-label{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));margin-bottom:0;font-size:inherit;font-weight:500;line-height:1.5}.col-form-label-lg{padding-top:calc(.5rem + var(--bs-border-width));padding-bottom:calc(.5rem + var(--bs-border-width));font-size:1.25rem}.col-form-label-sm{padding-top:calc(.25rem + var(--bs-border-width));padding-bottom:calc(.25rem + var(--bs-border-width));font-size:.875rem}.form-text{margin-top:.25rem;font-size:.875em;color:var(--bs-secondary-color)}.form-control{display:block;width:100%;padding:.5rem 1rem;font-size:.875rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-clip:padding-box;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);box-shadow:0 1px 2px rgba(0,0,0,.05);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:var(--bs-body-color);background-color:var(--bs-body-bg);border-color:#9aacf3;outline:0;box-shadow:0 1px 2px rgba(0,0,0,.05),0 0 0 .25rem rgba(52,89,230,.25)}.form-control::-webkit-date-and-time-value{min-width:85px;height:1.5em;margin:0}.form-control::-webkit-datetime-edit{display:block;padding:0}.form-control::-moz-placeholder{color:var(--bs-secondary-color);opacity:1}.form-control::placeholder{color:var(--bs-secondary-color);opacity:1}.form-control:disabled{background-color:var(--bs-secondary-bg);opacity:1}.form-control::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;-webkit-transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}.form-control::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem;color:var(--bs-body-color);background-color:var(--bs-tertiary-bg);pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:var(--bs-border-width);border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-control::-webkit-file-upload-button{-webkit-transition:none;transition:none}.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::-webkit-file-upload-button{background-color:var(--bs-secondary-bg)}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:var(--bs-secondary-bg)}.form-control-plaintext{display:block;width:100%;padding:.5rem 0;margin-bottom:0;line-height:1.5;color:var(--bs-body-color);background-color:transparent;border:solid transparent;border-width:var(--bs-border-width) 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-lg,.form-control-plaintext.form-control-sm{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2));padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-control-sm::-webkit-file-upload-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-.25rem -.5rem;-webkit-margin-end:.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.form-control-lg::-webkit-file-upload-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-.5rem -1rem;-webkit-margin-end:1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}textarea.form-control-sm{min-height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}textarea.form-control-lg{min-height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-control-color{width:3rem;height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));padding:.5rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color::-webkit-color-swatch{border:0!important;border-radius:var(--bs-border-radius)}.form-control-color.form-control-sm{height:calc(1.5em + .5rem + calc(var(--bs-border-width) * 2))}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + calc(var(--bs-border-width) * 2))}.form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");display:block;width:100%;padding:.5rem 3rem .5rem 1rem;font-size:.875rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-body-bg);background-image:var(--bs-form-select-bg-img),var(--bs-form-select-bg-icon,none);background-repeat:no-repeat;background-position:right 1rem center;background-size:16px 12px;border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius);box-shadow:var(--bs-box-shadow-inset);transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-select{transition:none}}.form-select:focus{border-color:#9aacf3;outline:0;box-shadow:var(--bs-box-shadow-inset),0 0 0 .25rem rgba(52,89,230,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:1rem;background-image:none}.form-select:disabled{background-color:var(--bs-secondary-bg)}.form-select:-moz-focusring{color:transparent;text-shadow:0 0 0 var(--bs-body-color)}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}[data-bs-theme=dark] .form-select{--bs-form-select-bg-img:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e")}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{--bs-form-check-bg:var(--bs-body-bg);flex-shrink:0;width:1em;height:1em;margin-top:.25em;vertical-align:top;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:var(--bs-form-check-bg);background-image:var(--bs-form-check-bg-image);background-repeat:no-repeat;background-position:center;background-size:contain;border:var(--bs-border-width) solid var(--bs-border-color);-webkit-print-color-adjust:exact;color-adjust:exact;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#9aacf3;outline:0;box-shadow:0 0 0 .25rem rgba(52,89,230,.25)}.form-check-input:checked{background-color:#3459e6;border-color:#3459e6}.form-check-input:checked[type=checkbox]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#3459e6;border-color:#3459e6;--bs-form-check-bg-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input:disabled~.form-check-label,.form-check-input[disabled]~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");width:2em;margin-left:-2.5em;background-image:var(--bs-form-switch-bg);background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%239aacf3'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0,0,0,0);pointer-events:none}.btn-check:disabled+.btn,.btn-check[disabled]+.btn{pointer-events:none;filter:none;opacity:.65}[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus){--bs-form-switch-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e")}.form-range{width:100%;height:1.5rem;padding:0;-webkit-appearance:none;-moz-appearance:none;appearance:none;background-color:transparent}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(52,89,230,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(52,89,230,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-.25rem;-webkit-appearance:none;appearance:none;background-color:#3459e6;border:0;border-radius:1rem;box-shadow:0 .1rem .25rem rgba(0,0,0,.1);-webkit-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-webkit-slider-thumb{-webkit-transition:none;transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#c2cdf8}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem;box-shadow:var(--bs-box-shadow-inset)}.form-range::-moz-range-thumb{width:1rem;height:1rem;-moz-appearance:none;appearance:none;background-color:#3459e6;border:0;border-radius:1rem;box-shadow:0 .1rem .25rem rgba(0,0,0,.1);-moz-transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.form-range::-moz-range-thumb{-moz-transition:none;transition:none}}.form-range::-moz-range-thumb:active{background-color:#c2cdf8}.form-range::-moz-range-track{width:100%;height:.5rem;color:transparent;cursor:pointer;background-color:var(--bs-secondary-bg);border-color:transparent;border-radius:1rem;box-shadow:var(--bs-box-shadow-inset)}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:var(--bs-secondary-color)}.form-range:disabled::-moz-range-thumb{background-color:var(--bs-secondary-color)}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + calc(var(--bs-border-width) * 2));min-height:calc(3.5rem + calc(var(--bs-border-width) * 2));line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;z-index:2;height:100%;padding:1rem 1rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:var(--bs-border-width) solid transparent;transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media (prefers-reduced-motion:reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem 1rem}.form-floating>.form-control-plaintext::-moz-placeholder,.form-floating>.form-control::-moz-placeholder{color:transparent}.form-floating>.form-control-plaintext::placeholder,.form-floating>.form-control::placeholder{color:transparent}.form-floating>.form-control-plaintext:not(:-moz-placeholder-shown),.form-floating>.form-control:not(:-moz-placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown),.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control-plaintext:-webkit-autofill,.form-floating>.form-control:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:not(:-moz-placeholder-shown)~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label,.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-select~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control:not(:-moz-placeholder-shown)~label::after{position:absolute;inset:1rem 0.5rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control-plaintext~label::after,.form-floating>.form-control:focus~label::after,.form-floating>.form-control:not(:placeholder-shown)~label::after,.form-floating>.form-select~label::after{position:absolute;inset:1rem 0.5rem;z-index:-1;height:1.5em;content:"";background-color:var(--bs-body-bg);border-radius:var(--bs-border-radius)}.form-floating>.form-control:-webkit-autofill~label{color:rgba(var(--bs-body-color-rgb),.65);transform:scale(.85) translateY(-.5rem) translateX(.15rem)}.form-floating>.form-control-plaintext~label{border-width:var(--bs-border-width) 0}.form-floating>.form-control:disabled~label,.form-floating>:disabled~label{color:#6c757d}.form-floating>.form-control:disabled~label::after,.form-floating>:disabled~label::after{background-color:var(--bs-secondary-bg)}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-floating,.input-group>.form-select{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-floating:focus-within,.input-group>.form-select:focus{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.5rem 1rem;font-size:.875rem;font-weight:400;line-height:1.5;color:var(--bs-body-color);text-align:center;white-space:nowrap;background-color:var(--bs-tertiary-bg);border:var(--bs-border-width) solid var(--bs-border-color);border-radius:var(--bs-border-radius)}.input-group-lg>.btn,.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text{padding:.5rem 1rem;font-size:1.25rem;border-radius:var(--bs-border-radius-lg)}.input-group-sm>.btn,.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text{padding:.25rem .5rem;font-size:.875rem;border-radius:var(--bs-border-radius-sm)}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:4rem}.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select,.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select,.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating){border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:calc(var(--bs-border-width) * -1);border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-valid-color)}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-success);border-radius:var(--bs-border-radius)}.is-valid~.valid-feedback,.is-valid~.valid-tooltip,.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip{display:block}.form-control.is-valid,.was-validated .form-control:valid{border-color:var(--bs-form-valid-border-color);padding-right:calc(1.5em + 1rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%232fb380' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .25rem) center;background-size:calc(.75em + .5rem) calc(.75em + .5rem)}.form-control.is-valid:focus,.was-validated .form-control:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:0 1px 2px rgba(0,0,0,.05),0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + 1rem);background-position:top calc(.375em + .25rem) right calc(.375em + .25rem)}.form-select.is-valid,.was-validated .form-select:valid{border-color:var(--bs-form-valid-border-color)}.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"],.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%232fb380' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");padding-right:5.5rem;background-position:right 1rem center,center right 3rem;background-size:16px 12px,calc(.75em + .5rem) calc(.75em + .5rem)}.form-select.is-valid:focus,.was-validated .form-select:valid:focus{border-color:var(--bs-form-valid-border-color);box-shadow:var(--bs-box-shadow-inset),0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-control-color.is-valid,.was-validated .form-control-color:valid{width:calc(3rem + calc(1.5em + 1rem))}.form-check-input.is-valid,.was-validated .form-check-input:valid{border-color:var(--bs-form-valid-border-color)}.form-check-input.is-valid:checked,.was-validated .form-check-input:valid:checked{background-color:var(--bs-form-valid-color)}.form-check-input.is-valid:focus,.was-validated .form-check-input:valid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-success-rgb),.25)}.form-check-input.is-valid~.form-check-label,.was-validated .form-check-input:valid~.form-check-label{color:var(--bs-form-valid-color)}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-valid,.input-group>.form-floating:not(:focus-within).is-valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-control:not(:focus):valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.was-validated .input-group>.form-select:not(:focus):valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:.875em;color:var(--bs-form-invalid-color)}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:.875rem;color:#fff;background-color:var(--bs-danger);border-radius:var(--bs-border-radius)}.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip,.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip{display:block}.form-control.is-invalid,.was-validated .form-control:invalid{border-color:var(--bs-form-invalid-border-color);padding-right:calc(1.5em + 1rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23da292e'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23da292e' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(.375em + .25rem) center;background-size:calc(.75em + .5rem) calc(.75em + .5rem)}.form-control.is-invalid:focus,.was-validated .form-control:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:0 1px 2px rgba(0,0,0,.05),0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + 1rem);background-position:top calc(.375em + .25rem) right calc(.375em + .25rem)}.form-select.is-invalid,.was-validated .form-select:invalid{border-color:var(--bs-form-invalid-border-color)}.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"],.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"]{--bs-form-select-bg-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23da292e'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23da292e' stroke='none'/%3e%3c/svg%3e");padding-right:5.5rem;background-position:right 1rem center,center right 3rem;background-size:16px 12px,calc(.75em + .5rem) calc(.75em + .5rem)}.form-select.is-invalid:focus,.was-validated .form-select:invalid:focus{border-color:var(--bs-form-invalid-border-color);box-shadow:var(--bs-box-shadow-inset),0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-control-color.is-invalid,.was-validated .form-control-color:invalid{width:calc(3rem + calc(1.5em + 1rem))}.form-check-input.is-invalid,.was-validated .form-check-input:invalid{border-color:var(--bs-form-invalid-border-color)}.form-check-input.is-invalid:checked,.was-validated .form-check-input:invalid:checked{background-color:var(--bs-form-invalid-color)}.form-check-input.is-invalid:focus,.was-validated .form-check-input:invalid:focus{box-shadow:0 0 0 .25rem rgba(var(--bs-danger-rgb),.25)}.form-check-input.is-invalid~.form-check-label,.was-validated .form-check-input:invalid~.form-check-label{color:var(--bs-form-invalid-color)}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.input-group>.form-control:not(:focus).is-invalid,.input-group>.form-floating:not(:focus-within).is-invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-control:not(:focus):invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.was-validated .input-group>.form-select:not(:focus):invalid{z-index:4}.btn{--bs-btn-padding-x:1rem;--bs-btn-padding-y:0.5rem;--bs-btn-font-family: ;--bs-btn-font-size:0.875rem;--bs-btn-font-weight:500;--bs-btn-line-height:1.5;--bs-btn-color:var(--bs-body-color);--bs-btn-bg:transparent;--bs-btn-border-width:var(--bs-border-width);--bs-btn-border-color:transparent;--bs-btn-border-radius:var(--bs-border-radius);--bs-btn-hover-border-color:transparent;--bs-btn-box-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-opacity:0.65;--bs-btn-focus-box-shadow:0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);box-shadow:var(--bs-btn-box-shadow);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-box-shadow),var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-box-shadow),var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,.btn.active,.btn.show,.btn:first-child:active,:not(.btn-check)+.btn:active{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color);box-shadow:var(--bs-btn-active-shadow)}.btn-check:checked+.btn:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible,.btn:first-child:active:focus-visible,:not(.btn-check)+.btn:active:focus-visible{box-shadow:var(--bs-btn-active-shadow),var(--bs-btn-focus-box-shadow)}.btn-check:checked:focus-visible+.btn{box-shadow:var(--bs-btn-active-shadow),var(--bs-btn-focus-box-shadow)}.btn.disabled,.btn:disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity);box-shadow:none}.btn-primary{--bs-btn-color:#fff;--bs-btn-bg:#3459e6;--bs-btn-border-color:#3459e6;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#2c4cc4;--bs-btn-hover-border-color:#2a47b8;--bs-btn-focus-shadow-rgb:82,114,234;--bs-btn-active-color:#fff;--bs-btn-active-bg:#2a47b8;--bs-btn-active-border-color:#2743ad;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#3459e6;--bs-btn-disabled-border-color:#3459e6}.btn-secondary{--bs-btn-color:#000;--bs-btn-bg:#fff;--bs-btn-border-color:#fff;--bs-btn-hover-color:#000;--bs-btn-hover-bg:white;--bs-btn-hover-border-color:white;--bs-btn-focus-shadow-rgb:217,217,217;--bs-btn-active-color:#000;--bs-btn-active-bg:white;--bs-btn-active-border-color:white;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#fff;--bs-btn-disabled-border-color:#fff}.btn-success{--bs-btn-color:#fff;--bs-btn-bg:#2fb380;--bs-btn-border-color:#2fb380;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#28986d;--bs-btn-hover-border-color:#268f66;--bs-btn-focus-shadow-rgb:78,190,147;--bs-btn-active-color:#fff;--bs-btn-active-bg:#268f66;--bs-btn-active-border-color:#238660;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#2fb380;--bs-btn-disabled-border-color:#2fb380}.btn-info{--bs-btn-color:#fff;--bs-btn-bg:#287bb5;--bs-btn-border-color:#287bb5;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#22699a;--bs-btn-hover-border-color:#206291;--bs-btn-focus-shadow-rgb:72,143,192;--bs-btn-active-color:#fff;--bs-btn-active-bg:#206291;--bs-btn-active-border-color:#1e5c88;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#287bb5;--bs-btn-disabled-border-color:#287bb5}.btn-warning{--bs-btn-color:#fff;--bs-btn-bg:#f4bd61;--bs-btn-border-color:#f4bd61;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#cfa152;--bs-btn-hover-border-color:#c3974e;--bs-btn-focus-shadow-rgb:246,199,121;--bs-btn-active-color:#fff;--bs-btn-active-bg:#c3974e;--bs-btn-active-border-color:#b78e49;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#f4bd61;--bs-btn-disabled-border-color:#f4bd61}.btn-danger{--bs-btn-color:#fff;--bs-btn-bg:#da292e;--bs-btn-border-color:#da292e;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#b92327;--bs-btn-hover-border-color:#ae2125;--bs-btn-focus-shadow-rgb:224,73,77;--bs-btn-active-color:#fff;--bs-btn-active-bg:#ae2125;--bs-btn-active-border-color:#a41f23;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#da292e;--bs-btn-disabled-border-color:#da292e}.btn-light{--bs-btn-color:#000;--bs-btn-bg:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#d3d4d5;--bs-btn-hover-border-color:#c6c7c8;--bs-btn-focus-shadow-rgb:211,212,213;--bs-btn-active-color:#fff;--bs-btn-active-bg:#c6c7c8;--bs-btn-active-border-color:#babbbc;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#000;--bs-btn-disabled-bg:#f8f9fa;--bs-btn-disabled-border-color:#f8f9fa}.btn-dark{--bs-btn-color:#fff;--bs-btn-bg:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#424649;--bs-btn-hover-border-color:#373b3e;--bs-btn-focus-shadow-rgb:66,70,73;--bs-btn-active-color:#fff;--bs-btn-active-bg:#4d5154;--bs-btn-active-border-color:#373b3e;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:#212529;--bs-btn-disabled-border-color:#212529}.btn-outline-primary{--bs-btn-color:#3459e6;--bs-btn-border-color:#3459e6;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#3459e6;--bs-btn-hover-border-color:#3459e6;--bs-btn-focus-shadow-rgb:52,89,230;--bs-btn-active-color:#fff;--bs-btn-active-bg:#3459e6;--bs-btn-active-border-color:#3459e6;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#3459e6;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#3459e6;--bs-gradient:none}.btn-outline-secondary{--bs-btn-color:#fff;--bs-btn-border-color:#fff;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#fff;--bs-btn-hover-border-color:#fff;--bs-btn-focus-shadow-rgb:255,255,255;--bs-btn-active-color:#000;--bs-btn-active-bg:#fff;--bs-btn-active-border-color:#fff;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#fff;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#fff;--bs-gradient:none}.btn-outline-success{--bs-btn-color:#2fb380;--bs-btn-border-color:#2fb380;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#2fb380;--bs-btn-hover-border-color:#2fb380;--bs-btn-focus-shadow-rgb:47,179,128;--bs-btn-active-color:#fff;--bs-btn-active-bg:#2fb380;--bs-btn-active-border-color:#2fb380;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#2fb380;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#2fb380;--bs-gradient:none}.btn-outline-info{--bs-btn-color:#287bb5;--bs-btn-border-color:#287bb5;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#287bb5;--bs-btn-hover-border-color:#287bb5;--bs-btn-focus-shadow-rgb:40,123,181;--bs-btn-active-color:#fff;--bs-btn-active-bg:#287bb5;--bs-btn-active-border-color:#287bb5;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#287bb5;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#287bb5;--bs-gradient:none}.btn-outline-warning{--bs-btn-color:#f4bd61;--bs-btn-border-color:#f4bd61;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#f4bd61;--bs-btn-hover-border-color:#f4bd61;--bs-btn-focus-shadow-rgb:244,189,97;--bs-btn-active-color:#fff;--bs-btn-active-bg:#f4bd61;--bs-btn-active-border-color:#f4bd61;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#f4bd61;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f4bd61;--bs-gradient:none}.btn-outline-danger{--bs-btn-color:#da292e;--bs-btn-border-color:#da292e;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#da292e;--bs-btn-hover-border-color:#da292e;--bs-btn-focus-shadow-rgb:218,41,46;--bs-btn-active-color:#fff;--bs-btn-active-bg:#da292e;--bs-btn-active-border-color:#da292e;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#da292e;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#da292e;--bs-gradient:none}.btn-outline-light{--bs-btn-color:#f8f9fa;--bs-btn-border-color:#f8f9fa;--bs-btn-hover-color:#000;--bs-btn-hover-bg:#f8f9fa;--bs-btn-hover-border-color:#f8f9fa;--bs-btn-focus-shadow-rgb:248,249,250;--bs-btn-active-color:#000;--bs-btn-active-bg:#f8f9fa;--bs-btn-active-border-color:#f8f9fa;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#f8f9fa;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#f8f9fa;--bs-gradient:none}.btn-outline-dark{--bs-btn-color:#212529;--bs-btn-border-color:#212529;--bs-btn-hover-color:#fff;--bs-btn-hover-bg:#212529;--bs-btn-hover-border-color:#212529;--bs-btn-focus-shadow-rgb:33,37,41;--bs-btn-active-color:#fff;--bs-btn-active-bg:#212529;--bs-btn-active-border-color:#212529;--bs-btn-active-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-btn-disabled-color:#212529;--bs-btn-disabled-bg:transparent;--bs-btn-disabled-border-color:#212529;--bs-gradient:none}.btn-link{--bs-btn-font-weight:400;--bs-btn-color:var(--bs-link-color);--bs-btn-bg:transparent;--bs-btn-border-color:transparent;--bs-btn-hover-color:var(--bs-link-hover-color);--bs-btn-hover-border-color:transparent;--bs-btn-active-color:var(--bs-link-hover-color);--bs-btn-active-border-color:transparent;--bs-btn-disabled-color:#6c757d;--bs-btn-disabled-border-color:transparent;--bs-btn-box-shadow:0 0 0 #000;--bs-btn-focus-shadow-rgb:82,114,234;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-group-lg>.btn,.btn-lg{--bs-btn-padding-y:0.5rem;--bs-btn-padding-x:1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius:var(--bs-border-radius-lg)}.btn-group-sm>.btn,.btn-sm{--bs-btn-padding-y:0.25rem;--bs-btn-padding-x:0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius:var(--bs-border-radius-sm)}.fade{transition:opacity .15s linear}@media (prefers-reduced-motion:reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media (prefers-reduced-motion:reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media (prefers-reduced-motion:reduce){.collapsing.collapse-horizontal{transition:none}}.dropdown,.dropdown-center,.dropend,.dropstart,.dropup,.dropup-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid transparent;border-bottom:0;border-left:.3em solid transparent}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex:1000;--bs-dropdown-min-width:10rem;--bs-dropdown-padding-x:0;--bs-dropdown-padding-y:0.5rem;--bs-dropdown-spacer:0.125rem;--bs-dropdown-font-size:0.875rem;--bs-dropdown-color:var(--bs-body-color);--bs-dropdown-bg:var(--bs-body-bg);--bs-dropdown-border-color:#dee2e6;--bs-dropdown-border-radius:var(--bs-border-radius);--bs-dropdown-border-width:var(--bs-border-width);--bs-dropdown-inner-border-radius:calc(var(--bs-border-radius) - var(--bs-border-width));--bs-dropdown-divider-bg:#e9ecef;--bs-dropdown-divider-margin-y:0.5rem;--bs-dropdown-box-shadow:var(--bs-box-shadow);--bs-dropdown-link-color:var(--bs-body-color);--bs-dropdown-link-hover-color:#fff;--bs-dropdown-link-hover-bg:#3459e6;--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#3459e6;--bs-dropdown-link-disabled-color:var(--bs-tertiary-color);--bs-dropdown-item-padding-x:1rem;--bs-dropdown-item-padding-y:0.5rem;--bs-dropdown-header-color:#6c757d;--bs-dropdown-header-padding-x:1rem;--bs-dropdown-header-padding-y:0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius);box-shadow:var(--bs-dropdown-box-shadow)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position:start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position:end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media (min-width:576px){.dropdown-menu-sm-start{--bs-position:start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position:end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media (min-width:768px){.dropdown-menu-md-start{--bs-position:start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position:end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media (min-width:992px){.dropdown-menu-lg-start{--bs-position:start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position:end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1200px){.dropdown-menu-xl-start{--bs-position:start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position:end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media (min-width:1400px){.dropdown-menu-xxl-start{--bs-position:start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position:end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid transparent;border-bottom:.3em solid;border-left:.3em solid transparent}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:0;border-bottom:.3em solid transparent;border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid transparent;border-right:.3em solid;border-bottom:.3em solid transparent}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:transparent;border:0;border-radius:var(--bs-dropdown-item-border-radius,0)}.dropdown-item:focus,.dropdown-item:hover{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:transparent}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color:#dee2e6;--bs-dropdown-bg:#343a40;--bs-dropdown-border-color:#dee2e6;--bs-dropdown-box-shadow: ;--bs-dropdown-link-color:#dee2e6;--bs-dropdown-link-hover-color:#fff;--bs-dropdown-divider-bg:#e9ecef;--bs-dropdown-link-hover-bg:rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color:#fff;--bs-dropdown-link-active-bg:#3459e6;--bs-dropdown-link-disabled-color:#adb5bd;--bs-dropdown-header-color:#adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group-vertical>.btn,.btn-group>.btn{position:relative;flex:1 1 auto}.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn.active,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:hover,.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn.active,.btn-group>.btn:active,.btn-group>.btn:focus,.btn-group>.btn:hover{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:var(--bs-border-radius)}.btn-group>.btn-group:not(:first-child),.btn-group>:not(.btn-check:first-child)+.btn{margin-left:calc(var(--bs-border-width) * -1)}.btn-group>.btn-group:not(:last-child)>.btn,.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn:not(:last-child):not(.dropdown-toggle){border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn-group:not(:first-child)>.btn,.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-group-sm>.btn+.dropdown-toggle-split,.btn-sm+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-group-lg>.btn+.dropdown-toggle-split,.btn-lg+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group.show .dropdown-toggle{box-shadow:0 1px 2px rgba(0,0,0,.05)}.btn-group.show .dropdown-toggle.btn-link{box-shadow:none}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn-group:not(:first-child),.btn-group-vertical>.btn:not(:first-child){margin-top:calc(var(--bs-border-width) * -1)}.btn-group-vertical>.btn-group:not(:last-child)>.btn,.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle){border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn-group:not(:first-child)>.btn,.btn-group-vertical>.btn~.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x:1rem;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:#495057;--bs-nav-link-hover-color:#495057;--bs-nav-link-disabled-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;background:0 0;border:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media (prefers-reduced-motion:reduce){.nav-link{transition:none}}.nav-link:focus,.nav-link:hover{color:var(--bs-nav-link-hover-color)}.nav-link:focus-visible{outline:0;box-shadow:0 0 0 .25rem rgba(52,89,230,.25)}.nav-link.disabled,.nav-link:disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width:var(--bs-border-width);--bs-nav-tabs-border-color:var(--bs-border-color);--bs-nav-tabs-border-radius:0;--bs-nav-tabs-link-hover-border-color:var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);--bs-nav-tabs-link-active-color:#3459e6;--bs-nav-tabs-link-active-bg:var(--bs-body-bg);--bs-nav-tabs-link-active-border-color:var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1 * var(--bs-nav-tabs-border-width));border:var(--bs-nav-tabs-border-width) solid transparent;border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:focus,.nav-tabs .nav-link:hover{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1 * var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius:var(--bs-border-radius);--bs-nav-pills-link-active-color:#fff;--bs-nav-pills-link-active-bg:#3459e6}.nav-pills .nav-link{border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-underline{--bs-nav-underline-gap:1rem;--bs-nav-underline-border-width:0.125rem;--bs-nav-underline-link-active-color:var(--bs-emphasis-color);gap:var(--bs-nav-underline-gap)}.nav-underline .nav-link{padding-right:0;padding-left:0;border-bottom:var(--bs-nav-underline-border-width) solid transparent}.nav-underline .nav-link:focus,.nav-underline .nav-link:hover{border-bottom-color:currentcolor}.nav-underline .nav-link.active,.nav-underline .show>.nav-link{font-weight:700;color:var(--bs-nav-underline-link-active-color);border-bottom-color:currentcolor}.nav-fill .nav-item,.nav-fill>.nav-link{flex:1 1 auto;text-align:center}.nav-justified .nav-item,.nav-justified>.nav-link{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x:0;--bs-navbar-padding-y:0.85rem;--bs-navbar-color:rgba(var(--bs-emphasis-color-rgb), 0.65);--bs-navbar-hover-color:rgba(var(--bs-emphasis-color-rgb), 0.8);--bs-navbar-disabled-color:rgba(var(--bs-emphasis-color-rgb), 0.3);--bs-navbar-active-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-padding-y:0.3125rem;--bs-navbar-brand-margin-end:1rem;--bs-navbar-brand-font-size:1.25rem;--bs-navbar-brand-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-brand-hover-color:rgba(var(--bs-emphasis-color-rgb), 1);--bs-navbar-nav-link-padding-x:0.75rem;--bs-navbar-toggler-padding-y:0.25rem;--bs-navbar-toggler-padding-x:0.75rem;--bs-navbar-toggler-font-size:1.25rem;--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2873, 80, 87, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color:rgba(var(--bs-emphasis-color-rgb), 0.15);--bs-navbar-toggler-border-radius:var(--bs-border-radius);--bs-navbar-toggler-focus-width:0.25rem;--bs-navbar-toggler-transition:box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-lg,.navbar>.container-md,.navbar>.container-sm,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:focus,.navbar-brand:hover{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x:0;--bs-nav-link-padding-y:0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color:var(--bs-navbar-color);--bs-nav-link-hover-color:var(--bs-navbar-hover-color);--bs-nav-link-disabled-color:var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .nav-link.active,.navbar-nav .nav-link.show{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:focus,.navbar-text a:hover{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:transparent;border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media (prefers-reduced-motion:reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height,75vh);overflow-y:auto}@media (min-width:576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;box-shadow:none;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;box-shadow:none;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;box-shadow:none;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;box-shadow:none;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media (min-width:1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;box-shadow:none;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex!important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto!important;height:auto!important;visibility:visible!important;background-color:transparent!important;border:0!important;transform:none!important;box-shadow:none;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark,.navbar[data-bs-theme=dark]{--bs-navbar-color:rgba(255, 255, 255, 0.55);--bs-navbar-hover-color:rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color:rgba(255, 255, 255, 0.25);--bs-navbar-active-color:#fff;--bs-navbar-brand-color:#fff;--bs-navbar-brand-hover-color:#fff;--bs-navbar-toggler-border-color:rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}[data-bs-theme=dark] .navbar-toggler-icon{--bs-navbar-toggler-icon-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y:1rem;--bs-card-spacer-x:1.5rem;--bs-card-title-spacer-y:0.5rem;--bs-card-title-color: ;--bs-card-subtitle-color: ;--bs-card-border-width:var(--bs-border-width);--bs-card-border-color:var(--bs-border-color-translucent);--bs-card-border-radius:var(--bs-border-radius);--bs-card-box-shadow: ;--bs-card-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-card-cap-padding-y:1rem;--bs-card-cap-padding-x:1.5rem;--bs-card-cap-bg:rgba(var(--bs-body-color-rgb), 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg:var(--bs-body-bg);--bs-card-img-overlay-padding:1rem;--bs-card-group-margin:0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);color:var(--bs-body-color);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius);box-shadow:var(--bs-card-box-shadow)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y);color:var(--bs-card-title-color)}.card-subtitle{margin-top:calc(-.5 * var(--bs-card-title-spacer-y));margin-bottom:0;color:var(--bs-card-subtitle-color)}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-bottom:calc(-1 * var(--bs-card-cap-padding-y));margin-left:calc(-.5 * var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-.5 * var(--bs-card-cap-padding-x));margin-left:calc(-.5 * var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom,.card-img-top{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media (min-width:576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-header,.card-group>.card:not(:last-child) .card-img-top{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-footer,.card-group>.card:not(:last-child) .card-img-bottom{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-header,.card-group>.card:not(:first-child) .card-img-top{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-footer,.card-group>.card:not(:first-child) .card-img-bottom{border-bottom-left-radius:0}}.accordion{--bs-accordion-color:var(--bs-body-color);--bs-accordion-bg:var(--bs-body-bg);--bs-accordion-transition:color 0.15s ease-in-out,background-color 0.15s ease-in-out,border-color 0.15s ease-in-out,box-shadow 0.15s ease-in-out,border-radius 0.15s ease;--bs-accordion-border-color:var(--bs-border-color);--bs-accordion-border-width:var(--bs-border-width);--bs-accordion-border-radius:var(--bs-border-radius);--bs-accordion-inner-border-radius:calc(var(--bs-border-radius) - (var(--bs-border-width)));--bs-accordion-btn-padding-x:1.25rem;--bs-accordion-btn-padding-y:1rem;--bs-accordion-btn-color:var(--bs-body-color);--bs-accordion-btn-bg:var(--bs-accordion-bg);--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23495057' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width:1.25rem;--bs-accordion-btn-icon-transform:rotate(-180deg);--bs-accordion-btn-icon-transition:transform 0.2s ease-in-out;--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%2315245c' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");--bs-accordion-btn-focus-box-shadow:0 1px 2px rgba(0, 0, 0, 0.05);--bs-accordion-body-padding-x:1.25rem;--bs-accordion-body-padding-y:1rem;--bs-accordion-active-color:var(--bs-primary-text-emphasis);--bs-accordion-active-bg:var(--bs-primary-bg-subtle)}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media (prefers-reduced-motion:reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media (prefers-reduced-motion:reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type>.accordion-header .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type>.accordion-header .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type>.accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush>.accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush>.accordion-item:first-child{border-top:0}.accordion-flush>.accordion-item:last-child{border-bottom:0}.accordion-flush>.accordion-item>.accordion-header .accordion-button,.accordion-flush>.accordion-item>.accordion-header .accordion-button.collapsed{border-radius:0}.accordion-flush>.accordion-item>.accordion-collapse{border-radius:0}[data-bs-theme=dark] .accordion-button::after{--bs-accordion-btn-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23859bf0'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-active-icon:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23859bf0'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.breadcrumb{--bs-breadcrumb-padding-x:1rem;--bs-breadcrumb-padding-y:0;--bs-breadcrumb-margin-bottom:1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color:var(--bs-secondary-color);--bs-breadcrumb-item-padding-x:0.5rem;--bs-breadcrumb-item-active-color:var(--bs-secondary-color);display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, ">")}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x:1rem;--bs-pagination-padding-y:0.5rem;--bs-pagination-font-size:1rem;--bs-pagination-color:var(--bs-primary-bg);--bs-pagination-bg:var(--bs-body-bg);--bs-pagination-border-width:var(--bs-border-width);--bs-pagination-border-color:var(--bs-border-color);--bs-pagination-border-radius:var(--bs-border-radius);--bs-pagination-hover-color:var(--bs-primary-bg);--bs-pagination-hover-bg:var(--bs-secondary-bg);--bs-pagination-hover-border-color:var(--bs-border-color);--bs-pagination-focus-color:var(--bs-primary-bg);--bs-pagination-focus-bg:var(--bs-secondary-bg);--bs-pagination-focus-box-shadow:0 0 0 0.25rem rgba(52, 89, 230, 0.25);--bs-pagination-active-color:#fff;--bs-pagination-active-bg:#3459e6;--bs-pagination-active-border-color:#3459e6;--bs-pagination-disabled-color:var(--bs-tertiary-color);--bs-pagination-disabled-bg:var(--bs-tertiary-bg);--bs-pagination-disabled-border-color:var(--bs-border-color);display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media (prefers-reduced-motion:reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.active>.page-link,.page-link.active{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.disabled>.page-link,.page-link.disabled{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:calc(var(--bs-border-width) * -1)}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x:1.5rem;--bs-pagination-padding-y:0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius:var(--bs-border-radius-lg)}.pagination-sm{--bs-pagination-padding-x:0.5rem;--bs-pagination-padding-y:0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius:var(--bs-border-radius-sm)}.badge{--bs-badge-padding-x:0.65em;--bs-badge-padding-y:0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight:700;--bs-badge-color:#fff;--bs-badge-border-radius:var(--bs-border-radius);display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg:transparent;--bs-alert-padding-x:1rem;--bs-alert-padding-y:1rem;--bs-alert-margin-bottom:1rem;--bs-alert-color:inherit;--bs-alert-border-color:transparent;--bs-alert-border:var(--bs-border-width) solid var(--bs-alert-border-color);--bs-alert-border-radius:var(--bs-border-radius);--bs-alert-link-color:inherit;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700;color:var(--bs-alert-link-color)}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color:var(--bs-primary-text-emphasis);--bs-alert-bg:var(--bs-primary-bg-subtle);--bs-alert-border-color:var(--bs-primary-border-subtle);--bs-alert-link-color:var(--bs-primary-text-emphasis)}.alert-secondary{--bs-alert-color:var(--bs-secondary-text-emphasis);--bs-alert-bg:var(--bs-secondary-bg-subtle);--bs-alert-border-color:var(--bs-secondary-border-subtle);--bs-alert-link-color:var(--bs-secondary-text-emphasis)}.alert-success{--bs-alert-color:var(--bs-success-text-emphasis);--bs-alert-bg:var(--bs-success-bg-subtle);--bs-alert-border-color:var(--bs-success-border-subtle);--bs-alert-link-color:var(--bs-success-text-emphasis)}.alert-info{--bs-alert-color:var(--bs-info-text-emphasis);--bs-alert-bg:var(--bs-info-bg-subtle);--bs-alert-border-color:var(--bs-info-border-subtle);--bs-alert-link-color:var(--bs-info-text-emphasis)}.alert-warning{--bs-alert-color:var(--bs-warning-text-emphasis);--bs-alert-bg:var(--bs-warning-bg-subtle);--bs-alert-border-color:var(--bs-warning-border-subtle);--bs-alert-link-color:var(--bs-warning-text-emphasis)}.alert-danger{--bs-alert-color:var(--bs-danger-text-emphasis);--bs-alert-bg:var(--bs-danger-bg-subtle);--bs-alert-border-color:var(--bs-danger-border-subtle);--bs-alert-link-color:var(--bs-danger-text-emphasis)}.alert-light{--bs-alert-color:var(--bs-light-text-emphasis);--bs-alert-bg:var(--bs-light-bg-subtle);--bs-alert-border-color:var(--bs-light-border-subtle);--bs-alert-link-color:var(--bs-light-text-emphasis)}.alert-dark{--bs-alert-color:var(--bs-dark-text-emphasis);--bs-alert-bg:var(--bs-dark-bg-subtle);--bs-alert-border-color:var(--bs-dark-border-subtle);--bs-alert-link-color:var(--bs-dark-text-emphasis)}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress,.progress-stacked{--bs-progress-height:1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg:var(--bs-secondary-bg);--bs-progress-border-radius:var(--bs-border-radius);--bs-progress-box-shadow:var(--bs-box-shadow-inset);--bs-progress-bar-color:#fff;--bs-progress-bar-bg:#3459e6;--bs-progress-bar-transition:width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius);box-shadow:var(--bs-progress-box-shadow)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media (prefers-reduced-motion:reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg,rgba(255,255,255,.15) 25%,transparent 25%,transparent 50%,rgba(255,255,255,.15) 50%,rgba(255,255,255,.15) 75%,transparent 75%,transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-stacked>.progress{overflow:visible}.progress-stacked>.progress>.progress-bar{width:100%}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media (prefers-reduced-motion:reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color:var(--bs-body-color);--bs-list-group-bg:var(--bs-body-bg);--bs-list-group-border-color:var(--bs-border-color);--bs-list-group-border-width:var(--bs-border-width);--bs-list-group-border-radius:var(--bs-border-radius);--bs-list-group-item-padding-x:1.5rem;--bs-list-group-item-padding-y:1rem;--bs-list-group-action-color:var(--bs-secondary-color);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-tertiary-bg);--bs-list-group-action-active-color:var(--bs-body-color);--bs-list-group-action-active-bg:var(--bs-secondary-bg);--bs-list-group-disabled-color:var(--bs-secondary-color);--bs-list-group-disabled-bg:var(--bs-body-bg);--bs-list-group-active-color:#fff;--bs-list-group-active-bg:#3459e6;--bs-list-group-active-border-color:#3459e6;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:focus,.list-group-item-action:hover{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1 * var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media (min-width:576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media (min-width:1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1 * var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{--bs-list-group-color:var(--bs-primary-text-emphasis);--bs-list-group-bg:var(--bs-primary-bg-subtle);--bs-list-group-border-color:var(--bs-primary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-primary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-primary-border-subtle);--bs-list-group-active-color:var(--bs-primary-bg-subtle);--bs-list-group-active-bg:var(--bs-primary-text-emphasis);--bs-list-group-active-border-color:var(--bs-primary-text-emphasis)}.list-group-item-secondary{--bs-list-group-color:var(--bs-secondary-text-emphasis);--bs-list-group-bg:var(--bs-secondary-bg-subtle);--bs-list-group-border-color:var(--bs-secondary-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-secondary-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-secondary-border-subtle);--bs-list-group-active-color:var(--bs-secondary-bg-subtle);--bs-list-group-active-bg:var(--bs-secondary-text-emphasis);--bs-list-group-active-border-color:var(--bs-secondary-text-emphasis)}.list-group-item-success{--bs-list-group-color:var(--bs-success-text-emphasis);--bs-list-group-bg:var(--bs-success-bg-subtle);--bs-list-group-border-color:var(--bs-success-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-success-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-success-border-subtle);--bs-list-group-active-color:var(--bs-success-bg-subtle);--bs-list-group-active-bg:var(--bs-success-text-emphasis);--bs-list-group-active-border-color:var(--bs-success-text-emphasis)}.list-group-item-info{--bs-list-group-color:var(--bs-info-text-emphasis);--bs-list-group-bg:var(--bs-info-bg-subtle);--bs-list-group-border-color:var(--bs-info-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-info-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-info-border-subtle);--bs-list-group-active-color:var(--bs-info-bg-subtle);--bs-list-group-active-bg:var(--bs-info-text-emphasis);--bs-list-group-active-border-color:var(--bs-info-text-emphasis)}.list-group-item-warning{--bs-list-group-color:var(--bs-warning-text-emphasis);--bs-list-group-bg:var(--bs-warning-bg-subtle);--bs-list-group-border-color:var(--bs-warning-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-warning-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-warning-border-subtle);--bs-list-group-active-color:var(--bs-warning-bg-subtle);--bs-list-group-active-bg:var(--bs-warning-text-emphasis);--bs-list-group-active-border-color:var(--bs-warning-text-emphasis)}.list-group-item-danger{--bs-list-group-color:var(--bs-danger-text-emphasis);--bs-list-group-bg:var(--bs-danger-bg-subtle);--bs-list-group-border-color:var(--bs-danger-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-danger-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-danger-border-subtle);--bs-list-group-active-color:var(--bs-danger-bg-subtle);--bs-list-group-active-bg:var(--bs-danger-text-emphasis);--bs-list-group-active-border-color:var(--bs-danger-text-emphasis)}.list-group-item-light{--bs-list-group-color:var(--bs-light-text-emphasis);--bs-list-group-bg:var(--bs-light-bg-subtle);--bs-list-group-border-color:var(--bs-light-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-light-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-light-border-subtle);--bs-list-group-active-color:var(--bs-light-bg-subtle);--bs-list-group-active-bg:var(--bs-light-text-emphasis);--bs-list-group-active-border-color:var(--bs-light-text-emphasis)}.list-group-item-dark{--bs-list-group-color:var(--bs-dark-text-emphasis);--bs-list-group-bg:var(--bs-dark-bg-subtle);--bs-list-group-border-color:var(--bs-dark-border-subtle);--bs-list-group-action-hover-color:var(--bs-emphasis-color);--bs-list-group-action-hover-bg:var(--bs-dark-border-subtle);--bs-list-group-action-active-color:var(--bs-emphasis-color);--bs-list-group-action-active-bg:var(--bs-dark-border-subtle);--bs-list-group-active-color:var(--bs-dark-bg-subtle);--bs-list-group-active-bg:var(--bs-dark-text-emphasis);--bs-list-group-active-border-color:var(--bs-dark-text-emphasis)}.btn-close{--bs-btn-close-color:#000;--bs-btn-close-bg:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");--bs-btn-close-opacity:0.5;--bs-btn-close-hover-opacity:0.75;--bs-btn-close-focus-shadow:0 0 0 0.25rem rgba(52, 89, 230, 0.25);--bs-btn-close-focus-opacity:1;--bs-btn-close-disabled-opacity:0.25;--bs-btn-close-white-filter:invert(1) grayscale(100%) brightness(200%);box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:var(--bs-btn-close-color);background:transparent var(--bs-btn-close-bg) center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:var(--bs-btn-close-opacity)}.btn-close:hover{color:var(--bs-btn-close-color);text-decoration:none;opacity:var(--bs-btn-close-hover-opacity)}.btn-close:focus{outline:0;box-shadow:var(--bs-btn-close-focus-shadow);opacity:var(--bs-btn-close-focus-opacity)}.btn-close.disabled,.btn-close:disabled{pointer-events:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;opacity:var(--bs-btn-close-disabled-opacity)}.btn-close-white{filter:var(--bs-btn-close-white-filter)}[data-bs-theme=dark] .btn-close{filter:var(--bs-btn-close-white-filter)}.toast{--bs-toast-zindex:1090;--bs-toast-padding-x:0.75rem;--bs-toast-padding-y:0.5rem;--bs-toast-spacing:1.5rem;--bs-toast-max-width:350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-border-width:var(--bs-border-width);--bs-toast-border-color:var(--bs-border-color-translucent);--bs-toast-border-radius:var(--bs-border-radius);--bs-toast-box-shadow:var(--bs-box-shadow);--bs-toast-header-color:var(--bs-primary-color);--bs-toast-header-bg:rgba(var(--bs-body-bg-rgb), 0.85);--bs-toast-header-border-color:var(--bs-border-color-translucent);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex:1090;position:absolute;z-index:var(--bs-toast-zindex);width:-webkit-max-content;width:-moz-max-content;width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-.5 * var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex:1055;--bs-modal-width:500px;--bs-modal-padding:1rem;--bs-modal-margin:0.5rem;--bs-modal-color: ;--bs-modal-bg:var(--bs-body-bg);--bs-modal-border-color:var(--bs-border-color-translucent);--bs-modal-border-width:var(--bs-border-width);--bs-modal-border-radius:var(--bs-border-radius-lg);--bs-modal-box-shadow:var(--bs-box-shadow-sm);--bs-modal-inner-border-radius:calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));--bs-modal-header-padding-x:1rem;--bs-modal-header-padding-y:1rem;--bs-modal-header-padding:1rem 1rem;--bs-modal-header-border-color:var(--bs-border-color);--bs-modal-header-border-width:0;--bs-modal-title-line-height:1.5;--bs-modal-footer-gap:0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color:var(--bs-border-color);--bs-modal-footer-border-width:0;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0,-50px)}@media (prefers-reduced-motion:reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin) * 2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin) * 2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);box-shadow:var(--bs-modal-box-shadow);outline:0}.modal-backdrop{--bs-backdrop-zindex:1050;--bs-backdrop-bg:#000;--bs-backdrop-opacity:0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y) * .5) calc(var(--bs-modal-header-padding-x) * .5);margin:calc(-.5 * var(--bs-modal-header-padding-y)) calc(-.5 * var(--bs-modal-header-padding-x)) calc(-.5 * var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * .5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap) * .5)}@media (min-width:576px){.modal{--bs-modal-margin:1.75rem;--bs-modal-box-shadow:var(--bs-box-shadow)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width:300px}}@media (min-width:992px){.modal-lg,.modal-xl{--bs-modal-width:800px}}@media (min-width:1200px){.modal-xl{--bs-modal-width:1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-footer,.modal-fullscreen .modal-header{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media (max-width:575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-footer,.modal-fullscreen-sm-down .modal-header{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media (max-width:767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-footer,.modal-fullscreen-md-down .modal-header{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media (max-width:991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-footer,.modal-fullscreen-lg-down .modal-header{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media (max-width:1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-footer,.modal-fullscreen-xl-down .modal-header{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media (max-width:1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-footer,.modal-fullscreen-xxl-down .modal-header{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex:1080;--bs-tooltip-max-width:200px;--bs-tooltip-padding-x:0.5rem;--bs-tooltip-padding-y:0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color:var(--bs-body-bg);--bs-tooltip-bg:var(--bs-emphasis-color);--bs-tooltip-border-radius:var(--bs-border-radius);--bs-tooltip-opacity:0.9;--bs-tooltip-arrow-width:0.8rem;--bs-tooltip-arrow-height:0.4rem;z-index:var(--bs-tooltip-zindex);display:block;margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:transparent;border-style:solid}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow,.bs-tooltip-top .tooltip-arrow{bottom:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before,.bs-tooltip-top .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow,.bs-tooltip-end .tooltip-arrow{left:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before,.bs-tooltip-end .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * .5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow,.bs-tooltip-bottom .tooltip-arrow{top:calc(-1 * var(--bs-tooltip-arrow-height))}.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before,.bs-tooltip-bottom .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow,.bs-tooltip-start .tooltip-arrow{right:calc(-1 * var(--bs-tooltip-arrow-height));width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before,.bs-tooltip-start .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width) * .5) 0 calc(var(--bs-tooltip-arrow-width) * .5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex:1070;--bs-popover-max-width:276px;--bs-popover-font-size:0.875rem;--bs-popover-bg:var(--bs-body-bg);--bs-popover-border-width:var(--bs-border-width);--bs-popover-border-color:var(--bs-border-color-translucent);--bs-popover-border-radius:var(--bs-border-radius-lg);--bs-popover-inner-border-radius:calc(var(--bs-border-radius-lg) - var(--bs-border-width));--bs-popover-box-shadow:var(--bs-box-shadow);--bs-popover-header-padding-x:1rem;--bs-popover-header-padding-y:0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color:var(--bs-primary-color);--bs-popover-header-bg:var(--bs-secondary-bg);--bs-popover-body-padding-x:1rem;--bs-popover-body-padding-y:1rem;--bs-popover-body-color:var(--bs-body-color);--bs-popover-arrow-width:1rem;--bs-popover-arrow-height:0.5rem;--bs-popover-arrow-border:var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius);box-shadow:var(--bs-popover-box-shadow)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::after,.popover .popover-arrow::before{position:absolute;display:block;content:"";border-color:transparent;border-style:solid;border-width:0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow,.bs-popover-top>.popover-arrow{bottom:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-top>.popover-arrow::before{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after,.bs-popover-top>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow,.bs-popover-end>.popover-arrow{left:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-end>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * .5) 0}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after,.bs-popover-end>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow,.bs-popover-bottom>.popover-arrow{top:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::before{border-width:0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after,.bs-popover-bottom>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before,.bs-popover-bottom .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-.5 * var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow,.bs-popover-start>.popover-arrow{right:calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-start>.popover-arrow::before{border-width:calc(var(--bs-popover-arrow-width) * .5) 0 calc(var(--bs-popover-arrow-width) * .5) var(--bs-popover-arrow-height)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after,.bs-popover-start>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;-webkit-backface-visibility:hidden;backface-visibility:hidden;transition:transform .6s ease-in-out}@media (prefers-reduced-motion:reduce){.carousel-item{transition:none}}.carousel-item-next,.carousel-item-prev,.carousel-item.active{display:block}.active.carousel-item-end,.carousel-item-next:not(.carousel-item-start){transform:translateX(100%)}.active.carousel-item-start,.carousel-item-prev:not(.carousel-item-end){transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end,.carousel-fade .carousel-item.active{z-index:1;opacity:1}.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{z-index:0;opacity:0;transition:opacity 0s .6s}@media (prefers-reduced-motion:reduce){.carousel-fade .active.carousel-item-end,.carousel-fade .active.carousel-item-start{transition:none}}.carousel-control-next,.carousel-control-prev{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:0 0;border:0;opacity:.5;transition:opacity .15s ease}@media (prefers-reduced-motion:reduce){.carousel-control-next,.carousel-control-prev{transition:none}}.carousel-control-next:focus,.carousel-control-next:hover,.carousel-control-prev:focus,.carousel-control-prev:hover{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-next-icon,.carousel-control-prev-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid transparent;border-bottom:10px solid transparent;opacity:.5;transition:opacity .6s ease}@media (prefers-reduced-motion:reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-next-icon,.carousel-dark .carousel-control-prev-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}[data-bs-theme=dark] .carousel .carousel-control-next-icon,[data-bs-theme=dark] .carousel .carousel-control-prev-icon,[data-bs-theme=dark].carousel .carousel-control-next-icon,[data-bs-theme=dark].carousel .carousel-control-prev-icon{filter:invert(1) grayscale(100)}[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target],[data-bs-theme=dark].carousel .carousel-indicators [data-bs-target]{background-color:#000}[data-bs-theme=dark] .carousel .carousel-caption,[data-bs-theme=dark].carousel .carousel-caption{color:#000}.spinner-border,.spinner-grow{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg)}}.spinner-border{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-border-width:0.25em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:transparent}.spinner-border-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem;--bs-spinner-border-width:0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width:2rem;--bs-spinner-height:2rem;--bs-spinner-vertical-align:-0.125em;--bs-spinner-animation-speed:0.75s;--bs-spinner-animation-name:spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width:1rem;--bs-spinner-height:1rem}@media (prefers-reduced-motion:reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed:1.5s}}.offcanvas,.offcanvas-lg,.offcanvas-md,.offcanvas-sm,.offcanvas-xl,.offcanvas-xxl{--bs-offcanvas-zindex:1045;--bs-offcanvas-width:400px;--bs-offcanvas-height:30vh;--bs-offcanvas-padding-x:1rem;--bs-offcanvas-padding-y:1rem;--bs-offcanvas-color:var(--bs-body-color);--bs-offcanvas-bg:var(--bs-body-bg);--bs-offcanvas-border-width:var(--bs-border-width);--bs-offcanvas-border-color:var(--bs-border-color-translucent);--bs-offcanvas-box-shadow:var(--bs-box-shadow-sm);--bs-offcanvas-transition:transform 0.3s ease-in-out;--bs-offcanvas-title-line-height:1.5}@media (max-width:575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;box-shadow:var(--bs-offcanvas-box-shadow);transition:var(--bs-offcanvas-transition)}}@media (max-width:575.98px) and (prefers-reduced-motion:reduce){.offcanvas-sm{transition:none}}@media (max-width:575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-sm.show:not(.hiding),.offcanvas-sm.showing{transform:none}.offcanvas-sm.hiding,.offcanvas-sm.show,.offcanvas-sm.showing{visibility:visible}}@media (min-width:576px){.offcanvas-sm{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;box-shadow:var(--bs-offcanvas-box-shadow);transition:var(--bs-offcanvas-transition)}}@media (max-width:767.98px) and (prefers-reduced-motion:reduce){.offcanvas-md{transition:none}}@media (max-width:767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-md.show:not(.hiding),.offcanvas-md.showing{transform:none}.offcanvas-md.hiding,.offcanvas-md.show,.offcanvas-md.showing{visibility:visible}}@media (min-width:768px){.offcanvas-md{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;box-shadow:var(--bs-offcanvas-box-shadow);transition:var(--bs-offcanvas-transition)}}@media (max-width:991.98px) and (prefers-reduced-motion:reduce){.offcanvas-lg{transition:none}}@media (max-width:991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-lg.show:not(.hiding),.offcanvas-lg.showing{transform:none}.offcanvas-lg.hiding,.offcanvas-lg.show,.offcanvas-lg.showing{visibility:visible}}@media (min-width:992px){.offcanvas-lg{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;box-shadow:var(--bs-offcanvas-box-shadow);transition:var(--bs-offcanvas-transition)}}@media (max-width:1199.98px) and (prefers-reduced-motion:reduce){.offcanvas-xl{transition:none}}@media (max-width:1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xl.show:not(.hiding),.offcanvas-xl.showing{transform:none}.offcanvas-xl.hiding,.offcanvas-xl.show,.offcanvas-xl.showing{visibility:visible}}@media (min-width:1200px){.offcanvas-xl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}@media (max-width:1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;box-shadow:var(--bs-offcanvas-box-shadow);transition:var(--bs-offcanvas-transition)}}@media (max-width:1399.98px) and (prefers-reduced-motion:reduce){.offcanvas-xxl{transition:none}}@media (max-width:1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas-xxl.show:not(.hiding),.offcanvas-xxl.showing{transform:none}.offcanvas-xxl.hiding,.offcanvas-xxl.show,.offcanvas-xxl.showing{visibility:visible}}@media (min-width:1400px){.offcanvas-xxl{--bs-offcanvas-height:auto;--bs-offcanvas-border-width:0;background-color:transparent!important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:transparent!important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;box-shadow:var(--bs-offcanvas-box-shadow);transition:var(--bs-offcanvas-transition)}@media (prefers-reduced-motion:reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.show:not(.hiding),.offcanvas.showing{transform:none}.offcanvas.hiding,.offcanvas.show,.offcanvas.showing{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y) * .5) calc(var(--bs-offcanvas-padding-x) * .5);margin:calc(-.5 * var(--bs-offcanvas-padding-y)) calc(-.5 * var(--bs-offcanvas-padding-x)) calc(-.5 * var(--bs-offcanvas-padding-y)) auto}.offcanvas-title{margin-bottom:0;line-height:var(--bs-offcanvas-title-line-height)}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{-webkit-mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);mask-image:linear-gradient(130deg,#000 55%,rgba(0,0,0,0.8) 75%,#000 95%);-webkit-mask-size:200% 100%;mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{-webkit-mask-position:-200% 0%;mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff!important;background-color:RGBA(var(--bs-primary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-secondary{color:#000!important;background-color:RGBA(var(--bs-secondary-rgb),var(--bs-bg-opacity,1))!important}.text-bg-success{color:#fff!important;background-color:RGBA(var(--bs-success-rgb),var(--bs-bg-opacity,1))!important}.text-bg-info{color:#fff!important;background-color:RGBA(var(--bs-info-rgb),var(--bs-bg-opacity,1))!important}.text-bg-warning{color:#fff!important;background-color:RGBA(var(--bs-warning-rgb),var(--bs-bg-opacity,1))!important}.text-bg-danger{color:#fff!important;background-color:RGBA(var(--bs-danger-rgb),var(--bs-bg-opacity,1))!important}.text-bg-light{color:#000!important;background-color:RGBA(var(--bs-light-rgb),var(--bs-bg-opacity,1))!important}.text-bg-dark{color:#fff!important;background-color:RGBA(var(--bs-dark-rgb),var(--bs-bg-opacity,1))!important}.link-primary{color:RGBA(var(--bs-primary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-primary-rgb),var(--bs-link-underline-opacity,1))!important}.link-primary:focus,.link-primary:hover{color:RGBA(42,71,184,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(42,71,184,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(42,71,184,var(--bs-link-underline-opacity,1))!important}.link-secondary{color:RGBA(var(--bs-secondary-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-secondary-rgb),var(--bs-link-underline-opacity,1))!important}.link-secondary:focus,.link-secondary:hover{color:RGBA(255,255,255,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(255,255,255,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(255,255,255,var(--bs-link-underline-opacity,1))!important}.link-success{color:RGBA(var(--bs-success-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-success-rgb),var(--bs-link-underline-opacity,1))!important}.link-success:focus,.link-success:hover{color:RGBA(38,143,102,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(38,143,102,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(38,143,102,var(--bs-link-underline-opacity,1))!important}.link-info{color:RGBA(var(--bs-info-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-info-rgb),var(--bs-link-underline-opacity,1))!important}.link-info:focus,.link-info:hover{color:RGBA(32,98,145,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(32,98,145,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(32,98,145,var(--bs-link-underline-opacity,1))!important}.link-warning{color:RGBA(var(--bs-warning-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-warning-rgb),var(--bs-link-underline-opacity,1))!important}.link-warning:focus,.link-warning:hover{color:RGBA(195,151,78,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(195,151,78,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(195,151,78,var(--bs-link-underline-opacity,1))!important}.link-danger{color:RGBA(var(--bs-danger-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-danger-rgb),var(--bs-link-underline-opacity,1))!important}.link-danger:focus,.link-danger:hover{color:RGBA(174,33,37,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(174,33,37,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(174,33,37,var(--bs-link-underline-opacity,1))!important}.link-light{color:RGBA(var(--bs-light-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-light-rgb),var(--bs-link-underline-opacity,1))!important}.link-light:focus,.link-light:hover{color:RGBA(249,250,251,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(249,250,251,var(--bs-link-underline-opacity,1))!important}.link-dark{color:RGBA(var(--bs-dark-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-dark-rgb),var(--bs-link-underline-opacity,1))!important}.link-dark:focus,.link-dark:hover{color:RGBA(26,30,33,var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(26,30,33,var(--bs-link-underline-opacity,1))!important}.link-body-emphasis{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,1))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-body-emphasis:focus,.link-body-emphasis:hover{color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-opacity,.75))!important;-webkit-text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important;text-decoration-color:RGBA(var(--bs-emphasis-color-rgb),var(--bs-link-underline-opacity,0.75))!important}.focus-ring:focus{outline:0;box-shadow:var(--bs-focus-ring-x,0) var(--bs-focus-ring-y,0) var(--bs-focus-ring-blur,0) var(--bs-focus-ring-width) var(--bs-focus-ring-color)}.icon-link{display:inline-flex;gap:.375rem;align-items:center;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-opacity,0.5));text-underline-offset:0.25em;-webkit-backface-visibility:hidden;backface-visibility:hidden}.icon-link>.bi{flex-shrink:0;width:1em;height:1em;fill:currentcolor;transition:.2s ease-in-out transform}@media (prefers-reduced-motion:reduce){.icon-link>.bi{transition:none}}.icon-link-hover:focus-visible>.bi,.icon-link-hover:hover>.bi{transform:var(--bs-icon-link-transform,translate3d(.25em,0,0))}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio:100%}.ratio-4x3{--bs-aspect-ratio:75%}.ratio-16x9{--bs-aspect-ratio:56.25%}.ratio-21x9{--bs-aspect-ratio:42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}@media (min-width:576px){.sticky-sm-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:768px){.sticky-md-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:992px){.sticky-lg-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1200px){.sticky-xl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}@media (min-width:1400px){.sticky-xxl-top{position:-webkit-sticky;position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:-webkit-sticky;position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){width:1px!important;height:1px!important;padding:0!important;margin:-1px!important;overflow:hidden!important;clip:rect(0,0,0,0)!important;white-space:nowrap!important;border:0!important}.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption),.visually-hidden:not(caption){position:absolute!important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:var(--bs-border-width);min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline!important}.align-top{vertical-align:top!important}.align-middle{vertical-align:middle!important}.align-bottom{vertical-align:bottom!important}.align-text-bottom{vertical-align:text-bottom!important}.align-text-top{vertical-align:text-top!important}.float-start{float:left!important}.float-end{float:right!important}.float-none{float:none!important}.object-fit-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-none{-o-object-fit:none!important;object-fit:none!important}.opacity-0{opacity:0!important}.opacity-25{opacity:.25!important}.opacity-50{opacity:.5!important}.opacity-75{opacity:.75!important}.opacity-100{opacity:1!important}.overflow-auto{overflow:auto!important}.overflow-hidden{overflow:hidden!important}.overflow-visible{overflow:visible!important}.overflow-scroll{overflow:scroll!important}.overflow-x-auto{overflow-x:auto!important}.overflow-x-hidden{overflow-x:hidden!important}.overflow-x-visible{overflow-x:visible!important}.overflow-x-scroll{overflow-x:scroll!important}.overflow-y-auto{overflow-y:auto!important}.overflow-y-hidden{overflow-y:hidden!important}.overflow-y-visible{overflow-y:visible!important}.overflow-y-scroll{overflow-y:scroll!important}.d-inline{display:inline!important}.d-inline-block{display:inline-block!important}.d-block{display:block!important}.d-grid{display:grid!important}.d-inline-grid{display:inline-grid!important}.d-table{display:table!important}.d-table-row{display:table-row!important}.d-table-cell{display:table-cell!important}.d-flex{display:flex!important}.d-inline-flex{display:inline-flex!important}.d-none{display:none!important}.shadow{box-shadow:var(--bs-box-shadow)!important}.shadow-sm{box-shadow:var(--bs-box-shadow-sm)!important}.shadow-lg{box-shadow:var(--bs-box-shadow-lg)!important}.shadow-none{box-shadow:none!important}.focus-ring-primary{--bs-focus-ring-color:rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-secondary{--bs-focus-ring-color:rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity))}.focus-ring-success{--bs-focus-ring-color:rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity))}.focus-ring-info{--bs-focus-ring-color:rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity))}.focus-ring-warning{--bs-focus-ring-color:rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity))}.focus-ring-danger{--bs-focus-ring-color:rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity))}.focus-ring-light{--bs-focus-ring-color:rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity))}.focus-ring-dark{--bs-focus-ring-color:rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity))}.position-static{position:static!important}.position-relative{position:relative!important}.position-absolute{position:absolute!important}.position-fixed{position:fixed!important}.position-sticky{position:-webkit-sticky!important;position:sticky!important}.top-0{top:0!important}.top-50{top:50%!important}.top-100{top:100%!important}.bottom-0{bottom:0!important}.bottom-50{bottom:50%!important}.bottom-100{bottom:100%!important}.start-0{left:0!important}.start-50{left:50%!important}.start-100{left:100%!important}.end-0{right:0!important}.end-50{right:50%!important}.end-100{right:100%!important}.translate-middle{transform:translate(-50%,-50%)!important}.translate-middle-x{transform:translateX(-50%)!important}.translate-middle-y{transform:translateY(-50%)!important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-0{border:0!important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-top-0{border-top:0!important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-end-0{border-right:0!important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-bottom-0{border-bottom:0!important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color)!important}.border-start-0{border-left:0!important}.border-primary{--bs-border-opacity:1;border-color:rgba(var(--bs-primary-rgb),var(--bs-border-opacity))!important}.border-secondary{--bs-border-opacity:1;border-color:rgba(var(--bs-secondary-rgb),var(--bs-border-opacity))!important}.border-success{--bs-border-opacity:1;border-color:rgba(var(--bs-success-rgb),var(--bs-border-opacity))!important}.border-info{--bs-border-opacity:1;border-color:rgba(var(--bs-info-rgb),var(--bs-border-opacity))!important}.border-warning{--bs-border-opacity:1;border-color:rgba(var(--bs-warning-rgb),var(--bs-border-opacity))!important}.border-danger{--bs-border-opacity:1;border-color:rgba(var(--bs-danger-rgb),var(--bs-border-opacity))!important}.border-light{--bs-border-opacity:1;border-color:rgba(var(--bs-light-rgb),var(--bs-border-opacity))!important}.border-dark{--bs-border-opacity:1;border-color:rgba(var(--bs-dark-rgb),var(--bs-border-opacity))!important}.border-black{--bs-border-opacity:1;border-color:rgba(var(--bs-black-rgb),var(--bs-border-opacity))!important}.border-white{--bs-border-opacity:1;border-color:rgba(var(--bs-white-rgb),var(--bs-border-opacity))!important}.border-primary-subtle{border-color:var(--bs-primary-border-subtle)!important}.border-secondary-subtle{border-color:var(--bs-secondary-border-subtle)!important}.border-success-subtle{border-color:var(--bs-success-border-subtle)!important}.border-info-subtle{border-color:var(--bs-info-border-subtle)!important}.border-warning-subtle{border-color:var(--bs-warning-border-subtle)!important}.border-danger-subtle{border-color:var(--bs-danger-border-subtle)!important}.border-light-subtle{border-color:var(--bs-light-border-subtle)!important}.border-dark-subtle{border-color:var(--bs-dark-border-subtle)!important}.border-1{border-width:1px!important}.border-2{border-width:2px!important}.border-3{border-width:3px!important}.border-4{border-width:4px!important}.border-5{border-width:5px!important}.border-opacity-10{--bs-border-opacity:0.1}.border-opacity-25{--bs-border-opacity:0.25}.border-opacity-50{--bs-border-opacity:0.5}.border-opacity-75{--bs-border-opacity:0.75}.border-opacity-100{--bs-border-opacity:1}.w-25{width:25%!important}.w-50{width:50%!important}.w-75{width:75%!important}.w-100{width:100%!important}.w-auto{width:auto!important}.mw-100{max-width:100%!important}.vw-100{width:100vw!important}.min-vw-100{min-width:100vw!important}.h-25{height:25%!important}.h-50{height:50%!important}.h-75{height:75%!important}.h-100{height:100%!important}.h-auto{height:auto!important}.mh-100{max-height:100%!important}.vh-100{height:100vh!important}.min-vh-100{min-height:100vh!important}.flex-fill{flex:1 1 auto!important}.flex-row{flex-direction:row!important}.flex-column{flex-direction:column!important}.flex-row-reverse{flex-direction:row-reverse!important}.flex-column-reverse{flex-direction:column-reverse!important}.flex-grow-0{flex-grow:0!important}.flex-grow-1{flex-grow:1!important}.flex-shrink-0{flex-shrink:0!important}.flex-shrink-1{flex-shrink:1!important}.flex-wrap{flex-wrap:wrap!important}.flex-nowrap{flex-wrap:nowrap!important}.flex-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-start{justify-content:flex-start!important}.justify-content-end{justify-content:flex-end!important}.justify-content-center{justify-content:center!important}.justify-content-between{justify-content:space-between!important}.justify-content-around{justify-content:space-around!important}.justify-content-evenly{justify-content:space-evenly!important}.align-items-start{align-items:flex-start!important}.align-items-end{align-items:flex-end!important}.align-items-center{align-items:center!important}.align-items-baseline{align-items:baseline!important}.align-items-stretch{align-items:stretch!important}.align-content-start{align-content:flex-start!important}.align-content-end{align-content:flex-end!important}.align-content-center{align-content:center!important}.align-content-between{align-content:space-between!important}.align-content-around{align-content:space-around!important}.align-content-stretch{align-content:stretch!important}.align-self-auto{align-self:auto!important}.align-self-start{align-self:flex-start!important}.align-self-end{align-self:flex-end!important}.align-self-center{align-self:center!important}.align-self-baseline{align-self:baseline!important}.align-self-stretch{align-self:stretch!important}.order-first{order:-1!important}.order-0{order:0!important}.order-1{order:1!important}.order-2{order:2!important}.order-3{order:3!important}.order-4{order:4!important}.order-5{order:5!important}.order-last{order:6!important}.m-0{margin:0!important}.m-1{margin:.25rem!important}.m-2{margin:.5rem!important}.m-3{margin:1rem!important}.m-4{margin:1.5rem!important}.m-5{margin:3rem!important}.m-auto{margin:auto!important}.mx-0{margin-right:0!important;margin-left:0!important}.mx-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-3{margin-right:1rem!important;margin-left:1rem!important}.mx-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-5{margin-right:3rem!important;margin-left:3rem!important}.mx-auto{margin-right:auto!important;margin-left:auto!important}.my-0{margin-top:0!important;margin-bottom:0!important}.my-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-0{margin-top:0!important}.mt-1{margin-top:.25rem!important}.mt-2{margin-top:.5rem!important}.mt-3{margin-top:1rem!important}.mt-4{margin-top:1.5rem!important}.mt-5{margin-top:3rem!important}.mt-auto{margin-top:auto!important}.me-0{margin-right:0!important}.me-1{margin-right:.25rem!important}.me-2{margin-right:.5rem!important}.me-3{margin-right:1rem!important}.me-4{margin-right:1.5rem!important}.me-5{margin-right:3rem!important}.me-auto{margin-right:auto!important}.mb-0{margin-bottom:0!important}.mb-1{margin-bottom:.25rem!important}.mb-2{margin-bottom:.5rem!important}.mb-3{margin-bottom:1rem!important}.mb-4{margin-bottom:1.5rem!important}.mb-5{margin-bottom:3rem!important}.mb-auto{margin-bottom:auto!important}.ms-0{margin-left:0!important}.ms-1{margin-left:.25rem!important}.ms-2{margin-left:.5rem!important}.ms-3{margin-left:1rem!important}.ms-4{margin-left:1.5rem!important}.ms-5{margin-left:3rem!important}.ms-auto{margin-left:auto!important}.p-0{padding:0!important}.p-1{padding:.25rem!important}.p-2{padding:.5rem!important}.p-3{padding:1rem!important}.p-4{padding:1.5rem!important}.p-5{padding:3rem!important}.px-0{padding-right:0!important;padding-left:0!important}.px-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-3{padding-right:1rem!important;padding-left:1rem!important}.px-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-5{padding-right:3rem!important;padding-left:3rem!important}.py-0{padding-top:0!important;padding-bottom:0!important}.py-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-0{padding-top:0!important}.pt-1{padding-top:.25rem!important}.pt-2{padding-top:.5rem!important}.pt-3{padding-top:1rem!important}.pt-4{padding-top:1.5rem!important}.pt-5{padding-top:3rem!important}.pe-0{padding-right:0!important}.pe-1{padding-right:.25rem!important}.pe-2{padding-right:.5rem!important}.pe-3{padding-right:1rem!important}.pe-4{padding-right:1.5rem!important}.pe-5{padding-right:3rem!important}.pb-0{padding-bottom:0!important}.pb-1{padding-bottom:.25rem!important}.pb-2{padding-bottom:.5rem!important}.pb-3{padding-bottom:1rem!important}.pb-4{padding-bottom:1.5rem!important}.pb-5{padding-bottom:3rem!important}.ps-0{padding-left:0!important}.ps-1{padding-left:.25rem!important}.ps-2{padding-left:.5rem!important}.ps-3{padding-left:1rem!important}.ps-4{padding-left:1.5rem!important}.ps-5{padding-left:3rem!important}.gap-0{gap:0!important}.gap-1{gap:.25rem!important}.gap-2{gap:.5rem!important}.gap-3{gap:1rem!important}.gap-4{gap:1.5rem!important}.gap-5{gap:3rem!important}.row-gap-0{row-gap:0!important}.row-gap-1{row-gap:.25rem!important}.row-gap-2{row-gap:.5rem!important}.row-gap-3{row-gap:1rem!important}.row-gap-4{row-gap:1.5rem!important}.row-gap-5{row-gap:3rem!important}.column-gap-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.font-monospace{font-family:var(--bs-font-monospace)!important}.fs-1{font-size:calc(1.375rem + 1.5vw)!important}.fs-2{font-size:calc(1.325rem + .9vw)!important}.fs-3{font-size:calc(1.3rem + .6vw)!important}.fs-4{font-size:calc(1.275rem + .3vw)!important}.fs-5{font-size:1.25rem!important}.fs-6{font-size:1rem!important}.fst-italic{font-style:italic!important}.fst-normal{font-style:normal!important}.fw-lighter{font-weight:lighter!important}.fw-light{font-weight:300!important}.fw-normal{font-weight:400!important}.fw-medium{font-weight:500!important}.fw-semibold{font-weight:600!important}.fw-bold{font-weight:700!important}.fw-bolder{font-weight:bolder!important}.lh-1{line-height:1!important}.lh-sm{line-height:1.25!important}.lh-base{line-height:1.5!important}.lh-lg{line-height:2!important}.text-start{text-align:left!important}.text-end{text-align:right!important}.text-center{text-align:center!important}.text-decoration-none{text-decoration:none!important}.text-decoration-underline{text-decoration:underline!important}.text-decoration-line-through{text-decoration:line-through!important}.text-lowercase{text-transform:lowercase!important}.text-uppercase{text-transform:uppercase!important}.text-capitalize{text-transform:capitalize!important}.text-wrap{white-space:normal!important}.text-nowrap{white-space:nowrap!important}.text-break{word-wrap:break-word!important;word-break:break-word!important}.text-primary{--bs-text-opacity:1;color:rgba(var(--bs-primary-rgb),var(--bs-text-opacity))!important}.text-secondary{--bs-text-opacity:1;color:rgba(var(--bs-secondary-rgb),var(--bs-text-opacity))!important}.text-success{--bs-text-opacity:1;color:rgba(var(--bs-success-rgb),var(--bs-text-opacity))!important}.text-info{--bs-text-opacity:1;color:rgba(var(--bs-info-rgb),var(--bs-text-opacity))!important}.text-warning{--bs-text-opacity:1;color:rgba(var(--bs-warning-rgb),var(--bs-text-opacity))!important}.text-danger{--bs-text-opacity:1;color:rgba(var(--bs-danger-rgb),var(--bs-text-opacity))!important}.text-light{--bs-text-opacity:1;color:rgba(var(--bs-light-rgb),var(--bs-text-opacity))!important}.text-dark{--bs-text-opacity:1;color:rgba(var(--bs-dark-rgb),var(--bs-text-opacity))!important}.text-black{--bs-text-opacity:1;color:rgba(var(--bs-black-rgb),var(--bs-text-opacity))!important}.text-white{--bs-text-opacity:1;color:rgba(var(--bs-white-rgb),var(--bs-text-opacity))!important}.text-body{--bs-text-opacity:1;color:rgba(var(--bs-body-color-rgb),var(--bs-text-opacity))!important}.text-muted{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-black-50{--bs-text-opacity:1;color:rgba(0,0,0,.5)!important}.text-white-50{--bs-text-opacity:1;color:rgba(255,255,255,.5)!important}.text-body-secondary{--bs-text-opacity:1;color:var(--bs-secondary-color)!important}.text-body-tertiary{--bs-text-opacity:1;color:var(--bs-tertiary-color)!important}.text-body-emphasis{--bs-text-opacity:1;color:var(--bs-emphasis-color)!important}.text-reset{--bs-text-opacity:1;color:inherit!important}.text-opacity-25{--bs-text-opacity:0.25}.text-opacity-50{--bs-text-opacity:0.5}.text-opacity-75{--bs-text-opacity:0.75}.text-opacity-100{--bs-text-opacity:1}.text-primary-emphasis{color:var(--bs-primary-text-emphasis)!important}.text-secondary-emphasis{color:var(--bs-secondary-text-emphasis)!important}.text-success-emphasis{color:var(--bs-success-text-emphasis)!important}.text-info-emphasis{color:var(--bs-info-text-emphasis)!important}.text-warning-emphasis{color:var(--bs-warning-text-emphasis)!important}.text-danger-emphasis{color:var(--bs-danger-text-emphasis)!important}.text-light-emphasis{color:var(--bs-light-text-emphasis)!important}.text-dark-emphasis{color:var(--bs-dark-text-emphasis)!important}.link-opacity-10{--bs-link-opacity:0.1}.link-opacity-10-hover:hover{--bs-link-opacity:0.1}.link-opacity-25{--bs-link-opacity:0.25}.link-opacity-25-hover:hover{--bs-link-opacity:0.25}.link-opacity-50{--bs-link-opacity:0.5}.link-opacity-50-hover:hover{--bs-link-opacity:0.5}.link-opacity-75{--bs-link-opacity:0.75}.link-opacity-75-hover:hover{--bs-link-opacity:0.75}.link-opacity-100{--bs-link-opacity:1}.link-opacity-100-hover:hover{--bs-link-opacity:1}.link-offset-1{text-underline-offset:0.125em!important}.link-offset-1-hover:hover{text-underline-offset:0.125em!important}.link-offset-2{text-underline-offset:0.25em!important}.link-offset-2-hover:hover{text-underline-offset:0.25em!important}.link-offset-3{text-underline-offset:0.375em!important}.link-offset-3-hover:hover{text-underline-offset:0.375em!important}.link-underline-primary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-primary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-secondary{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-secondary-rgb),var(--bs-link-underline-opacity))!important}.link-underline-success{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-success-rgb),var(--bs-link-underline-opacity))!important}.link-underline-info{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-info-rgb),var(--bs-link-underline-opacity))!important}.link-underline-warning{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-warning-rgb),var(--bs-link-underline-opacity))!important}.link-underline-danger{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-danger-rgb),var(--bs-link-underline-opacity))!important}.link-underline-light{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-light-rgb),var(--bs-link-underline-opacity))!important}.link-underline-dark{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important;text-decoration-color:rgba(var(--bs-dark-rgb),var(--bs-link-underline-opacity))!important}.link-underline{--bs-link-underline-opacity:1;-webkit-text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important;text-decoration-color:rgba(var(--bs-link-color-rgb),var(--bs-link-underline-opacity,1))!important}.link-underline-opacity-0{--bs-link-underline-opacity:0}.link-underline-opacity-0-hover:hover{--bs-link-underline-opacity:0}.link-underline-opacity-10{--bs-link-underline-opacity:0.1}.link-underline-opacity-10-hover:hover{--bs-link-underline-opacity:0.1}.link-underline-opacity-25{--bs-link-underline-opacity:0.25}.link-underline-opacity-25-hover:hover{--bs-link-underline-opacity:0.25}.link-underline-opacity-50{--bs-link-underline-opacity:0.5}.link-underline-opacity-50-hover:hover{--bs-link-underline-opacity:0.5}.link-underline-opacity-75{--bs-link-underline-opacity:0.75}.link-underline-opacity-75-hover:hover{--bs-link-underline-opacity:0.75}.link-underline-opacity-100{--bs-link-underline-opacity:1}.link-underline-opacity-100-hover:hover{--bs-link-underline-opacity:1}.bg-primary{--bs-bg-opacity:1;background-color:rgba(var(--bs-primary-rgb),var(--bs-bg-opacity))!important}.bg-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-rgb),var(--bs-bg-opacity))!important}.bg-success{--bs-bg-opacity:1;background-color:rgba(var(--bs-success-rgb),var(--bs-bg-opacity))!important}.bg-info{--bs-bg-opacity:1;background-color:rgba(var(--bs-info-rgb),var(--bs-bg-opacity))!important}.bg-warning{--bs-bg-opacity:1;background-color:rgba(var(--bs-warning-rgb),var(--bs-bg-opacity))!important}.bg-danger{--bs-bg-opacity:1;background-color:rgba(var(--bs-danger-rgb),var(--bs-bg-opacity))!important}.bg-light{--bs-bg-opacity:1;background-color:rgba(var(--bs-light-rgb),var(--bs-bg-opacity))!important}.bg-dark{--bs-bg-opacity:1;background-color:rgba(var(--bs-dark-rgb),var(--bs-bg-opacity))!important}.bg-black{--bs-bg-opacity:1;background-color:rgba(var(--bs-black-rgb),var(--bs-bg-opacity))!important}.bg-white{--bs-bg-opacity:1;background-color:rgba(var(--bs-white-rgb),var(--bs-bg-opacity))!important}.bg-body{--bs-bg-opacity:1;background-color:rgba(var(--bs-body-bg-rgb),var(--bs-bg-opacity))!important}.bg-transparent{--bs-bg-opacity:1;background-color:transparent!important}.bg-body-secondary{--bs-bg-opacity:1;background-color:rgba(var(--bs-secondary-bg-rgb),var(--bs-bg-opacity))!important}.bg-body-tertiary{--bs-bg-opacity:1;background-color:rgba(var(--bs-tertiary-bg-rgb),var(--bs-bg-opacity))!important}.bg-opacity-10{--bs-bg-opacity:0.1}.bg-opacity-25{--bs-bg-opacity:0.25}.bg-opacity-50{--bs-bg-opacity:0.5}.bg-opacity-75{--bs-bg-opacity:0.75}.bg-opacity-100{--bs-bg-opacity:1}.bg-primary-subtle{background-color:var(--bs-primary-bg-subtle)!important}.bg-secondary-subtle{background-color:var(--bs-secondary-bg-subtle)!important}.bg-success-subtle{background-color:var(--bs-success-bg-subtle)!important}.bg-info-subtle{background-color:var(--bs-info-bg-subtle)!important}.bg-warning-subtle{background-color:var(--bs-warning-bg-subtle)!important}.bg-danger-subtle{background-color:var(--bs-danger-bg-subtle)!important}.bg-light-subtle{background-color:var(--bs-light-bg-subtle)!important}.bg-dark-subtle{background-color:var(--bs-dark-bg-subtle)!important}.bg-gradient{background-image:var(--bs-gradient)!important}.user-select-all{-webkit-user-select:all!important;-moz-user-select:all!important;user-select:all!important}.user-select-auto{-webkit-user-select:auto!important;-moz-user-select:auto!important;user-select:auto!important}.user-select-none{-webkit-user-select:none!important;-moz-user-select:none!important;user-select:none!important}.pe-none{pointer-events:none!important}.pe-auto{pointer-events:auto!important}.rounded{border-radius:var(--bs-border-radius)!important}.rounded-0{border-radius:0!important}.rounded-1{border-radius:var(--bs-border-radius-sm)!important}.rounded-2{border-radius:var(--bs-border-radius)!important}.rounded-3{border-radius:var(--bs-border-radius-lg)!important}.rounded-4{border-radius:var(--bs-border-radius-xl)!important}.rounded-5{border-radius:var(--bs-border-radius-xxl)!important}.rounded-circle{border-radius:50%!important}.rounded-pill{border-radius:var(--bs-border-radius-pill)!important}.rounded-top{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-0{border-top-left-radius:0!important;border-top-right-radius:0!important}.rounded-top-1{border-top-left-radius:var(--bs-border-radius-sm)!important;border-top-right-radius:var(--bs-border-radius-sm)!important}.rounded-top-2{border-top-left-radius:var(--bs-border-radius)!important;border-top-right-radius:var(--bs-border-radius)!important}.rounded-top-3{border-top-left-radius:var(--bs-border-radius-lg)!important;border-top-right-radius:var(--bs-border-radius-lg)!important}.rounded-top-4{border-top-left-radius:var(--bs-border-radius-xl)!important;border-top-right-radius:var(--bs-border-radius-xl)!important}.rounded-top-5{border-top-left-radius:var(--bs-border-radius-xxl)!important;border-top-right-radius:var(--bs-border-radius-xxl)!important}.rounded-top-circle{border-top-left-radius:50%!important;border-top-right-radius:50%!important}.rounded-top-pill{border-top-left-radius:var(--bs-border-radius-pill)!important;border-top-right-radius:var(--bs-border-radius-pill)!important}.rounded-end{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-0{border-top-right-radius:0!important;border-bottom-right-radius:0!important}.rounded-end-1{border-top-right-radius:var(--bs-border-radius-sm)!important;border-bottom-right-radius:var(--bs-border-radius-sm)!important}.rounded-end-2{border-top-right-radius:var(--bs-border-radius)!important;border-bottom-right-radius:var(--bs-border-radius)!important}.rounded-end-3{border-top-right-radius:var(--bs-border-radius-lg)!important;border-bottom-right-radius:var(--bs-border-radius-lg)!important}.rounded-end-4{border-top-right-radius:var(--bs-border-radius-xl)!important;border-bottom-right-radius:var(--bs-border-radius-xl)!important}.rounded-end-5{border-top-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-right-radius:var(--bs-border-radius-xxl)!important}.rounded-end-circle{border-top-right-radius:50%!important;border-bottom-right-radius:50%!important}.rounded-end-pill{border-top-right-radius:var(--bs-border-radius-pill)!important;border-bottom-right-radius:var(--bs-border-radius-pill)!important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-0{border-bottom-right-radius:0!important;border-bottom-left-radius:0!important}.rounded-bottom-1{border-bottom-right-radius:var(--bs-border-radius-sm)!important;border-bottom-left-radius:var(--bs-border-radius-sm)!important}.rounded-bottom-2{border-bottom-right-radius:var(--bs-border-radius)!important;border-bottom-left-radius:var(--bs-border-radius)!important}.rounded-bottom-3{border-bottom-right-radius:var(--bs-border-radius-lg)!important;border-bottom-left-radius:var(--bs-border-radius-lg)!important}.rounded-bottom-4{border-bottom-right-radius:var(--bs-border-radius-xl)!important;border-bottom-left-radius:var(--bs-border-radius-xl)!important}.rounded-bottom-5{border-bottom-right-radius:var(--bs-border-radius-xxl)!important;border-bottom-left-radius:var(--bs-border-radius-xxl)!important}.rounded-bottom-circle{border-bottom-right-radius:50%!important;border-bottom-left-radius:50%!important}.rounded-bottom-pill{border-bottom-right-radius:var(--bs-border-radius-pill)!important;border-bottom-left-radius:var(--bs-border-radius-pill)!important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-0{border-bottom-left-radius:0!important;border-top-left-radius:0!important}.rounded-start-1{border-bottom-left-radius:var(--bs-border-radius-sm)!important;border-top-left-radius:var(--bs-border-radius-sm)!important}.rounded-start-2{border-bottom-left-radius:var(--bs-border-radius)!important;border-top-left-radius:var(--bs-border-radius)!important}.rounded-start-3{border-bottom-left-radius:var(--bs-border-radius-lg)!important;border-top-left-radius:var(--bs-border-radius-lg)!important}.rounded-start-4{border-bottom-left-radius:var(--bs-border-radius-xl)!important;border-top-left-radius:var(--bs-border-radius-xl)!important}.rounded-start-5{border-bottom-left-radius:var(--bs-border-radius-xxl)!important;border-top-left-radius:var(--bs-border-radius-xxl)!important}.rounded-start-circle{border-bottom-left-radius:50%!important;border-top-left-radius:50%!important}.rounded-start-pill{border-bottom-left-radius:var(--bs-border-radius-pill)!important;border-top-left-radius:var(--bs-border-radius-pill)!important}.visible{visibility:visible!important}.invisible{visibility:hidden!important}.z-n1{z-index:-1!important}.z-0{z-index:0!important}.z-1{z-index:1!important}.z-2{z-index:2!important}.z-3{z-index:3!important}@media (min-width:576px){.float-sm-start{float:left!important}.float-sm-end{float:right!important}.float-sm-none{float:none!important}.object-fit-sm-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-sm-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-sm-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-sm-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-sm-none{-o-object-fit:none!important;object-fit:none!important}.d-sm-inline{display:inline!important}.d-sm-inline-block{display:inline-block!important}.d-sm-block{display:block!important}.d-sm-grid{display:grid!important}.d-sm-inline-grid{display:inline-grid!important}.d-sm-table{display:table!important}.d-sm-table-row{display:table-row!important}.d-sm-table-cell{display:table-cell!important}.d-sm-flex{display:flex!important}.d-sm-inline-flex{display:inline-flex!important}.d-sm-none{display:none!important}.flex-sm-fill{flex:1 1 auto!important}.flex-sm-row{flex-direction:row!important}.flex-sm-column{flex-direction:column!important}.flex-sm-row-reverse{flex-direction:row-reverse!important}.flex-sm-column-reverse{flex-direction:column-reverse!important}.flex-sm-grow-0{flex-grow:0!important}.flex-sm-grow-1{flex-grow:1!important}.flex-sm-shrink-0{flex-shrink:0!important}.flex-sm-shrink-1{flex-shrink:1!important}.flex-sm-wrap{flex-wrap:wrap!important}.flex-sm-nowrap{flex-wrap:nowrap!important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-sm-start{justify-content:flex-start!important}.justify-content-sm-end{justify-content:flex-end!important}.justify-content-sm-center{justify-content:center!important}.justify-content-sm-between{justify-content:space-between!important}.justify-content-sm-around{justify-content:space-around!important}.justify-content-sm-evenly{justify-content:space-evenly!important}.align-items-sm-start{align-items:flex-start!important}.align-items-sm-end{align-items:flex-end!important}.align-items-sm-center{align-items:center!important}.align-items-sm-baseline{align-items:baseline!important}.align-items-sm-stretch{align-items:stretch!important}.align-content-sm-start{align-content:flex-start!important}.align-content-sm-end{align-content:flex-end!important}.align-content-sm-center{align-content:center!important}.align-content-sm-between{align-content:space-between!important}.align-content-sm-around{align-content:space-around!important}.align-content-sm-stretch{align-content:stretch!important}.align-self-sm-auto{align-self:auto!important}.align-self-sm-start{align-self:flex-start!important}.align-self-sm-end{align-self:flex-end!important}.align-self-sm-center{align-self:center!important}.align-self-sm-baseline{align-self:baseline!important}.align-self-sm-stretch{align-self:stretch!important}.order-sm-first{order:-1!important}.order-sm-0{order:0!important}.order-sm-1{order:1!important}.order-sm-2{order:2!important}.order-sm-3{order:3!important}.order-sm-4{order:4!important}.order-sm-5{order:5!important}.order-sm-last{order:6!important}.m-sm-0{margin:0!important}.m-sm-1{margin:.25rem!important}.m-sm-2{margin:.5rem!important}.m-sm-3{margin:1rem!important}.m-sm-4{margin:1.5rem!important}.m-sm-5{margin:3rem!important}.m-sm-auto{margin:auto!important}.mx-sm-0{margin-right:0!important;margin-left:0!important}.mx-sm-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-sm-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-sm-3{margin-right:1rem!important;margin-left:1rem!important}.mx-sm-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-sm-5{margin-right:3rem!important;margin-left:3rem!important}.mx-sm-auto{margin-right:auto!important;margin-left:auto!important}.my-sm-0{margin-top:0!important;margin-bottom:0!important}.my-sm-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-sm-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-sm-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-sm-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-sm-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-sm-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-sm-0{margin-top:0!important}.mt-sm-1{margin-top:.25rem!important}.mt-sm-2{margin-top:.5rem!important}.mt-sm-3{margin-top:1rem!important}.mt-sm-4{margin-top:1.5rem!important}.mt-sm-5{margin-top:3rem!important}.mt-sm-auto{margin-top:auto!important}.me-sm-0{margin-right:0!important}.me-sm-1{margin-right:.25rem!important}.me-sm-2{margin-right:.5rem!important}.me-sm-3{margin-right:1rem!important}.me-sm-4{margin-right:1.5rem!important}.me-sm-5{margin-right:3rem!important}.me-sm-auto{margin-right:auto!important}.mb-sm-0{margin-bottom:0!important}.mb-sm-1{margin-bottom:.25rem!important}.mb-sm-2{margin-bottom:.5rem!important}.mb-sm-3{margin-bottom:1rem!important}.mb-sm-4{margin-bottom:1.5rem!important}.mb-sm-5{margin-bottom:3rem!important}.mb-sm-auto{margin-bottom:auto!important}.ms-sm-0{margin-left:0!important}.ms-sm-1{margin-left:.25rem!important}.ms-sm-2{margin-left:.5rem!important}.ms-sm-3{margin-left:1rem!important}.ms-sm-4{margin-left:1.5rem!important}.ms-sm-5{margin-left:3rem!important}.ms-sm-auto{margin-left:auto!important}.p-sm-0{padding:0!important}.p-sm-1{padding:.25rem!important}.p-sm-2{padding:.5rem!important}.p-sm-3{padding:1rem!important}.p-sm-4{padding:1.5rem!important}.p-sm-5{padding:3rem!important}.px-sm-0{padding-right:0!important;padding-left:0!important}.px-sm-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-sm-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-sm-3{padding-right:1rem!important;padding-left:1rem!important}.px-sm-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-sm-5{padding-right:3rem!important;padding-left:3rem!important}.py-sm-0{padding-top:0!important;padding-bottom:0!important}.py-sm-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-sm-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-sm-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-sm-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-sm-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-sm-0{padding-top:0!important}.pt-sm-1{padding-top:.25rem!important}.pt-sm-2{padding-top:.5rem!important}.pt-sm-3{padding-top:1rem!important}.pt-sm-4{padding-top:1.5rem!important}.pt-sm-5{padding-top:3rem!important}.pe-sm-0{padding-right:0!important}.pe-sm-1{padding-right:.25rem!important}.pe-sm-2{padding-right:.5rem!important}.pe-sm-3{padding-right:1rem!important}.pe-sm-4{padding-right:1.5rem!important}.pe-sm-5{padding-right:3rem!important}.pb-sm-0{padding-bottom:0!important}.pb-sm-1{padding-bottom:.25rem!important}.pb-sm-2{padding-bottom:.5rem!important}.pb-sm-3{padding-bottom:1rem!important}.pb-sm-4{padding-bottom:1.5rem!important}.pb-sm-5{padding-bottom:3rem!important}.ps-sm-0{padding-left:0!important}.ps-sm-1{padding-left:.25rem!important}.ps-sm-2{padding-left:.5rem!important}.ps-sm-3{padding-left:1rem!important}.ps-sm-4{padding-left:1.5rem!important}.ps-sm-5{padding-left:3rem!important}.gap-sm-0{gap:0!important}.gap-sm-1{gap:.25rem!important}.gap-sm-2{gap:.5rem!important}.gap-sm-3{gap:1rem!important}.gap-sm-4{gap:1.5rem!important}.gap-sm-5{gap:3rem!important}.row-gap-sm-0{row-gap:0!important}.row-gap-sm-1{row-gap:.25rem!important}.row-gap-sm-2{row-gap:.5rem!important}.row-gap-sm-3{row-gap:1rem!important}.row-gap-sm-4{row-gap:1.5rem!important}.row-gap-sm-5{row-gap:3rem!important}.column-gap-sm-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-sm-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-sm-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-sm-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-sm-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-sm-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-sm-start{text-align:left!important}.text-sm-end{text-align:right!important}.text-sm-center{text-align:center!important}}@media (min-width:768px){.float-md-start{float:left!important}.float-md-end{float:right!important}.float-md-none{float:none!important}.object-fit-md-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-md-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-md-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-md-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-md-none{-o-object-fit:none!important;object-fit:none!important}.d-md-inline{display:inline!important}.d-md-inline-block{display:inline-block!important}.d-md-block{display:block!important}.d-md-grid{display:grid!important}.d-md-inline-grid{display:inline-grid!important}.d-md-table{display:table!important}.d-md-table-row{display:table-row!important}.d-md-table-cell{display:table-cell!important}.d-md-flex{display:flex!important}.d-md-inline-flex{display:inline-flex!important}.d-md-none{display:none!important}.flex-md-fill{flex:1 1 auto!important}.flex-md-row{flex-direction:row!important}.flex-md-column{flex-direction:column!important}.flex-md-row-reverse{flex-direction:row-reverse!important}.flex-md-column-reverse{flex-direction:column-reverse!important}.flex-md-grow-0{flex-grow:0!important}.flex-md-grow-1{flex-grow:1!important}.flex-md-shrink-0{flex-shrink:0!important}.flex-md-shrink-1{flex-shrink:1!important}.flex-md-wrap{flex-wrap:wrap!important}.flex-md-nowrap{flex-wrap:nowrap!important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-md-start{justify-content:flex-start!important}.justify-content-md-end{justify-content:flex-end!important}.justify-content-md-center{justify-content:center!important}.justify-content-md-between{justify-content:space-between!important}.justify-content-md-around{justify-content:space-around!important}.justify-content-md-evenly{justify-content:space-evenly!important}.align-items-md-start{align-items:flex-start!important}.align-items-md-end{align-items:flex-end!important}.align-items-md-center{align-items:center!important}.align-items-md-baseline{align-items:baseline!important}.align-items-md-stretch{align-items:stretch!important}.align-content-md-start{align-content:flex-start!important}.align-content-md-end{align-content:flex-end!important}.align-content-md-center{align-content:center!important}.align-content-md-between{align-content:space-between!important}.align-content-md-around{align-content:space-around!important}.align-content-md-stretch{align-content:stretch!important}.align-self-md-auto{align-self:auto!important}.align-self-md-start{align-self:flex-start!important}.align-self-md-end{align-self:flex-end!important}.align-self-md-center{align-self:center!important}.align-self-md-baseline{align-self:baseline!important}.align-self-md-stretch{align-self:stretch!important}.order-md-first{order:-1!important}.order-md-0{order:0!important}.order-md-1{order:1!important}.order-md-2{order:2!important}.order-md-3{order:3!important}.order-md-4{order:4!important}.order-md-5{order:5!important}.order-md-last{order:6!important}.m-md-0{margin:0!important}.m-md-1{margin:.25rem!important}.m-md-2{margin:.5rem!important}.m-md-3{margin:1rem!important}.m-md-4{margin:1.5rem!important}.m-md-5{margin:3rem!important}.m-md-auto{margin:auto!important}.mx-md-0{margin-right:0!important;margin-left:0!important}.mx-md-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-md-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-md-3{margin-right:1rem!important;margin-left:1rem!important}.mx-md-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-md-5{margin-right:3rem!important;margin-left:3rem!important}.mx-md-auto{margin-right:auto!important;margin-left:auto!important}.my-md-0{margin-top:0!important;margin-bottom:0!important}.my-md-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-md-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-md-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-md-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-md-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-md-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-md-0{margin-top:0!important}.mt-md-1{margin-top:.25rem!important}.mt-md-2{margin-top:.5rem!important}.mt-md-3{margin-top:1rem!important}.mt-md-4{margin-top:1.5rem!important}.mt-md-5{margin-top:3rem!important}.mt-md-auto{margin-top:auto!important}.me-md-0{margin-right:0!important}.me-md-1{margin-right:.25rem!important}.me-md-2{margin-right:.5rem!important}.me-md-3{margin-right:1rem!important}.me-md-4{margin-right:1.5rem!important}.me-md-5{margin-right:3rem!important}.me-md-auto{margin-right:auto!important}.mb-md-0{margin-bottom:0!important}.mb-md-1{margin-bottom:.25rem!important}.mb-md-2{margin-bottom:.5rem!important}.mb-md-3{margin-bottom:1rem!important}.mb-md-4{margin-bottom:1.5rem!important}.mb-md-5{margin-bottom:3rem!important}.mb-md-auto{margin-bottom:auto!important}.ms-md-0{margin-left:0!important}.ms-md-1{margin-left:.25rem!important}.ms-md-2{margin-left:.5rem!important}.ms-md-3{margin-left:1rem!important}.ms-md-4{margin-left:1.5rem!important}.ms-md-5{margin-left:3rem!important}.ms-md-auto{margin-left:auto!important}.p-md-0{padding:0!important}.p-md-1{padding:.25rem!important}.p-md-2{padding:.5rem!important}.p-md-3{padding:1rem!important}.p-md-4{padding:1.5rem!important}.p-md-5{padding:3rem!important}.px-md-0{padding-right:0!important;padding-left:0!important}.px-md-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-md-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-md-3{padding-right:1rem!important;padding-left:1rem!important}.px-md-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-md-5{padding-right:3rem!important;padding-left:3rem!important}.py-md-0{padding-top:0!important;padding-bottom:0!important}.py-md-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-md-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-md-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-md-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-md-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-md-0{padding-top:0!important}.pt-md-1{padding-top:.25rem!important}.pt-md-2{padding-top:.5rem!important}.pt-md-3{padding-top:1rem!important}.pt-md-4{padding-top:1.5rem!important}.pt-md-5{padding-top:3rem!important}.pe-md-0{padding-right:0!important}.pe-md-1{padding-right:.25rem!important}.pe-md-2{padding-right:.5rem!important}.pe-md-3{padding-right:1rem!important}.pe-md-4{padding-right:1.5rem!important}.pe-md-5{padding-right:3rem!important}.pb-md-0{padding-bottom:0!important}.pb-md-1{padding-bottom:.25rem!important}.pb-md-2{padding-bottom:.5rem!important}.pb-md-3{padding-bottom:1rem!important}.pb-md-4{padding-bottom:1.5rem!important}.pb-md-5{padding-bottom:3rem!important}.ps-md-0{padding-left:0!important}.ps-md-1{padding-left:.25rem!important}.ps-md-2{padding-left:.5rem!important}.ps-md-3{padding-left:1rem!important}.ps-md-4{padding-left:1.5rem!important}.ps-md-5{padding-left:3rem!important}.gap-md-0{gap:0!important}.gap-md-1{gap:.25rem!important}.gap-md-2{gap:.5rem!important}.gap-md-3{gap:1rem!important}.gap-md-4{gap:1.5rem!important}.gap-md-5{gap:3rem!important}.row-gap-md-0{row-gap:0!important}.row-gap-md-1{row-gap:.25rem!important}.row-gap-md-2{row-gap:.5rem!important}.row-gap-md-3{row-gap:1rem!important}.row-gap-md-4{row-gap:1.5rem!important}.row-gap-md-5{row-gap:3rem!important}.column-gap-md-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-md-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-md-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-md-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-md-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-md-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-md-start{text-align:left!important}.text-md-end{text-align:right!important}.text-md-center{text-align:center!important}}@media (min-width:992px){.float-lg-start{float:left!important}.float-lg-end{float:right!important}.float-lg-none{float:none!important}.object-fit-lg-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-lg-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-lg-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-lg-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-lg-none{-o-object-fit:none!important;object-fit:none!important}.d-lg-inline{display:inline!important}.d-lg-inline-block{display:inline-block!important}.d-lg-block{display:block!important}.d-lg-grid{display:grid!important}.d-lg-inline-grid{display:inline-grid!important}.d-lg-table{display:table!important}.d-lg-table-row{display:table-row!important}.d-lg-table-cell{display:table-cell!important}.d-lg-flex{display:flex!important}.d-lg-inline-flex{display:inline-flex!important}.d-lg-none{display:none!important}.flex-lg-fill{flex:1 1 auto!important}.flex-lg-row{flex-direction:row!important}.flex-lg-column{flex-direction:column!important}.flex-lg-row-reverse{flex-direction:row-reverse!important}.flex-lg-column-reverse{flex-direction:column-reverse!important}.flex-lg-grow-0{flex-grow:0!important}.flex-lg-grow-1{flex-grow:1!important}.flex-lg-shrink-0{flex-shrink:0!important}.flex-lg-shrink-1{flex-shrink:1!important}.flex-lg-wrap{flex-wrap:wrap!important}.flex-lg-nowrap{flex-wrap:nowrap!important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-lg-start{justify-content:flex-start!important}.justify-content-lg-end{justify-content:flex-end!important}.justify-content-lg-center{justify-content:center!important}.justify-content-lg-between{justify-content:space-between!important}.justify-content-lg-around{justify-content:space-around!important}.justify-content-lg-evenly{justify-content:space-evenly!important}.align-items-lg-start{align-items:flex-start!important}.align-items-lg-end{align-items:flex-end!important}.align-items-lg-center{align-items:center!important}.align-items-lg-baseline{align-items:baseline!important}.align-items-lg-stretch{align-items:stretch!important}.align-content-lg-start{align-content:flex-start!important}.align-content-lg-end{align-content:flex-end!important}.align-content-lg-center{align-content:center!important}.align-content-lg-between{align-content:space-between!important}.align-content-lg-around{align-content:space-around!important}.align-content-lg-stretch{align-content:stretch!important}.align-self-lg-auto{align-self:auto!important}.align-self-lg-start{align-self:flex-start!important}.align-self-lg-end{align-self:flex-end!important}.align-self-lg-center{align-self:center!important}.align-self-lg-baseline{align-self:baseline!important}.align-self-lg-stretch{align-self:stretch!important}.order-lg-first{order:-1!important}.order-lg-0{order:0!important}.order-lg-1{order:1!important}.order-lg-2{order:2!important}.order-lg-3{order:3!important}.order-lg-4{order:4!important}.order-lg-5{order:5!important}.order-lg-last{order:6!important}.m-lg-0{margin:0!important}.m-lg-1{margin:.25rem!important}.m-lg-2{margin:.5rem!important}.m-lg-3{margin:1rem!important}.m-lg-4{margin:1.5rem!important}.m-lg-5{margin:3rem!important}.m-lg-auto{margin:auto!important}.mx-lg-0{margin-right:0!important;margin-left:0!important}.mx-lg-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-lg-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-lg-3{margin-right:1rem!important;margin-left:1rem!important}.mx-lg-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-lg-5{margin-right:3rem!important;margin-left:3rem!important}.mx-lg-auto{margin-right:auto!important;margin-left:auto!important}.my-lg-0{margin-top:0!important;margin-bottom:0!important}.my-lg-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-lg-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-lg-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-lg-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-lg-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-lg-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-lg-0{margin-top:0!important}.mt-lg-1{margin-top:.25rem!important}.mt-lg-2{margin-top:.5rem!important}.mt-lg-3{margin-top:1rem!important}.mt-lg-4{margin-top:1.5rem!important}.mt-lg-5{margin-top:3rem!important}.mt-lg-auto{margin-top:auto!important}.me-lg-0{margin-right:0!important}.me-lg-1{margin-right:.25rem!important}.me-lg-2{margin-right:.5rem!important}.me-lg-3{margin-right:1rem!important}.me-lg-4{margin-right:1.5rem!important}.me-lg-5{margin-right:3rem!important}.me-lg-auto{margin-right:auto!important}.mb-lg-0{margin-bottom:0!important}.mb-lg-1{margin-bottom:.25rem!important}.mb-lg-2{margin-bottom:.5rem!important}.mb-lg-3{margin-bottom:1rem!important}.mb-lg-4{margin-bottom:1.5rem!important}.mb-lg-5{margin-bottom:3rem!important}.mb-lg-auto{margin-bottom:auto!important}.ms-lg-0{margin-left:0!important}.ms-lg-1{margin-left:.25rem!important}.ms-lg-2{margin-left:.5rem!important}.ms-lg-3{margin-left:1rem!important}.ms-lg-4{margin-left:1.5rem!important}.ms-lg-5{margin-left:3rem!important}.ms-lg-auto{margin-left:auto!important}.p-lg-0{padding:0!important}.p-lg-1{padding:.25rem!important}.p-lg-2{padding:.5rem!important}.p-lg-3{padding:1rem!important}.p-lg-4{padding:1.5rem!important}.p-lg-5{padding:3rem!important}.px-lg-0{padding-right:0!important;padding-left:0!important}.px-lg-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-lg-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-lg-3{padding-right:1rem!important;padding-left:1rem!important}.px-lg-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-lg-5{padding-right:3rem!important;padding-left:3rem!important}.py-lg-0{padding-top:0!important;padding-bottom:0!important}.py-lg-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-lg-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-lg-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-lg-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-lg-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-lg-0{padding-top:0!important}.pt-lg-1{padding-top:.25rem!important}.pt-lg-2{padding-top:.5rem!important}.pt-lg-3{padding-top:1rem!important}.pt-lg-4{padding-top:1.5rem!important}.pt-lg-5{padding-top:3rem!important}.pe-lg-0{padding-right:0!important}.pe-lg-1{padding-right:.25rem!important}.pe-lg-2{padding-right:.5rem!important}.pe-lg-3{padding-right:1rem!important}.pe-lg-4{padding-right:1.5rem!important}.pe-lg-5{padding-right:3rem!important}.pb-lg-0{padding-bottom:0!important}.pb-lg-1{padding-bottom:.25rem!important}.pb-lg-2{padding-bottom:.5rem!important}.pb-lg-3{padding-bottom:1rem!important}.pb-lg-4{padding-bottom:1.5rem!important}.pb-lg-5{padding-bottom:3rem!important}.ps-lg-0{padding-left:0!important}.ps-lg-1{padding-left:.25rem!important}.ps-lg-2{padding-left:.5rem!important}.ps-lg-3{padding-left:1rem!important}.ps-lg-4{padding-left:1.5rem!important}.ps-lg-5{padding-left:3rem!important}.gap-lg-0{gap:0!important}.gap-lg-1{gap:.25rem!important}.gap-lg-2{gap:.5rem!important}.gap-lg-3{gap:1rem!important}.gap-lg-4{gap:1.5rem!important}.gap-lg-5{gap:3rem!important}.row-gap-lg-0{row-gap:0!important}.row-gap-lg-1{row-gap:.25rem!important}.row-gap-lg-2{row-gap:.5rem!important}.row-gap-lg-3{row-gap:1rem!important}.row-gap-lg-4{row-gap:1.5rem!important}.row-gap-lg-5{row-gap:3rem!important}.column-gap-lg-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-lg-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-lg-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-lg-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-lg-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-lg-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-lg-start{text-align:left!important}.text-lg-end{text-align:right!important}.text-lg-center{text-align:center!important}}@media (min-width:1200px){.float-xl-start{float:left!important}.float-xl-end{float:right!important}.float-xl-none{float:none!important}.object-fit-xl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xl-none{-o-object-fit:none!important;object-fit:none!important}.d-xl-inline{display:inline!important}.d-xl-inline-block{display:inline-block!important}.d-xl-block{display:block!important}.d-xl-grid{display:grid!important}.d-xl-inline-grid{display:inline-grid!important}.d-xl-table{display:table!important}.d-xl-table-row{display:table-row!important}.d-xl-table-cell{display:table-cell!important}.d-xl-flex{display:flex!important}.d-xl-inline-flex{display:inline-flex!important}.d-xl-none{display:none!important}.flex-xl-fill{flex:1 1 auto!important}.flex-xl-row{flex-direction:row!important}.flex-xl-column{flex-direction:column!important}.flex-xl-row-reverse{flex-direction:row-reverse!important}.flex-xl-column-reverse{flex-direction:column-reverse!important}.flex-xl-grow-0{flex-grow:0!important}.flex-xl-grow-1{flex-grow:1!important}.flex-xl-shrink-0{flex-shrink:0!important}.flex-xl-shrink-1{flex-shrink:1!important}.flex-xl-wrap{flex-wrap:wrap!important}.flex-xl-nowrap{flex-wrap:nowrap!important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xl-start{justify-content:flex-start!important}.justify-content-xl-end{justify-content:flex-end!important}.justify-content-xl-center{justify-content:center!important}.justify-content-xl-between{justify-content:space-between!important}.justify-content-xl-around{justify-content:space-around!important}.justify-content-xl-evenly{justify-content:space-evenly!important}.align-items-xl-start{align-items:flex-start!important}.align-items-xl-end{align-items:flex-end!important}.align-items-xl-center{align-items:center!important}.align-items-xl-baseline{align-items:baseline!important}.align-items-xl-stretch{align-items:stretch!important}.align-content-xl-start{align-content:flex-start!important}.align-content-xl-end{align-content:flex-end!important}.align-content-xl-center{align-content:center!important}.align-content-xl-between{align-content:space-between!important}.align-content-xl-around{align-content:space-around!important}.align-content-xl-stretch{align-content:stretch!important}.align-self-xl-auto{align-self:auto!important}.align-self-xl-start{align-self:flex-start!important}.align-self-xl-end{align-self:flex-end!important}.align-self-xl-center{align-self:center!important}.align-self-xl-baseline{align-self:baseline!important}.align-self-xl-stretch{align-self:stretch!important}.order-xl-first{order:-1!important}.order-xl-0{order:0!important}.order-xl-1{order:1!important}.order-xl-2{order:2!important}.order-xl-3{order:3!important}.order-xl-4{order:4!important}.order-xl-5{order:5!important}.order-xl-last{order:6!important}.m-xl-0{margin:0!important}.m-xl-1{margin:.25rem!important}.m-xl-2{margin:.5rem!important}.m-xl-3{margin:1rem!important}.m-xl-4{margin:1.5rem!important}.m-xl-5{margin:3rem!important}.m-xl-auto{margin:auto!important}.mx-xl-0{margin-right:0!important;margin-left:0!important}.mx-xl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xl-auto{margin-right:auto!important;margin-left:auto!important}.my-xl-0{margin-top:0!important;margin-bottom:0!important}.my-xl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xl-0{margin-top:0!important}.mt-xl-1{margin-top:.25rem!important}.mt-xl-2{margin-top:.5rem!important}.mt-xl-3{margin-top:1rem!important}.mt-xl-4{margin-top:1.5rem!important}.mt-xl-5{margin-top:3rem!important}.mt-xl-auto{margin-top:auto!important}.me-xl-0{margin-right:0!important}.me-xl-1{margin-right:.25rem!important}.me-xl-2{margin-right:.5rem!important}.me-xl-3{margin-right:1rem!important}.me-xl-4{margin-right:1.5rem!important}.me-xl-5{margin-right:3rem!important}.me-xl-auto{margin-right:auto!important}.mb-xl-0{margin-bottom:0!important}.mb-xl-1{margin-bottom:.25rem!important}.mb-xl-2{margin-bottom:.5rem!important}.mb-xl-3{margin-bottom:1rem!important}.mb-xl-4{margin-bottom:1.5rem!important}.mb-xl-5{margin-bottom:3rem!important}.mb-xl-auto{margin-bottom:auto!important}.ms-xl-0{margin-left:0!important}.ms-xl-1{margin-left:.25rem!important}.ms-xl-2{margin-left:.5rem!important}.ms-xl-3{margin-left:1rem!important}.ms-xl-4{margin-left:1.5rem!important}.ms-xl-5{margin-left:3rem!important}.ms-xl-auto{margin-left:auto!important}.p-xl-0{padding:0!important}.p-xl-1{padding:.25rem!important}.p-xl-2{padding:.5rem!important}.p-xl-3{padding:1rem!important}.p-xl-4{padding:1.5rem!important}.p-xl-5{padding:3rem!important}.px-xl-0{padding-right:0!important;padding-left:0!important}.px-xl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xl-0{padding-top:0!important;padding-bottom:0!important}.py-xl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xl-0{padding-top:0!important}.pt-xl-1{padding-top:.25rem!important}.pt-xl-2{padding-top:.5rem!important}.pt-xl-3{padding-top:1rem!important}.pt-xl-4{padding-top:1.5rem!important}.pt-xl-5{padding-top:3rem!important}.pe-xl-0{padding-right:0!important}.pe-xl-1{padding-right:.25rem!important}.pe-xl-2{padding-right:.5rem!important}.pe-xl-3{padding-right:1rem!important}.pe-xl-4{padding-right:1.5rem!important}.pe-xl-5{padding-right:3rem!important}.pb-xl-0{padding-bottom:0!important}.pb-xl-1{padding-bottom:.25rem!important}.pb-xl-2{padding-bottom:.5rem!important}.pb-xl-3{padding-bottom:1rem!important}.pb-xl-4{padding-bottom:1.5rem!important}.pb-xl-5{padding-bottom:3rem!important}.ps-xl-0{padding-left:0!important}.ps-xl-1{padding-left:.25rem!important}.ps-xl-2{padding-left:.5rem!important}.ps-xl-3{padding-left:1rem!important}.ps-xl-4{padding-left:1.5rem!important}.ps-xl-5{padding-left:3rem!important}.gap-xl-0{gap:0!important}.gap-xl-1{gap:.25rem!important}.gap-xl-2{gap:.5rem!important}.gap-xl-3{gap:1rem!important}.gap-xl-4{gap:1.5rem!important}.gap-xl-5{gap:3rem!important}.row-gap-xl-0{row-gap:0!important}.row-gap-xl-1{row-gap:.25rem!important}.row-gap-xl-2{row-gap:.5rem!important}.row-gap-xl-3{row-gap:1rem!important}.row-gap-xl-4{row-gap:1.5rem!important}.row-gap-xl-5{row-gap:3rem!important}.column-gap-xl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xl-start{text-align:left!important}.text-xl-end{text-align:right!important}.text-xl-center{text-align:center!important}}@media (min-width:1400px){.float-xxl-start{float:left!important}.float-xxl-end{float:right!important}.float-xxl-none{float:none!important}.object-fit-xxl-contain{-o-object-fit:contain!important;object-fit:contain!important}.object-fit-xxl-cover{-o-object-fit:cover!important;object-fit:cover!important}.object-fit-xxl-fill{-o-object-fit:fill!important;object-fit:fill!important}.object-fit-xxl-scale{-o-object-fit:scale-down!important;object-fit:scale-down!important}.object-fit-xxl-none{-o-object-fit:none!important;object-fit:none!important}.d-xxl-inline{display:inline!important}.d-xxl-inline-block{display:inline-block!important}.d-xxl-block{display:block!important}.d-xxl-grid{display:grid!important}.d-xxl-inline-grid{display:inline-grid!important}.d-xxl-table{display:table!important}.d-xxl-table-row{display:table-row!important}.d-xxl-table-cell{display:table-cell!important}.d-xxl-flex{display:flex!important}.d-xxl-inline-flex{display:inline-flex!important}.d-xxl-none{display:none!important}.flex-xxl-fill{flex:1 1 auto!important}.flex-xxl-row{flex-direction:row!important}.flex-xxl-column{flex-direction:column!important}.flex-xxl-row-reverse{flex-direction:row-reverse!important}.flex-xxl-column-reverse{flex-direction:column-reverse!important}.flex-xxl-grow-0{flex-grow:0!important}.flex-xxl-grow-1{flex-grow:1!important}.flex-xxl-shrink-0{flex-shrink:0!important}.flex-xxl-shrink-1{flex-shrink:1!important}.flex-xxl-wrap{flex-wrap:wrap!important}.flex-xxl-nowrap{flex-wrap:nowrap!important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse!important}.justify-content-xxl-start{justify-content:flex-start!important}.justify-content-xxl-end{justify-content:flex-end!important}.justify-content-xxl-center{justify-content:center!important}.justify-content-xxl-between{justify-content:space-between!important}.justify-content-xxl-around{justify-content:space-around!important}.justify-content-xxl-evenly{justify-content:space-evenly!important}.align-items-xxl-start{align-items:flex-start!important}.align-items-xxl-end{align-items:flex-end!important}.align-items-xxl-center{align-items:center!important}.align-items-xxl-baseline{align-items:baseline!important}.align-items-xxl-stretch{align-items:stretch!important}.align-content-xxl-start{align-content:flex-start!important}.align-content-xxl-end{align-content:flex-end!important}.align-content-xxl-center{align-content:center!important}.align-content-xxl-between{align-content:space-between!important}.align-content-xxl-around{align-content:space-around!important}.align-content-xxl-stretch{align-content:stretch!important}.align-self-xxl-auto{align-self:auto!important}.align-self-xxl-start{align-self:flex-start!important}.align-self-xxl-end{align-self:flex-end!important}.align-self-xxl-center{align-self:center!important}.align-self-xxl-baseline{align-self:baseline!important}.align-self-xxl-stretch{align-self:stretch!important}.order-xxl-first{order:-1!important}.order-xxl-0{order:0!important}.order-xxl-1{order:1!important}.order-xxl-2{order:2!important}.order-xxl-3{order:3!important}.order-xxl-4{order:4!important}.order-xxl-5{order:5!important}.order-xxl-last{order:6!important}.m-xxl-0{margin:0!important}.m-xxl-1{margin:.25rem!important}.m-xxl-2{margin:.5rem!important}.m-xxl-3{margin:1rem!important}.m-xxl-4{margin:1.5rem!important}.m-xxl-5{margin:3rem!important}.m-xxl-auto{margin:auto!important}.mx-xxl-0{margin-right:0!important;margin-left:0!important}.mx-xxl-1{margin-right:.25rem!important;margin-left:.25rem!important}.mx-xxl-2{margin-right:.5rem!important;margin-left:.5rem!important}.mx-xxl-3{margin-right:1rem!important;margin-left:1rem!important}.mx-xxl-4{margin-right:1.5rem!important;margin-left:1.5rem!important}.mx-xxl-5{margin-right:3rem!important;margin-left:3rem!important}.mx-xxl-auto{margin-right:auto!important;margin-left:auto!important}.my-xxl-0{margin-top:0!important;margin-bottom:0!important}.my-xxl-1{margin-top:.25rem!important;margin-bottom:.25rem!important}.my-xxl-2{margin-top:.5rem!important;margin-bottom:.5rem!important}.my-xxl-3{margin-top:1rem!important;margin-bottom:1rem!important}.my-xxl-4{margin-top:1.5rem!important;margin-bottom:1.5rem!important}.my-xxl-5{margin-top:3rem!important;margin-bottom:3rem!important}.my-xxl-auto{margin-top:auto!important;margin-bottom:auto!important}.mt-xxl-0{margin-top:0!important}.mt-xxl-1{margin-top:.25rem!important}.mt-xxl-2{margin-top:.5rem!important}.mt-xxl-3{margin-top:1rem!important}.mt-xxl-4{margin-top:1.5rem!important}.mt-xxl-5{margin-top:3rem!important}.mt-xxl-auto{margin-top:auto!important}.me-xxl-0{margin-right:0!important}.me-xxl-1{margin-right:.25rem!important}.me-xxl-2{margin-right:.5rem!important}.me-xxl-3{margin-right:1rem!important}.me-xxl-4{margin-right:1.5rem!important}.me-xxl-5{margin-right:3rem!important}.me-xxl-auto{margin-right:auto!important}.mb-xxl-0{margin-bottom:0!important}.mb-xxl-1{margin-bottom:.25rem!important}.mb-xxl-2{margin-bottom:.5rem!important}.mb-xxl-3{margin-bottom:1rem!important}.mb-xxl-4{margin-bottom:1.5rem!important}.mb-xxl-5{margin-bottom:3rem!important}.mb-xxl-auto{margin-bottom:auto!important}.ms-xxl-0{margin-left:0!important}.ms-xxl-1{margin-left:.25rem!important}.ms-xxl-2{margin-left:.5rem!important}.ms-xxl-3{margin-left:1rem!important}.ms-xxl-4{margin-left:1.5rem!important}.ms-xxl-5{margin-left:3rem!important}.ms-xxl-auto{margin-left:auto!important}.p-xxl-0{padding:0!important}.p-xxl-1{padding:.25rem!important}.p-xxl-2{padding:.5rem!important}.p-xxl-3{padding:1rem!important}.p-xxl-4{padding:1.5rem!important}.p-xxl-5{padding:3rem!important}.px-xxl-0{padding-right:0!important;padding-left:0!important}.px-xxl-1{padding-right:.25rem!important;padding-left:.25rem!important}.px-xxl-2{padding-right:.5rem!important;padding-left:.5rem!important}.px-xxl-3{padding-right:1rem!important;padding-left:1rem!important}.px-xxl-4{padding-right:1.5rem!important;padding-left:1.5rem!important}.px-xxl-5{padding-right:3rem!important;padding-left:3rem!important}.py-xxl-0{padding-top:0!important;padding-bottom:0!important}.py-xxl-1{padding-top:.25rem!important;padding-bottom:.25rem!important}.py-xxl-2{padding-top:.5rem!important;padding-bottom:.5rem!important}.py-xxl-3{padding-top:1rem!important;padding-bottom:1rem!important}.py-xxl-4{padding-top:1.5rem!important;padding-bottom:1.5rem!important}.py-xxl-5{padding-top:3rem!important;padding-bottom:3rem!important}.pt-xxl-0{padding-top:0!important}.pt-xxl-1{padding-top:.25rem!important}.pt-xxl-2{padding-top:.5rem!important}.pt-xxl-3{padding-top:1rem!important}.pt-xxl-4{padding-top:1.5rem!important}.pt-xxl-5{padding-top:3rem!important}.pe-xxl-0{padding-right:0!important}.pe-xxl-1{padding-right:.25rem!important}.pe-xxl-2{padding-right:.5rem!important}.pe-xxl-3{padding-right:1rem!important}.pe-xxl-4{padding-right:1.5rem!important}.pe-xxl-5{padding-right:3rem!important}.pb-xxl-0{padding-bottom:0!important}.pb-xxl-1{padding-bottom:.25rem!important}.pb-xxl-2{padding-bottom:.5rem!important}.pb-xxl-3{padding-bottom:1rem!important}.pb-xxl-4{padding-bottom:1.5rem!important}.pb-xxl-5{padding-bottom:3rem!important}.ps-xxl-0{padding-left:0!important}.ps-xxl-1{padding-left:.25rem!important}.ps-xxl-2{padding-left:.5rem!important}.ps-xxl-3{padding-left:1rem!important}.ps-xxl-4{padding-left:1.5rem!important}.ps-xxl-5{padding-left:3rem!important}.gap-xxl-0{gap:0!important}.gap-xxl-1{gap:.25rem!important}.gap-xxl-2{gap:.5rem!important}.gap-xxl-3{gap:1rem!important}.gap-xxl-4{gap:1.5rem!important}.gap-xxl-5{gap:3rem!important}.row-gap-xxl-0{row-gap:0!important}.row-gap-xxl-1{row-gap:.25rem!important}.row-gap-xxl-2{row-gap:.5rem!important}.row-gap-xxl-3{row-gap:1rem!important}.row-gap-xxl-4{row-gap:1.5rem!important}.row-gap-xxl-5{row-gap:3rem!important}.column-gap-xxl-0{-moz-column-gap:0!important;column-gap:0!important}.column-gap-xxl-1{-moz-column-gap:0.25rem!important;column-gap:.25rem!important}.column-gap-xxl-2{-moz-column-gap:0.5rem!important;column-gap:.5rem!important}.column-gap-xxl-3{-moz-column-gap:1rem!important;column-gap:1rem!important}.column-gap-xxl-4{-moz-column-gap:1.5rem!important;column-gap:1.5rem!important}.column-gap-xxl-5{-moz-column-gap:3rem!important;column-gap:3rem!important}.text-xxl-start{text-align:left!important}.text-xxl-end{text-align:right!important}.text-xxl-center{text-align:center!important}}@media (min-width:1200px){.fs-1{font-size:2.5rem!important}.fs-2{font-size:2rem!important}.fs-3{font-size:1.75rem!important}.fs-4{font-size:1.5rem!important}}@media print{.d-print-inline{display:inline!important}.d-print-inline-block{display:inline-block!important}.d-print-block{display:block!important}.d-print-grid{display:grid!important}.d-print-inline-grid{display:inline-grid!important}.d-print-table{display:table!important}.d-print-table-row{display:table-row!important}.d-print-table-cell{display:table-cell!important}.d-print-flex{display:flex!important}.d-print-inline-flex{display:inline-flex!important}.d-print-none{display:none!important}}.navbar{font-size:.875rem;font-weight:500}.navbar .nav-item{margin-right:.5rem;margin-left:.5rem}.navbar .navbar-nav .nav-link{border-radius:.375rem}.navbar-dark .navbar-nav .nav-link:hover{background-color:rgba(255,255,255,.1)}.navbar-dark .navbar-nav .nav-link.active{background-color:rgba(0,0,0,.5)}.navbar-light .navbar-nav .nav-link:hover{background-color:rgba(0,0,0,.03)}.navbar-light .navbar-nav .nav-link.active{background-color:rgba(0,0,0,.05)}.navbar-nav{--bs-nav-link-padding-x:.5rem}.btn-light,.btn-outline-light,.btn-outline-secondary,.btn-secondary{color:#212529}.btn-light.disabled,.btn-light:disabled,.btn-outline-light.disabled,.btn-outline-light:disabled,.btn-outline-secondary.disabled,.btn-outline-secondary:disabled,.btn-secondary.disabled,.btn-secondary:disabled{border:1px solid #e6e6e6}.btn-outline-secondary,.btn-secondary{border-color:#e6e6e6}.btn-outline-secondary:active,.btn-outline-secondary:hover,.btn-secondary:active,.btn-secondary:hover{background-color:#e6e6e6;border-color:#e6e6e6}.btn-light,.btn-outline-light{border-color:#dfe0e1}.btn-light:active,.btn-light:hover,.btn-outline-light:active,.btn-outline-light:hover{background-color:#dfe0e1;border-color:#dfe0e1}.table{font-size:.875rem;box-shadow:0 1px 3px 0 rgba(0,0,0,.1),0 1px 2px 0 rgba(0,0,0,.06)}thead th{font-size:.875rem;text-transform:uppercase}.input-group-text{box-shadow:0 1px 2px rgba(0,0,0,.05)}.nav-tabs{font-weight:500}.nav-tabs .nav-link{padding-top:1rem;padding-bottom:1rem;border-width:0 0 1px}.nav-tabs .nav-item.show .nav-link,.nav-tabs .nav-link.active{box-shadow:inset 0 -2px 0 #3459e6}.nav-pills{font-weight:500}.pagination{font-size:.875rem;font-weight:500}.pagination .page-link{box-shadow:0 1px 2px rgba(0,0,0,.05)}.breadcrumb{font-size:.875rem;font-weight:500;border:1px solid var(--bs-secondary-bg);border-radius:.375rem;box-shadow:0 1px 2px rgba(0,0,0,.05)}.breadcrumb-item{padding:1rem .5rem 1rem 0}.breadcrumb-item+.breadcrumb-item::before{padding-right:1rem}.alert .btn-close{color:inherit}.badge.bg-light,.badge.bg-secondary{color:#212529}.card .h1,.card .h2,.card .h3,.card .h4,.card .h5,.card .h6,.card h1,.card h2,.card h3,.card h4,.card h5,.card h6,.list-group-item .h1,.list-group-item .h2,.list-group-item .h3,.list-group-item .h4,.list-group-item .h5,.list-group-item .h6,.list-group-item h1,.list-group-item h2,.list-group-item h3,.list-group-item h4,.list-group-item h5,.list-group-item h6{color:inherit}.list-group{box-shadow:0 1px 3px 0 rgba(0,0,0,.1),0 1px 2px 0 rgba(0,0,0,.06)}.card{box-shadow:0 1px 3px 0 rgba(0,0,0,.1),0 1px 2px 0 rgba(0,0,0,.06)}.modal-footer{background-color:var(--bs-tertiary-bg)}.modal-content{box-shadow:0 1px 3px 0 rgba(0,0,0,.1),0 1px 2px 0 rgba(0,0,0,.06)}
+/*# sourceMappingURL=bootstrap.min.css.map */
\ No newline at end of file
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/add.html b/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/add.html
new file mode 100644
index 00000000..67ac51be
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/add.html
@@ -0,0 +1,29 @@
+{% extends "students/base.html" %}
+
+{% block body %}
+
Add Student
+ {% if success %}
+
+ {% else %}
+
+ {% endif %}
+{% endblock %}
\ No newline at end of file
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/base.html b/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/base.html
new file mode 100644
index 00000000..4be899c9
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/base.html
@@ -0,0 +1,65 @@
+{% load static %}
+
+
+
+
+
+
Student Management System
+
+
+
+
+
+
+
+
+ {% block body %}
+ {% endblock %}
+
+
+
+
+
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/edit.html b/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/edit.html
new file mode 100644
index 00000000..286f502b
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/edit.html
@@ -0,0 +1,29 @@
+{% extends "students/base.html" %}
+
+{% block body %}
+
Update Student
+ {% if success %}
+
+ {% else %}
+
+ {% endif %}
+{% endblock %}
\ No newline at end of file
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/index.html b/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/index.html
new file mode 100644
index 00000000..e00891f5
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/templates/students/index.html
@@ -0,0 +1,117 @@
+{% extends "students/base.html" %}
+
+{% block body %}
+
All Students
+
+
+ {% if students %}
+
+
+
+
+
+
+
+
+ Student Number
+ First Name
+ Last Name
+ Email
+ Field of Study
+ GPA
+ Actions
+
+
+
+ {% for student in students %}
+
+ {{ student.student_number }}
+ {{ student.first_name }}
+ {{ student.last_name }}
+ {{ student.email }}
+ {{ student.field_of_study }}
+ {{ student.gpa }}
+
+
+
+
+
+
+
+
+
+
+
+
+ Student Number: {{ student.student_number }}
+ First Name: {{ student.first_name }}
+ Last Name: {{ student.last_name }}
+ Email: {{ student.email }}
+ Field of Study: {{ student.field_of_study }}
+ GPA: {{ student.gpa }}
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
Are you sure you want to delete this student?
+
+
+
+
+
+
+
+ {% endfor %}
+
+
+
+
+
+
+ {% else %}
+
No Student Records
+ {% endif %}
+
+
+{% endblock %}
\ No newline at end of file
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/tests.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/tests.py
new file mode 100644
index 00000000..7ce503c2
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/tests.py
@@ -0,0 +1,3 @@
+from django.test import TestCase
+
+# Create your tests here.
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/urls.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/urls.py
new file mode 100644
index 00000000..81d04301
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/urls.py
@@ -0,0 +1,10 @@
+from django.urls import path
+from . import views
+
+urlpatterns = [
+ path('', views.index, name='index'),
+ path('
', views.view_student, name='view_student'),
+ path('add/', views.add, name='add'),
+ path('edit//', views.edit, name='edit'),
+ path('delete//', views.delete, name='delete'),
+]
\ No newline at end of file
diff --git a/SYSTEM MANAGEMENT APPS/Student_management_system/students/views.py b/SYSTEM MANAGEMENT APPS/Student_management_system/students/views.py
new file mode 100644
index 00000000..e53d40d0
--- /dev/null
+++ b/SYSTEM MANAGEMENT APPS/Student_management_system/students/views.py
@@ -0,0 +1,69 @@
+from django.http import HttpResponseRedirect
+from django.shortcuts import render
+from django.urls import reverse
+
+from .models import Student
+from .forms import StudentForm
+
+# Create your views here.
+def index(request):
+ return render(request, 'students/index.html', {
+ 'students': Student.objects.all()
+ })
+
+def view_student(request, id):
+ student = Student.objects.get(pk=id)
+ return HttpResponseRedirect(reverse('index'))
+
+def add(request):
+ if request.method == 'POST':
+ form = StudentForm(request.POST)
+ if form.is_valid():
+ new_student_number = form.cleaned_data['student_number']
+ new_first_name = form.cleaned_data['first_name']
+ new_last_name = form.cleaned_data['last_name']
+ new_email = form.cleaned_data['email']
+ new_field_of_study = form.cleaned_data['field_of_study']
+ new_gpa = form.cleaned_data['gpa']
+
+ new_student = Student(
+ student_number = new_student_number,
+ first_name = new_first_name,
+ last_name = new_last_name,
+ email = new_email,
+ field_of_study = new_field_of_study,
+ gpa = new_gpa
+ )
+ new_student.save()
+ return render(request, 'students/add.html', {
+ 'form': StudentForm(),
+ 'success': True
+ })
+ else:
+ form = StudentForm()
+ return render(request, 'students/add.html', {
+ 'form': StudentForm()
+ })
+
+def edit(request, id):
+ if request.method == 'POST':
+ student = Student.objects.get(pk=id)
+ form = StudentForm(request.POST, instance=student)
+ if form.is_valid():
+ form.save()
+ return render(request, 'students/edit.html', {
+ 'form': form,
+ 'success': True
+ })
+ else:
+ student = Student.objects.get(pk=id)
+ form = StudentForm(instance=student)
+ return render(request, 'students/edit.html', {
+ 'form': form
+ })
+
+def delete(request, id):
+ if request.method == 'POST':
+ student = Student.objects.get(pk=id)
+ student.delete()
+ return HttpResponseRedirect(reverse('index'))
\ No newline at end of file
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/LICENSE b/WEB SCRAPING/devJobsScanner_Scraper/LICENSE
new file mode 100644
index 00000000..59c6af06
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2024 Asib Hossen
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/ReadME.md b/WEB SCRAPING/devJobsScanner_Scraper/ReadME.md
new file mode 100644
index 00000000..310a02f4
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/ReadME.md
@@ -0,0 +1,81 @@
+# devJobScanner Job Scraper
+
+## Description
+This repository contains two scripts designed to scrape job listings from a specified website. Users can input their desired job title, remote work preference, sorting preference, and choose how to save the output (CSV, TXT, or both).
+
+## Scripts
+
+### Script 1: `job_scraper_static.py`
+- Scrapes job listings using the `requests` library and `BeautifulSoup`.
+- Displays job details in the console.
+- Saves job details in CSV and/or TXT format.
+- Suitable for static page scraping.
+
+### Script 2: `job_scraper_dynamic.py`
+- Enhanced to use `SeleniumBase` for dynamic page interaction.
+- Supports infinite scrolling to load more job listings.
+- Users can specify the number of job listings to scrape.
+- More robust handling of dynamically loaded content.
+
+## Requirements
+
+### Common Requirements
+- Python 3.x
+- `beautifulsoup4` library
+- `requests` library
+
+### Dynamic Script Additional Requirements
+- `seleniumbase` library
+- WebDriver for your browser (e.g., ChromeDriver for Chrome)
+
+## Installation
+1. Clone the repository:
+ ```bash
+ git clone https://github.com/asibhossen897/devJobsScanner-job-scraper.git
+ cd devJobsScanner-job-scraper
+ ```
+
+2. Install the required libraries:
+ ```bash
+ pip install -r requirements.txt
+ ```
+
+3. For `job_scraper_dynamic.py`, ensure you have the appropriate WebDriver installed and available in your PATH.
+
+## Usage
+
+### Static Scraper (`job_scraper_static.py`)
+1. Run the script:
+ ```bash
+ python job_scraper_static.py
+ ```
+ (**If ```python``` does not work, use ```python3```**)
+
+2. Follow the prompts to input your job search criteria and preferences.
+
+### Dynamic Scraper (`job_scraper_dynamic.py`)
+1. Run the script:
+ ```bash
+ python job_scraper_dynamic.py
+ ```
+ (**If ```python``` does not work, use ```python3```**)
+
+2. Follow the prompts to input your job search criteria, number of jobs to scrape, and preferences.
+
+## File Structure
+- `job_scraper_static.py`: Script for static job scraping.
+- `job_scraper_dynamic.py`: Script for dynamic job scraping with SeleniumBase.
+- `requirements.txt`: List of required Python libraries.
+- `outputFiles/`: Directory where output files (CSV, TXT) are saved.
+
+## Disclaimer
+These scripts are for educational and personal use only. Scraping websites can be against the terms of service of the website being scraped. Always check the website’s terms and conditions before scraping any content. The author is not responsible for any misuse of these scripts. Use at your own risk.
+
+## License
+This project is licensed under the MIT License - see the [LICENSE](LICENSE) file for details.
+
+## Author
+Asib Hossen
+
+## Date
+May 21, 2024
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/job_scraper_dynamic.py b/WEB SCRAPING/devJobsScanner_Scraper/job_scraper_dynamic.py
new file mode 100644
index 00000000..dbd6467a
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/job_scraper_dynamic.py
@@ -0,0 +1,184 @@
+# Author: Asib Hossen
+# Date: May 21, 2024
+# Description: This script scrapes job listings from https://www.devjobsscanner.com/ based on user input, displays the job details, and optionally saves them as CSV and/or TXT files.
+# Version: 1.1
+
+
+import os
+import re
+import csv
+import time
+from seleniumbase import Driver
+from bs4 import BeautifulSoup
+
+def get_user_input():
+ """
+ Prompt user for job title, remote job preference, number of jobs to scrape,
+ sorting preference, and save option.
+
+ Returns:
+ tuple: A tuple containing job title (str), remote job preference (bool),
+ number of jobs to scrape (int), save option (str), and sorting preference (str).
+ """
+ job = input("Enter the job title: ")
+ remote = input("Do you want remote jobs only? (yes/no): ").lower() == 'yes'
+ num_jobs = int(input("Enter the number of jobs you want to scrape: "))
+ sort_options = ['matches', 'newest', 'salary']
+ print(f"Sort options: {sort_options}")
+ sort_by = input("Enter the sorting preference (matches/newest/salary): ")
+ save_option = input("Do you want to save the output as CSV, TXT, or both of them? (csv/txt/both): ").lower()
+ return job, remote, num_jobs, save_option, sort_by
+
+def construct_url(job, remote, sort_by):
+ """
+ Construct the URL based on the job title, remote preference, and sorting preference.
+
+ Args:
+ job (str): The job title.
+ remote (bool): True if user wants remote jobs only, False otherwise.
+ sort_by (str): The sorting preference.
+
+ Returns:
+ str: The constructed URL.
+ """
+ base_url = "https://www.devjobsscanner.com/search/"
+ search_params = f"?search={job}"
+ if remote is not None:
+ search_params += f"&remote={str(remote).lower()}"
+ if sort_by is not None:
+ search_params += f"&sort={sort_by}"
+ url = base_url + search_params
+ return url
+
+def scrape_jobs(url, num_jobs):
+ """
+ Scrape job listings from the provided URL using SeleniumBase.
+
+ Args:
+ url (str): The URL to scrape job listings from.
+ num_jobs (int): The number of jobs to scrape.
+
+ Returns:
+ list: A list of dictionaries containing job details.
+ """
+ jobs = []
+ try:
+ driver = Driver(browser="Firefox", headless=False)
+ driver.get(url)
+ time.sleep(5) # Initial wait for page load
+
+ while len(jobs) < num_jobs:
+ soup = BeautifulSoup(driver.page_source, 'html.parser')
+ job_divs = soup.find_all('div', class_='flex p-3 rounded group relative overflow-hidden')
+
+ for job_div in job_divs:
+ if len(jobs) >= num_jobs:
+ break
+ title = job_div.find('h2').text.strip()
+ company = job_div.find('div', class_='jbs-dot-separeted-list').find('a').text.strip()
+ tags = [tag.text.strip() for tag in job_div.find_all('a', class_='tag')]
+ date_posted = job_div.find('span', class_='text-primary-text').text.strip()
+ salary = job_div.find('span', class_='text-gray-text').text.strip()
+
+ # Check if the salary contains at least two digits
+ if not re.search(r'\d{2}', salary):
+ salary = "Not mentioned"
+
+ job_url = job_div.find('a', class_='jbs-text-hover-link')['href']
+
+ jobs.append({
+ 'title': title,
+ 'company': company,
+ 'company_url': f"https://www.devjobsscanner.com/company/{company.lower()}",
+ 'tags': tags,
+ 'date_posted': date_posted,
+ 'salary': salary,
+ 'job_url': job_url
+ })
+
+ # Scroll down to load more jobs
+ driver.execute_script("window.scrollTo(0, document.body.scrollHeight);")
+ time.sleep(5) # Wait for new jobs to load
+
+ driver.quit()
+ return jobs[:num_jobs]
+ except Exception as e:
+ print("Error scraping jobs:", e)
+ return []
+
+def display_jobs(jobs):
+ """
+ Display job details to the console.
+
+ Args:
+ jobs (list): A list of dictionaries containing job details.
+ """
+ for job in jobs:
+ print(f"Title: {job['title']}")
+ print(f"Company: {job['company']}")
+ print(f"Company URL: {job['company_url']}")
+ print(f"Tags: {', '.join(job['tags'])}")
+ print(f"Date Posted: {job['date_posted']}")
+ print(f"Salary: {job['salary']}")
+ print(f"Job URL: {job['job_url']}")
+ print("-" * 40)
+
+def save_as_csv(jobs, filename):
+ """
+ Save job details as CSV file.
+
+ Args:
+ jobs (list): A list of dictionaries containing job details.
+ filename (str): The name of the CSV file to save.
+ """
+ output_dir = os.path.join(os.getcwd(), "outputFiles")
+ os.makedirs(output_dir, exist_ok=True)
+ keys = jobs[0].keys()
+ try:
+ with open(filename, 'w', newline='', encoding='utf-8') as output_file:
+ dict_writer = csv.DictWriter(output_file, fieldnames=keys)
+ dict_writer.writeheader()
+ dict_writer.writerows(jobs)
+ except IOError as e:
+ print("Error saving as CSV:", e)
+
+def save_as_txt(jobs, filename):
+ """
+ Save job details as text file.
+
+ Args:
+ jobs (list): A list of dictionaries containing job details.
+ filename (str): The name of the text file to save.
+ """
+ try:
+ with open(filename, 'w', encoding='utf-8') as output_file:
+ for job in jobs:
+ output_file.write(f"Title: {job['title']}\n")
+ output_file.write(f"Company: {job['company']}\n")
+ output_file.write(f"Company URL: {job['company_url']}\n")
+ output_file.write(f"Tags: {', '.join(job['tags'])}\n")
+ output_file.write(f"Date Posted: {job['date_posted']}\n")
+ output_file.write(f"Salary: {job['salary']}\n")
+ output_file.write(f"Job URL: {job['job_url']}\n")
+ output_file.write("-" * 40 + "\n")
+ except IOError as e:
+ print("Error saving as TXT:", e)
+
+if __name__ == '__main__':
+ job, remote, num_jobs, save_option, sort_by = get_user_input()
+ url = construct_url(job, remote, sort_by)
+ print(f"Scraping URL: {url}")
+ jobs = scrape_jobs(url, num_jobs)
+ if jobs:
+ display_jobs(jobs)
+ fileName = f"./outputFiles/{job}_jobs_remote_{str(remote).lower()}_sorted_by_{sort_by}"
+ if save_option == 'csv':
+ save_as_csv(jobs, f"{fileName}.csv")
+ elif save_option == 'txt':
+ save_as_txt(jobs, f"{fileName}.txt")
+ elif save_option == 'both':
+ save_as_csv(jobs, f"{fileName}.csv")
+ save_as_txt(jobs, f"{fileName}.txt")
+ print(f"Jobs saved as {save_option.upper()} file(s).")
+ else:
+ print("No jobs found. Exiting.")
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/job_scraper_static.py b/WEB SCRAPING/devJobsScanner_Scraper/job_scraper_static.py
new file mode 100644
index 00000000..593fe40f
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/job_scraper_static.py
@@ -0,0 +1,172 @@
+# Author: Asib Hossen
+# Date: May 21, 2024
+# Description: This script scrapes job listings from https://www.devjobsscanner.com/ based on user input, displays the job details, and optionally saves them as CSV and/or TXT files.
+# Version: 1.1
+
+
+import os
+import re
+import csv
+import time
+import requests
+from bs4 import BeautifulSoup
+
+def get_user_input():
+ """
+ Prompt user for job title, remote job preference, sorting preference,
+ and save option.
+
+ Returns:
+ tuple: A tuple containing job title (str), remote job preference (bool),
+ save option (str), and sorting preference (str).
+ """
+ job = input("Enter the job title: ")
+ remote = input("Do you want remote jobs only? (yes/no): ").lower() == 'yes'
+ sort_options = ['matches', 'newest', 'salary']
+ print(f"Sort options: {sort_options}")
+ sort_by = input("Enter the sorting preference (matches/newest/salary): ")
+ save_option = input("Do you want to save the output as CSV, TXT, or both of them? (csv/txt/both): ").lower()
+ return job, remote, save_option, sort_by
+
+def construct_url(job, remote, sort_by):
+ """
+ Construct the URL based on the job title, remote preference, and sorting preference.
+
+ Args:
+ job (str): The job title.
+ remote (bool): True if user wants remote jobs only, False otherwise.
+ sort_by (str): The sorting preference.
+
+ Returns:
+ str: The constructed URL.
+ """
+ base_url = "https://www.devjobsscanner.com/search/"
+ search_params = f"?search={job}"
+ if remote is not None:
+ search_params += f"&remote={str(remote).lower()}"
+ if sort_by is not None:
+ search_params += f"&sort={sort_by}"
+ url = base_url + search_params
+ return url
+
+def scrape_jobs(url):
+ """
+ Scrape job listings from the provided URL.
+
+ Args:
+ url (str): The URL to scrape job listings from.
+
+ Returns:
+ list: A list of dictionaries containing job details.
+ """
+ try:
+ response = requests.get(url)
+ response.raise_for_status() # Raise an exception for HTTP errors
+ time.sleep(5) # Delay to avoid hitting the server too frequently
+ soup = BeautifulSoup(response.content, 'html.parser')
+
+ job_divs = soup.find_all('div', class_='flex p-3 rounded group relative overflow-hidden')
+ jobs = []
+ for job_div in job_divs:
+ title = job_div.find('h2').text.strip()
+ company = job_div.find('div', class_='jbs-dot-separeted-list').find('a').text.strip()
+ tags = [tag.text.strip() for tag in job_div.find_all('a', class_='tag')]
+ date_posted = job_div.find('span', class_='text-primary-text').text.strip()
+ salary = job_div.find('span', class_='text-gray-text').text.strip()
+
+ # Check if the salary contains at least two digits
+ if not re.search(r'\d{2}', salary):
+ salary = "Not mentioned"
+
+ job_url = job_div.find('a', class_='jbs-text-hover-link')['href']
+
+ jobs.append({
+ 'title': title,
+ 'company': company,
+ 'company_url': f"https://www.devjobsscanner.com/company/{company.lower()}",
+ 'tags': tags,
+ 'date_posted': date_posted,
+ 'salary': salary,
+ 'job_url': job_url
+ })
+ return jobs
+ except requests.RequestException as e:
+ print("Error scraping jobs:", e)
+ return []
+
+def display_jobs(jobs):
+ """
+ Display job details to the console.
+
+ Args:
+ jobs (list): A list of dictionaries containing job details.
+ """
+ for job in jobs:
+ print(f"Title: {job['title']}")
+ print(f"Company: {job['company']}")
+ print(f"Company URL: {job['company_url']}")
+ print(f"Tags: {', '.join(job['tags'])}")
+ print(f"Date Posted: {job['date_posted']}")
+ print(f"Salary: {job['salary']}")
+ print(f"Job URL: {job['job_url']}")
+ print("-" * 40)
+
+def save_as_csv(jobs, filename):
+ """
+ Save job details as CSV file.
+
+ Args:
+ jobs (list): A list of dictionaries containing job details.
+ filename (str): The name of the CSV file to save.
+ """
+ output_dir = os.path.join(os.getcwd(), "outputFiles")
+ os.makedirs(output_dir, exist_ok=True)
+ keys = jobs[0].keys()
+ try:
+ with open(filename, 'w', newline='', encoding='utf-8') as output_file:
+ dict_writer = csv.DictWriter(output_file, fieldnames=keys)
+ dict_writer.writeheader()
+ dict_writer.writerows(jobs)
+ except IOError as e:
+ print("Error saving as CSV:", e)
+
+def save_as_txt(jobs, filename):
+ """
+ Save job details as text file.
+
+ Args:
+ jobs (list): A list of dictionaries containing job details.
+ filename (str): The name of the text file to save.
+ """
+ try:
+ with open(filename, 'w', encoding='utf-8') as output_file:
+ for job in jobs:
+ output_file.write(f"Title: {job['title']}\n")
+ output_file.write(f"Company: {job['company']}\n")
+ output_file.write(f"Company URL: {job['company_url']}\n")
+ output_file.write(f"Tags: {', '.join(job['tags'])}\n")
+ output_file.write(f"Date Posted: {job['date_posted']}\n")
+ output_file.write(f"Salary: {job['salary']}\n")
+ output_file.write(f"Job URL: {job['job_url']}\n")
+ output_file.write("-" * 40 + "\n")
+ except IOError as e:
+ print("Error saving as TXT:", e)
+
+if __name__ == '__main__':
+ job, remote, save_option, sort_by = get_user_input()
+ url = construct_url(job, remote, sort_by)
+ print(f"Scraping URL: {url}")
+ jobs = scrape_jobs(url)
+ if jobs:
+ display_jobs(jobs)
+ fileName = f"./outputFiles/{job}_jobs_remote_{str(remote).lower()}_sorted_by_{sort_by}"
+ if save_option == 'csv':
+ save_as_csv(jobs, f"{fileName}.csv")
+ elif save_option == 'txt':
+ save_as_txt(jobs, f"{fileName}.txt")
+ elif save_option == 'both':
+ save_as_csv(jobs, f"{fileName}.csv")
+ save_as_txt(jobs, f"{fileName}.txt")
+ print(f"Jobs saved as {save_option.upper()} file(s).")
+ else:
+ print("No jobs found. Exiting.")
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Junior Python Developer_jobs_remote_true_sorted_by_matches.csv b/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Junior Python Developer_jobs_remote_true_sorted_by_matches.csv
new file mode 100644
index 00000000..e7ebe2d8
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Junior Python Developer_jobs_remote_true_sorted_by_matches.csv
@@ -0,0 +1,21 @@
+title,company,company_url,tags,date_posted,salary,job_url
+Junior Python Developer - Fully Remote,INDI Staffing Services,https://www.devjobsscanner.com/company/indi staffing services,['python'],4 weeks ago,Not mentioned,https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905557993?refId=CIi7kPgOLtsBQ2GdsSUZ6A%3D%3D&trackingId=HjTjhxuOXesYMFynnjZ3sA%3D%3D&position=23&pageNum=15&trk=public_jobs_jserp-result_search-card
+Junior Python Developer - Fully Remote,INDI Staffing Services,https://www.devjobsscanner.com/company/indi staffing services,['python'],4 weeks ago,Not mentioned,https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905559533?refId=24YIlA6nBIXWZAw2pp8YIQ%3D%3D&trackingId=K0RNbyZF8P1NVP8jSDTZxg%3D%3D&position=14&pageNum=4&trk=public_jobs_jserp-result_search-card
+Junior Python Developer - Fully Remote,INDI Staffing Services,https://www.devjobsscanner.com/company/indi staffing services,['python'],4 weeks ago,Not mentioned,https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905558971?position=4&pageNum=50&refId=f%2FMDbLRF9jpyu1FP2qKzBA%3D%3D&trackingId=3b3MyV8heftivJ1yAEGDSA%3D%3D&trk=public_jobs_jserp-result_search-card
+Junior Python Developer - Fully Remote,INDI Staffing Services,https://www.devjobsscanner.com/company/indi staffing services,['python'],4 weeks ago,Not mentioned,https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905564228?position=9&pageNum=25&refId=3vjg%2F7Apk5o3blJ1SV4Trg%3D%3D&trackingId=YQovs1pUWZwPBsIsc%2F%2FeNA%3D%3D&trk=public_jobs_jserp-result_search-card
+Junior Python Developer - Fully Remote,INDI Staffing Services,https://www.devjobsscanner.com/company/indi staffing services,['python'],4 weeks ago,Not mentioned,https://co.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905560503?position=3&pageNum=2&refId=n%2BIMuq%2BFPiZWMUAdjPElDQ%3D%3D&trackingId=CL5eC5WRkvm518gLzpcuXA%3D%3D&trk=public_jobs_jserp-result_search-card
+Junior Python Developer - Fully Remote,INDI Staffing Services,https://www.devjobsscanner.com/company/indi staffing services,['python'],4 weeks ago,Not mentioned,https://co.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905560484?position=4&pageNum=2&refId=n%2BIMuq%2BFPiZWMUAdjPElDQ%3D%3D&trackingId=Ns2Q8YkzKL8BpD1ymz7nZw%3D%3D&trk=public_jobs_jserp-result_search-card
+Junior Python Developer - Fully Remote,INDI Staffing Services,https://www.devjobsscanner.com/company/indi staffing services,['python'],4 weeks ago,Not mentioned,https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905563257?position=2&pageNum=2&refId=bUQQZsGdjsbzIyYszLfYAA%3D%3D&trackingId=BsQara%2F7D3fS3KbgT8qvng%3D%3D&trk=public_jobs_jserp-result_search-card
+Junior Python Developer - Fully Remote,INDI Staffing Services,https://www.devjobsscanner.com/company/indi staffing services,['python'],4 weeks ago,Not mentioned,https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905564224?position=1&pageNum=97&refId=%2BqnXHLbBBntROtlrbSJwyg%3D%3D&trackingId=NizLf2pvyn21xhEur7DC5g%3D%3D&trk=public_jobs_jserp-result_search-card
+Junior Python Developer,Remote,https://www.devjobsscanner.com/company/remote,['python'],3 weeks ago,360K-420K INR,https://www.glassdoor.com/partner/jobListing.htm?pos=110&ao=1136043&tgt=APPLY_START&s=58&guid=0000018f6ee9aef3b4d180f3e6156037&src=GD_JOB_VIEW&t=SR&vt=w&ea=1&cs=1_90bec054&cb=1715552759939&jobListingId=1009261935030&jrtk=5-yul1-0-1htnejbpehdht800-4608d5f7f2223d74
+Python/Django Developer (Junior/Mid level),Remote,https://www.devjobsscanner.com/company/remote,"['python', 'django']",3 weeks ago,$83K-104K,https://www.glassdoor.com/partner/jobListing.htm?pos=1535&ao=1136043&tgt=APPLY_START&s=58&guid=0000018f6afd4e1790ebc43a68a229b4&src=GD_JOB_VIEW&t=SR&vt=w&ea=1&cs=1_c4a3bb53&cb=1715486937283&jobListingId=1009258237173&jrtk=5-yul1-0-1htlfqjioir0k800-8ef82aa48f33eb1f
+"Full Stack Developer 80-100% (f/m/x), fully remote",comparis.ch AG,https://www.devjobsscanner.com/company/comparis.ch ag,"['JavaScript', 'TypeScript', 'React', 'Next.js is a must']",2 weeks ago,$50K-60K,https://www.comparis.ch/people/jobs/detail/1483471
+Junior Python Developer,Remote,https://www.devjobsscanner.com/company/remote,['python'],1 month ago,200K-600K INR,https://www.glassdoor.com/partner/jobListing.htm?pos=1007&ao=1136043&tgt=APPLY_START&s=58&guid=0000018f050f36598d01f2ccbf6c4a0c&src=GD_JOB_VIEW&t=SR&vt=w&ea=1&cs=1_ee5c1cb4&cb=1713776834633&jobListingId=1009236729692&jrtk=5-yul1-0-1hs2gudkok7rv807-fc64d05e0d0ad0b8
+Remote Junior AI Developer (Python),Capital Certainty,https://www.devjobsscanner.com/company/capital certainty,['python'],1 month ago,Not mentioned,https://mx.linkedin.com/jobs/view/remote-junior-ai-developer-python-at-capital-certainty-3903420724?position=1&pageNum=40&refId=GrzP6Ij8MHMJSeEX7POvZg%3D%3D&trackingId=tul63IYKsaIJgCMpBs8E8A%3D%3D&trk=public_jobs_jserp-result_search-card
+Remote Junior AI Developer (Python),Capital Certainty,https://www.devjobsscanner.com/company/capital certainty,['python'],1 month ago,Not mentioned,https://co.linkedin.com/jobs/view/remote-junior-ai-developer-python-at-capital-certainty-3903424707?position=2&pageNum=25&refId=9jXnRE8TnaMjCU9ULDZnFg%3D%3D&trackingId=a2cdthbZLKym%2FrjOau2ixw%3D%3D&trk=public_jobs_jserp-result_search-card
+Junior Python Automation Engineer - Remote,HireMeFast LLC,https://www.devjobsscanner.com/company/hiremefast llc,"['python', 'automation']",4 weeks ago,Not mentioned,https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3911597343?refId=153raRUvsXB3eCH6JeOXdQ%3D%3D&trackingId=rqvfYQhC%2FjOGJKCliF6eTg%3D%3D&position=20&pageNum=3&trk=public_jobs_jserp-result_search-card
+Junior Python Automation Engineer - Remote,HireMeFast LLC,https://www.devjobsscanner.com/company/hiremefast llc,"['python', 'automation']",3 weeks ago,Not mentioned,https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3913083195?refId=jRHwmdZSYrD1hTxFj57UvA%3D%3D&trackingId=EonPhC0mP6MG%2BVNmkjwcvA%3D%3D&position=13&pageNum=1&trk=public_jobs_jserp-result_search-card
+Junior Python Automation Engineer - Remote,HireMeFast LLC,https://www.devjobsscanner.com/company/hiremefast llc,"['python', 'automation']",3 weeks ago,Not mentioned,https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3913727649?refId=Rv6T5COZxcDrHwk3jw8cRQ%3D%3D&trackingId=kr7fAONQKUm%2FJvt4WMPFvg%3D%3D&position=5&pageNum=30&trk=public_jobs_jserp-result_search-card
+Junior Python Automation Engineer - Remote,HireMeFast LLC,https://www.devjobsscanner.com/company/hiremefast llc,"['python', 'automation']",3 weeks ago,Not mentioned,https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3914226121?refId=MSdQMFwE%2F3S%2BUcrDpBSA7w%3D%3D&trackingId=GhJ3LvB0hWSAn3CrkHTNKQ%3D%3D&position=20&pageNum=38&trk=public_jobs_jserp-result_search-card
+Junior Python Automation Engineer - Remote,HireMeFast LLC,https://www.devjobsscanner.com/company/hiremefast llc,"['python', 'automation']",2 weeks ago,Not mentioned,https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3917915478?position=9&pageNum=87&refId=6OvZjHtktNkp3%2FtdijaA2g%3D%3D&trackingId=HBgQCPVN%2FlVJb8JEHXNqvw%3D%3D&trk=public_jobs_jserp-result_search-card
+Junior Python Automation Engineer - Remote,HireMeFast LLC,https://www.devjobsscanner.com/company/hiremefast llc,"['python', 'automation']",2 weeks ago,Not mentioned,https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3918715725?position=8&pageNum=2&refId=lKPDTgHL55I1EMZcazybag%3D%3D&trackingId=4UEgu8DCO4otvbIw2kr31w%3D%3D&trk=public_jobs_jserp-result_search-card
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Junior Python Developer_jobs_remote_true_sorted_by_matches.txt b/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Junior Python Developer_jobs_remote_true_sorted_by_matches.txt
new file mode 100644
index 00000000..afc2026c
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Junior Python Developer_jobs_remote_true_sorted_by_matches.txt
@@ -0,0 +1,160 @@
+Title: Junior Python Developer - Fully Remote
+Company: INDI Staffing Services
+Company URL: https://www.devjobsscanner.com/company/indi staffing services
+Tags: python
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905557993?refId=CIi7kPgOLtsBQ2GdsSUZ6A%3D%3D&trackingId=HjTjhxuOXesYMFynnjZ3sA%3D%3D&position=23&pageNum=15&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Developer - Fully Remote
+Company: INDI Staffing Services
+Company URL: https://www.devjobsscanner.com/company/indi staffing services
+Tags: python
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905559533?refId=24YIlA6nBIXWZAw2pp8YIQ%3D%3D&trackingId=K0RNbyZF8P1NVP8jSDTZxg%3D%3D&position=14&pageNum=4&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Developer - Fully Remote
+Company: INDI Staffing Services
+Company URL: https://www.devjobsscanner.com/company/indi staffing services
+Tags: python
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905558971?position=4&pageNum=50&refId=f%2FMDbLRF9jpyu1FP2qKzBA%3D%3D&trackingId=3b3MyV8heftivJ1yAEGDSA%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Developer - Fully Remote
+Company: INDI Staffing Services
+Company URL: https://www.devjobsscanner.com/company/indi staffing services
+Tags: python
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905564228?position=9&pageNum=25&refId=3vjg%2F7Apk5o3blJ1SV4Trg%3D%3D&trackingId=YQovs1pUWZwPBsIsc%2F%2FeNA%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Developer - Fully Remote
+Company: INDI Staffing Services
+Company URL: https://www.devjobsscanner.com/company/indi staffing services
+Tags: python
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://co.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905560503?position=3&pageNum=2&refId=n%2BIMuq%2BFPiZWMUAdjPElDQ%3D%3D&trackingId=CL5eC5WRkvm518gLzpcuXA%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Developer - Fully Remote
+Company: INDI Staffing Services
+Company URL: https://www.devjobsscanner.com/company/indi staffing services
+Tags: python
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://co.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905560484?position=4&pageNum=2&refId=n%2BIMuq%2BFPiZWMUAdjPElDQ%3D%3D&trackingId=Ns2Q8YkzKL8BpD1ymz7nZw%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Developer - Fully Remote
+Company: INDI Staffing Services
+Company URL: https://www.devjobsscanner.com/company/indi staffing services
+Tags: python
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905563257?position=2&pageNum=2&refId=bUQQZsGdjsbzIyYszLfYAA%3D%3D&trackingId=BsQara%2F7D3fS3KbgT8qvng%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Developer - Fully Remote
+Company: INDI Staffing Services
+Company URL: https://www.devjobsscanner.com/company/indi staffing services
+Tags: python
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://br.linkedin.com/jobs/view/junior-python-developer-fully-remote-at-indi-staffing-services-3905564224?position=1&pageNum=97&refId=%2BqnXHLbBBntROtlrbSJwyg%3D%3D&trackingId=NizLf2pvyn21xhEur7DC5g%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Developer
+Company: Remote
+Company URL: https://www.devjobsscanner.com/company/remote
+Tags: python
+Date Posted: 3 weeks ago
+Salary: 360K-420K INR
+Job URL: https://www.glassdoor.com/partner/jobListing.htm?pos=110&ao=1136043&tgt=APPLY_START&s=58&guid=0000018f6ee9aef3b4d180f3e6156037&src=GD_JOB_VIEW&t=SR&vt=w&ea=1&cs=1_90bec054&cb=1715552759939&jobListingId=1009261935030&jrtk=5-yul1-0-1htnejbpehdht800-4608d5f7f2223d74
+----------------------------------------
+Title: Python/Django Developer (Junior/Mid level)
+Company: Remote
+Company URL: https://www.devjobsscanner.com/company/remote
+Tags: python, django
+Date Posted: 3 weeks ago
+Salary: $83K-104K
+Job URL: https://www.glassdoor.com/partner/jobListing.htm?pos=1535&ao=1136043&tgt=APPLY_START&s=58&guid=0000018f6afd4e1790ebc43a68a229b4&src=GD_JOB_VIEW&t=SR&vt=w&ea=1&cs=1_c4a3bb53&cb=1715486937283&jobListingId=1009258237173&jrtk=5-yul1-0-1htlfqjioir0k800-8ef82aa48f33eb1f
+----------------------------------------
+Title: Full Stack Developer 80-100% (f/m/x), fully remote
+Company: comparis.ch AG
+Company URL: https://www.devjobsscanner.com/company/comparis.ch ag
+Tags: JavaScript, TypeScript, React, Next.js is a must
+Date Posted: 2 weeks ago
+Salary: $50K-60K
+Job URL: https://www.comparis.ch/people/jobs/detail/1483471
+----------------------------------------
+Title: Junior Python Developer
+Company: Remote
+Company URL: https://www.devjobsscanner.com/company/remote
+Tags: python
+Date Posted: 1 month ago
+Salary: 200K-600K INR
+Job URL: https://www.glassdoor.com/partner/jobListing.htm?pos=1007&ao=1136043&tgt=APPLY_START&s=58&guid=0000018f050f36598d01f2ccbf6c4a0c&src=GD_JOB_VIEW&t=SR&vt=w&ea=1&cs=1_ee5c1cb4&cb=1713776834633&jobListingId=1009236729692&jrtk=5-yul1-0-1hs2gudkok7rv807-fc64d05e0d0ad0b8
+----------------------------------------
+Title: Remote Junior AI Developer (Python)
+Company: Capital Certainty
+Company URL: https://www.devjobsscanner.com/company/capital certainty
+Tags: python
+Date Posted: 1 month ago
+Salary: Not mentioned
+Job URL: https://mx.linkedin.com/jobs/view/remote-junior-ai-developer-python-at-capital-certainty-3903420724?position=1&pageNum=40&refId=GrzP6Ij8MHMJSeEX7POvZg%3D%3D&trackingId=tul63IYKsaIJgCMpBs8E8A%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Remote Junior AI Developer (Python)
+Company: Capital Certainty
+Company URL: https://www.devjobsscanner.com/company/capital certainty
+Tags: python
+Date Posted: 1 month ago
+Salary: Not mentioned
+Job URL: https://co.linkedin.com/jobs/view/remote-junior-ai-developer-python-at-capital-certainty-3903424707?position=2&pageNum=25&refId=9jXnRE8TnaMjCU9ULDZnFg%3D%3D&trackingId=a2cdthbZLKym%2FrjOau2ixw%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Automation Engineer - Remote
+Company: HireMeFast LLC
+Company URL: https://www.devjobsscanner.com/company/hiremefast llc
+Tags: python, automation
+Date Posted: 4 weeks ago
+Salary: Not mentioned
+Job URL: https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3911597343?refId=153raRUvsXB3eCH6JeOXdQ%3D%3D&trackingId=rqvfYQhC%2FjOGJKCliF6eTg%3D%3D&position=20&pageNum=3&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Automation Engineer - Remote
+Company: HireMeFast LLC
+Company URL: https://www.devjobsscanner.com/company/hiremefast llc
+Tags: python, automation
+Date Posted: 3 weeks ago
+Salary: Not mentioned
+Job URL: https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3913083195?refId=jRHwmdZSYrD1hTxFj57UvA%3D%3D&trackingId=EonPhC0mP6MG%2BVNmkjwcvA%3D%3D&position=13&pageNum=1&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Automation Engineer - Remote
+Company: HireMeFast LLC
+Company URL: https://www.devjobsscanner.com/company/hiremefast llc
+Tags: python, automation
+Date Posted: 3 weeks ago
+Salary: Not mentioned
+Job URL: https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3913727649?refId=Rv6T5COZxcDrHwk3jw8cRQ%3D%3D&trackingId=kr7fAONQKUm%2FJvt4WMPFvg%3D%3D&position=5&pageNum=30&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Automation Engineer - Remote
+Company: HireMeFast LLC
+Company URL: https://www.devjobsscanner.com/company/hiremefast llc
+Tags: python, automation
+Date Posted: 3 weeks ago
+Salary: Not mentioned
+Job URL: https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3914226121?refId=MSdQMFwE%2F3S%2BUcrDpBSA7w%3D%3D&trackingId=GhJ3LvB0hWSAn3CrkHTNKQ%3D%3D&position=20&pageNum=38&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Automation Engineer - Remote
+Company: HireMeFast LLC
+Company URL: https://www.devjobsscanner.com/company/hiremefast llc
+Tags: python, automation
+Date Posted: 2 weeks ago
+Salary: Not mentioned
+Job URL: https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3917915478?position=9&pageNum=87&refId=6OvZjHtktNkp3%2FtdijaA2g%3D%3D&trackingId=HBgQCPVN%2FlVJb8JEHXNqvw%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Junior Python Automation Engineer - Remote
+Company: HireMeFast LLC
+Company URL: https://www.devjobsscanner.com/company/hiremefast llc
+Tags: python, automation
+Date Posted: 2 weeks ago
+Salary: Not mentioned
+Job URL: https://www.linkedin.com/jobs/view/junior-python-automation-engineer-remote-at-hiremefast-llc-3918715725?position=8&pageNum=2&refId=lKPDTgHL55I1EMZcazybag%3D%3D&trackingId=4UEgu8DCO4otvbIw2kr31w%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Python Developer_jobs_remote_true_sorted_by_newest.csv b/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Python Developer_jobs_remote_true_sorted_by_newest.csv
new file mode 100644
index 00000000..2c35ac06
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Python Developer_jobs_remote_true_sorted_by_newest.csv
@@ -0,0 +1,41 @@
+title,company,company_url,tags,date_posted,salary,job_url
+"Lead Software Engineer, Capital One Shopping (Remote)",Capital One,https://www.devjobsscanner.com/company/capital one,"['lead', 'startup', 'build', 'javascript', 'python', 'typescript']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby91akVEUUxiIiwiam9iSWQiOiI1ZjEzM2ExZS05YzYzLTQzOTgtYmZiZS01ZDZhNjQ1MGZjMTIiLCJqb2JUaXRsZSI6IkxlYWQgU29mdHdhcmUgRW5naW5lZXIsIENhcGl0YWwgT25lIFNob3BwaW5nIChSZW1vdGUpIiwiam9iVHlwZSI6InByb2dyYW1tYXRpYyJ9
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9jcnFBNFViIiwiam9iSWQiOiJhZmVjNTk5Yy0yZmE2LTQxMmYtYWExOC1kMTE2ZGExNTMxYTQiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9aWktRYmtiIiwiam9iSWQiOiI4YjVjMWZmYi0xMzgyLTQ0MDYtYmM3Yy00M2YwMjM1MmFhNmYiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9GUEhQV09iIiwiam9iSWQiOiJlOWViMzY2Ni04MDdhLTRiNGYtODc3NS02NWFiOWEwODBlMzYiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9GeFd4YUZiIiwiam9iSWQiOiJkZjBlNzE5Yy1iMTE5LTQ1NjctYjE0Ni0wOTY2NDI2MzMyZDkiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9VdktKb09iIiwiam9iSWQiOiJmMzhlNDg0ZC00ZTAwLTQ2YmEtYmRjYS0xMjM4YzM2Y2ViMDAiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Senior ServiceNow Custom App Developer DHS (Remote),ICF,https://www.devjobsscanner.com/company/icf,"['Support', 'ITIL', 'JavaScript', 'Security', 'ServiceNow']",1 week ago,$85K-144K,https://devitjobs.us/jobs/ICF-Senior-ServiceNow-Custom-App-Developer-DHS-Remote?utm_source=devjobsscanner
+Senior ServiceNow ITBM and SPM Developer,ICF,https://www.devjobsscanner.com/company/icf,"['CMS', 'HTML5', 'ITIL', 'JSON', 'JavaScript', 'REST', 'SOAP', 'Security', 'ServiceNow', 'jQuery', 'UX UI Design']",1 week ago,$83K-141K,https://devitjobs.us/jobs/ICF-Senior-ServiceNow-ITBM-and-SPM-Developer?utm_source=devjobsscanner
+Full Stack Engineer FTE,Linkitall LLC,https://www.devjobsscanner.com/company/linkitall llc,"['AWS', 'C#', 'Cloud', 'CSS', 'JavaScript', 'MySQL', 'PostgreSQL', 'Python', 'React', 'Ruby', 'Security', 'Serverless', 'Web', 'ASP.NET']",1 week ago,$100K-120K,https://devitjobs.us/jobs/Linkitall-LLC-Full-Stack-Engineer-FTE?utm_source=devjobsscanner
+NestJS Developer,"Business Performance Systems, LLC","https://www.devjobsscanner.com/company/business performance systems, llc","['Architect', 'Backend', 'CSS', 'GitHub', 'HTTP', 'JSON', 'NestJS', 'RPA', 'React', 'Selenium', 'TypeScript', 'Web', 'XML', 'DDD']",1 week ago,$104K-166K,https://devitjobs.us/jobs/Business-Performance-Systems-LLC-NestJS-Developer?utm_source=devjobsscanner
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://ca.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918956049?position=4&pageNum=82&refId=o5Fir2Hl1NbqZJIDVZDTTg%3D%3D&trackingId=9C369v4uC7ZvlIG362ZzPg%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://ca.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952607?position=10&pageNum=77&refId=rIp8uk7Zb7YJ%2FIoM6gjThA%3D%3D&trackingId=4%2BR9sWdqi6VNsYdqYbI%2BSg%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://ee.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952164?position=7&pageNum=2&refId=%2BlzGQBFIZNr%2F77X2aCLJwg%3D%3D&trackingId=NwmYBAuw6pdZbJvt7BUl%2FA%3D%3D&trk=public_jobs_jserp-result_search-card
+"Back End Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://se.linkedin.com/jobs/view/back-end-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952649?position=2&pageNum=95&refId=gkhd25N%2BusYKXmVi%2Ftc6hQ%3D%3D&trackingId=Df2REZr6HIyqEOi59JTEXQ%3D%3D&trk=public_jobs_jserp-result_search-card
+"Back End Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://jp.linkedin.com/jobs/view/back-end-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918955247?position=2&pageNum=92&refId=M%2F%2B%2FfR2XZRE3Q7c%2BcUH98Q%3D%3D&trackingId=fImG1FN3mqOKjFysIccDkw%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://jp.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918958006?position=4&pageNum=62&refId=zFLlHYOklNghNqc5H5wHeg%3D%3D&trackingId=WD%2B0Wti%2FEdhUVqRVIFR%2FCQ%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://jp.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918956027?position=6&pageNum=45&refId=c3IIxVPPuCAd6X%2B9eAfStA%3D%3D&trackingId=UcpNg1sflvPcannqUbWp9Q%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://mx.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918951923?position=2&pageNum=60&refId=11dLN08Bn3KEU19lv2RyJw%3D%3D&trackingId=bNTnSuMHG9M9TSPyAEdjcQ%3D%3D&trk=public_jobs_jserp-result_search-card
+"Development Team Lead, gt.school (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,['lead'],1 week ago,Not mentioned,https://ar.linkedin.com/jobs/view/development-team-lead-gt-school-remote-%24100-000-year-usd-at-crossover-3918949522?position=7&pageNum=40&refId=6UvPAwIoDVN26%2BwNoBzz7Q%3D%3D&trackingId=W2om2ebZp74ceBYLiXAL1A%3D%3D&trk=public_jobs_jserp-result_search-card
+Software Development Engineer in Test (Remote Canada),Milk Moovement,https://www.devjobsscanner.com/company/milk moovement,[],1 week ago,Not mentioned,https://www.glassdoor.com/partner/jobListing.htm?pos=338&ao=1136043&s=58&guid=0000018f70da9400a9dd451b642c35d5&src=GD_JOB_VIEW&t=SR&vt=w&cs=1_ebf9e050&cb=1715585324501&jobListingId=1009124516931&jrtk=5-yul1-0-1htodl51oj33d805-acafb3b76c0b8a5c
+"Lead Software Engineer, Capital One Shopping (Remote)",Capital One,https://www.devjobsscanner.com/company/capital one,"['lead', 'startup', 'build', 'javascript', 'python', 'typescript']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby91akVEUUxiIiwiam9iSWQiOiI1ZjEzM2ExZS05YzYzLTQzOTgtYmZiZS01ZDZhNjQ1MGZjMTIiLCJqb2JUaXRsZSI6IkxlYWQgU29mdHdhcmUgRW5naW5lZXIsIENhcGl0YWwgT25lIFNob3BwaW5nIChSZW1vdGUpIiwiam9iVHlwZSI6InByb2dyYW1tYXRpYyJ9
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9jcnFBNFViIiwiam9iSWQiOiJhZmVjNTk5Yy0yZmE2LTQxMmYtYWExOC1kMTE2ZGExNTMxYTQiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9aWktRYmtiIiwiam9iSWQiOiI4YjVjMWZmYi0xMzgyLTQ0MDYtYmM3Yy00M2YwMjM1MmFhNmYiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9GUEhQV09iIiwiam9iSWQiOiJlOWViMzY2Ni04MDdhLTRiNGYtODc3NS02NWFiOWEwODBlMzYiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9GeFd4YUZiIiwiam9iSWQiOiJkZjBlNzE5Yy1iMTE5LTQ1NjctYjE0Ni0wOTY2NDI2MzMyZDkiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Sr. Software Engineer - C++ Go Python - Remote,Comcast Corporation,https://www.devjobsscanner.com/company/comcast corporation,"['video', 'data', 'design', 'build', 'c++', 'go', 'python']",1 week ago,Not mentioned,https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9VdktKb09iIiwiam9iSWQiOiJmMzhlNDg0ZC00ZTAwLTQ2YmEtYmRjYS0xMjM4YzM2Y2ViMDAiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+Senior ServiceNow Custom App Developer DHS (Remote),ICF,https://www.devjobsscanner.com/company/icf,"['Support', 'ITIL', 'JavaScript', 'Security', 'ServiceNow']",1 week ago,$85K-144K,https://devitjobs.us/jobs/ICF-Senior-ServiceNow-Custom-App-Developer-DHS-Remote?utm_source=devjobsscanner
+Senior ServiceNow ITBM and SPM Developer,ICF,https://www.devjobsscanner.com/company/icf,"['CMS', 'HTML5', 'ITIL', 'JSON', 'JavaScript', 'REST', 'SOAP', 'Security', 'ServiceNow', 'jQuery', 'UX UI Design']",1 week ago,$83K-141K,https://devitjobs.us/jobs/ICF-Senior-ServiceNow-ITBM-and-SPM-Developer?utm_source=devjobsscanner
+Full Stack Engineer FTE,Linkitall LLC,https://www.devjobsscanner.com/company/linkitall llc,"['AWS', 'C#', 'Cloud', 'CSS', 'JavaScript', 'MySQL', 'PostgreSQL', 'Python', 'React', 'Ruby', 'Security', 'Serverless', 'Web', 'ASP.NET']",1 week ago,$100K-120K,https://devitjobs.us/jobs/Linkitall-LLC-Full-Stack-Engineer-FTE?utm_source=devjobsscanner
+NestJS Developer,"Business Performance Systems, LLC","https://www.devjobsscanner.com/company/business performance systems, llc","['Architect', 'Backend', 'CSS', 'GitHub', 'HTTP', 'JSON', 'NestJS', 'RPA', 'React', 'Selenium', 'TypeScript', 'Web', 'XML', 'DDD']",1 week ago,$104K-166K,https://devitjobs.us/jobs/Business-Performance-Systems-LLC-NestJS-Developer?utm_source=devjobsscanner
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://ca.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918956049?position=4&pageNum=82&refId=o5Fir2Hl1NbqZJIDVZDTTg%3D%3D&trackingId=9C369v4uC7ZvlIG362ZzPg%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://ca.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952607?position=10&pageNum=77&refId=rIp8uk7Zb7YJ%2FIoM6gjThA%3D%3D&trackingId=4%2BR9sWdqi6VNsYdqYbI%2BSg%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://ee.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952164?position=7&pageNum=2&refId=%2BlzGQBFIZNr%2F77X2aCLJwg%3D%3D&trackingId=NwmYBAuw6pdZbJvt7BUl%2FA%3D%3D&trk=public_jobs_jserp-result_search-card
+"Back End Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://se.linkedin.com/jobs/view/back-end-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952649?position=2&pageNum=95&refId=gkhd25N%2BusYKXmVi%2Ftc6hQ%3D%3D&trackingId=Df2REZr6HIyqEOi59JTEXQ%3D%3D&trk=public_jobs_jserp-result_search-card
+"Back End Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://jp.linkedin.com/jobs/view/back-end-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918955247?position=2&pageNum=92&refId=M%2F%2B%2FfR2XZRE3Q7c%2BcUH98Q%3D%3D&trackingId=fImG1FN3mqOKjFysIccDkw%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://jp.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918958006?position=4&pageNum=62&refId=zFLlHYOklNghNqc5H5wHeg%3D%3D&trackingId=WD%2B0Wti%2FEdhUVqRVIFR%2FCQ%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://jp.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918956027?position=6&pageNum=45&refId=c3IIxVPPuCAd6X%2B9eAfStA%3D%3D&trackingId=UcpNg1sflvPcannqUbWp9Q%3D%3D&trk=public_jobs_jserp-result_search-card
+"Full stack Developer, Trilogy (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,[],1 week ago,Not mentioned,https://mx.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918951923?position=2&pageNum=60&refId=11dLN08Bn3KEU19lv2RyJw%3D%3D&trackingId=bNTnSuMHG9M9TSPyAEdjcQ%3D%3D&trk=public_jobs_jserp-result_search-card
+"Development Team Lead, gt.school (Remote) - $100,000/year USD",Crossover,https://www.devjobsscanner.com/company/crossover,['lead'],1 week ago,Not mentioned,https://ar.linkedin.com/jobs/view/development-team-lead-gt-school-remote-%24100-000-year-usd-at-crossover-3918949522?position=7&pageNum=40&refId=6UvPAwIoDVN26%2BwNoBzz7Q%3D%3D&trackingId=W2om2ebZp74ceBYLiXAL1A%3D%3D&trk=public_jobs_jserp-result_search-card
+Software Development Engineer in Test (Remote Canada),Milk Moovement,https://www.devjobsscanner.com/company/milk moovement,[],1 week ago,Not mentioned,https://www.glassdoor.com/partner/jobListing.htm?pos=338&ao=1136043&s=58&guid=0000018f70da9400a9dd451b642c35d5&src=GD_JOB_VIEW&t=SR&vt=w&cs=1_ebf9e050&cb=1715585324501&jobListingId=1009124516931&jrtk=5-yul1-0-1htodl51oj33d805-acafb3b76c0b8a5c
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Python Developer_jobs_remote_true_sorted_by_newest.txt b/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Python Developer_jobs_remote_true_sorted_by_newest.txt
new file mode 100644
index 00000000..e29e517a
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/outputFiles/Python Developer_jobs_remote_true_sorted_by_newest.txt
@@ -0,0 +1,320 @@
+Title: Lead Software Engineer, Capital One Shopping (Remote)
+Company: Capital One
+Company URL: https://www.devjobsscanner.com/company/capital one
+Tags: lead, startup, build, javascript, python, typescript
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby91akVEUUxiIiwiam9iSWQiOiI1ZjEzM2ExZS05YzYzLTQzOTgtYmZiZS01ZDZhNjQ1MGZjMTIiLCJqb2JUaXRsZSI6IkxlYWQgU29mdHdhcmUgRW5naW5lZXIsIENhcGl0YWwgT25lIFNob3BwaW5nIChSZW1vdGUpIiwiam9iVHlwZSI6InByb2dyYW1tYXRpYyJ9
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9jcnFBNFViIiwiam9iSWQiOiJhZmVjNTk5Yy0yZmE2LTQxMmYtYWExOC1kMTE2ZGExNTMxYTQiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9aWktRYmtiIiwiam9iSWQiOiI4YjVjMWZmYi0xMzgyLTQ0MDYtYmM3Yy00M2YwMjM1MmFhNmYiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9GUEhQV09iIiwiam9iSWQiOiJlOWViMzY2Ni04MDdhLTRiNGYtODc3NS02NWFiOWEwODBlMzYiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9GeFd4YUZiIiwiam9iSWQiOiJkZjBlNzE5Yy1iMTE5LTQ1NjctYjE0Ni0wOTY2NDI2MzMyZDkiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9VdktKb09iIiwiam9iSWQiOiJmMzhlNDg0ZC00ZTAwLTQ2YmEtYmRjYS0xMjM4YzM2Y2ViMDAiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Senior ServiceNow Custom App Developer DHS (Remote)
+Company: ICF
+Company URL: https://www.devjobsscanner.com/company/icf
+Tags: Support, ITIL, JavaScript, Security, ServiceNow
+Date Posted: 1 week ago
+Salary: $85K-144K
+Job URL: https://devitjobs.us/jobs/ICF-Senior-ServiceNow-Custom-App-Developer-DHS-Remote?utm_source=devjobsscanner
+----------------------------------------
+Title: Senior ServiceNow ITBM and SPM Developer
+Company: ICF
+Company URL: https://www.devjobsscanner.com/company/icf
+Tags: CMS, HTML5, ITIL, JSON, JavaScript, REST, SOAP, Security, ServiceNow, jQuery, UX UI Design
+Date Posted: 1 week ago
+Salary: $83K-141K
+Job URL: https://devitjobs.us/jobs/ICF-Senior-ServiceNow-ITBM-and-SPM-Developer?utm_source=devjobsscanner
+----------------------------------------
+Title: Full Stack Engineer FTE
+Company: Linkitall LLC
+Company URL: https://www.devjobsscanner.com/company/linkitall llc
+Tags: AWS, C#, Cloud, CSS, JavaScript, MySQL, PostgreSQL, Python, React, Ruby, Security, Serverless, Web, ASP.NET
+Date Posted: 1 week ago
+Salary: $100K-120K
+Job URL: https://devitjobs.us/jobs/Linkitall-LLC-Full-Stack-Engineer-FTE?utm_source=devjobsscanner
+----------------------------------------
+Title: NestJS Developer
+Company: Business Performance Systems, LLC
+Company URL: https://www.devjobsscanner.com/company/business performance systems, llc
+Tags: Architect, Backend, CSS, GitHub, HTTP, JSON, NestJS, RPA, React, Selenium, TypeScript, Web, XML, DDD
+Date Posted: 1 week ago
+Salary: $104K-166K
+Job URL: https://devitjobs.us/jobs/Business-Performance-Systems-LLC-NestJS-Developer?utm_source=devjobsscanner
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://ca.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918956049?position=4&pageNum=82&refId=o5Fir2Hl1NbqZJIDVZDTTg%3D%3D&trackingId=9C369v4uC7ZvlIG362ZzPg%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://ca.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952607?position=10&pageNum=77&refId=rIp8uk7Zb7YJ%2FIoM6gjThA%3D%3D&trackingId=4%2BR9sWdqi6VNsYdqYbI%2BSg%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://ee.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952164?position=7&pageNum=2&refId=%2BlzGQBFIZNr%2F77X2aCLJwg%3D%3D&trackingId=NwmYBAuw6pdZbJvt7BUl%2FA%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Back End Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://se.linkedin.com/jobs/view/back-end-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952649?position=2&pageNum=95&refId=gkhd25N%2BusYKXmVi%2Ftc6hQ%3D%3D&trackingId=Df2REZr6HIyqEOi59JTEXQ%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Back End Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://jp.linkedin.com/jobs/view/back-end-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918955247?position=2&pageNum=92&refId=M%2F%2B%2FfR2XZRE3Q7c%2BcUH98Q%3D%3D&trackingId=fImG1FN3mqOKjFysIccDkw%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://jp.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918958006?position=4&pageNum=62&refId=zFLlHYOklNghNqc5H5wHeg%3D%3D&trackingId=WD%2B0Wti%2FEdhUVqRVIFR%2FCQ%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://jp.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918956027?position=6&pageNum=45&refId=c3IIxVPPuCAd6X%2B9eAfStA%3D%3D&trackingId=UcpNg1sflvPcannqUbWp9Q%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://mx.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918951923?position=2&pageNum=60&refId=11dLN08Bn3KEU19lv2RyJw%3D%3D&trackingId=bNTnSuMHG9M9TSPyAEdjcQ%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Development Team Lead, gt.school (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags: lead
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://ar.linkedin.com/jobs/view/development-team-lead-gt-school-remote-%24100-000-year-usd-at-crossover-3918949522?position=7&pageNum=40&refId=6UvPAwIoDVN26%2BwNoBzz7Q%3D%3D&trackingId=W2om2ebZp74ceBYLiXAL1A%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Software Development Engineer in Test (Remote Canada)
+Company: Milk Moovement
+Company URL: https://www.devjobsscanner.com/company/milk moovement
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.glassdoor.com/partner/jobListing.htm?pos=338&ao=1136043&s=58&guid=0000018f70da9400a9dd451b642c35d5&src=GD_JOB_VIEW&t=SR&vt=w&cs=1_ebf9e050&cb=1715585324501&jobListingId=1009124516931&jrtk=5-yul1-0-1htodl51oj33d805-acafb3b76c0b8a5c
+----------------------------------------
+Title: Lead Software Engineer, Capital One Shopping (Remote)
+Company: Capital One
+Company URL: https://www.devjobsscanner.com/company/capital one
+Tags: lead, startup, build, javascript, python, typescript
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby91akVEUUxiIiwiam9iSWQiOiI1ZjEzM2ExZS05YzYzLTQzOTgtYmZiZS01ZDZhNjQ1MGZjMTIiLCJqb2JUaXRsZSI6IkxlYWQgU29mdHdhcmUgRW5naW5lZXIsIENhcGl0YWwgT25lIFNob3BwaW5nIChSZW1vdGUpIiwiam9iVHlwZSI6InByb2dyYW1tYXRpYyJ9
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9jcnFBNFViIiwiam9iSWQiOiJhZmVjNTk5Yy0yZmE2LTQxMmYtYWExOC1kMTE2ZGExNTMxYTQiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9aWktRYmtiIiwiam9iSWQiOiI4YjVjMWZmYi0xMzgyLTQ0MDYtYmM3Yy00M2YwMjM1MmFhNmYiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9GUEhQV09iIiwiam9iSWQiOiJlOWViMzY2Ni04MDdhLTRiNGYtODc3NS02NWFiOWEwODBlMzYiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9GeFd4YUZiIiwiam9iSWQiOiJkZjBlNzE5Yy1iMTE5LTQ1NjctYjE0Ni0wOTY2NDI2MzMyZDkiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Sr. Software Engineer - C++ Go Python - Remote
+Company: Comcast Corporation
+Company URL: https://www.devjobsscanner.com/company/comcast corporation
+Tags: video, data, design, build, c++, go, python
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.dice.com/apply-redirect?eyJjb25maWd1cmVkVXJsIjoiaHR0cHM6Ly9kc3AucHJuZy5jby9VdktKb09iIiwiam9iSWQiOiJmMzhlNDg0ZC00ZTAwLTQ2YmEtYmRjYS0xMjM4YzM2Y2ViMDAiLCJqb2JUaXRsZSI6IlNyLiBTb2Z0d2FyZSBFbmdpbmVlciAtIEMrKyBHbyBQeXRob24gLSBSZW1vdGUiLCJqb2JUeXBlIjoicHJvZ3JhbW1hdGljIn0=
+----------------------------------------
+Title: Senior ServiceNow Custom App Developer DHS (Remote)
+Company: ICF
+Company URL: https://www.devjobsscanner.com/company/icf
+Tags: Support, ITIL, JavaScript, Security, ServiceNow
+Date Posted: 1 week ago
+Salary: $85K-144K
+Job URL: https://devitjobs.us/jobs/ICF-Senior-ServiceNow-Custom-App-Developer-DHS-Remote?utm_source=devjobsscanner
+----------------------------------------
+Title: Senior ServiceNow ITBM and SPM Developer
+Company: ICF
+Company URL: https://www.devjobsscanner.com/company/icf
+Tags: CMS, HTML5, ITIL, JSON, JavaScript, REST, SOAP, Security, ServiceNow, jQuery, UX UI Design
+Date Posted: 1 week ago
+Salary: $83K-141K
+Job URL: https://devitjobs.us/jobs/ICF-Senior-ServiceNow-ITBM-and-SPM-Developer?utm_source=devjobsscanner
+----------------------------------------
+Title: Full Stack Engineer FTE
+Company: Linkitall LLC
+Company URL: https://www.devjobsscanner.com/company/linkitall llc
+Tags: AWS, C#, Cloud, CSS, JavaScript, MySQL, PostgreSQL, Python, React, Ruby, Security, Serverless, Web, ASP.NET
+Date Posted: 1 week ago
+Salary: $100K-120K
+Job URL: https://devitjobs.us/jobs/Linkitall-LLC-Full-Stack-Engineer-FTE?utm_source=devjobsscanner
+----------------------------------------
+Title: NestJS Developer
+Company: Business Performance Systems, LLC
+Company URL: https://www.devjobsscanner.com/company/business performance systems, llc
+Tags: Architect, Backend, CSS, GitHub, HTTP, JSON, NestJS, RPA, React, Selenium, TypeScript, Web, XML, DDD
+Date Posted: 1 week ago
+Salary: $104K-166K
+Job URL: https://devitjobs.us/jobs/Business-Performance-Systems-LLC-NestJS-Developer?utm_source=devjobsscanner
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://ca.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918956049?position=4&pageNum=82&refId=o5Fir2Hl1NbqZJIDVZDTTg%3D%3D&trackingId=9C369v4uC7ZvlIG362ZzPg%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://ca.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952607?position=10&pageNum=77&refId=rIp8uk7Zb7YJ%2FIoM6gjThA%3D%3D&trackingId=4%2BR9sWdqi6VNsYdqYbI%2BSg%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://ee.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952164?position=7&pageNum=2&refId=%2BlzGQBFIZNr%2F77X2aCLJwg%3D%3D&trackingId=NwmYBAuw6pdZbJvt7BUl%2FA%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Back End Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://se.linkedin.com/jobs/view/back-end-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918952649?position=2&pageNum=95&refId=gkhd25N%2BusYKXmVi%2Ftc6hQ%3D%3D&trackingId=Df2REZr6HIyqEOi59JTEXQ%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Back End Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://jp.linkedin.com/jobs/view/back-end-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918955247?position=2&pageNum=92&refId=M%2F%2B%2FfR2XZRE3Q7c%2BcUH98Q%3D%3D&trackingId=fImG1FN3mqOKjFysIccDkw%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://jp.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918958006?position=4&pageNum=62&refId=zFLlHYOklNghNqc5H5wHeg%3D%3D&trackingId=WD%2B0Wti%2FEdhUVqRVIFR%2FCQ%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://jp.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918956027?position=6&pageNum=45&refId=c3IIxVPPuCAd6X%2B9eAfStA%3D%3D&trackingId=UcpNg1sflvPcannqUbWp9Q%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Full stack Developer, Trilogy (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://mx.linkedin.com/jobs/view/full-stack-developer-trilogy-remote-%24100-000-year-usd-at-crossover-3918951923?position=2&pageNum=60&refId=11dLN08Bn3KEU19lv2RyJw%3D%3D&trackingId=bNTnSuMHG9M9TSPyAEdjcQ%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Development Team Lead, gt.school (Remote) - $100,000/year USD
+Company: Crossover
+Company URL: https://www.devjobsscanner.com/company/crossover
+Tags: lead
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://ar.linkedin.com/jobs/view/development-team-lead-gt-school-remote-%24100-000-year-usd-at-crossover-3918949522?position=7&pageNum=40&refId=6UvPAwIoDVN26%2BwNoBzz7Q%3D%3D&trackingId=W2om2ebZp74ceBYLiXAL1A%3D%3D&trk=public_jobs_jserp-result_search-card
+----------------------------------------
+Title: Software Development Engineer in Test (Remote Canada)
+Company: Milk Moovement
+Company URL: https://www.devjobsscanner.com/company/milk moovement
+Tags:
+Date Posted: 1 week ago
+Salary: Not mentioned
+Job URL: https://www.glassdoor.com/partner/jobListing.htm?pos=338&ao=1136043&s=58&guid=0000018f70da9400a9dd451b642c35d5&src=GD_JOB_VIEW&t=SR&vt=w&cs=1_ebf9e050&cb=1715585324501&jobListingId=1009124516931&jrtk=5-yul1-0-1htodl51oj33d805-acafb3b76c0b8a5c
+----------------------------------------
diff --git a/WEB SCRAPING/devJobsScanner_Scraper/requirements.txt b/WEB SCRAPING/devJobsScanner_Scraper/requirements.txt
new file mode 100644
index 00000000..734fc03d
--- /dev/null
+++ b/WEB SCRAPING/devJobsScanner_Scraper/requirements.txt
@@ -0,0 +1,3 @@
+beautifulsoup4
+requests
+seleniumbase
\ No newline at end of file
diff --git a/file.txt b/file.txt
new file mode 100644
index 00000000..e69de29b
diff --git a/gemini chatbot/Gemini-Chatbot b/gemini chatbot/Gemini-Chatbot
new file mode 160000
index 00000000..9d3c59a9
--- /dev/null
+++ b/gemini chatbot/Gemini-Chatbot
@@ -0,0 +1 @@
+Subproject commit 9d3c59a9e3b949733d4fb3361e3abfc061d70271
diff --git a/gemini chatbot/chatbot.py b/gemini chatbot/chatbot.py
new file mode 100644
index 00000000..1f8fe269
--- /dev/null
+++ b/gemini chatbot/chatbot.py
@@ -0,0 +1,24 @@
+import google.generativeai as genai
+
+genai.configure(api_key="GOOGLE_GEMINI_API_KEY")
+
+model = genai.GenerativeModel("gemini-1.5-flash")
+
+chat = model.start_chat(history=[])
+
+def chat_with_gemini():
+ print("🤖 Gemini ChatBot (type 'exit' to quit)")
+ while True:
+ user_input = input("You: ")
+ if user_input.lower() in ["exit", "quit"]:
+ print("Bot: Goodbye 👋")
+ break
+
+ try:
+ response = chat.send_message(user_input)
+ print("Bot:", response.text)
+ except Exception as e:
+ print("⚠️ Error:", e)
+
+if __name__ == "__main__":
+ chat_with_gemini()
\ No newline at end of file
diff --git a/gemini chatbot/readme.txt b/gemini chatbot/readme.txt
new file mode 100644
index 00000000..9022c64f
--- /dev/null
+++ b/gemini chatbot/readme.txt
@@ -0,0 +1,19 @@
+---------------------------------------------- Gemini ChatBot 🤖 ----------------------------------------------
+
+Welcome to the Gemini ChatBot Project — an intelligent, Python-based chatbot powered by Google’s Gemini 1.5 Flash model. This project allows you to have smart, interactive conversations directly in the terminal. It’s ideal for developers, students, or hobbyists exploring Generative AI and conversational interfaces. Whether you're curious about large language models or looking to contribute to open-source AI tools, this chatbot is a perfect place to start.
+
+The Gemini ChatBot maintains conversation history, enabling more context-aware and meaningful interactions. It uses Google’s official Generative AI Python SDK to communicate with the Gemini API. The code is written for clarity and modularity, making it easy to customize, extend, and learn from.
+
+To get started, you’ll need Python 3.8 to 3.10 installed on your machine (Python 3.13 may not be fully compatible yet) and an API key from Google AI Studio, which you can obtain for free. The chatbot is designed to run in a command-line environment and responds to your input in real-time, simulating a natural conversation. You can modify the script to integrate it into other platforms later, such as a web app or a GUI interface.
+
+To ensure clean package management and avoid conflicts with other Python projects, it’s recommended to set up a Conda environment. Start by opening Anaconda Prompt or your terminal, then create a new environment with Python 3.10. Once the environment is created and activated, you can install the required google-generativeai package using pip. After that, you're ready to run the chatbot.
+
+To launch the chatbot, navigate to the project folder in your terminal and run the Python script. The chatbot will start with a greeting and wait for your input. Simply type anything you’d like to ask or discuss. You can chat freely, and the model will respond with AI-generated replies. To end the session at any time, just type “exit” or “quit,” and the chatbot will close the conversation with a goodbye message.
+
+The project folder is organized for simplicity and ease of use. The main script is chatbot.py, where all the chatbot logic is implemented. The requirements.txt file contains a list of dependencies, so others can easily replicate your environment using pip. A .gitignore file is included to exclude virtual environment folders and temporary files from version control.
+
+Looking ahead, there are many exciting directions this project could take. You can add a web interface using Streamlit or Flask, implement support for file or image inputs using Gemini Pro Vision, enable chat logging to save previous conversations, or even integrate secure key storage using environment variables. These enhancements are perfect opportunities for open-source contributions.
+
+If you’d like to contribute, you’re welcome to fork the repository, create your own feature branch, and submit a pull request. Feedback, improvements, and new ideas are encouraged — collaboration is at the heart of open-source.
+
+Thank you for checking out the Gemini ChatBot! Whether you’re here to learn, experiment, or build, we hope this project helps you get one step closer to the future of AI-powered applications. Let’s build something incredible together. 🚀
diff --git a/gemini chatbot/requirements.txt b/gemini chatbot/requirements.txt
new file mode 100644
index 00000000..ac4a68a3
--- /dev/null
+++ b/gemini chatbot/requirements.txt
@@ -0,0 +1 @@
+google-generativeai>=0.3.2